mirror of
https://git.lyx.org/repos/lyx.git
synced 2024-11-06 00:10:59 +00:00
13358 lines
440 KiB
Groff
13358 lines
440 KiB
Groff
|
2001-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (getTocList): make the method const, so that
|
|||
|
|
InsetTOC::Ascii compiles.
|
|||
|
|
|
|||
|
|
* src/insets/insettoc.C (Ascii): return 0
|
|||
|
|
|
|||
|
|
2001-01-11 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/insets/insettoc.C (Ascii): New method.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init) Set first_start to false when running
|
|||
|
|
without a GUI.
|
|||
|
|
|
|||
|
|
2000-12-19 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar,SimpleTeXOnePar) Fix problem with
|
|||
|
|
aligned paragraphs.
|
|||
|
|
|
|||
|
|
2001-01-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFile): add missing ' ' after lyxformat.
|
|||
|
|
|
|||
|
|
* src/buffer.h: change format to int, and change name to file_format
|
|||
|
|
|
|||
|
|
* src/buffer.C: change LYX_FORMAT to int, and bump version number
|
|||
|
|
to 218.
|
|||
|
|
(readLyXformat2): handle it
|
|||
|
|
handle it
|
|||
|
|
(readFile): handle it
|
|||
|
|
(writeFile): handle it
|
|||
|
|
|
|||
|
|
2001-01-10 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): Add handling of
|
|||
|
|
LFUN_BREAKPARAGRAPHKEEPLAYOUT.
|
|||
|
|
|
|||
|
|
2001-01-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/tabular.C (Write): write lowercase identifiers
|
|||
|
|
(Read): read lowercase identifiers
|
|||
|
|
|
|||
|
|
2001-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (rfind): better fix (from Dekel).
|
|||
|
|
|
|||
|
|
* src/tabular.h: add a couple std:: qualifiers.
|
|||
|
|
|
|||
|
|
2001-01-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (rfind): also test the first char in the
|
|||
|
|
string and be sure that t >= 0.
|
|||
|
|
|
|||
|
|
2001-01-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/tabular.C (ReadNew): new method
|
|||
|
|
(Read): changed to call ReadNew or ReadOld depending on the
|
|||
|
|
tabular version found.
|
|||
|
|
|
|||
|
|
* src/tabular-old.C: new file with the support functions and the
|
|||
|
|
ReadOld method.
|
|||
|
|
(ReadOld): new method
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (CheckChoiceClass): make tc
|
|||
|
|
unsigned to remove a signed/usigned warning.
|
|||
|
|
|
|||
|
|
* src/tabular.C (tostr): new spesializations, replaces type2string
|
|||
|
|
(Write): use the new spesializations
|
|||
|
|
|
|||
|
|
2001-01-09 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/tabular.C (OldFormatRead): convert the footer/header information
|
|||
|
|
to the right row.
|
|||
|
|
(getTokenValue): chaned this functions again.
|
|||
|
|
(string2type): added a bunch of this functions per type.
|
|||
|
|
(Write): use type2string and write columns first.
|
|||
|
|
(type2string): added a bunch of this functions per type.
|
|||
|
|
(TeXBottomHLine):
|
|||
|
|
(TeXTopHLine): check row parameter.
|
|||
|
|
|
|||
|
|
2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/tabular.C (getTokenValue): Fix crash with malformed files.
|
|||
|
|
(Read): Read the rotate attribute.
|
|||
|
|
|
|||
|
|
2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix
|
|||
|
|
class switching; do not do anything if class has not been changed.
|
|||
|
|
|
|||
|
|
2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/build-listerrors: Exit if literate-article doesn't appear in
|
|||
|
|
textclass.lst
|
|||
|
|
|
|||
|
|
2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/combox.h (getline): small fix for sun CC 6.0
|
|||
|
|
* src/combox.C (input_cb): ditto.
|
|||
|
|
* src/spellchecker.C (sigchldhandler): ditto.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init): do not query for creation of user
|
|||
|
|
directory when running without a GUI.
|
|||
|
|
|
|||
|
|
2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (LocalDispatch): Toggle font properties.
|
|||
|
|
|
|||
|
|
2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* BufferView2.C (open_new_inset): Added 2nd argument.
|
|||
|
|
(getParentText, getParentLanguage): New methods.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and
|
|||
|
|
LFUN_INSET_TABULAR for RTL text.
|
|||
|
|
|
|||
|
|
* src/tabular.C (Latex): Put \R{} around RTL cells.
|
|||
|
|
|
|||
|
|
* src/text2.C (InsertInset): Change cursor position for highly
|
|||
|
|
editable insets.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormTabularCreate.C (apply): Create the
|
|||
|
|
tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...)
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (LocalDispatch): When dispatching
|
|||
|
|
LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
|
|||
|
|
locked, then the insettext of the new cell will be locked.
|
|||
|
|
(moveLeft, moveRight): Fixed for RTL tabulars.
|
|||
|
|
(moveNextCell, movePrevCell): Ditto.
|
|||
|
|
(isRightToLeft): New method.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): Fixed handling of
|
|||
|
|
non-dispatched function in the locking inset.
|
|||
|
|
(Edit): If the inset is empty set the language of the current font
|
|||
|
|
to the language to the surronding text (this code was moved from
|
|||
|
|
LocalDispatch to allow the user to change the languaeg before
|
|||
|
|
inserting text).
|
|||
|
|
(moveRight, moveLeft): Fixed for RTL text.
|
|||
|
|
(checkAndActivateInset): Fixed.
|
|||
|
|
|
|||
|
|
* src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
|
|||
|
|
|
|||
|
|
2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate
|
|||
|
|
the tooltip.
|
|||
|
|
(set): ditto.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL
|
|||
|
|
around some ispell code.
|
|||
|
|
|
|||
|
|
* src/lyxcursor.[Ch]: add proper constructor, to avoid tons of
|
|||
|
|
Unitialized Memory Read in purify.
|
|||
|
|
|
|||
|
|
* lib/examples/nl_splash.lyx: update from Tino Meinen.
|
|||
|
|
|
|||
|
|
2001-01-04 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (FormDocument::build):
|
|||
|
|
Disable class_->choice_doc_class and language_->choice_language to
|
|||
|
|
allow using the class/language combox with keyboard.
|
|||
|
|
|
|||
|
|
2001-01-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/snprintf.c (va_copy): only define va_copy if undefined
|
|||
|
|
|
|||
|
|
2001-01-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxvc.C (showLog): give the tempfile a mask
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
|
|||
|
|
branch on !rename
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (IsDirWriteable): give the tempfile a
|
|||
|
|
mask and unlink the tempfile after use.
|
|||
|
|
|
|||
|
|
2001-01-04 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (resetPos): an extra scroll, but we
|
|||
|
|
really should redo all this scrolling code!
|
|||
|
|
(TabularFeatures): unlock the_locking_inset before add/del rows/colums.
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): check that y/h values are good otherwise
|
|||
|
|
change them.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
|
|||
|
|
(pasteSelection): pay attention to multicolumn cells.
|
|||
|
|
(calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
|
|||
|
|
|
|||
|
|
2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/math_panel.C (deco_cb): check the decoration index is
|
|||
|
|
valid.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (feedback): apply
|
|||
|
|
formatting to the translated string, not to the original one.
|
|||
|
|
(printWarning): ditto.
|
|||
|
|
|
|||
|
|
* src/gettext.C (_): translate empty string with empty string.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.C (build): use _() instead of
|
|||
|
|
N_().
|
|||
|
|
|
|||
|
|
* NEWS: small update
|
|||
|
|
|
|||
|
|
* UPGRADING: mention that tabular format has been changed.
|
|||
|
|
|
|||
|
|
2001-01-03 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (InsetButtonPress): look for button==2
|
|||
|
|
and do Clipboard Paste!
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (SetText): added function.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
|
|||
|
|
new LFUN_PASTESELECTION.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (draw): don't clear if top_x changes.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (draw): clear only if the inset didn't
|
|||
|
|
change in the draw routine.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (width): make the width dependant on the
|
|||
|
|
textWidth too.
|
|||
|
|
|
|||
|
|
* src/text.C (draw): comment out the UpdateInset call.
|
|||
|
|
|
|||
|
|
* src/screen.C (DrawOneRow):
|
|||
|
|
(DrawFromTo): check for bv->text->status not text->status.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
|
|||
|
|
dimensions of ascent-descent for the whole row.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (draw): check also for need_update == INIT.
|
|||
|
|
|
|||
|
|
2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* Makefile.am (EXTRA_DIST): add autogen.sh
|
|||
|
|
|
|||
|
|
2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
|
|||
|
|
|
|||
|
|
* development/OS2/quick_fix.patch:
|
|||
|
|
* lib/configure.cmd: update OS/2 support files.
|
|||
|
|
|
|||
|
|
2001-01-02 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (pasteSelection): rewritten correctly.
|
|||
|
|
|
|||
|
|
* src/tabular.C (TeXTopHLine):
|
|||
|
|
(TeXBottomHLine): fixed Lars new code.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): added support for math_greek.
|
|||
|
|
|
|||
|
|
* src/mathed/math_symbols.C (math_insert_greek): removed current_view
|
|||
|
|
from this function and added a BufferView * parameter.
|
|||
|
|
|
|||
|
|
* src/mathed/math_symbols.C (math_insert_symbol): ditto
|
|||
|
|
|
|||
|
|
2000-12-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/version.h: set to pre3
|
|||
|
|
|
|||
|
|
2000-12-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): added Floating.C
|
|||
|
|
|
|||
|
|
* src/Floating.h: moved all the inlines to Floating.C
|
|||
|
|
|
|||
|
|
* src/Floating.C: new file
|
|||
|
|
|
|||
|
|
2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (feedback): fix
|
|||
|
|
description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
|
|||
|
|
|
|||
|
|
2000-12-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/FileInfo.h: move unistd.h to after sys/types.h and
|
|||
|
|
sys/stat.h.
|
|||
|
|
|
|||
|
|
* src/support/FileInfo.C: don't include sys/types. and sys/stat.h
|
|||
|
|
|
|||
|
|
* src/mathed/math_inset.h: move LString.h to be included first
|
|||
|
|
|
|||
|
|
* src/insets/insetfloat.C: adjust for change in private variable names
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_helpers.h : don't include config.h
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_helpers.C: adjust the order of
|
|||
|
|
includes, some whitespace changes.
|
|||
|
|
|
|||
|
|
* src/trans.C (Load): constify filename and res
|
|||
|
|
|
|||
|
|
* src/text2.C (SetCounter): call Floating::name()
|
|||
|
|
|
|||
|
|
* src/screen.C: change to not use owner from WorkArea, but from
|
|||
|
|
text instead.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: adjust because of changes in Intl.
|
|||
|
|
|
|||
|
|
* src/intl.h: make trans a object instead of pointer, inlucd
|
|||
|
|
trans_mgr.h in this file.
|
|||
|
|
(getTrans): return a reference to TransManager
|
|||
|
|
|
|||
|
|
* src/intl.C: don't include trans_mgr.h here
|
|||
|
|
modify calls to trans to work on object instead of on pointer
|
|||
|
|
|
|||
|
|
* src/WorkArea.h: add using for Signal1
|
|||
|
|
comment out forward decl of BufferView.
|
|||
|
|
add signal scrollCB
|
|||
|
|
remove class variable owner_ and getter method for this.
|
|||
|
|
|
|||
|
|
* src/WorkArea.C: don't include BufferView.h
|
|||
|
|
(WorkArea): change to not take a BufferView.h, use signals
|
|||
|
|
instead.
|
|||
|
|
(scroll_cb): emit signal
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.C: include Floatlist.h
|
|||
|
|
(getPackages): only load float.sty when needed
|
|||
|
|
(getMacros): prepare for outputting the correct code to preamble.
|
|||
|
|
|
|||
|
|
* src/Floating.h: make all variables private + rename to var_.
|
|||
|
|
(Floating): default ctor
|
|||
|
|
(Floating): complex ctor to set a complete Floating
|
|||
|
|
(type): getter
|
|||
|
|
(placement): getter
|
|||
|
|
(name): getter
|
|||
|
|
(builtin): getter
|
|||
|
|
|
|||
|
|
* src/FloatList.C (FloatList): use Floating's constructor
|
|||
|
|
(begin): new method
|
|||
|
|
(end): ditto
|
|||
|
|
(newFloat): call type()
|
|||
|
|
(defaultPlacement): call placement()
|
|||
|
|
(operator): new operator
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
|
|||
|
|
(scrollUp): call pimpl's scrollCB
|
|||
|
|
(scrollDown): ditto
|
|||
|
|
(pasteClipboard): constify clip
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (insertLyXFile): constify fname, fi and c.
|
|||
|
|
(insertErrors): constify desctext, errortext, msgtxt and errorrow
|
|||
|
|
(open_new_inset): delete some commented code.
|
|||
|
|
|
|||
|
|
* src/BufferView.[Ch] (enterView): comment out
|
|||
|
|
(leaveView): ditto
|
|||
|
|
(scrollCB): ditto
|
|||
|
|
(workAreaMotionNotify): ditto
|
|||
|
|
(workAreaButtonPress): ditto
|
|||
|
|
(doubleClick): ditto
|
|||
|
|
(tripleClick): ditto
|
|||
|
|
(workAreaButtonRelease): ditto
|
|||
|
|
(workAreaExpose): ditto
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (cross_compiling): small stuff to be able
|
|||
|
|
to compile with cvs gcc (2.97).
|
|||
|
|
|
|||
|
|
2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: menu structure cleanup.
|
|||
|
|
|
|||
|
|
* lib/languages: add description of entries.
|
|||
|
|
|
|||
|
|
2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/ExternalTemplate.C (readTemplates): change debug
|
|||
|
|
messages a bit.
|
|||
|
|
(readTemplate): use lyxlex.printError to report read errors.
|
|||
|
|
(readFormat): ditto.
|
|||
|
|
|
|||
|
|
* src/insets/insetexternal.C (Read): suppress debug message when
|
|||
|
|
not needed.
|
|||
|
|
|
|||
|
|
2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (Ascii): New method. Currently
|
|||
|
|
supports only verbatim input.
|
|||
|
|
|
|||
|
|
2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/bind/fi_menus.bind: update from Pauli Virtanen.
|
|||
|
|
|
|||
|
|
2000-12-22 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (InsetButtonPress): do nothing if we
|
|||
|
|
have a selection and button == 3.
|
|||
|
|
(UpdateLocal): if what == INIT clear selection if existent!
|
|||
|
|
(InsetButtonPress): don't activate the cell inset on button==3
|
|||
|
|
(Edit): ditto
|
|||
|
|
(LocalDispatch): move curor up/down if exiting an inset which this
|
|||
|
|
keys.
|
|||
|
|
|
|||
|
|
2000-12-20 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
|
|||
|
|
calling for the math-panel (do not unlock the math-inset if locked)!
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): fixed drawing of depth lines inside
|
|||
|
|
text-insets (with x-offset).
|
|||
|
|
|
|||
|
|
* src/tabular.C (TeXCellPreamble): fixed wrong output of special
|
|||
|
|
alignment of multicolumn-cells.
|
|||
|
|
|
|||
|
|
2000-12-19 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch):
|
|||
|
|
* src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
|
|||
|
|
for insettext.
|
|||
|
|
|
|||
|
|
2000-12-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (work_area_handler): simplify the key/keysym
|
|||
|
|
handling for XForms 0.89, this might have rendered some cases
|
|||
|
|
unusable. I have at least deadkeys, accent-xxx and KP_x working.
|
|||
|
|
Please report proplems.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeySym): make the self-insert handling
|
|||
|
|
work as it should
|
|||
|
|
|
|||
|
|
2000-12-18 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (deplog): fix spelling errors
|
|||
|
|
* src/text2.C (CutSelection): ditto
|
|||
|
|
* src/lyxfunc.C (Dispatch): ditto
|
|||
|
|
|
|||
|
|
2000-12-18 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/layouts/stdlayouts.inc: only allow align Center for Caption
|
|||
|
|
|
|||
|
|
* src/mathed/math_inset.C (MathMatrixInset): initialize v_align
|
|||
|
|
and h_align in default init.
|
|||
|
|
adjust calls to MathedRowSt
|
|||
|
|
|
|||
|
|
* src/mathed/math_iter.C: adjust calls to MathedRowSt
|
|||
|
|
* src/mathed/math_iter.h (getAD): ditto
|
|||
|
|
|
|||
|
|
* src/mathed/math_defs.h (class MathedRowSt): remove friends, add
|
|||
|
|
methods setBaseline, ascent, descent
|
|||
|
|
(class MathMatrixInset): remove method GetAlign, change h_align
|
|||
|
|
from char* to string
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeySym): discover the correct argument if
|
|||
|
|
the action is LFUN_SELFINSERT
|
|||
|
|
|
|||
|
|
2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/math_cursor.C (Interpret) Suppress a debug message
|
|||
|
|
in normal run.
|
|||
|
|
|
|||
|
|
2000-12-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/copy.C: don't include filetools.h
|
|||
|
|
|
|||
|
|
* lib/images: revert to old banner, drop the cucumber.
|
|||
|
|
|
|||
|
|
2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.C (Formats::View): Change the current directory to
|
|||
|
|
the directory of the file.
|
|||
|
|
|
|||
|
|
2000-12-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/kbsequence.C (addkey): also clear sequence and modifiers if
|
|||
|
|
length == 0
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (theLockingInset): return 0 if text is 0
|
|||
|
|
|
|||
|
|
2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* Many files: Fix RTL support for insettext.
|
|||
|
|
|
|||
|
|
2000-12-11 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* README: add mention of broken ghostscript versions, remove
|
|||
|
|
reference to non-existent BUGS file
|
|||
|
|
|
|||
|
|
2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (compare_no_case): small fix. When passed
|
|||
|
|
length, should use it in the size comparison.
|
|||
|
|
|
|||
|
|
2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insetexternal.C (getScreenLabel): Return a default
|
|||
|
|
value if the template label is empty.
|
|||
|
|
|
|||
|
|
* src/lyxlookup.C: do not condition on FL_REVISION.
|
|||
|
|
|
|||
|
|
* forms/sp_form.fd:
|
|||
|
|
* src/sp_form.C: fix the font size of some text entries
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
|
|||
|
|
after TOC when there is no TOC.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
|
|||
|
|
bind file if it has not been done yet.
|
|||
|
|
(read): remove local bindFile variable. Try to fix the handling of
|
|||
|
|
RC_BIND and RC_BINDFILE.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init): use readBindFileIfNeeded().
|
|||
|
|
|
|||
|
|
* lib/languages: Change description of german to "German (new
|
|||
|
|
spelling)".
|
|||
|
|
|
|||
|
|
2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormInset.C (createInset): activate "Ok",
|
|||
|
|
"Apply" buttons if arg is non-zero.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): enable citation to be inserted without
|
|||
|
|
launching the popup if sufficient info is passed to
|
|||
|
|
LFUN_CITATION_CREATE.
|
|||
|
|
|
|||
|
|
2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
|
|||
|
|
labels (disabled in 1.1.6).
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch]: New variable label_init_length
|
|||
|
|
|
|||
|
|
* mathed/formula.C (LocalDispatch): Preserve the label when
|
|||
|
|
changing from display math to eqnarray (however, the label
|
|||
|
|
do not appear at the first line, as one might expects, but at the
|
|||
|
|
second line).
|
|||
|
|
(LocalDispatch): When inserting a label to a formula which already
|
|||
|
|
have a label, the old label is used as default value.
|
|||
|
|
Also, if the label is changed, then all references to the label
|
|||
|
|
are changed.
|
|||
|
|
|
|||
|
|
* src/mathed/math_iter.C (setLabel): Allow to set the label
|
|||
|
|
even if it is empty. This is needed to allow deletion of a label
|
|||
|
|
in an eqnarray.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
|
|||
|
|
refernces only if the old label appears once in the document.
|
|||
|
|
|
|||
|
|
2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
|
|||
|
|
<gehlert@Rcs1.urz.tu-dresden.de>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.C: comment out debug.h
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
|
|||
|
|
code in xform_helpers instead.
|
|||
|
|
(d-tor): comment out "delete dialog;" and so prevent a crash on exit.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: use AddName() in more places.
|
|||
|
|
Use N_(), rather than _() when creating strings to pass to browseFile()
|
|||
|
|
because browseFile calls gettext() itself now.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
|
|||
|
|
display the filename correctly.
|
|||
|
|
|
|||
|
|
2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.C (Move): New method. Used to move file or files
|
|||
|
|
from temp dir to the output dir. (this fixes the bug that
|
|||
|
|
exporting linuxdoc/docbook document to html would not move all
|
|||
|
|
html file from temp directory).
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (DirList): Fixed.
|
|||
|
|
|
|||
|
|
* src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
|
|||
|
|
|
|||
|
|
2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.C (Add): Remove $$i when setting latex_command.
|
|||
|
|
|
|||
|
|
* src/text.C (IsBoundary): Return false when pos = 0.
|
|||
|
|
|
|||
|
|
2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
|
|||
|
|
|
|||
|
|
2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
|
|||
|
|
need to empty the fields to turn off use of the geometry package!
|
|||
|
|
|
|||
|
|
2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
|
|||
|
|
(Buffer const &), not a (BufferParams const &) and so fix a crash
|
|||
|
|
caused by using current_view before it had been initialised. Not
|
|||
|
|
the best way to do this, but much easier than changing
|
|||
|
|
Inset::Clone(Buffer const &) to Inset::Clone().
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C:
|
|||
|
|
* src/tabular.C: changed call to CopyIntoMinibuffer().
|
|||
|
|
|
|||
|
|
2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: put TOC at the beginning of the TOC menu.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): disable insertion of floats in a
|
|||
|
|
tabular.
|
|||
|
|
|
|||
|
|
2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
|
|||
|
|
changed filter for screen fonts input filter from int to float
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/input_validators.c: removed.
|
|||
|
|
* src/frontends/xforms/input_validators.C: new file. Can now call C++
|
|||
|
|
functions from within the filter functions.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/input_validators.[Ch]
|
|||
|
|
(fl_unsigned_float_filter): new filter function.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
|
|||
|
|
confused now! And if you think I'm going to do this in
|
|||
|
|
./forms/fdfix.sh with its "sed -e" declarations, then think again!
|
|||
|
|
|
|||
|
|
2000-12-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (work_area_handler): don't handle button requests
|
|||
|
|
if xbutton.button == 0
|
|||
|
|
|
|||
|
|
2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
|
|||
|
|
It creates a lot of interesting problems.
|
|||
|
|
|
|||
|
|
2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (openByName): check that
|
|||
|
|
the menu exists in the current menubar before opening it.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (hasSubmenu): new method.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
|
|||
|
|
action value by offsetting actions by a large constant (so that
|
|||
|
|
bogs choice result will be less than this constant).
|
|||
|
|
|
|||
|
|
* lib/bind/fi_menus.bind: more cleanup to menus.
|
|||
|
|
* lib/bind/sciword.bind: ditto.
|
|||
|
|
* lib/bind/xemacs.bind: ditto.
|
|||
|
|
* lib/bind/emacs.bind: ditto.
|
|||
|
|
* lib/bind/pt_menus.bind: ditto.
|
|||
|
|
* lib/bind/hu_menus.bind: ditto.
|
|||
|
|
|
|||
|
|
* src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
|
|||
|
|
|
|||
|
|
* INSTALL: update PROBLEMS section.
|
|||
|
|
|
|||
|
|
* src/lyxlookup.h: remove condition on xforms version, since we
|
|||
|
|
should not include it if not appropriate.
|
|||
|
|
|
|||
|
|
2000-12-05 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/LColor.C: "latex text" -> "latex inset" (from
|
|||
|
|
Angus Leeming)
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormTabularCreate.C:
|
|||
|
|
* src/frontends/kde/citationdlg.C:
|
|||
|
|
* src/frontends/kde/copyrightdlg.C:
|
|||
|
|
* src/frontends/kde/paradlg.C:
|
|||
|
|
* src/frontends/kde/paraextradlg.C:
|
|||
|
|
* src/frontends/kde/parageneraldlg.C:
|
|||
|
|
* src/frontends/kde/printdlg.C:
|
|||
|
|
* src/frontends/kde/refdlg.C:
|
|||
|
|
* src/frontends/kde/tabcreatedlg.C:
|
|||
|
|
* src/frontends/kde/tocdlg.C:
|
|||
|
|
* src/frontends/kde/urldlg.C: add necessary headers
|
|||
|
|
(from Angus Leeming)
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/emptytable.C:
|
|||
|
|
* src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
|
|||
|
|
default parameters (from Angus Leeming)
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/moc/.cvsignore:
|
|||
|
|
* src/frontends/kde/dlg/.cvsignore:
|
|||
|
|
* src/frontends/kde/moc/.cvsignore: fix the library name
|
|||
|
|
(from Angus Leeming)
|
|||
|
|
|
|||
|
|
* src/frontends/kde/paradlg.C:
|
|||
|
|
* src/frontends/kde/parageneraldlg.C:
|
|||
|
|
* src/frontends/kde/dlg/para.dlg:
|
|||
|
|
* src/frontends/kde/dlg/paradlgdata.C: added accelerators
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/README: clarified qtarch version
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/Makefile.am: removed the
|
|||
|
|
dlg rules as they created spontaneous rebuilds
|
|||
|
|
(not a good idea as it requires qtarch)
|
|||
|
|
|
|||
|
|
2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
|
|||
|
|
fixlevel along with xforms version.
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
|
|||
|
|
xforms version is strictly less than 0.89.5.
|
|||
|
|
* src/lyx_gui.C (LyXGUI): ditto.
|
|||
|
|
* src/LyXView.C (show): ditto.
|
|||
|
|
|
|||
|
|
2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
|
|||
|
|
movement in inset in RTL text.
|
|||
|
|
(checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
|
|||
|
|
(workAreaButtonRelease): Do not open a float when there is a selection.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (cx): Fixed for insets in RTL text.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (RunSpellChecker): Open all floats before
|
|||
|
|
spellchecking.
|
|||
|
|
|
|||
|
|
* src/text.C (InsertChar): Consider "," as a part of a number
|
|||
|
|
(for LTR numbers in RTL text code).
|
|||
|
|
(IsBoundary): Fixed (and simplified).
|
|||
|
|
(InsertChar): Recalculate cursor boundary.
|
|||
|
|
(Backspace): Ditto.
|
|||
|
|
|
|||
|
|
2000-12-04 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: fix figures with pspell enabled
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: workaround for gs hang xforms bug
|
|||
|
|
|
|||
|
|
2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/bind/??_menus.bind: comment out the entries corresponding to
|
|||
|
|
real menus. They should be eventually removed, but I'll let the
|
|||
|
|
language maintainers do that.
|
|||
|
|
|
|||
|
|
2000-12-04 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/parageneraldlg.C:
|
|||
|
|
* src/frontends/kde/parageneraldlg.h: don't use
|
|||
|
|
a derived class for SpaceAbove/Below
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/README: add some info
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/*: update data files, update
|
|||
|
|
dialog files.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/moc/Makefile.am: add
|
|||
|
|
${FRONTEND_INCLUDES}
|
|||
|
|
|
|||
|
|
2000-12-04 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* configure.in: add new KDE Makefiles
|
|||
|
|
* src/vspace.h: return GlueLength not a normal one
|
|||
|
|
* src/support/lstrings.h:
|
|||
|
|
* src/support/lstrings.C: add isStrUnsignedInt(),
|
|||
|
|
strToUnsignedInt()
|
|||
|
|
|
|||
|
|
* src/frontends/kde/*: big reorganisation, update
|
|||
|
|
FormParagraph, add FormTabCreate
|
|||
|
|
|
|||
|
|
2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: small grammatical change.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_macros.h: removed.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.C:
|
|||
|
|
* src/frontends/xforms/FormPreferences.C:
|
|||
|
|
* src/frontends/xforms/Makefile.am: changes associated with removing
|
|||
|
|
xform_macros.h. Should make Lars' debugging a little easier.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C:
|
|||
|
|
* src/frontends/xforms/FormPreferences.h:
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
|
|||
|
|
longer use X11 color name database. HSV and RGB dials/sliders.
|
|||
|
|
Please let this be the end of this!
|
|||
|
|
|
|||
|
|
2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* Several files: Allow compilation when the compiler doesn't
|
|||
|
|
support namespaces.
|
|||
|
|
|
|||
|
|
2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* lyx.man:
|
|||
|
|
* src/lyx_main.C (commandLineHelp, easyParse): documented remaining
|
|||
|
|
command line options.
|
|||
|
|
|
|||
|
|
2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
|
|||
|
|
FL_MENU_BUTTON for items in menu bar. Not sure what difference it
|
|||
|
|
makes, anyway.
|
|||
|
|
|
|||
|
|
2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormRef.C (updateBrowser):
|
|||
|
|
* src/frontends/xforms/forms/form_ref.fd: try clicking on
|
|||
|
|
different insets with the sort key active. Now apply this patch!
|
|||
|
|
|
|||
|
|
2000-11-29 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPrint.C: set to valid()
|
|||
|
|
when we update from the passed parameters.
|
|||
|
|
|
|||
|
|
2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/LColor.C (getFromGUIName): internationalise the comparison.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
|
|||
|
|
FormPreferences choice.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: some additional Color safety.
|
|||
|
|
Should be redundant.
|
|||
|
|
|
|||
|
|
2000-11-29 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: more detail for the printer program config
|
|||
|
|
dialog.
|
|||
|
|
|
|||
|
|
* src/LColor.C: ert->latex text. LColor needs a big revamp
|
|||
|
|
but will have to wait till after 1.1.6
|
|||
|
|
|
|||
|
|
* src/buffer.C: bring up a dialog if we load a document
|
|||
|
|
with an un-installed text class, rather than just complain
|
|||
|
|
on the console.
|
|||
|
|
|
|||
|
|
2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
|
|||
|
|
the browser form for a combox in a tabbed folder. Bug fix courtesy of
|
|||
|
|
Steve Lamont <spl@ncmir.ucsd.edu>.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (build):
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (Language::build):
|
|||
|
|
pass tabfolders to Combox::add() in order to use this work around.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C (connect): remove max size
|
|||
|
|
limitation.
|
|||
|
|
(update): sort list of bibliography keys.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
|
|||
|
|
setSize): removed.
|
|||
|
|
No max size limitation. Same popup for new and existing insets. Fixes
|
|||
|
|
bugs reported by Rob Lahaye.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C (c-tor):
|
|||
|
|
* src/frontends/xforms/FormCopyright.C (c-tor):
|
|||
|
|
* src/frontends/xforms/FormError.C (c-tor):
|
|||
|
|
* src/frontends/xforms/FormGraphics.C (c-tor):
|
|||
|
|
* src/frontends/xforms/FormIndex.C (c-tor):
|
|||
|
|
* src/frontends/xforms/FormRef.C (c-tor):
|
|||
|
|
* src/frontends/xforms/FormToc.C (c-tor):
|
|||
|
|
* src/frontends/xforms/FormUrl.C (c-tor):
|
|||
|
|
use correct policy for ButtonController.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
|
|||
|
|
call a little.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_citation.fd: some resizing changes.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
|
|||
|
|
Some resizing changes.
|
|||
|
|
|
|||
|
|
2000-11-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* configure.in: fix typo
|
|||
|
|
|
|||
|
|
* lib/languages: add ukraninian and change no to no_NO
|
|||
|
|
|
|||
|
|
* src/lyxfont.[Ch] (setGUISize): comment out setGUISize
|
|||
|
|
|
|||
|
|
* src/bufferview_funcs.C (FontSize): use setLyXSize
|
|||
|
|
|
|||
|
|
2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
|
|||
|
|
|
|||
|
|
* acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
|
|||
|
|
to check for systems where mkstemp() is available but not declared
|
|||
|
|
in headers. The new autoconf macro lyx_CHECK_DECL can be used
|
|||
|
|
to check for declarations in headers.
|
|||
|
|
|
|||
|
|
2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* forms/bibforms.fd: tiny fix to get it to run with fdesign.
|
|||
|
|
|
|||
|
|
* forms/makefile: added bibforms.fd, include_form.fd.
|
|||
|
|
Removed lyx_sendfax.fd.
|
|||
|
|
|
|||
|
|
* src/LaTeXLog.C (ShowLatexLog):
|
|||
|
|
* src/LyXAction.C (init):
|
|||
|
|
* src/bufferparams.C (readLanguage): altered messages as suggested by
|
|||
|
|
John Levon.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
|
|||
|
|
Dialogs::redrawGUI.
|
|||
|
|
|
|||
|
|
* src/credits.C: made fd_form_credits non-static, so that it can be
|
|||
|
|
redrawn should the xforms colors be re-mapped.
|
|||
|
|
* src/spellchecker.C ditto fd_form_spell_options.
|
|||
|
|
|
|||
|
|
* src/filedlg.[Ch] (redraw):
|
|||
|
|
* src/intl.[Ch] (redraw):
|
|||
|
|
* src/lyxfr0.[Ch] (redraw):
|
|||
|
|
* src/insets/figinset.[Ch] (redraw):
|
|||
|
|
* src/insets/insetexternal.[Ch] (redraw):
|
|||
|
|
new methods, connected to Dialogs::redrawGUI.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
|
|||
|
|
to be connected to Dialogs::redrawGUI.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C (build):
|
|||
|
|
* src/frontends/xforms/FormCopyright.C (build):
|
|||
|
|
* src/frontends/xforms/FormError.C (build):
|
|||
|
|
* src/frontends/xforms/FormGraphics.C (build):
|
|||
|
|
* src/frontends/xforms/FormIndex.C (build):
|
|||
|
|
* src/frontends/xforms/FormTabularCreate.[Ch] (update):
|
|||
|
|
* src/frontends/xforms/FormToc.C (build):
|
|||
|
|
* src/frontends/xforms/FormUrl.C (build):
|
|||
|
|
use the ButtonController correctly.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.C (build):
|
|||
|
|
* src/frontends/xforms/forms/form_copyright.fd: moved the text out of
|
|||
|
|
the .fd file and into build().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: tiny clean-up.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_citation.fd:
|
|||
|
|
* src/frontends/xforms/forms/form_copyright.fd:
|
|||
|
|
* src/frontends/xforms/forms/form_error.fd:
|
|||
|
|
* src/frontends/xforms/forms/form_graphics.fd:
|
|||
|
|
* src/frontends/xforms/forms/form_index.fd:
|
|||
|
|
* src/frontends/xforms/forms/form_toc.fd:
|
|||
|
|
* src/frontends/xforms/forms/form_url.fd:
|
|||
|
|
renamed some of the objects. Named others explicitly for the first time.
|
|||
|
|
Added Restore and Apply buttons where appropriate.
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
|
|||
|
|
used.
|
|||
|
|
|
|||
|
|
2000-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/version.h: try the pre2 again
|
|||
|
|
|
|||
|
|
2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormParagraph.C: added using directive.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/paradlg.C: added config.h and using directive.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/paradlg.h: added std::qualifier.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
|
|||
|
|
|
|||
|
|
2000-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* configure.in (AC_OUTPUT): don't output src/xtl/Makefile
|
|||
|
|
|
|||
|
|
* src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
|
|||
|
|
|
|||
|
|
2000-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/version.h: set back to 1.1.6cvs
|
|||
|
|
|
|||
|
|
2000-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/version.h: set to 1.1.6pre2
|
|||
|
|
|
|||
|
|
2000-11-20 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Makefile.am: updated list of XForms object files
|
|||
|
|
|
|||
|
|
2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/LColor.C (init):
|
|||
|
|
* src/lyxrc.C (getDescription): changed some comments as suggested by
|
|||
|
|
John Levon.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch]: modified to connect and
|
|||
|
|
disconnect the redrawGUI signal in best-practice fashion.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
|
|||
|
|
long_opts_tab to reflect the change in name of this tabfolder, as
|
|||
|
|
suggested by John Levon.
|
|||
|
|
(connect, disconnect): new methods. Don't do much at present other than
|
|||
|
|
ensuring that we can't resize the dialog. This just makes xforms go
|
|||
|
|
crazy.
|
|||
|
|
(lots of methods in Colors): made void rather than bool. The idea is
|
|||
|
|
to have an isOk() function that keeps track of whether any input is
|
|||
|
|
genuinely invalid and should therefore block Save, Apply.
|
|||
|
|
Easier to manipulate the counters rapidly.
|
|||
|
|
(Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
|
|||
|
|
compiler will like this code. Much cleaner way of doing things.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: used normal counters
|
|||
|
|
rather than simple counters, following suggestion by John Levon.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_print.fd: used labelframe rather
|
|||
|
|
than engraved frame + text.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/makefile: removed spurious command.
|
|||
|
|
|
|||
|
|
2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
|
|||
|
|
array.
|
|||
|
|
* src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
|
|||
|
|
ReadOnly|NoBuffer.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: re-formatted so that I can
|
|||
|
|
see what Lars has changed and what is just white space!
|
|||
|
|
Now used X directly to ascertain the RGB color associated with the
|
|||
|
|
color name.
|
|||
|
|
Replaced the RGB sliders with HSV equivalent. Should be more intuitive
|
|||
|
|
to use.
|
|||
|
|
Added some sort capability.
|
|||
|
|
The X11 color name database input is only displayed if the database
|
|||
|
|
isn't found in the standard place.
|
|||
|
|
Got rid of struct compare_converter; it wasn't used.
|
|||
|
|
Probably some other stuff that I've forgotten.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.h: changed the names of some
|
|||
|
|
methods in the Colors struct. Added a couple of structs to help sort
|
|||
|
|
colors by name and by RGBColor.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
|
|||
|
|
functions into a new class RWInfo.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
|
|||
|
|
The dialog is now almost navigable using the keyboard. Unfortunately,
|
|||
|
|
the cursor has to be inside a browser for it to be activated. There is
|
|||
|
|
no visual feedback for the key shortcuts to the arrow keys (use
|
|||
|
|
Alt-appropriate arrow key, Alt-x).
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
|
|||
|
|
around a lot.
|
|||
|
|
|
|||
|
|
* src/support/filetools.[Ch]: moved out ReadableFile etc and into
|
|||
|
|
xform_helpers.[Ch]. See above.
|
|||
|
|
|
|||
|
|
2000-11-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
|
|||
|
|
|
|||
|
|
* src/screen.C (setCursorColor): new method. Sets the color of the
|
|||
|
|
cursor.
|
|||
|
|
(ShowManualCursor): call it.
|
|||
|
|
Constify some local variables.
|
|||
|
|
|
|||
|
|
* src/LColor.[Ch] (LColor): add entry for cursor
|
|||
|
|
* lib/configure(.m4) (word_to_latex_command): add quotes, removes
|
|||
|
|
a warning.
|
|||
|
|
|
|||
|
|
2000-11-19 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (draw): fixed text border redraw problem.
|
|||
|
|
(calculate_dimensions_of_cells): try to boost up when inserting chars.
|
|||
|
|
|
|||
|
|
2000-11-15 Rob Lahaye <lahaye@postech.edu>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: OptItem used for Fax entry
|
|||
|
|
|
|||
|
|
2000-11-17 Matej Cepl <cepl@bigfoot.com>
|
|||
|
|
|
|||
|
|
* lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
|
|||
|
|
|
|||
|
|
2000-11-15 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/vspace.C (nextToken): fix so it can handle length phrases like
|
|||
|
|
"10mm+-20mm", "40inplus16mmminus10cm" etc.
|
|||
|
|
|
|||
|
|
2000-11-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: constify several variables
|
|||
|
|
(BrowserLyX): rewrite to not need the choice variable
|
|||
|
|
(Modify): rewrite to not need the choide variable
|
|||
|
|
(compare_converter): make operator const
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (output): be a bit nicer og os usage, and try to
|
|||
|
|
correct the writing of \set_color
|
|||
|
|
(getDescription): return a const string
|
|||
|
|
|
|||
|
|
* src/kbsequence.[Ch] (addkey): remove dead code
|
|||
|
|
|
|||
|
|
* src/Painter.C (text): remove some commented code
|
|||
|
|
|
|||
|
|
2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/ColorHandler.[Ch]: removed some header files from .h file.
|
|||
|
|
Included LColor.h in .C file.
|
|||
|
|
|
|||
|
|
* src/LColor.[Ch]: made class copyable so that I could create a
|
|||
|
|
system_lcolor instance.
|
|||
|
|
|
|||
|
|
* src/Painter.h: removed LColor.h.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): used AddName.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
|
|||
|
|
of user preferences/lyxrc file.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (output): output changes to lcolor.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
|
|||
|
|
NamedColor.
|
|||
|
|
Moved class xformColor to files xform_helpers.[Ch]. These files,
|
|||
|
|
Color.[Ch], could now be moved into src if they would be useful to
|
|||
|
|
other GUIs.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
|
|||
|
|
Also moved FormPreferences::browseFile here as it can be used by any
|
|||
|
|
xform dialog with a "Browse" button. FormGraphics is a perfect example.
|
|||
|
|
|
|||
|
|
* src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
|
|||
|
|
ReadableFile): changed the FormPreferences methods a little and moved
|
|||
|
|
them here as they'll be useful elsewhere also.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
|
|||
|
|
Removed some header files and used forward declarations instead.
|
|||
|
|
Better commenting.
|
|||
|
|
Removed some methods as they'll be useful elsewhere (see above).
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
|
|||
|
|
Can also now modify the LyX LColors. However, for reasons that I don't
|
|||
|
|
yet understand, it appears that we can use
|
|||
|
|
LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
|
|||
|
|
present. The problem appears to lie in ColorHandler, because I can
|
|||
|
|
change the color using LColor.SetColor(). Similarly, when reading in a
|
|||
|
|
preferences file with some set_color instances, I'll get a warning
|
|||
|
|
like: Color sea green is undefined or may not be redefined
|
|||
|
|
Bad lyxrc set_color for sea green
|
|||
|
|
|
|||
|
|
Once the buffer is loaded, however, I can happily change to this color.
|
|||
|
|
|
|||
|
|
Finally, it appears that I have to set the color of "inset frame"
|
|||
|
|
explicitly, or it oscillates from "black" to "indian red" with each
|
|||
|
|
successive "Apply".
|
|||
|
|
|
|||
|
|
2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* ANNOUNCE: corrected a spelling mistake.
|
|||
|
|
|
|||
|
|
* src/tabular.C (OldFormatRead): variable "h" was set but never used.
|
|||
|
|
Removed.
|
|||
|
|
|
|||
|
|
2000-11-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
|
|||
|
|
distdir.
|
|||
|
|
|
|||
|
|
* src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
|
|||
|
|
match the requirements from the standard better. This is required
|
|||
|
|
to work with gnu libstdc++-v3
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: add explict pair
|
|||
|
|
arguments to browse calls. include support/lyxmanip.h remvoe
|
|||
|
|
extern fmt. whitespace changes. reorder variables in
|
|||
|
|
FormPreferences.h, to match initalizaton order.
|
|||
|
|
|
|||
|
|
* several files: constify more local variables.
|
|||
|
|
|
|||
|
|
* src/buffer.C: remove some commented functions.
|
|||
|
|
|
|||
|
|
* src/DepTable.C (remove_files_with_extension): temporary
|
|||
|
|
work around for gcc 2.97
|
|||
|
|
* src/filedlg.C (find): ditto
|
|||
|
|
* src/Variables.C (set): ditto
|
|||
|
|
* src/LyXAction.C (searchActionArg): ditto
|
|||
|
|
(retrieveActionArg): ditto
|
|||
|
|
|
|||
|
|
* configure.in: check for mktemp too
|
|||
|
|
|
|||
|
|
* UPGRADING: prepare for 1.1.6
|
|||
|
|
|
|||
|
|
* Makefile.am (lgbtags): add backup tags for when etags are
|
|||
|
|
different than usual.
|
|||
|
|
|
|||
|
|
* ANNOUNCE: prepare for 1.1.6
|
|||
|
|
|
|||
|
|
* src/support/tempname.C (make_tempfile): new function, wrapper
|
|||
|
|
around mkstemp and mktemp. Only mkstemp has been tested.
|
|||
|
|
(tempName): call it.
|
|||
|
|
|
|||
|
|
2000-11-14 Rob Lahaye <lahaye@postech.edu>
|
|||
|
|
|
|||
|
|
* default.ui: capitalized some menu items to improve shortcuts.
|
|||
|
|
|
|||
|
|
2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (ok): use AddName().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Dialogs.C: add "using" directive.
|
|||
|
|
|
|||
|
|
2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/filedlg.C (Select): highlight suggested file in browser, if
|
|||
|
|
it is present.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: re-written so that
|
|||
|
|
each tab folder is encapsulated in its own class.
|
|||
|
|
The Language keymaps are now chosen using a text input and a
|
|||
|
|
browser button, rather than a Combox.
|
|||
|
|
All the browser buttons are now functional, although LyXFileDlg
|
|||
|
|
still needs to be modified to make it straighhtforward to return a
|
|||
|
|
directory if that is what is desired.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: use text input
|
|||
|
|
and browse button to input the Language keymaps. Add a few
|
|||
|
|
callbacks for the browse buttons.
|
|||
|
|
|
|||
|
|
2000-11-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/tempname.C (tempName): small changes to make it
|
|||
|
|
safer. remove the '.' before XXXXXX
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (TmpFileName): remove func
|
|||
|
|
(GetCWD): ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
|
|||
|
|
* src/frontends/xforms/FormUrl.C (FormUrl): ditto
|
|||
|
|
* src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
|
|||
|
|
* src/frontends/xforms/FormTabular.C (FormTabular): ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormInset.h (FormInset): remove default for bp
|
|||
|
|
(FormCommand): ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
|
|||
|
|
call the bp
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
|
|||
|
|
for bp (this fixes a reproducible hard crash)
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
|
|||
|
|
call the bp
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.h: make bp_ private
|
|||
|
|
(FormBaseBI): remove default for bp
|
|||
|
|
(FormBaseBD): ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
|
|||
|
|
is safe enough.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Color.C (RGBColor): made several vars
|
|||
|
|
const, changed initialization of j to allow it to be const
|
|||
|
|
(HSVColor): similar
|
|||
|
|
|
|||
|
|
* several files: added const to local variables.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: removed several function prototypes and moved them
|
|||
|
|
to lyx_cb.h
|
|||
|
|
(MenuWrite):
|
|||
|
|
(MenuWriteAs):
|
|||
|
|
(UpdateLayoutPreamble):
|
|||
|
|
(MenuLayoutSave):
|
|||
|
|
(MenuInsertLabel): add BufferView as arguemnt
|
|||
|
|
(LayoutsCB): make tmp const
|
|||
|
|
|
|||
|
|
* src/layout_forms.h: regenerated
|
|||
|
|
|
|||
|
|
* src/debug.C: add Debug::FILES
|
|||
|
|
(showLevel) (showTags): translate the desc
|
|||
|
|
|
|||
|
|
* src/debug.h: add FILES as debug target
|
|||
|
|
|
|||
|
|
* src/bufferlist.C: use current_view as an interim measure becuase
|
|||
|
|
of added arguments to MenuWrite and MenuWriteAs
|
|||
|
|
|
|||
|
|
* forms/layout_forms.h.patch: make the patch more correct and more appalyable
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
|
|||
|
|
string.
|
|||
|
|
(LYX_PROG_CXX): change 2.97 rules to include the -f.. that
|
|||
|
|
libstdc++ is compiled with.
|
|||
|
|
|
|||
|
|
2000-11-13 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
|
|||
|
|
|
|||
|
|
* lib/layouts/docbook-book.layout
|
|||
|
|
* lib/layouts/docbook.layout
|
|||
|
|
* lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
|
|||
|
|
those paragraphs are expresse as SGML comments <!-- -->.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.h
|
|||
|
|
* src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
|
|||
|
|
parameter, this allows to express all the include files as relative
|
|||
|
|
paths to the master buffer. The verbatim insert works as the other
|
|||
|
|
include file modes.
|
|||
|
|
|
|||
|
|
* src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
|
|||
|
|
is a SGML comment.
|
|||
|
|
(MakeLinuxdocFile) (MakeDocBookFile): included files are relative
|
|||
|
|
to master path.
|
|||
|
|
(MakeDocBookFile): top_element is always written. Some clean up, as
|
|||
|
|
sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
|
|||
|
|
(DocBook) added close tag to inlinegraphics trick for verbatim. Now
|
|||
|
|
a reference is written instead of the name.
|
|||
|
|
(Validate): use the relative path for the filename.
|
|||
|
|
|
|||
|
|
* src/insets/insetlabel.C (DocBook): write end tag, for XML
|
|||
|
|
compatibility.
|
|||
|
|
|
|||
|
|
* src/support/filetools.h
|
|||
|
|
* src/support/filetools.C (IsSGMLFilename): added.
|
|||
|
|
(BasePath): added.
|
|||
|
|
|
|||
|
|
2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
|
|||
|
|
|
|||
|
|
* development/OS2/quick_fix.patch:
|
|||
|
|
* lib/configure.cmd:
|
|||
|
|
* README.OS2: quick update to the OS/2 port.
|
|||
|
|
|
|||
|
|
2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/converter.C: add "using" directive.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: add "using" directive.
|
|||
|
|
(compare_converter): add "int" as return type.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
|
|||
|
|
too.
|
|||
|
|
|
|||
|
|
2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): map the xform colours, should a
|
|||
|
|
mapping exist. Ie, call XformColor::read().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
|
|||
|
|
and struct HSV as HSVColor.
|
|||
|
|
(XformColor::read, XformColor::write) : new methods that
|
|||
|
|
input/output any changes to the cform GUI colors.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
|
|||
|
|
included.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C Lots of little changes
|
|||
|
|
associated with the changed name of the RGB and HSV structs. Can
|
|||
|
|
now save changes to xforms GUI to file. Commented out
|
|||
|
|
FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
|
|||
|
|
used currently anyway.
|
|||
|
|
|
|||
|
|
2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.C: A lot of changes:
|
|||
|
|
- It is no longer possible to choose between two or more ways to
|
|||
|
|
export to some format (the new code uses only the shortest path).
|
|||
|
|
However, it is still possible to choose between pdflatex/ps2pdf
|
|||
|
|
for creating a PDF file, by defining two PDF formats: pdf & pdf2.
|
|||
|
|
- Added several methods that makes the FormPreferences code simpler.
|
|||
|
|
- Changed the tokens $$FName and $$OutName to $$i and $$o.
|
|||
|
|
|
|||
|
|
* src/exporter.C (Export): lyxrc.use_pdf is set before
|
|||
|
|
makeLaTeXFile is called. This works but not very nice.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: The formats/converters
|
|||
|
|
tabs are now fully functional.
|
|||
|
|
|
|||
|
|
* src/buffer.C (getTocList): Add numbers to the captions.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Removed fax section
|
|||
|
|
|
|||
|
|
* src/support/rename.C (rename): Delete the old file if lyx::copy
|
|||
|
|
is called.
|
|||
|
|
|
|||
|
|
2000-11-13 Rob Lahaye <lahaye@postech.edu>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: minor polishing.
|
|||
|
|
|
|||
|
|
2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Color.C: include <algorithm> and <cmath>
|
|||
|
|
headers.
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (DOCINST): do not install everything in the
|
|||
|
|
documentation directory.
|
|||
|
|
|
|||
|
|
2000-11-10 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (newFile): set the filename to the constructed
|
|||
|
|
newfileXX.lyx
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
|
|||
|
|
constructed "newfileXX.lyx" name to the dialog
|
|||
|
|
|
|||
|
|
* src/frontends/DialogBase.h: make update() non-abstract so
|
|||
|
|
KDE doesn't need to implement two update methods for every form
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am: add missing xforms objects
|
|||
|
|
to compile again
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
|
|||
|
|
|
|||
|
|
2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Color.[Ch]: new files, defining the color
|
|||
|
|
structs RGB and HSV. May not be the best place for these files.
|
|||
|
|
Perhaps move them into src ?
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am: added new files.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd:
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
|
|||
|
|
replaced all instances of "colour" with "color"!
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
|
|||
|
|
slightly yet again.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
|
|||
|
|
tab. Can now alter the colors of the xform's GUI on the fly. With
|
|||
|
|
the aid of a single static Signal (see below), can "Apply" these
|
|||
|
|
changes to all currently open dialogs. (Well, to all of the NEW
|
|||
|
|
dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
|
|||
|
|
subsequently opened dialogs will, of course, also have the new
|
|||
|
|
color scheme. Cannot yet save (or load) the choices to file, so
|
|||
|
|
they are lost when exiting LyX.
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h:
|
|||
|
|
* src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
|
|||
|
|
Used to trigger a redraw of any dialogs connected to it because,
|
|||
|
|
for example, the GUI colours have been re-mapped.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormDocument.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormParagraph.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
|
|||
|
|
method, to be connected to Dialogs::redrawGUI. Method must be
|
|||
|
|
virtual, because dialogs with tabbed folders need to redraw the
|
|||
|
|
forms of each tab folder.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (d-tor):
|
|||
|
|
* src/frontends/xforms/FormBase.C (d-tor): connected
|
|||
|
|
Dialogs::redrawGUI signal to redraw().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
|
|||
|
|
removed Assert, because it is identical to that in FormBase.
|
|||
|
|
|
|||
|
|
2000-11-10 Rob Lahaye <lahaye@postech.edu>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: minor polishing.
|
|||
|
|
|
|||
|
|
2000-11-10 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (resizeLyXText): check !cache[bv]
|
|||
|
|
(deleteLyXText): ditto
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (InsetButtonPress): don't clear the
|
|||
|
|
selection on mouse-button-3.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.h: new function clearSelection(), use this
|
|||
|
|
functions inside insettabular.C.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (TabularFeatures): clear the selection
|
|||
|
|
on remove_row/column.
|
|||
|
|
|
|||
|
|
* src/insets/inset.C (scroll): fixed some scroll stuff.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (draw): fixed another minor draw problem.
|
|||
|
|
|
|||
|
|
2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/CREDITS: add Yves Bastide
|
|||
|
|
|
|||
|
|
2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
|
|||
|
|
check whether C library functions are in the global namespace.
|
|||
|
|
|
|||
|
|
* configure.in: calls it.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
|
|||
|
|
#ifndef __GLIBCPP__.
|
|||
|
|
|
|||
|
|
2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (updateLanguage): Check
|
|||
|
|
iterators to prevent crash.
|
|||
|
|
|
|||
|
|
2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/converter.h (getprettyname, getFromToPrettyname): new methods.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
|
|||
|
|
shortcut for xforms CB to the preemptive or post-handler function.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd (form_preferences):
|
|||
|
|
removed the HIDDEN_TIMER as it's no longer used.
|
|||
|
|
Various other small changes.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
|
|||
|
|
preemptive handler to obtain feedback, rather than the post-handler.
|
|||
|
|
(ColoursLoadBrowser): find "black" and "white" based on RGB values
|
|||
|
|
rather than name.
|
|||
|
|
Formats tab is now complete. Converters tab is nearly so.
|
|||
|
|
|
|||
|
|
2000-11-09 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (~InsetText):
|
|||
|
|
(clear):
|
|||
|
|
(Read):
|
|||
|
|
(SetParagraphData): set cache.second to 0 after deleting it!
|
|||
|
|
(getLyXText): check if cache.second is not 0 if finding it.
|
|||
|
|
|
|||
|
|
2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
|
|||
|
|
lyxlex to parse the rgb.txt file.
|
|||
|
|
|
|||
|
|
* src/lyxlex.[Ch]:
|
|||
|
|
* src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
|
|||
|
|
replace the default '#' comment character.
|
|||
|
|
|
|||
|
|
* src/support/tempname.C: add "using" directive
|
|||
|
|
* src/frontends/ButtonPolicies.C: ditto.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (DirList): add an explicit cast to avoid
|
|||
|
|
a compile error (probably not the right fix)
|
|||
|
|
|
|||
|
|
2000-11-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (DirList): implement using system functions
|
|||
|
|
|
|||
|
|
* src/support/tempname.C: new file
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
|
|||
|
|
|
|||
|
|
* src/insets/insetexternal.C (InsetExternal): use lyx::tempName
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
|
|||
|
|
lyx::tempName
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/ButtonController.C: new file
|
|||
|
|
|
|||
|
|
* src/os2_defines.h: remove getcwd define
|
|||
|
|
|
|||
|
|
* src/lyxvc.C: include support/lyxlib.h
|
|||
|
|
(showLog): use lyx::tempName
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: comment out includes that we don't need
|
|||
|
|
(AutoSave): use lyx::tempName
|
|||
|
|
|
|||
|
|
* src/filedlg.C: include support/lyxlib.h
|
|||
|
|
(Reread): use lyx::getcwd
|
|||
|
|
|
|||
|
|
* src/converter.C: include support/filetools.h
|
|||
|
|
(add_options): change to static inline, make tail const
|
|||
|
|
(Add): make old_viewer const
|
|||
|
|
(GetAllFormats): make it a const method, use const_iterator
|
|||
|
|
(enable): make static inline
|
|||
|
|
(SplitFormat): make using_format const
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (run): use lyx::getcwd
|
|||
|
|
|
|||
|
|
* configure.in: check for mkstemp as well
|
|||
|
|
|
|||
|
|
2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/converter.[Ch] (GetAllCommands): new method.
|
|||
|
|
|
|||
|
|
* src/support/filetools.[Ch] (DirList): new method.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: started (just!) adding
|
|||
|
|
functionality to the converters tab.
|
|||
|
|
The formats tab is now nearly complete.
|
|||
|
|
The kbmap choices in Languages tab now display the contents of
|
|||
|
|
system_lyxdir/kbd/*.kmap in readable form.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.h: made struct RGB private.
|
|||
|
|
Moved some variables into the class.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: Revert colour of
|
|||
|
|
inactive tab folder to FL_COL1. Haven't yet worked out how to change
|
|||
|
|
colour of active folder to lighter grey instead. Any takers?
|
|||
|
|
(form_colours): added an "Apply" button.
|
|||
|
|
(form_converters): added a "Flags" input field.
|
|||
|
|
(form_formats): added a "Shortcut" input field. Note that we can't use
|
|||
|
|
names such as "input_shortcut" as this buggers up the sed script stuff.
|
|||
|
|
|
|||
|
|
2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/LaTeXLog.C:
|
|||
|
|
* src/LyXSendto.C:
|
|||
|
|
* src/credits.C:
|
|||
|
|
* src/filedlg.C:
|
|||
|
|
* src/intl.C:
|
|||
|
|
* src/lyx_cb.C:
|
|||
|
|
* src/lyx_sendfax_main.C:
|
|||
|
|
* src/lyxfr0.C:
|
|||
|
|
* src/lyxvc.C:
|
|||
|
|
* src/spellchecker.C:
|
|||
|
|
* src/insets/figinset.C:
|
|||
|
|
* src/insets/insetbib.C:
|
|||
|
|
* src/insets/insetexternal.C:
|
|||
|
|
* src/insets/insetinclude.C:
|
|||
|
|
* src/insets/insetinfo.C:
|
|||
|
|
* src/mathed/math_panel.C:
|
|||
|
|
use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
|
|||
|
|
all "daughter" dialogs now have identical "feel".
|
|||
|
|
|
|||
|
|
2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
|
|||
|
|
used (and was only used in one place prior to this patch. Incorrectly!)
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C: changed some instances of
|
|||
|
|
FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
|
|||
|
|
sense. Also added fl_set_input_return() for class_->input_doc_extra and
|
|||
|
|
for options_->input_float_placement. This fixes a bug reported by
|
|||
|
|
Rob Lahaye.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
|
|||
|
|
functionality into d-tor.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
|
|||
|
|
input of numerals also.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
|
|||
|
|
fl_set_form_atclose(). Can now close dialog from window manager,
|
|||
|
|
fixing a bug reported by Rob Lahaye.
|
|||
|
|
|
|||
|
|
2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
|
|||
|
|
are no longer dark. Haven't yet worked out how to lighten the colour of
|
|||
|
|
the active tabfolder. Any ideas anybody?
|
|||
|
|
Adjusted Colours tab a little.
|
|||
|
|
Added Shortcut field to converters tab. Note that we can't create an
|
|||
|
|
fdesign label like "input_shortcut" as this buggers up the sed-script
|
|||
|
|
stuff.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
(feedback): fixed crash due to to ob=0.
|
|||
|
|
(LanguagesXXX): the kbmap choices now contain the files
|
|||
|
|
sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
|
|||
|
|
be replaced by an input with a file browse button, but since the browse
|
|||
|
|
buttons don'y yet work, this'll do for the moment.
|
|||
|
|
(FormatsXXX): think that this is now nearly fully functional.
|
|||
|
|
Some points/questions though:
|
|||
|
|
1. Does "Apply" remove formats if no longer present?
|
|||
|
|
2. I think that the browser should list the GUI names rather than the
|
|||
|
|
format names.
|
|||
|
|
3. Must ensure that we can't delete Formats used by an existing
|
|||
|
|
Converter.
|
|||
|
|
|
|||
|
|
* src/support/filetools.[Ch] (DirList): new function. Not at all sure
|
|||
|
|
if this is the best way to do this.
|
|||
|
|
|
|||
|
|
2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
|
|||
|
|
|
|||
|
|
* lib/configure.m4 (latex_to_html_command): avoid spaces around =
|
|||
|
|
for variable assignment.
|
|||
|
|
|
|||
|
|
2000-11-07 Rob Lahaye <lahaye@postech.edu>
|
|||
|
|
|
|||
|
|
* src/lib/ui/default.ui: added sub/superscripts to menu as
|
|||
|
|
Insert->Special characters and cleaned-up the file a bit
|
|||
|
|
|
|||
|
|
2000-11-07 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (feedback): make sure
|
|||
|
|
ob isn't 0 before using it. See comments in function.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/form_*.C: regenerated
|
|||
|
|
|
|||
|
|
2000-11-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
|
|||
|
|
compiling with gcc-2.96
|
|||
|
|
|
|||
|
|
2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: add a couple "using" directives.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
|
|||
|
|
a .c_str() here too for good measure.
|
|||
|
|
* src/Spacing.C (set): ditto.
|
|||
|
|
* src/lyxfunc.C (Dispatch): ditto.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (copySelection): change .str() to
|
|||
|
|
.str().c_str() to fix problems with lyxstring.
|
|||
|
|
* src/support/filetools.C (GetFileContents): ditto.
|
|||
|
|
* src/buffer.C (asciiParagraph): ditto.
|
|||
|
|
* src/paragraph.C (String): ditto.
|
|||
|
|
|
|||
|
|
* lib/bind/fi_menus.bind: change symbol-insert to math-insert.
|
|||
|
|
* lib/bind/sciword.bind: ditto.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): remove "symbol-insert" function, which
|
|||
|
|
shared LFUN_INSERT_MATH with "math-insert".
|
|||
|
|
|
|||
|
|
* lib/configure.m4: == is not a valid operator for command test.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: add using directive.
|
|||
|
|
|
|||
|
|
* src/converter.h: add std:: qualifier.
|
|||
|
|
|
|||
|
|
2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.[Ch] and other files: Change the Format class to a
|
|||
|
|
real class, and create two instances: formats and system_format.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (output): Output the difference between formats and
|
|||
|
|
system_formats.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (input): Simplify.
|
|||
|
|
(buildFormats): Insert formats into browser.
|
|||
|
|
(inputFormats): Made the browser and add button functional.
|
|||
|
|
(applyFormats): Update formats from format_vec.
|
|||
|
|
|
|||
|
|
* src/converter.C: Changed all (*it). to it->
|
|||
|
|
(Format::dummy): New method.
|
|||
|
|
(Format::importer): New format flag.
|
|||
|
|
(Formats::GetAllFormats): New method.
|
|||
|
|
(Formats::Add): Delete format from the map if prettyname is empty.
|
|||
|
|
(Converter::Convert): Print an error message if moving the file fails.
|
|||
|
|
(Converter::GetReachableTo): New method
|
|||
|
|
|
|||
|
|
* src/MenuBackend.[Ch]: Add support for importformats tag.
|
|||
|
|
|
|||
|
|
* src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
|
|||
|
|
|
|||
|
|
* lib/configure.m4: Add word->tex and ps->fax converters.
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: Use ImportFormats on file->import menu.
|
|||
|
|
Return fax to file menu.
|
|||
|
|
|
|||
|
|
* NEWS: Updated.
|
|||
|
|
|
|||
|
|
2000-11-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
|
|||
|
|
(operator!): ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
|
|||
|
|
the use of FileInfo
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent): removed
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (emergencyWrite): removed the out commented
|
|||
|
|
emergency write code.
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_main.o): add dep for commandtags.h
|
|||
|
|
|
|||
|
|
* src/LyXView.[Ch]: remove the outcommented raw_callback code
|
|||
|
|
|
|||
|
|
* many files: change formatting to be a bit more uniform for
|
|||
|
|
if,while,for,switch statements, remove some parantesis not needed.
|
|||
|
|
|
|||
|
|
|
|||
|
|
2000-11-03 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* config/kde.m4: make config more robust when KDEDIR is set
|
|||
|
|
|
|||
|
|
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
|
|||
|
|
not returned a pixmap for "math-insert".
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): sort the entries a bit.
|
|||
|
|
|
|||
|
|
2000-11-03 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.h: added fixed number to update codes so
|
|||
|
|
that update is only in one direction.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (UpdateLocal): modified a bit don't think
|
|||
|
|
it matters.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (InsetButtonPress): set the_locking_inset
|
|||
|
|
before call to edit because of redraw.
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C (draw): fixed clearing too much.
|
|||
|
|
|
|||
|
|
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: Populate "edit_float" menu
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
|
|||
|
|
"floats-operate". The name is ugly (and the func also), but this
|
|||
|
|
is just a band-aid until we switch to new insets.
|
|||
|
|
|
|||
|
|
2000-11-03 Rob Lahaye <lahaye@postech.edu>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: update again the menu layout (fix some
|
|||
|
|
shortcuts).
|
|||
|
|
|
|||
|
|
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/MenuBackend.h (fulllabel): new method.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (checkShortcuts): new method. Checks whether
|
|||
|
|
the menu shortcuts of a menu are unique and whether they
|
|||
|
|
correspond to a letter of the label.
|
|||
|
|
(expand): call checkShortcuts when debugging.
|
|||
|
|
|
|||
|
|
2000-11-03 Andre Poenitz <poenitz@HTWM.De>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (InsetButtonPress): shut off warning.
|
|||
|
|
|
|||
|
|
2000-11-02 Lior Silberman <lior@Princeton.EDU>
|
|||
|
|
|
|||
|
|
* lib/examples/*.lyx : '\language default' => '\language english'
|
|||
|
|
|
|||
|
|
* lib/examples/it_splash.lyx : except where it should be italian
|
|||
|
|
|
|||
|
|
* lib/templates/*.lyx : the same
|
|||
|
|
|
|||
|
|
* doc/*.lyx* : the same
|
|||
|
|
|
|||
|
|
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/bind/menus.bind: remove the Layout menu entries, which I
|
|||
|
|
somehow forgot earlier.
|
|||
|
|
|
|||
|
|
2000-11-03 Rob Lahaye <lahaye@postech.edu>
|
|||
|
|
|
|||
|
|
* lib/ui/old-default.ui: keep the old one here for reference (to
|
|||
|
|
be deleted later).
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: update the menu layout
|
|||
|
|
|
|||
|
|
2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C: made use of ButtonController.
|
|||
|
|
Can now Apply to different insets without closing the dialog.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
|
|||
|
|
Can't actually DO anything with them yet, but I'd like a little
|
|||
|
|
feedback.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/input_validators.[ch]
|
|||
|
|
(fl_lowercase_filter): new.
|
|||
|
|
|
|||
|
|
2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
|
|||
|
|
of MATH_CODE. This fixes a bug with math-macros in RTL text.
|
|||
|
|
|
|||
|
|
* src/text.C (PrepareToPrint): Show math-macros block aligned.
|
|||
|
|
|
|||
|
|
2000-11-02 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
|
|||
|
|
on char insertion as it has already be updated by bv->updateInset().
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (UpdateInsetInInset): update the inset
|
|||
|
|
if an inset inside was updated.
|
|||
|
|
|
|||
|
|
* lib/configure.cmd: commented out fax-search code
|
|||
|
|
|
|||
|
|
2000-11-01 Yves Bastide <stid@acm.org>
|
|||
|
|
|
|||
|
|
* src/tabular.C (OldFormatRead): set tabular language to the
|
|||
|
|
document's one.
|
|||
|
|
|
|||
|
|
2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
|
|||
|
|
class names with non-letter characters (from Yves Bastide).
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: change Item to OptItem in import menu.
|
|||
|
|
Comment out fax stuff.
|
|||
|
|
|
|||
|
|
* lib/configure.m4: comment out fax-related stuff.
|
|||
|
|
|
|||
|
|
2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
|
|||
|
|
useful xforms helper functions. At present contains only formatted().
|
|||
|
|
Input a string and it returns it with line breaks so that in fits
|
|||
|
|
inside the label.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am: add new files.
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch] (getDescription): new name for getFeedback.
|
|||
|
|
* src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
|
|||
|
|
punctuation.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: No new functionality
|
|||
|
|
but lots of little clean ups. Removed enum State. Make use of
|
|||
|
|
formatted(). Constify lots of methods. Perhaps best of all: removed
|
|||
|
|
requirement for that horrible reinterpret_cast from pointer to long in
|
|||
|
|
feedbackPost().
|
|||
|
|
|
|||
|
|
2000-11-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
|
|||
|
|
conditionalize build on xforms < 0.89
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): commenout LFUN_FAX
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): comment out fax
|
|||
|
|
|
|||
|
|
* src/lyxrc.h: comment out the fax enums
|
|||
|
|
comment out the fax variables
|
|||
|
|
|
|||
|
|
* src/commandtags.h: comment out LFUN_FAX
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: disable fax variables.
|
|||
|
|
(read): disable parsing of fax variables
|
|||
|
|
(output): disable writing of fax variables
|
|||
|
|
(getFeedback): now description for fax variables
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: comment out MenuFax
|
|||
|
|
(Dispatch): disable LFUN_FAX
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuFax): comment out
|
|||
|
|
|
|||
|
|
* src/WorkArea.C: add <cctype>
|
|||
|
|
(work_area_handler): better key handling, should be ok now.
|
|||
|
|
for accented chars + etc
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
|
|||
|
|
lyx_sendfax.h and lyx_sendfax_man.C
|
|||
|
|
|
|||
|
|
* src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
|
|||
|
|
(show): don't call InitLyXLookup when using xforms 0.89
|
|||
|
|
|
|||
|
|
2000-11-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/trans.C (AddDeadkey): better fix, the other one could crash...
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (GetFileContents): close to dummy change
|
|||
|
|
|
|||
|
|
2000-10-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/trans.C (AddDeadkey): workaround stupid compilers.
|
|||
|
|
|
|||
|
|
2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (class_update): fix setting
|
|||
|
|
of two-sided document.
|
|||
|
|
|
|||
|
|
2000-10-31 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (ActivateCellInset): passed the wrong
|
|||
|
|
xposition to the Edit call.
|
|||
|
|
|
|||
|
|
2000-10-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/trans.C (AddDeadkey): cast explicitly to char.
|
|||
|
|
|
|||
|
|
2000-10-30 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/tabular.C (AsciiBottomHLine): simplify?
|
|||
|
|
(AsciiTopHLine): simplify?
|
|||
|
|
(print_n_chars): simplify
|
|||
|
|
(DocBook): remove most of the << endl; we should flush the stream
|
|||
|
|
as seldom as possible.
|
|||
|
|
(Latex): ditto
|
|||
|
|
(TeXBottomHLine): ditto
|
|||
|
|
(TeXTopHLine): ditto
|
|||
|
|
(Write): formatting
|
|||
|
|
(write_attribute): try a templified version.
|
|||
|
|
(set_row_column_number_info): lesson scope of variables
|
|||
|
|
|
|||
|
|
* src/support/lstrings.h (tostr): new specialization of tostr
|
|||
|
|
|
|||
|
|
* src/trans.C (AddDeadkey): slightly cleaner fix.
|
|||
|
|
|
|||
|
|
2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
|
|||
|
|
'%%' in Toc menu labels.
|
|||
|
|
(add_toc2): ditto
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (draw): Correct rendering when
|
|||
|
|
font_norm is iso10646-1.
|
|||
|
|
|
|||
|
|
* src/font.C (ascent): Fixed for 16bit fonts
|
|||
|
|
(descent,lbearing,rbearing): ditto
|
|||
|
|
|
|||
|
|
2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
|
|||
|
|
(getFeedback): new static method.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
|
|||
|
|
Now use combox rather than choice to display languages.
|
|||
|
|
Feedback is now output using a new timer callback mechanism, identical
|
|||
|
|
to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
|
|||
|
|
|
|||
|
|
2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/minibuffer.C: fix for older compilers
|
|||
|
|
|
|||
|
|
2000-10-30 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (InsertInset): fixed this as the cursor
|
|||
|
|
has to be Left of the inset otherwise LyXText won't find it!
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (open_new_inset): delete the inset if it can
|
|||
|
|
not be inserted.
|
|||
|
|
|
|||
|
|
2000-10-30 Rob Lahaye <lahaye@postech.edu>
|
|||
|
|
|
|||
|
|
* lyx.man: fix typo.
|
|||
|
|
|
|||
|
|
2000-10-29 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
* src/frontends/gnome/FormCitation.C
|
|||
|
|
* src/frontends/gnome/FormCitation.h
|
|||
|
|
* src/frontends/gnome/FormCopyright.C
|
|||
|
|
* src/frontends/gnome/FormCopyright.h
|
|||
|
|
* src/frontends/gnome/FormError.C
|
|||
|
|
* src/frontends/gnome/FormError.h
|
|||
|
|
* src/frontends/gnome/FormIndex.C
|
|||
|
|
* src/frontends/gnome/FormIndex.h
|
|||
|
|
* src/frontends/gnome/FormPrint.C
|
|||
|
|
* src/frontends/gnome/FormPrint.h
|
|||
|
|
* src/frontends/gnome/FormRef.C
|
|||
|
|
* src/frontends/gnome/FormRef.h
|
|||
|
|
* src/frontends/gnome/FormToc.C
|
|||
|
|
* src/frontends/gnome/FormToc.h
|
|||
|
|
* src/frontends/gnome/FormUrl.C
|
|||
|
|
* src/frontends/gnome/FormUrl.h
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.C
|
|||
|
|
* src/frontends/gnome/mainapp.C
|
|||
|
|
* src/frontends/gnome/mainapp.h
|
|||
|
|
* src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
|
|||
|
|
changing update() to updateSlot() where appropriate
|
|||
|
|
|
|||
|
|
2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: added a Languagues
|
|||
|
|
tab.
|
|||
|
|
|
|||
|
|
2000-10-28 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (draw): fixed drawing bug.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (clear):
|
|||
|
|
(Read):
|
|||
|
|
(SetParagraphData): clearing the TEXT buffers when deleting the
|
|||
|
|
paragraphs used by it.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
|
|||
|
|
|
|||
|
|
* src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
|
|||
|
|
|
|||
|
|
2000-10-27 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/tabular.C (~LyXTabular): removed not needed anymore.
|
|||
|
|
|
|||
|
|
* src/tabular.h: changed rowofcell and columnofcell to vector<int>
|
|||
|
|
(from Andre).
|
|||
|
|
|
|||
|
|
2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h: remove hideTabular signal as it is no
|
|||
|
|
longer used.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
|
|||
|
|
size.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: lots and lots!
|
|||
|
|
Reorganised as modules based on tabs. Much easier to follow the
|
|||
|
|
flow and to add new tabs. Added warning and feedback messages.
|
|||
|
|
Added new tabs.
|
|||
|
|
|
|||
|
|
2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/tabular.h (DocBook): add std:: qualifier.
|
|||
|
|
|
|||
|
|
2000-10-26 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
|
|||
|
|
|
|||
|
|
* src/buffer.h (SimpleDocBookOnePar): becomes public and const.
|
|||
|
|
* src/buffer.C (SimpleDocBookOnePar): this method goes const.
|
|||
|
|
|
|||
|
|
* insettabular.h
|
|||
|
|
* insettabular.C (DocBook): uses the tabular methods to export
|
|||
|
|
docbook
|
|||
|
|
|
|||
|
|
* src/insets/insettext.h
|
|||
|
|
* src/insets/insettext.C (DocBook): Implemented export for docbooc.
|
|||
|
|
|
|||
|
|
2000-10-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.h (operator<<): reinsert for State
|
|||
|
|
and SMInput
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (MenuNew): lessen the scope of fname
|
|||
|
|
moved misplaced AllowInput two lines up.
|
|||
|
|
|
|||
|
|
* src/buffer.C (readFile): compare float with float, not with int
|
|||
|
|
|
|||
|
|
2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/minibuffer.C: add "using SigC::slot" statement.
|
|||
|
|
|
|||
|
|
2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/README: updated section about make.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
|
|||
|
|
Tidied some forms up, made two of form_tabular's tabs more
|
|||
|
|
self-consistent, fixed Jean-Marc's size problem in form_preferences,
|
|||
|
|
fixed translation problem with "Column".
|
|||
|
|
|
|||
|
|
2000-10-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/minibuffer.h: use Timeout instead of the xforms timer
|
|||
|
|
object.
|
|||
|
|
(setTimer) rewrite for the Timeout, change to unsigned arg
|
|||
|
|
(set): change to unsigned timer arg
|
|||
|
|
(TimerCB): remove
|
|||
|
|
|
|||
|
|
* src/minibuffer.C (TimerCB): removed func
|
|||
|
|
(C_MiniBuffer_TimerCB): removed func
|
|||
|
|
(C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
|
|||
|
|
(peek_event): use a switch statement
|
|||
|
|
(add): don't use fl_add_timer.
|
|||
|
|
(Set): rewrite to use the Timeout
|
|||
|
|
(Init): ditto
|
|||
|
|
|
|||
|
|
* src/Timeout.[Ch] (setType): return a Timeout &
|
|||
|
|
(setTimeout): ditto, change to unsigned arg for timeout
|
|||
|
|
|
|||
|
|
2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (mathed_string_width): Use string instead
|
|||
|
|
of a constant size char array.
|
|||
|
|
|
|||
|
|
2000-10-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.h: remove the LOstream and remove
|
|||
|
|
the two recently added operator<< for SMInput and State.
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
|
|||
|
|
SMI_TOTAL to int.
|
|||
|
|
(OkCancelPolicy): ditto
|
|||
|
|
(OkCancelReadOnlyPolicy): ditto
|
|||
|
|
(NoRepeatedApplyReadOnlyPolicy): ditto
|
|||
|
|
(OkApplyCancelReadOnlyPolicy): ditto
|
|||
|
|
(OkApplyCancelPolicy): ditto
|
|||
|
|
(NoRepeatedApplyPolicy): ditto
|
|||
|
|
|
|||
|
|
2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
|
|||
|
|
add the usual std:: qualifiers.
|
|||
|
|
|
|||
|
|
2000-10-25 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/screen.C (ShowManualCursor): fixed another uint -> int problem.
|
|||
|
|
|
|||
|
|
2000-10-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (MakeRelPath): change some types to
|
|||
|
|
string::size_type
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.h (operator<<): new operator for
|
|||
|
|
ButtonPolicy::SMInput and ButtonPolicy::State.
|
|||
|
|
|
|||
|
|
* src/FontLoader.C (reset): small cleanup
|
|||
|
|
(unload): small cleanup
|
|||
|
|
|
|||
|
|
* src/FontInfo.C (getFontname): initialize error to 10000.0
|
|||
|
|
|
|||
|
|
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: added spell checker,
|
|||
|
|
TeX encoding and default paper size sections.
|
|||
|
|
|
|||
|
|
2000-10-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormTabularCreate.C: add missing #pragma
|
|||
|
|
implementation
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormError.C (disconnect): use erase() to
|
|||
|
|
make the message_ empty.
|
|||
|
|
(FormError): don't initialize message_ in initializer list.
|
|||
|
|
|
|||
|
|
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
|
|||
|
|
|
|||
|
|
2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/kbd/latvian.kmap: new file from Janne P<>nk<6E>l<EFBFBD> (epa@iki.fi)
|
|||
|
|
|
|||
|
|
2000-10-24 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/*data.[Ch]: _("") is not
|
|||
|
|
allowed
|
|||
|
|
|
|||
|
|
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/buffer.C: removed redundant using directive.
|
|||
|
|
|
|||
|
|
* src/frontends/DialogBase.h: revert to original definition of
|
|||
|
|
update().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
|
|||
|
|
stuff into two classes, one for each dialog, requires a new
|
|||
|
|
element in the dialogs vector, FormTabularCreate.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormXXX.[Ch] (update): revert to original
|
|||
|
|
definition.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
|
|||
|
|
method. Continues Allan's idea, but means that derived classes
|
|||
|
|
don't need to worry about "update or hide?".
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormError.C (showInset): add connection
|
|||
|
|
again ;-)
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormTabular.[Ch]: split into two classes,
|
|||
|
|
one for each dialog. FormTabular now contains main tabular dialog
|
|||
|
|
only.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormTabularCreate.[Ch]:
|
|||
|
|
* src/frontends/xforms/forms/form_tabular_create.fd: the create
|
|||
|
|
dialog.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormGraphics.[Ch]:
|
|||
|
|
* src/frontends/xforms/forms/form_graphics.fd
|
|||
|
|
* src/frontends/xforms/FormTabular.[Ch]:
|
|||
|
|
* src/frontends/xforms/forms/form_tabular.fd: made daughter
|
|||
|
|
classes of FormInset.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
|
|||
|
|
class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am:
|
|||
|
|
* src/frontends/xforms/forms/makefile: added new files.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.[Ch]: removed (Dialogs *) member
|
|||
|
|
variable. added Signal0 hide signal, in keeping with other GUI-I
|
|||
|
|
insets.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.h: removed redundant std:: qualifier as
|
|||
|
|
it's already declared in Lsstream.h.
|
|||
|
|
|
|||
|
|
2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
|
|||
|
|
open a new display.
|
|||
|
|
(runqueue): ditto.
|
|||
|
|
|
|||
|
|
2000-10-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/tabular.C (Ascii): minimize scope of cell.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (nextWord): return string() instead of 0;
|
|||
|
|
|
|||
|
|
2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/converter.h: add a std:: qualifier
|
|||
|
|
|
|||
|
|
2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/importer.[Ch]: New files. Used for importing files into LyX.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (doImport): Use the new Importer class.
|
|||
|
|
|
|||
|
|
* src/converter.h: Add shortcut member to the Format class.
|
|||
|
|
Used for holding the menu shortcut.
|
|||
|
|
|
|||
|
|
* src/converter.C and other files: Made a distinction between
|
|||
|
|
format name and format extension. New formats can be defined using
|
|||
|
|
the \format lyxrc tag.
|
|||
|
|
Added two new converter flags: latex and disable.
|
|||
|
|
|
|||
|
|
2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h: unify namespace/struct implementation.
|
|||
|
|
Remove extra declarations.
|
|||
|
|
|
|||
|
|
* src/support/chdir.C (chdir): remove version taking char const *
|
|||
|
|
argument.
|
|||
|
|
* src/support/rename.C: ditto.
|
|||
|
|
* src/support/lyxsum.C: ditto.
|
|||
|
|
|
|||
|
|
2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
|
|||
|
|
read the xforms manual to discover that fl_set_form_minsize()/maxsize()
|
|||
|
|
work only for the next call to fl_show_form(). The correct place to set
|
|||
|
|
them, therefore is in connect() immediately BEFORE fl_show_form(). Now
|
|||
|
|
done. FormBase also stores minw_, minh_ itself. All dialogs derived
|
|||
|
|
from FormBase have the minimum size set; no more stupid crashes with
|
|||
|
|
tabbed folders etc.
|
|||
|
|
|
|||
|
|
2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: fix shortcut for Insert->Include File.
|
|||
|
|
|
|||
|
|
2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h: changed second argument of mkdir to
|
|||
|
|
unsigned long int (unsigned int would probably have been enough,
|
|||
|
|
but...). Removed <sys/types.h> header.
|
|||
|
|
* src/support/mkdir.C (mkdir): ditto.
|
|||
|
|
|
|||
|
|
* NEWS: update.
|
|||
|
|
|
|||
|
|
2000-10-19 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (MenuNew): small fix (form John)
|
|||
|
|
|
|||
|
|
* src/screen.C (Update): removed unneeded code.
|
|||
|
|
|
|||
|
|
* src/tabular.C (Ascii): refixed int != uint bug!
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h: added sys/types.h include for now permits
|
|||
|
|
compiling, but I don't like this!
|
|||
|
|
|
|||
|
|
2000-10-18 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/text2.C (ClearSelection): if we clear the selection we need
|
|||
|
|
more refresh so set the status apropriately
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (draw): hopefully finally fixed draw
|
|||
|
|
problems!
|
|||
|
|
|
|||
|
|
2000-10-12 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (draw): another small fix and make a block
|
|||
|
|
so that variables are localized.
|
|||
|
|
|
|||
|
|
2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (lowercase, uppercase):
|
|||
|
|
use explicit casts to remove compiler warnings.
|
|||
|
|
|
|||
|
|
* src/support/LRegex.C (Impl):
|
|||
|
|
* src/support/StrPool.C (add):
|
|||
|
|
* src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
|
|||
|
|
(AddPath, MakeDisplayPath):
|
|||
|
|
* src/support/lstrings.C (prefixIs, subst):
|
|||
|
|
use correct type to remove compiler warnings.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.[Ch] (countChar): returns string::size_type.
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h:
|
|||
|
|
* src/support/mkdir.C (mkdir): change parameter to mode_t for
|
|||
|
|
portability and to remove compiler warning with DEC cxx.
|
|||
|
|
|
|||
|
|
* src/support/FileInfo.[Ch] (flagRWX): ditto.
|
|||
|
|
|
|||
|
|
2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/minibuffer.C (peek_event): retun 1 when there has been a
|
|||
|
|
mouseclick in the minibuffer.
|
|||
|
|
|
|||
|
|
* NEWS: updated.
|
|||
|
|
|
|||
|
|
2000-10-17 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormParagraph.C: more space above/below
|
|||
|
|
fixes
|
|||
|
|
|
|||
|
|
2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): Call to showState() after insertion of
|
|||
|
|
a char only if real_current_font was changed.
|
|||
|
|
|
|||
|
|
2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* NEWS: update somewhat for 1.1.6
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: clean up.
|
|||
|
|
|
|||
|
|
2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* lib/CREDITS: clean up
|
|||
|
|
|
|||
|
|
2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/combox.[Ch] (select): changed argument back to int
|
|||
|
|
* src/combox.C (peek_event): removed num_bytes as it is declared but
|
|||
|
|
never referenced.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
|
|||
|
|
modified calls to Combox::select() to remove warnings about type
|
|||
|
|
conversion.
|
|||
|
|
|
|||
|
|
* src/insets/insetbutton.C (width): explicit cast to remove warning
|
|||
|
|
about type conversion.
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.C (getScreenLabel): use string::size_type not
|
|||
|
|
size_t.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
|
|||
|
|
sel_pos_end, refering to cursor position are changed to
|
|||
|
|
LyXParagraph::size_type.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
|
|||
|
|
consistent with LyXCursor::pos().
|
|||
|
|
(inset_pos): changed to LyXParagraph::size_type for same reason.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (resizeLyXText): changed some temporary
|
|||
|
|
variables refing to cursor position to LyXParagraph::size_type.
|
|||
|
|
|
|||
|
|
2000-10-16 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/<various>: The Great Renaming,
|
|||
|
|
add FormParagraph
|
|||
|
|
|
|||
|
|
2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
|
|||
|
|
|
|||
|
|
2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/math_macro.C (MathMacroTemplate): initialize args to
|
|||
|
|
0 when there are no arguments.
|
|||
|
|
|
|||
|
|
2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C: re-introduce current_view as a temporary fix
|
|||
|
|
to segfaults when pressing Ok in InsetBibtex dialog.
|
|||
|
|
|
|||
|
|
2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* forms/layout_forms.fd:
|
|||
|
|
* src/layout_forms.C (create_form_form_character): small change to use
|
|||
|
|
labelframe rather than engraved frame + text
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): initialise choice_language with some
|
|||
|
|
arbitrary value to prevent segfault when dialog is shown.
|
|||
|
|
|
|||
|
|
2000-10-16 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/converter.C (runLaTeX, scanLog): Added a warning when there
|
|||
|
|
is no resulting file. This pertains only to LaTeX output.
|
|||
|
|
|
|||
|
|
2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/text.C (Backspace): Make sure that the row of the cursor is
|
|||
|
|
rebreaked.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): Call to showState() after insertion of
|
|||
|
|
a char.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (init): Prevent a crash when only one font from
|
|||
|
|
menu/popup fonts is not found.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Add an example for binding a key for language
|
|||
|
|
switching.
|
|||
|
|
|
|||
|
|
2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.C (GetReachable): Changed the returned type to
|
|||
|
|
vector<FormatPair>
|
|||
|
|
(IsReachable): New method
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (expand): Handle formats that appear more
|
|||
|
|
than once
|
|||
|
|
|
|||
|
|
2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/support/Makefile.am
|
|||
|
|
(libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
|
|||
|
|
not in SOURCES.
|
|||
|
|
|
|||
|
|
* lib/CREDITS: add Garst Reese.
|
|||
|
|
|
|||
|
|
* src/support/snprintf.h: add extern "C" {} around the definitions.
|
|||
|
|
|
|||
|
|
* src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
|
|||
|
|
|
|||
|
|
2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/combox.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormDocument.C:
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C: small changes so that they
|
|||
|
|
compile without "conversion to integral type of smaller size"
|
|||
|
|
warnings.
|
|||
|
|
|
|||
|
|
2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/text.C (GetColumnNearX): Fixed disabled code.
|
|||
|
|
|
|||
|
|
2000-10-13 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* configure.in (CPPFLAGS): add snprintf and vsnprintf to
|
|||
|
|
AC_CHECK_FUNCS
|
|||
|
|
|
|||
|
|
* src/support/snprintf.[ch]: new files
|
|||
|
|
|
|||
|
|
2000-10-13 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/formprintdialog.C: add
|
|||
|
|
file browser for selecting postscript output
|
|||
|
|
|
|||
|
|
* src/frontends/kde/formprintdialogdata.C:
|
|||
|
|
* src/frontends/kde/formprintdialogdata.h: re-generate
|
|||
|
|
correctly
|
|||
|
|
|
|||
|
|
2000-10-13 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Makefile.am:
|
|||
|
|
* src/frontends/kde/Makefile.am: FormCommand.C
|
|||
|
|
disappeared from xforms
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormCitation.C:
|
|||
|
|
* src/frontends/kde/FormIndex.C: read-only
|
|||
|
|
correctness
|
|||
|
|
|
|||
|
|
2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/lyxfunctional.h (void_class_fun_t): fix name of
|
|||
|
|
constructor.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C: add using directive.
|
|||
|
|
|
|||
|
|
2000-10-13 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxfunctional.h: version of class_fun for void
|
|||
|
|
returns added, const versions of back_inseter_fun and compare_fun
|
|||
|
|
added.
|
|||
|
|
|
|||
|
|
2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormInset.C (showInset): fix typo.
|
|||
|
|
|
|||
|
|
2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* ChangeLog: cleanup.
|
|||
|
|
|
|||
|
|
* lib/CREDITS: update to add all the contributors we've forgotten.
|
|||
|
|
I have obviously missed some, so tell me whether there were
|
|||
|
|
errors.
|
|||
|
|
|
|||
|
|
2000-10-13 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/FormCitation.C
|
|||
|
|
* src/frontends/gnome/FormCitation.h
|
|||
|
|
* src/frontends/gnome/FormError.C
|
|||
|
|
* src/frontends/gnome/FormIndex.C
|
|||
|
|
* src/frontends/gnome/FormRef.C
|
|||
|
|
* src/frontends/gnome/FormRef.h
|
|||
|
|
* src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/FormCitation.C
|
|||
|
|
* src/frontends/gnome/FormCopyright.C
|
|||
|
|
* src/frontends/gnome/FormError.C
|
|||
|
|
* src/frontends/gnome/FormIndex.C
|
|||
|
|
* src/frontends/gnome/FormRef.C
|
|||
|
|
* src/frontends/gnome/FormToc.C
|
|||
|
|
* src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
|
|||
|
|
appropriate.
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.C
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
|
|||
|
|
fill the menus.
|
|||
|
|
|
|||
|
|
2000-10-11 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/minibuffer.h:
|
|||
|
|
* src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
|
|||
|
|
to convey its real action.
|
|||
|
|
|
|||
|
|
* src/minibuffer.C (peek_event): Added action when mouse clicks to
|
|||
|
|
clear the minibuffer and prepare to enter a command.
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (LocalDispatch): Changed to conform with
|
|||
|
|
the rename from ExecCommand to PrepareForCommand.
|
|||
|
|
* src/lyxfunc.C (Dispatch): ditto.
|
|||
|
|
|
|||
|
|
2000-10-11 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFile): Added test for errors on writing, this
|
|||
|
|
catches all errors and not only file system full errors as intended.
|
|||
|
|
|
|||
|
|
2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): better fix for crash with
|
|||
|
|
translated interface.
|
|||
|
|
|
|||
|
|
2000-10-12 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am:
|
|||
|
|
* src/frontends/kde/FormCopyright.C:
|
|||
|
|
* src/frontends/kde/formcopyrightdialog.C:
|
|||
|
|
* src/frontends/kde/formcopyrightdialog.h:
|
|||
|
|
* src/frontends/kde/formcopyrightdialogdata.C:
|
|||
|
|
* src/frontends/kde/formcopyrightdialogdata.h:
|
|||
|
|
* src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
|
|||
|
|
* src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
|
|||
|
|
copyright to use qtarch
|
|||
|
|
|
|||
|
|
2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/encoding.C (read): Fixed bug that caused an error message at
|
|||
|
|
the end of the file.
|
|||
|
|
|
|||
|
|
* po/Makefile.in.in: Fixed rule for ext_l10n.h
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Fixed hebrew example.
|
|||
|
|
|
|||
|
|
2000-10-13 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (input): reworking the
|
|||
|
|
checking
|
|||
|
|
(build, update, apply): New inputs in various tabfolders
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormToc.C: use new button policy.
|
|||
|
|
* src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
|
|||
|
|
dialogs that either can't use any existing policy or where it just
|
|||
|
|
doesn't care.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormTabular.h: removed copyright notice that
|
|||
|
|
said it was mine.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
|
|||
|
|
added a bool parameter which is ignored.
|
|||
|
|
|
|||
|
|
* src/buffer.C (setReadonly):
|
|||
|
|
* src/BufferView_pimpl.C (buffer):
|
|||
|
|
* src/frontends/kde/FormCopyright.h (update):
|
|||
|
|
* src/frontends/kde/FormCitation.[Ch] (update):
|
|||
|
|
* src/frontends/kde/FormIndex.[Ch] (update):
|
|||
|
|
* src/frontends/kde/FormPrint.[Ch] (update):
|
|||
|
|
* src/frontends/kde/FormRef.[Ch] (update):
|
|||
|
|
* src/frontends/kde/FormToc.[Ch] (update):
|
|||
|
|
* src/frontends/kde/FormUrl.[Ch] (update):
|
|||
|
|
* src/frontends/gnome/FormCopyright.h (update):
|
|||
|
|
* src/frontends/gnome/FormCitation.[Ch] (update):
|
|||
|
|
* src/frontends/gnome/FormError.[Ch] (update):
|
|||
|
|
* src/frontends/gnome/FormIndex.[Ch] (update):
|
|||
|
|
* src/frontends/gnome/FormPrint.[Ch] (update):
|
|||
|
|
* src/frontends/gnome/FormRef.h (update):
|
|||
|
|
* src/frontends/gnome/FormToc.[Ch] (update):
|
|||
|
|
* src/frontends/gnome/FormUrl.[Ch] (update):
|
|||
|
|
* src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
|
|||
|
|
to updateBufferDependent and DialogBase
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.[hC]:
|
|||
|
|
* src/frontends/xforms/FormDocument.[hC]: also removed restore()
|
|||
|
|
* src/frontends/xforms/FormError.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormGraphics.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormIndex.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
|
|||
|
|
and fixed readOnly handling.
|
|||
|
|
* src/frontends/xforms/FormPrint.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormRef.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormTabular.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormToc.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormUrl.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormInset.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormBase.[hC]: modifications to use the new
|
|||
|
|
form of updateBufferDependent.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.C (hide): only call disconnect()
|
|||
|
|
if form()->visible just in case someone does stuff to the form in a
|
|||
|
|
derived class.
|
|||
|
|
|
|||
|
|
* src/frontends/DialogBase.h (enum): removed enum since we can now use
|
|||
|
|
the buttoncontroller for everything the enum used to be used for.
|
|||
|
|
(update) It would seem we need to force all dialogs to use a bool
|
|||
|
|
parameter or have two update functions. I chose to go with one.
|
|||
|
|
I did try removing update() from here and FormBase and defining the
|
|||
|
|
appropriate update signatures in FormBaseB[DI] but then ran into the
|
|||
|
|
problem of the update() call in FormBase::show(). Whatever I did
|
|||
|
|
to get around that would require another function and that just
|
|||
|
|
got more confusing. Hence the decision to make everyone have an
|
|||
|
|
update(bool). An alternative might have been to override show() in
|
|||
|
|
FormBaseB[DI] and that would allow the different and appropriate
|
|||
|
|
update signatures.
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
|
|||
|
|
true == buffer change occurred. I decided against using a default
|
|||
|
|
template parameter since not all compilers support that at present.
|
|||
|
|
|
|||
|
|
2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
|
|||
|
|
army knife" by removing functionality.
|
|||
|
|
(clearStore): removed. All such housekeeping on hide()ing the dialog
|
|||
|
|
is to be carried out by overloaded disconnect() methods.
|
|||
|
|
(dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
|
|||
|
|
superceded by Baruch's neat test (FormGraphics) to update an existing
|
|||
|
|
dialog if a new signal is recieved rather than block all new signals
|
|||
|
|
until it is closed.
|
|||
|
|
(cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
|
|||
|
|
only to Inset dialogs.
|
|||
|
|
(FormBaseBI, FormBaseBD): new classes derived from FormBase for
|
|||
|
|
"Buffer Independent" and "Buffer Dependent" dialogs respectively.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
|
|||
|
|
as a base class to all inset dialogs. Used solely to connect/disconnect
|
|||
|
|
the Inset::hide signal and to define what action to take on receipt of
|
|||
|
|
a UpdateBufferDependent signal.
|
|||
|
|
(FormCommand): now derived from FormInset.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
|
|||
|
|
disconnect().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
now derived from FormBaseBI.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormParagraph.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormPrint.[Ch]:
|
|||
|
|
now derived from FormBaseBD.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormError.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormRef.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormToc.[Ch]:
|
|||
|
|
(clearStore): reworked as disconnect().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
|
|||
|
|
FormInset.[Ch].
|
|||
|
|
|
|||
|
|
2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/converter.C (runLaTeX): constify buffer argument
|
|||
|
|
(scanLog): ditto.
|
|||
|
|
|
|||
|
|
* src/frontends/support/Makefile.am (INCLUDES): fix.
|
|||
|
|
|
|||
|
|
* src/buffer.h: add std:: qualifier
|
|||
|
|
* src/insets/figinset.C (addpidwait): ditto
|
|||
|
|
* src/MenuBackend.C: ditto
|
|||
|
|
* src/buffer.C: ditto
|
|||
|
|
* src/bufferlist.C: ditto
|
|||
|
|
* src/layout.C: ditto
|
|||
|
|
* src/lyxfunc.C: ditto
|
|||
|
|
|
|||
|
|
2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxtext.h (bidi_level): change return type to
|
|||
|
|
LyXParagraph::size_type.
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: change size_type to
|
|||
|
|
TextContainer::difference_type. This should really be
|
|||
|
|
TextContainer::size_type, but we need currently to support signed
|
|||
|
|
values.
|
|||
|
|
|
|||
|
|
2000-10-11 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
* src/frontends/gnome/FormError.h
|
|||
|
|
* src/frontends/gnome/FormRef.C
|
|||
|
|
* src/frontends/gnome/FormRef.h
|
|||
|
|
* src/frontends/gnome/FormError.C
|
|||
|
|
* src/frontends/gnome/Makefile.am
|
|||
|
|
* src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
|
|||
|
|
to Gnome frontend. Both dialogs use "action" area.
|
|||
|
|
|
|||
|
|
2000-10-12 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCacheItem_pimpl.C:
|
|||
|
|
* src/graphics/Renderer.C:
|
|||
|
|
* src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
|
|||
|
|
It now compiles.
|
|||
|
|
|
|||
|
|
2000-10-12 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (draw): fixed drawing bug (specifically
|
|||
|
|
visible when selecting).
|
|||
|
|
|
|||
|
|
* development/Code_rules/Rules: fixed some typos.
|
|||
|
|
|
|||
|
|
2000-10-09 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/filedlg.C (GroupCache::find): de-inlined the function, makes
|
|||
|
|
compiling on egcs 1.1.2 possible.
|
|||
|
|
|
|||
|
|
* src/filedlg.C (comp_direntry::operator() ): ditto.
|
|||
|
|
|
|||
|
|
2000-08-31 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
|
|||
|
|
Buffer parameter.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormGraphics.C: Changed the dialog to be
|
|||
|
|
transient it now only gets freed when the object is destructed.
|
|||
|
|
|
|||
|
|
2000-08-24 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/frontends/FormGraphics.h:
|
|||
|
|
* src/frontends/FormGraphics.C: Changed to use ButtonController and
|
|||
|
|
ButtonPolicies.
|
|||
|
|
|
|||
|
|
2000-08-20 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.C:
|
|||
|
|
(draw): Added messages to the drawn rectangle to report status.
|
|||
|
|
(updateInset): Disabled the use of the inline graphics,
|
|||
|
|
(draw): ditto.
|
|||
|
|
|
|||
|
|
2000-08-17 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/frontends/support: Directory added for the support of GUII LyX.
|
|||
|
|
|
|||
|
|
* src/frontends/support/LyXImage.h:
|
|||
|
|
* src/frontends/support/LyXImage.C: Base class for GUII holding of
|
|||
|
|
images.
|
|||
|
|
|
|||
|
|
* src/frontends/support/LyXImage_X.h:
|
|||
|
|
* src/frontends/support/LyXImage_X.C: Implementation of the Xlib
|
|||
|
|
version of LyXImage, this uses the Xlib Pixmap.
|
|||
|
|
|
|||
|
|
* src/PainterBase.h:
|
|||
|
|
* src/PainterBase.C:
|
|||
|
|
* src/Painter.h:
|
|||
|
|
* src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
|
|||
|
|
replacement to Pixmap.
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.h:
|
|||
|
|
* src/insets/insetgraphics.C:
|
|||
|
|
* src/graphics/GraphicsCacheItem.h:
|
|||
|
|
* src/graphics/GraphicsCacheItem.C:
|
|||
|
|
* src/graphics/GraphicsCacheItem_pimpl.h:
|
|||
|
|
* src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
|
|||
|
|
instead of Pixmap.
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCacheItem.h:
|
|||
|
|
* src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
|
|||
|
|
another copy of the object.
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.C (Clone): Changed to create a second copy
|
|||
|
|
of cacheHandle, this fixed a bug that sent LyX crashing.
|
|||
|
|
|
|||
|
|
* src/graphics/XPM_Renderer.h:
|
|||
|
|
* src/graphics/XPM_Renderer.C:
|
|||
|
|
* src/graphics/EPS_Renderer.h:
|
|||
|
|
* src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
|
|||
|
|
|
|||
|
|
2000-10-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeySym): only handle the
|
|||
|
|
lockinginset/inset stuff if we have a buffer and text loaded...
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (EXTRA_DIST): add encodings and languages
|
|||
|
|
|
|||
|
|
2000-10-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxfunctional.h: add operator= that takes a reference
|
|||
|
|
|
|||
|
|
* src/lyxserver.C (mkfifo): make first arg const
|
|||
|
|
|
|||
|
|
* src/layout.h: renamed name(...) to setName(...) to work around
|
|||
|
|
bugs in egcs.
|
|||
|
|
|
|||
|
|
* src/buffer.C (setFileName): had to change name of function to
|
|||
|
|
work around bugs in egcs. (renamed from fileName)
|
|||
|
|
|
|||
|
|
2000-10-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/translator.h: move helper template classes to
|
|||
|
|
lyxfunctional.h, include "support/lyxfunctional.h"
|
|||
|
|
|
|||
|
|
* src/support/lyxmanip.h: add delaration of fmt
|
|||
|
|
|
|||
|
|
* src/support/lyxfunctional.h: new file
|
|||
|
|
(class_fun_t): new template class
|
|||
|
|
(class_fun): helper template function
|
|||
|
|
(back_insert_fun_iterator): new template class
|
|||
|
|
(back_inserter_fun): helper template function
|
|||
|
|
(compare_memfun_t): new template class
|
|||
|
|
(compare_memfun): helper template function
|
|||
|
|
(equal_1st_in_pair): moved here from translator
|
|||
|
|
(equal_2nd_in_pair): moved here from translator
|
|||
|
|
|
|||
|
|
* src/support/fmt.C: new file
|
|||
|
|
(fmt): new func, can be used for a printf substitute when still
|
|||
|
|
using iostreams ex. lyxerr << fmt("Hello %s", "J<>rgen") << endl;
|
|||
|
|
|
|||
|
|
* src/support/StrPool.C: add some comments
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
|
|||
|
|
lyxfunctional.h
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (addpidwait): use std::copy with
|
|||
|
|
ostream_iterator to fill the pidwaitlist
|
|||
|
|
|
|||
|
|
* src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
|
|||
|
|
c_str()
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C: make several file scope
|
|||
|
|
variables static
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (build): remove c_str()
|
|||
|
|
(class_update): ditto
|
|||
|
|
(BulletPanel): ditto
|
|||
|
|
(CheckChoiceClass): move initialization of tc and tct
|
|||
|
|
|
|||
|
|
* src/tabular.C: remove current_view
|
|||
|
|
(OldFormatRead): similar to right below [istream::ignore]
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.C (next): add code for faster skipping of
|
|||
|
|
chars, unfortunately this is buggy on gcc 2.95.2, so currently
|
|||
|
|
unused [istream::ignore]
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: include "support/lyxfunctional.h"
|
|||
|
|
(getInsetByCode): use std::find_if and compare_memfun
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (stateText): remove c_str()
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (setDebuggingLevel): make static
|
|||
|
|
(commandLineHelp): make static
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
|
|||
|
|
Screen* together with fl_get_display() and fl_screen
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
|
|||
|
|
togheter with fl_get_display() and fl_screen
|
|||
|
|
(create_forms): remove c_str()
|
|||
|
|
|
|||
|
|
* src/layout.C: include "support/lyxfunctional.h"
|
|||
|
|
(hasLayout): use std::find_if and compare_memfun
|
|||
|
|
(GetLayout): use std::find_if and comapre_memfun
|
|||
|
|
(delete_layout): use std::remove_if and compare_memfun
|
|||
|
|
(NumberOfClass): use std:.find_if and compare_memfun
|
|||
|
|
|
|||
|
|
* src/gettext.h: change for the new functions
|
|||
|
|
|
|||
|
|
* src/gettext.C: new file, make _(char const * str) and _(string
|
|||
|
|
const & str) real functions.
|
|||
|
|
|
|||
|
|
* src/font.C (width): rewrite slightly to avoid one extra variable
|
|||
|
|
|
|||
|
|
* src/debug.C: initialize Debug::ANY here
|
|||
|
|
|
|||
|
|
* src/commandtags.h: update number comments
|
|||
|
|
|
|||
|
|
* src/combox.h (get): make const func
|
|||
|
|
(empty): make const
|
|||
|
|
(getline): make const
|
|||
|
|
|
|||
|
|
* src/combox.C (input_cb): handle case where fl_get_input can
|
|||
|
|
return NULL
|
|||
|
|
|
|||
|
|
* src/bufferlist.C: add <functional>, "support/lyxmanip.h",
|
|||
|
|
"support/lyxfunctional.h", remove current_view variable.
|
|||
|
|
(resize): use std::for_each with std::mem_fun
|
|||
|
|
(getFileNames): use std::copy with back_inserter_fun
|
|||
|
|
(getBuffer): change arg type to unsigned int
|
|||
|
|
(emergencyWriteAll): call emergencyWrite with std::for_each and
|
|||
|
|
class_fun.
|
|||
|
|
(emergencyWrite): new method, the for loop in emergencyWriteAll
|
|||
|
|
has been unrolled.
|
|||
|
|
(exists): use std::find_if with compare_memfun
|
|||
|
|
(getBuffer): use std::find_if and compare_memfun
|
|||
|
|
|
|||
|
|
* src/buffer.h: add typedefs for iterator_category, value_type
|
|||
|
|
difference_type, pointer and reference for inset_iterator
|
|||
|
|
add postfix ++ for inset_iterator
|
|||
|
|
make inset_iterator::getPos() const
|
|||
|
|
|
|||
|
|
* src/buffer.C: added support/lyxmanip.h
|
|||
|
|
(readFile): use lyxerr << fmt instead of printf
|
|||
|
|
(makeLaTeXFile): use std::copy to write out encodings
|
|||
|
|
|
|||
|
|
* src/Painter.C (text): rewrite slightly to avoid extra font variable
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (read): remove c_str(), as well as strdup and
|
|||
|
|
free and the char * temp.
|
|||
|
|
(hasMenu): use std::find_if and compare_memfun
|
|||
|
|
(getMenu): ditto
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): added gettext.C
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (retrieveActionArg): clear the arg, use
|
|||
|
|
string::insert small change to avoid temporary
|
|||
|
|
|
|||
|
|
* src/LColor.C (getGUIName): remove c_str()
|
|||
|
|
|
|||
|
|
* several files: change all occurrences of fl_display to
|
|||
|
|
fl_get_display()
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
|
|||
|
|
that -pedantic is not used for gcc 2.97 (cvs gcc)
|
|||
|
|
|
|||
|
|
* boost/Makefile.am: begin slowly to prepare for a real boost lib
|
|||
|
|
|
|||
|
|
2000-10-11 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (input): template path must be
|
|||
|
|
a readable directory. It doesn't need to be writeable.
|
|||
|
|
(build, delete, update, apply): New inputs in the various tabfolders
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd:
|
|||
|
|
* src/frontends/xforms/FormPreferences.h: New tabfolder and added
|
|||
|
|
several new entries to existing folders. Shuffled some existing stuff
|
|||
|
|
around.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_print.fd:
|
|||
|
|
* src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
|
|||
|
|
Should probably rework PrinterParams as well. Note that the switch to
|
|||
|
|
collated is effectively the same as !unsorted so changing PrinterParams
|
|||
|
|
will require a lot of fiddly changes to reverse the existing logic.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
|
|||
|
|
|
|||
|
|
2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
|
|||
|
|
|
|||
|
|
2000-10-10 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch]:
|
|||
|
|
* src/lyxfunc.C (Dispatch):
|
|||
|
|
* src/lyx_gui.C:
|
|||
|
|
* src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
|
|||
|
|
member of LyXRC
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (output): Only write the differences between system lyxrc
|
|||
|
|
and the users settings.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C:
|
|||
|
|
* src/lyxrc.[Ch]: commented out noncopyable so I can keep a
|
|||
|
|
system_lyxrc.
|
|||
|
|
I'll rewrite this later, after 1.1.6 probably, to keep a single
|
|||
|
|
LyXRC but two instances of a LyXRCStruct.
|
|||
|
|
|
|||
|
|
2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (pkgdata_DATA): add encoding and languages
|
|||
|
|
|
|||
|
|
* src/tabular.h: add a few std:: qualifiers.
|
|||
|
|
|
|||
|
|
* src/encoding.C: add using directive.
|
|||
|
|
* src/language.C: ditto.
|
|||
|
|
|
|||
|
|
* src/insets/insetquotes.C (Validate): use languages->lang()
|
|||
|
|
instead of only language.
|
|||
|
|
|
|||
|
|
2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/languages: New file.
|
|||
|
|
|
|||
|
|
* lib/encodings: New file.
|
|||
|
|
|
|||
|
|
* src/language.C (Languages): New class.
|
|||
|
|
(read): New method. Reads the languages from the 'languages' file.
|
|||
|
|
|
|||
|
|
* src/encoding.C (Encodings): New class.
|
|||
|
|
(read): New method. Reads the encodings from the 'encodings' file.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init): Call to LyXSetStyle() after languages
|
|||
|
|
initialization.
|
|||
|
|
|
|||
|
|
* src/bufferparams.h and a lot of files: Deleted the member language,
|
|||
|
|
and renamed language_info to language
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
|
|||
|
|
* src/lyxfont.C (latexWriteStartChanges): ditto.
|
|||
|
|
* src/paragraph.C (validate,TeXOnePar): ditto.
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (update): Restored deleted code.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (build): Made the combox taller
|
|||
|
|
|
|||
|
|
2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (buffer): cleaned up a little.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.[Ch]:
|
|||
|
|
* src/insets/insetinclude.[Ch]:
|
|||
|
|
* src/insets/insetinclude.[Ch]:
|
|||
|
|
* src/insets/insetparent.[Ch]:
|
|||
|
|
* src/insets/insetref.[Ch]:
|
|||
|
|
* src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
|
|||
|
|
|
|||
|
|
* src/insets/*.[Ch]:
|
|||
|
|
* src/mathed/formula.[Ch]:
|
|||
|
|
* src/mathed/formulamacro.C (Clone): passed Buffer const &.
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token, readInset):
|
|||
|
|
* src/lyx_cb.C (FigureApplyCB):
|
|||
|
|
* src/lyxfunc.C (getStatus, Dispatch):
|
|||
|
|
* src/frontends/xforms/FormTabular.C: use modified c-tors to some
|
|||
|
|
insets.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
|
|||
|
|
|
|||
|
|
* src/converter.[Ch] (Formats::View):
|
|||
|
|
* src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
|
|||
|
|
*current_view->buffer(). This will change later, but this patch is way
|
|||
|
|
big enough already!
|
|||
|
|
|
|||
|
|
2000-10-09 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/text.C (GetRow): small fix.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (cursorPrevious):
|
|||
|
|
(cursorNext): added LyXText parameter to function.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (LocalDispatch): activate cell inset on
|
|||
|
|
keypress depending on cursor position.
|
|||
|
|
|
|||
|
|
2000-10-06 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (Ascii): finally call right ascii-function.
|
|||
|
|
(copySelection): redone this function and also copy ascii representa-
|
|||
|
|
tion to clipboard.
|
|||
|
|
|
|||
|
|
* src/tabular.C (Ascii):
|
|||
|
|
(AsciiPrintCell):
|
|||
|
|
(AsciiBottomHLine):
|
|||
|
|
(AsciiTopHLine):
|
|||
|
|
(print_n_chars): new functions to realize the ascii export of tabulars.
|
|||
|
|
|
|||
|
|
2000-10-05 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
|
|||
|
|
if we don't have a buffer.
|
|||
|
|
|
|||
|
|
2000-10-10 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
|
|||
|
|
with closing dialog. It seems that nested tabfolders require hiding
|
|||
|
|
of inner tabfolders before hiding the dialog itself. Actually all I
|
|||
|
|
did was hide the active outer folder.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
|
|||
|
|
unless there really is a buffer. hideBufferDependent is called
|
|||
|
|
instead.
|
|||
|
|
|
|||
|
|
* po/Makefile.in.in (POTFILES.in): one little tweak to ensure
|
|||
|
|
POTFILES.in stays in $(srcdir).
|
|||
|
|
|
|||
|
|
2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Few changes.
|
|||
|
|
|
|||
|
|
2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (buffer): only need one the
|
|||
|
|
updateBufferDependent signal to be emitted once! Moved to the end of
|
|||
|
|
the method to allow bv_->text to be updated first.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
|
|||
|
|
and hSignal_ with Dialogs * and BufferDependency variables.
|
|||
|
|
New Buffer * parent_, initialised when the dialog is launched. Used to
|
|||
|
|
check whether to update() or hide() dialog in the new, private
|
|||
|
|
updateOrHide() method that is connected to the updateBufferDependent
|
|||
|
|
signal. Daughter classes dictate what to do using the
|
|||
|
|
ChangedBufferAction enum, passed to the c-tor.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C:
|
|||
|
|
* src/frontends/xforms/FormCommand.C:
|
|||
|
|
* src/frontends/xforms/FormCopyright.C:
|
|||
|
|
* src/frontends/xforms/FormDocument.C:
|
|||
|
|
* src/frontends/xforms/FormError.C:
|
|||
|
|
* src/frontends/xforms/FormIndex.C:
|
|||
|
|
* src/frontends/xforms/FormPreferences.C:
|
|||
|
|
* src/frontends/xforms/FormPrint.C:
|
|||
|
|
* src/frontends/xforms/FormRef.C:
|
|||
|
|
* src/frontends/xforms/FormToc.C:
|
|||
|
|
* src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
|
|||
|
|
c-tor.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
|
|||
|
|
ChangedBufferAction enum.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormParagraph.[Ch]
|
|||
|
|
* src/frontends/xforms/forms/form_paragraph.fd: now derived from
|
|||
|
|
FormBase.
|
|||
|
|
|
|||
|
|
2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/bind/cua.bind: fix a bit.
|
|||
|
|
* lib/bind/emacs.bind: ditto.
|
|||
|
|
|
|||
|
|
* lib/bind/menus.bind: remove real menu entries from there.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: make sure we only include strings.h when
|
|||
|
|
_AIX is defined.
|
|||
|
|
|
|||
|
|
2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
|
|||
|
|
function. It enlarges the maximum number of pup when needed.
|
|||
|
|
(add_toc2): Open a new menu if maximum number of items per menu has
|
|||
|
|
reached.
|
|||
|
|
|
|||
|
|
2000-10-05 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormPrint.C: fix error reporting
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C: fix compiler
|
|||
|
|
warnings
|
|||
|
|
|
|||
|
|
* lib/.cvsignore: add Literate.nw
|
|||
|
|
|
|||
|
|
2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* buffer.C
|
|||
|
|
* bufferview_funcs.[Ch]
|
|||
|
|
* lyxfont.[Ch]
|
|||
|
|
* text.C
|
|||
|
|
* text2.C: Add support for numbers in RTL text.
|
|||
|
|
|
|||
|
|
2000-10-06 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
|
|||
|
|
to be gettext.m4 friendly again. ext_l10n.h is now
|
|||
|
|
generated into $top_srcdir instead of $top_builddir
|
|||
|
|
so that lyx.pot will be built correctly -- without
|
|||
|
|
duplicate parsing of ext_l10n.h.
|
|||
|
|
|
|||
|
|
2000-10-04 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormCitation.C: make the dialog
|
|||
|
|
behave more sensibly
|
|||
|
|
|
|||
|
|
2000-10-03 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* config/kde.m4: fix consecutive ./configure runs,
|
|||
|
|
look for qtarch, fix library order
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am: tidy up,
|
|||
|
|
add Print dialog, add .dlg dependencies
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormPrint.C:
|
|||
|
|
* src/frontends/kde/FormPrint.h:
|
|||
|
|
* src/frontends/kde/formprintdialog.C:
|
|||
|
|
* src/frontends/kde/formprintdialog.h:
|
|||
|
|
* src/frontends/kde/formprintdialogdata.C:
|
|||
|
|
* src/frontends/kde/formprintdialogdata.h:
|
|||
|
|
* src/frontends/kde/dlg/formprintdialog.dlg: add
|
|||
|
|
print dialog
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/README: Added explanatory readme
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/checkinitorder.pl: small perl
|
|||
|
|
script to double-check qtarch's output
|
|||
|
|
|
|||
|
|
* src/frontends/kde/formindexdialog.C:
|
|||
|
|
* src/frontends/kde/formindexdialogdata.C:
|
|||
|
|
* src/frontends/kde/formindexdialogdata.h:
|
|||
|
|
* src/frontends/kde/dlg/formindexdialog.dlg: update
|
|||
|
|
for qtarch, minor fixes
|
|||
|
|
|
|||
|
|
2000-10-05 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
|
|||
|
|
dialogs when switching buffers update them instead. It's up to each
|
|||
|
|
dialog to decide if it should still be visible or not.
|
|||
|
|
update() should return a bool to control visiblity within show().
|
|||
|
|
Or perhaps better to set a member variable and use that to control
|
|||
|
|
visibility.
|
|||
|
|
|
|||
|
|
* lib/build-listerrors: create an empty "listerrors" file just to stop
|
|||
|
|
make trying to regenerate it all the time if you don't have noweb
|
|||
|
|
installed.
|
|||
|
|
|
|||
|
|
* .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
|
|||
|
|
|
|||
|
|
* po/Makefile.in.in (ext_l10n.h): added a rule to build
|
|||
|
|
$(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
|
|||
|
|
is built before src/ and ext_l10n.h isn't actually needed to build lyx.
|
|||
|
|
(POTFILES.in): added a rule to build POTFILES.in. It is also now safe
|
|||
|
|
to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
|
|||
|
|
|
|||
|
|
* autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
|
|||
|
|
|
|||
|
|
2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
|
|||
|
|
deleting buffer. Closes all buffer-dependent dialogs.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch] (input): modified to pass
|
|||
|
|
FL_OBJECT * also.
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormPrint.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormRef.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormUrl.[Ch]: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.[Ch]:
|
|||
|
|
* src/frontends/xforms/forms/form_document.C.patch:
|
|||
|
|
* src/frontends/xforms/forms/form_document.fd: all input callbacks now
|
|||
|
|
pass through a single input() function.
|
|||
|
|
|
|||
|
|
2000-10-04 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* lib/build-listerrors: return status as OK
|
|||
|
|
|
|||
|
|
2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Updated to new export code
|
|||
|
|
|
|||
|
|
2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
|
|||
|
|
LexAlpha.
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
|
|||
|
|
character.
|
|||
|
|
|
|||
|
|
* lib/layouts/amsart.layout: include lyxmacros.inc, so that
|
|||
|
|
LyX-Code is defined.
|
|||
|
|
* lib/layouts/amsbook.layout: ditto.
|
|||
|
|
|
|||
|
|
* boost/Makefile.am: fix typo.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
|
|||
|
|
Menu::expand.
|
|||
|
|
(add_lastfiles): removed.
|
|||
|
|
(add_documents): removed.
|
|||
|
|
(add_formats): removed.
|
|||
|
|
|
|||
|
|
* src/frontends/Menubar.C: remove useless "using" directive.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.h: add a new MenuItem constructor.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
|
|||
|
|
xforms frontend.
|
|||
|
|
|
|||
|
|
2000-10-04 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (listerrors):
|
|||
|
|
* lib/build-listerrors: make $builddir != $srcdir compiles work again.
|
|||
|
|
I haven't got notangle installed so Kayvan please test. The output
|
|||
|
|
should end up in $builddir. This also allows people who don't have
|
|||
|
|
noweb installed to complete the make process without error.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.[Ch] (showInset):
|
|||
|
|
* src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
|
|||
|
|
by JMarc's picky compiler.
|
|||
|
|
|
|||
|
|
2000-10-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (setPos): change for loop to not use
|
|||
|
|
sequencing operator. Please check this J<>rgen.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
|
|||
|
|
instead of 'c'
|
|||
|
|
* src/insets/insetcite.C (getScreenLabel): ditto
|
|||
|
|
* src/support/filetools.C (QuoteName): ditto
|
|||
|
|
(ChangeExtension): ditto
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (scrollCB): make heigt int
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (insertInset): comment out unused arg
|
|||
|
|
|
|||
|
|
* boost/Makefile.am (EXTRADIST): new variable
|
|||
|
|
|
|||
|
|
2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/exporter.C (IsExportable): Fixed
|
|||
|
|
|
|||
|
|
* lib/configure.m4: Small fix
|
|||
|
|
|
|||
|
|
2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/insets/insetbutton.C (width): Changed to work with no GUI.
|
|||
|
|
* src/insets/insetbib.C (bibitemWidest): ditto.
|
|||
|
|
* src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
|
|||
|
|
|
|||
|
|
2000-10-03 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (theLockingInset): removed const because of
|
|||
|
|
Agnus's compile problems.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): set the language of the
|
|||
|
|
surronding paragraph on inserting the first character.
|
|||
|
|
|
|||
|
|
* various files: changed use of BufferView::the_locking_inset.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (theLockingInset):
|
|||
|
|
(theLockingInset): new functions.
|
|||
|
|
|
|||
|
|
* src/BufferView.h: removed the_locking_inset.
|
|||
|
|
|
|||
|
|
* src/lyxtext.h: added the_locking_inset
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
|
|||
|
|
|
|||
|
|
2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (IsMacro): declared but not referenced; removed.
|
|||
|
|
* src/mathed/math_cursor.C (IsAlpha): ditto.
|
|||
|
|
* src/mathed/math_inset.C (strnew): ditto.
|
|||
|
|
* src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
|
|||
|
|
(IMetrics): cxp set but never used; removed.
|
|||
|
|
* src/insets/figinset.C (InitFigures): removed redundant for loop, now
|
|||
|
|
that the variable in question has been removed also!
|
|||
|
|
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
|
|||
|
|
using the Buffer * passed to Latex(), using the BufferView * passed to
|
|||
|
|
bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C: use the Buffer * passed to Latex(),
|
|||
|
|
Linuxdoc() and DocBook() rather than the stored Buffer * master.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
|
|||
|
|
* src/buffer.C (readInset): used new InsetBibtex c-tor
|
|||
|
|
* (getBibkeyList): used new InsetBibtex::getKeys
|
|||
|
|
|
|||
|
|
2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/configure.m4
|
|||
|
|
* lib/build-listerrors
|
|||
|
|
* src/converter.C
|
|||
|
|
* src/exporter.C: Add literate programming support to the export code
|
|||
|
|
|
|||
|
|
* src/buffer.C
|
|||
|
|
* src/lyx_cb.C: Remove old literate code.
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
|
|||
|
|
variables.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): Use Exporter::IsExportable
|
|||
|
|
* src/converter.C (View, Convert): Use QuoteName.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (Preview): Use Formats::View.
|
|||
|
|
|
|||
|
|
* lib/configure.m4: Add sgml->dvi converter to lyxrc.default
|
|||
|
|
|
|||
|
|
2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): move declaration of text variable at
|
|||
|
|
the top of the function, because compaq cxx complains that the
|
|||
|
|
"goto exit_with_message" when the function is disabled bypasses
|
|||
|
|
its initialization.
|
|||
|
|
(MenuNew): try a better fix for the generation of new file names.
|
|||
|
|
This time, I used AddName() instead of AddPath(), hoping Juergen
|
|||
|
|
will be happier :)
|
|||
|
|
|
|||
|
|
2000-10-03 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd:
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
|
|||
|
|
nested tabfolders has begun. The old "Miscellaneous" was renamed as
|
|||
|
|
"Look and Feel"->"General" but will need to be split up further into
|
|||
|
|
general output and general input tabs. Current plan is for four outer
|
|||
|
|
tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
|
|||
|
|
stuff; "Inputs" for input and import configuration; "Outputs" for
|
|||
|
|
output and export configuration; and one more whatever is left over
|
|||
|
|
called "General". The leftovers at present look like being which
|
|||
|
|
viewers to use, spellchecker, language support and might be better
|
|||
|
|
named "Support". I've put "Paths" in "Inputs" for the moment as this
|
|||
|
|
seems reasonable for now at least.
|
|||
|
|
One problem remains: X error kills LyX when you close Preferences.
|
|||
|
|
|
|||
|
|
2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
|
|||
|
|
qualifier from form()
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormCopyright.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormDocument.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormError.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormIndex.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormPrint.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormRef.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormToc.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormUrl.[Ch]: ditto.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormIndex.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormRef.[Ch]:
|
|||
|
|
* src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
|
|||
|
|
with Allan's naming policy
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C: some static casts to remove
|
|||
|
|
compiler warnings.
|
|||
|
|
|
|||
|
|
2000-10-02 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (LocalDispatch): fixed selection code,
|
|||
|
|
now you can type or do stuff inside the table-cell also when in dummy
|
|||
|
|
position, fixed visible cursor.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (Edit): fixing cursor-view position.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): use * text variable so that it can
|
|||
|
|
be used for equal functions in lyxfunc and insettext.
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): fixed a small clear_area bug.
|
|||
|
|
|
|||
|
|
2000-10-02 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/FormCitation.h:
|
|||
|
|
* src/frontends/gnome/FormCopyright.h:
|
|||
|
|
* src/frontends/gnome/FormIndex.h:
|
|||
|
|
* src/frontends/gnome/FormPrint.h:
|
|||
|
|
* src/frontends/gnome/FormToc.h:
|
|||
|
|
* src/frontends/gnome/FormUrl.h:
|
|||
|
|
* src/frontends/kde/FormCitation.h:
|
|||
|
|
* src/frontends/kde/FormCopyright.h:
|
|||
|
|
* src/frontends/kde/FormIndex.h:
|
|||
|
|
* src/frontends/kde/FormRef.h:
|
|||
|
|
* src/frontends/kde/FormToc.h:
|
|||
|
|
* src/frontends/kde/FormUrl.h: fix remaining users of
|
|||
|
|
support/utility.hpp
|
|||
|
|
|
|||
|
|
2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (linuxDocHandleFootnote): remove const modifier
|
|||
|
|
from depth argument.
|
|||
|
|
(DocBookHandleCaption): ditto.
|
|||
|
|
(DocBookHandleFootnote): ditto.
|
|||
|
|
(SimpleDocBookOnePar): ditto.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.h (form): remove extra
|
|||
|
|
FormDocument:: qualifier.
|
|||
|
|
|
|||
|
|
* sigc++/macros/basic_signal.h.m4: remove erroneous virtual
|
|||
|
|
destructor.
|
|||
|
|
* sigc++/handle.h: ditto.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C: add "using" directive.
|
|||
|
|
|
|||
|
|
* src/cheaders/cstddef: new file, needed by the boost library (for
|
|||
|
|
compaq cxx).
|
|||
|
|
|
|||
|
|
2000-10-02 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (SetFont): better support.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (draw): fixed drawing of single cell.
|
|||
|
|
|
|||
|
|
* src/screen.C (DrawOneRow): some uint refixes!
|
|||
|
|
|
|||
|
|
2000-10-02 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* boost/.cvsignore: ignore Makefile as well
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
|
|||
|
|
LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
|
|||
|
|
Left this one out by accident.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.h (restore): default to calling
|
|||
|
|
update() since that will restore the original/currently-applied values.
|
|||
|
|
Any input() triggered error messages will require the derived classes
|
|||
|
|
to redefine restore().
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C: initialize a few variables to
|
|||
|
|
avoid a segfault. combo_doc_class is the main concern.
|
|||
|
|
|
|||
|
|
2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
|
|||
|
|
|
|||
|
|
* Simplify build-listerrors in view of GUI-less export ability!
|
|||
|
|
|
|||
|
|
2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (easyParse): Disable gui when exporting
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C:
|
|||
|
|
* src/LaTeX.C
|
|||
|
|
* src/converter.C
|
|||
|
|
* src/lyx_gui_misc.C
|
|||
|
|
* src/tabular.C: Changes to allow no-gui.
|
|||
|
|
|
|||
|
|
2000-10-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/utility.hpp: removed file
|
|||
|
|
* src/support/block.h: removed file
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
|
|||
|
|
and utility.hpp
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C: add support/lyxlib.h
|
|||
|
|
* src/mathed/formulamacro.C: ditto
|
|||
|
|
|
|||
|
|
* src/bufferparams.h: use boost/array.hpp instead of support/block.h
|
|||
|
|
* src/lyxparagraph.h: ditto
|
|||
|
|
|
|||
|
|
* src/Makefile.am (BOOST_INCLUDES): the boost include dir
|
|||
|
|
* src/frontends/Makefile.am (INCLUDES): ditto
|
|||
|
|
* src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
|
|||
|
|
* src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
|
|||
|
|
* src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
|
|||
|
|
* src/graphics/Makefile.am (BOOST_INCLUDES): ditto
|
|||
|
|
* src/insets/Makefile.am (BOOST_INCLUDES): ditto
|
|||
|
|
* src/mathed/Makefile.am (BOOST_INCLUDES): ditto
|
|||
|
|
|
|||
|
|
* src/BufferView.h: use boost/utility.hpp
|
|||
|
|
* src/LColor.h: ditto
|
|||
|
|
* src/LaTeX.h: ditto
|
|||
|
|
* src/LyXAction.h: ditto
|
|||
|
|
* src/LyXView.h: ditto
|
|||
|
|
* src/bufferlist.h: ditto
|
|||
|
|
* src/lastfiles.h: ditto
|
|||
|
|
* src/layout.h: ditto
|
|||
|
|
* src/lyx_gui.h: ditto
|
|||
|
|
* src/lyx_main.h: ditto
|
|||
|
|
* src/lyxlex.h: ditto
|
|||
|
|
* src/lyxrc.h: ditto
|
|||
|
|
* src/frontends/ButtonPolicies.h: ditto
|
|||
|
|
* src/frontends/Dialogs.h: ditto
|
|||
|
|
* src/frontends/xforms/FormBase.h: ditto
|
|||
|
|
* src/frontends/xforms/FormGraphics.h: ditto
|
|||
|
|
* src/frontends/xforms/FormParagraph.h: ditto
|
|||
|
|
* src/frontends/xforms/FormTabular.h: ditto
|
|||
|
|
* src/graphics/GraphicsCache.h: ditto
|
|||
|
|
* src/graphics/Renderer.h: ditto
|
|||
|
|
* src/insets/ExternalTemplate.h: ditto
|
|||
|
|
* src/insets/insetcommand.h: ditto
|
|||
|
|
* src/support/path.h: ditto
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
|
|||
|
|
and introduce clause for 2.97.
|
|||
|
|
|
|||
|
|
* boost/libs/README: new file
|
|||
|
|
|
|||
|
|
* boost/boost/utility.hpp: new file
|
|||
|
|
|
|||
|
|
* boost/boost/config.hpp: new file
|
|||
|
|
|
|||
|
|
* boost/boost/array.hpp: new file
|
|||
|
|
|
|||
|
|
* boost/Makefile.am: new file
|
|||
|
|
|
|||
|
|
* boost/.cvsignore: new file
|
|||
|
|
|
|||
|
|
* configure.in (AC_OUTPUT): add boost/Makefile
|
|||
|
|
|
|||
|
|
* Makefile.am (SUBDIRS): add boost
|
|||
|
|
|
|||
|
|
2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (suffixIs): Fixed.
|
|||
|
|
|
|||
|
|
2000-10-01 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/PrinterParams.h: moved things around to avoid the "can't
|
|||
|
|
inline call" warning.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/RadioButtonGroup.h: turned a comment
|
|||
|
|
into doc++ documentation.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.[Ch]: support button policy
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormRef.C: make use of button controller
|
|||
|
|
* src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
|
|||
|
|
cleaned up button controller usage.
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
|
|||
|
|
* src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
|
|||
|
|
use the button controller
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/*.fd: and associated generated files
|
|||
|
|
updated to reflect changes to FormBase. Some other FormXxxx files
|
|||
|
|
also got minor updates to reflect changes to FormBase.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
|
|||
|
|
(hide): made virtual.
|
|||
|
|
(input): return a bool. true == valid input
|
|||
|
|
(RestoreCB, restore): new
|
|||
|
|
(CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
|
|||
|
|
Changes to allow derived dialogs to use a ButtonController and
|
|||
|
|
make sense when doing so: OK button calls ok() and so on.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/ButtonController.h (class ButtonController):
|
|||
|
|
Switch from template implementation to taking Policy parameter.
|
|||
|
|
Allows FormBase to provide a ButtonController for any dialog.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
|
|||
|
|
Probably should rename connect and disconnect.
|
|||
|
|
(apply): use the radio button groups
|
|||
|
|
(form): needed by FormBase
|
|||
|
|
(build): setup the radio button groups
|
|||
|
|
|
|||
|
|
2000-09-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* several files: type changes to reduce the number of warnings and
|
|||
|
|
to unify type hangling a bit. Still much to do.
|
|||
|
|
|
|||
|
|
2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/images/*: rename a bunch of icons to match Dekel converter
|
|||
|
|
changes.
|
|||
|
|
|
|||
|
|
* src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
|
|||
|
|
last parameter.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
|
|||
|
|
|
|||
|
|
* sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
|
|||
|
|
virtual destructor
|
|||
|
|
* sigc++/handle.h: ditto for class Handle.
|
|||
|
|
|
|||
|
|
2000-09-27 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* config/kde.m4: make Qt fail immediately if Qt2 is picked up
|
|||
|
|
|
|||
|
|
2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/intl.C (InitKeyMapper): Correct the value of n due to the
|
|||
|
|
removal of the "default" language.
|
|||
|
|
|
|||
|
|
* src/combox.h (getline): Check that sel > 0
|
|||
|
|
|
|||
|
|
2000-09-29 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
|
|||
|
|
|
|||
|
|
* lib/examples/docbook_example.lyx
|
|||
|
|
* lib/examples/docbook_article.lyx: file renamed to avoid confusion.
|
|||
|
|
|
|||
|
|
* lib/layouts/docbook-book.layout: new docbook book layout.
|
|||
|
|
|
|||
|
|
* lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
|
|||
|
|
|
|||
|
|
* lib/layouts/manpage.layout: Same as above. Style SubSection removed.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (DocBook):fixed small typo.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (DocBook): new export for verbatim type.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.h: string include_label doesn't need to be
|
|||
|
|
mutable.
|
|||
|
|
|
|||
|
|
2000-09-29 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
|
|||
|
|
Allow derived type to control connection and disconnection from signals
|
|||
|
|
of its choice if desired.
|
|||
|
|
|
|||
|
|
2000-09-28 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (update): fixed cursor setting when
|
|||
|
|
the_locking_inset changed.
|
|||
|
|
(draw): made this a bit cleaner.
|
|||
|
|
(InsetButtonPress): fixed!
|
|||
|
|
|
|||
|
|
* various files: added LyXText Parameter to fitCursor call.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (fitCursor): added LyXText parameter.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (draw): small draw fix.
|
|||
|
|
|
|||
|
|
* src/tabular.C: right setting of left/right celllines.
|
|||
|
|
|
|||
|
|
* src/tabular.[Ch]: fixed various types in funcions and structures.
|
|||
|
|
* src/insets/insettabular.C: ditto
|
|||
|
|
* src/frontends/xforms/FormTabular.C: ditto
|
|||
|
|
|
|||
|
|
2000-09-28 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
|
|||
|
|
that the #ifdef's had been applied to part of what should have been
|
|||
|
|
a complete condition. It's possible there are other tests that
|
|||
|
|
were specific to tables that are also wrong now that InsetTabular is
|
|||
|
|
being used. Now we need to fix the output of '\n' after a table in a
|
|||
|
|
float for the same reason as the original condition:
|
|||
|
|
"don't insert this if we would be adding it before or after a table
|
|||
|
|
in a float. This little trick is needed in order to allow use of
|
|||
|
|
tables in \subfigures or \subtables."
|
|||
|
|
Juergen can you check this?
|
|||
|
|
|
|||
|
|
2000-09-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (Ascii): return numer of '\n' in the text
|
|||
|
|
output to the ostream.
|
|||
|
|
|
|||
|
|
* several files: fixed types based on warnings from cxx
|
|||
|
|
|
|||
|
|
2000-09-26 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am: fix rule for
|
|||
|
|
formindexdialogdata_moc.C
|
|||
|
|
|
|||
|
|
* src/.cvsignore: add ext_l10n.h to ignore
|
|||
|
|
|
|||
|
|
* acconfig.h: stop messing with __STRICT_ANSI__
|
|||
|
|
* config/gnome.m4: remove option to set -ansi
|
|||
|
|
* config/kde.m4: remove option to set -ansi
|
|||
|
|
* config/lyxinclude.m4: don't set -ansi
|
|||
|
|
|
|||
|
|
2000-09-27 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* various files: remove "default" language check.
|
|||
|
|
|
|||
|
|
* src/insets/insetquotes.C: removed use of current_view.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
|
|||
|
|
the one should have red ears by now!
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
|
|||
|
|
in more then one paragraph. Fixed cursor-movement/selection.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormParagraph.C: disable pagebreaks for
|
|||
|
|
paragraphs inside a text inset.
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
|
|||
|
|
text-inset if this owner is an inset.
|
|||
|
|
|
|||
|
|
2000-09-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/Bullet.h: changed type of font, character and size to int
|
|||
|
|
|
|||
|
|
* src/buffer.C (asciiParagraph): remove actcell and fname1.
|
|||
|
|
|
|||
|
|
* src/insets/inseturl.[Ch]:
|
|||
|
|
* src/insets/insetref.[Ch]:
|
|||
|
|
* src/insets/insetlabel.[Ch]: add linelen to Ascii
|
|||
|
|
|
|||
|
|
2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/buffer.C (readFile): block-if statement rearranged to minimise
|
|||
|
|
bloat. Patch does not reverse Jean-Marc's change ;-)
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
|
|||
|
|
Class rewritten to store pointers to hide/update signals directly,
|
|||
|
|
rather than Dialogs *. Also defined an enum to ease use. All xforms
|
|||
|
|
forms can now be derived from this class.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.[Ch]
|
|||
|
|
* src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
|
|||
|
|
out of header file.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_citation.fd
|
|||
|
|
* src/frontends/xforms/forms/form_copyright.fd
|
|||
|
|
* src/frontends/xforms/forms/form_error.fd
|
|||
|
|
* src/frontends/xforms/forms/form_index.fd
|
|||
|
|
* src/frontends/xforms/forms/form_ref.fd
|
|||
|
|
* src/frontends/xforms/forms/form_toc.fd
|
|||
|
|
* src/frontends/xforms/forms/form_url.fd: remamed callbacks
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/makefile: small change to work with DEC sh.
|
|||
|
|
|
|||
|
|
* src/insets/insetfoot.C: removed redundent using directive.
|
|||
|
|
|
|||
|
|
2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/layouts/siamltex.layout: new textclass for SIAM journals,
|
|||
|
|
from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
|
|||
|
|
created in the constructors in different groups. Then set() just
|
|||
|
|
have to show the groups as needed. This fixes the redraw problems
|
|||
|
|
(and is how the old menu code worked).
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h: declare the methods as static when we do
|
|||
|
|
not have namespaces.
|
|||
|
|
|
|||
|
|
2000-09-26 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/buffer.C (asciiParagraph): new function.
|
|||
|
|
(writeFileAscii): new function with parameter ostream.
|
|||
|
|
(writeFileAscii): use now asciiParagraph.
|
|||
|
|
|
|||
|
|
* various inset files: added the linelen parameter to the Ascii-func.
|
|||
|
|
|
|||
|
|
* src/tabular.C (Write): fixed error in writing file introduced by
|
|||
|
|
the last changes from Lars.
|
|||
|
|
|
|||
|
|
* lib/bind/menus.bind: removed not supported functions.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (Ascii): implemented this function.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h (Ascii): added linelen parameter.
|
|||
|
|
|
|||
|
|
* src/tabular.C (write_attribute[int,string,bool]): new functions.
|
|||
|
|
(Write): use of the write_attribute functions.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (close): fixed reasking question!
|
|||
|
|
|
|||
|
|
2000-09-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/unlink.C src/support/remove.C src/support/mkdir.C:
|
|||
|
|
new files use the everwhere possible.
|
|||
|
|
|
|||
|
|
* several files:
|
|||
|
|
* src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
|
|||
|
|
src/log_form.C src/lyx.C:
|
|||
|
|
regenerated
|
|||
|
|
|
|||
|
|
* src/buffer.C (runLaTeX): remove func
|
|||
|
|
|
|||
|
|
* src/PaperLayout.C: removed file
|
|||
|
|
* src/ParagraphExtra.C: likewise
|
|||
|
|
* src/bullet_forms.C: likewise
|
|||
|
|
* src/bullet_forms.h: likewise
|
|||
|
|
* src/bullet_forms_cb.C: likewise
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
|
|||
|
|
ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
|
|||
|
|
bullet_forms_cb.C
|
|||
|
|
|
|||
|
|
* several files: remove all traces of the old fd_form_paragraph,
|
|||
|
|
and functions belonging to that.
|
|||
|
|
|
|||
|
|
* several files: remove all traces of the old fd_form_document,
|
|||
|
|
and functions belonging to that.
|
|||
|
|
|
|||
|
|
* several files: constify local variables were possible.
|
|||
|
|
|
|||
|
|
* several files: remove all code that was dead when NEW_EXPORT was
|
|||
|
|
defined
|
|||
|
|
|
|||
|
|
* several files: removed string::c_str in as many places as
|
|||
|
|
possible.
|
|||
|
|
|
|||
|
|
* forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
|
|||
|
|
(e): be a bit more outspoken when patching
|
|||
|
|
(updatesrc): only move files if changed.
|
|||
|
|
|
|||
|
|
* forms/layout_forms.h.patch: regenerated
|
|||
|
|
|
|||
|
|
* forms/layout_forms.fd: remove form_document and form_paragraph
|
|||
|
|
and form_quotes and form_paper and form_table_options and
|
|||
|
|
form_paragraph_extra
|
|||
|
|
|
|||
|
|
* forms/form1.fd: remove form_table
|
|||
|
|
|
|||
|
|
* forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
|
|||
|
|
the fdui->... rewrite. Update some comments to xforms 0.88
|
|||
|
|
|
|||
|
|
* forms/bullet_forms.C.patch: removed file
|
|||
|
|
* forms/bullet_forms.fd: likewise
|
|||
|
|
* forms/bullet_forms.h.patch: likewise
|
|||
|
|
|
|||
|
|
* development/Code_rules/Rules: added a section on switch
|
|||
|
|
statements. Updated some comment to xforms 0.88.
|
|||
|
|
|
|||
|
|
2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (readFile): make sure that the whole version number
|
|||
|
|
is read after \lyxformat (even when it contains a comma)
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: change shortcut of math menu to M-a.
|
|||
|
|
|
|||
|
|
2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/vspace.C (nextToken): use isStrDbl() to check for proper
|
|||
|
|
double values.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (updateWindowTitle): show the full files name in
|
|||
|
|
window title, limited to 30 characters.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (lyxstring): fix it correctly this time.
|
|||
|
|
When a number of characters has been given, we should not assume
|
|||
|
|
that the string is 0-terminated.
|
|||
|
|
|
|||
|
|
* src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
|
|||
|
|
calls (fixes some memory leaks)
|
|||
|
|
|
|||
|
|
* src/intl.[Ch]: add a destructor for Intl, in order to delete the
|
|||
|
|
trans member on exit.
|
|||
|
|
|
|||
|
|
2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/converter.C (GetReachable): fix typo.
|
|||
|
|
|
|||
|
|
* src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
|
|||
|
|
understand ',' instead of '.'.
|
|||
|
|
(GetInteger): rewrite to use strToInt().
|
|||
|
|
|
|||
|
|
2000-09-26 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
|
|||
|
|
better visibility and error-message on wrong VSpace input.
|
|||
|
|
|
|||
|
|
* src/language.C (initL): added english again.
|
|||
|
|
|
|||
|
|
2000-09-25 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Dialogs.C (Dialogs):
|
|||
|
|
* src/frontends/gnome/Dialogs.C (Dialogs):
|
|||
|
|
* src/frontends/kde/Makefile.am:
|
|||
|
|
* src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/makefile: added form_paragraph.fd.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am: added files for FormParagraph.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormParagraph.C:
|
|||
|
|
* src/frontends/xforms/FormParagraph.h:
|
|||
|
|
* src/frontends/xforms/form_paragraph.C:
|
|||
|
|
* src/frontends/xforms/form_paragraph.h:
|
|||
|
|
* src/frontends/xforms/forms/form_paragraph.fd: new files for the new
|
|||
|
|
paragraph layout.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): call the new layout paragraph.
|
|||
|
|
|
|||
|
|
* src/tabular.C (OldFormatRead): forgot to delete the temporary
|
|||
|
|
Paragraph-Data after use.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): don't set the layout on
|
|||
|
|
non breakable paragraphs.
|
|||
|
|
|
|||
|
|
2000-09-25 Garst R. Reese <reese@isn.net>
|
|||
|
|
|
|||
|
|
* src/language.C (initL): added missing language_country codes.
|
|||
|
|
|
|||
|
|
2000-09-25 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (InsetText):
|
|||
|
|
(deleteLyXText): remove the not released LyXText structure!
|
|||
|
|
|
|||
|
|
2000-09-24 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/mainapp.C
|
|||
|
|
* src/frontends/gnome/mainapp.h: added support for keyboard
|
|||
|
|
accelerators
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/FormCitation.C
|
|||
|
|
* src/frontends/gnome/FormCitation.h
|
|||
|
|
* src/frontends/gnome/Makefile.am
|
|||
|
|
* src/frontends/gnome/pixbutton.h: completed the rewrite of
|
|||
|
|
FormCitation to use "action area" in mainapp window
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.C
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
|
|||
|
|
large TOC.
|
|||
|
|
|
|||
|
|
2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (MathFuncInset::Metrics): Use default
|
|||
|
|
width/descent/ascent values if name is empty.
|
|||
|
|
(mathed_string_height): Use std::max.
|
|||
|
|
|
|||
|
|
2000-09-25 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: resize to stop
|
|||
|
|
segfault. This will be completely redesigned soon.
|
|||
|
|
|
|||
|
|
* sigc++: updated libsigc++. Fixes struct timespec bug.
|
|||
|
|
|
|||
|
|
* development/tools/makeLyXsigc.sh: .cvsignore addition
|
|||
|
|
|
|||
|
|
2000-09-23 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* several files: removed almost all traces of the old table
|
|||
|
|
(tabular) code.
|
|||
|
|
|
|||
|
|
* src/TableLayout.C: removed file
|
|||
|
|
|
|||
|
|
2000-09-22 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Dialogs.C: added credits forms.
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Dialogs.C: added some forms.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (init_spell_checker): set language in pspell code
|
|||
|
|
(RunSpellChecker): some modifications for setting language string.
|
|||
|
|
|
|||
|
|
* src/language.[Ch]: added language_country code.
|
|||
|
|
|
|||
|
|
2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h: added new signal showError.
|
|||
|
|
Rearranged existing signals in some sort of alphabetical order.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
|
|||
|
|
FormError.[Ch], form_error.[Ch]
|
|||
|
|
* src/frontends/xforms/forms/makefile: added new file form_error.fd
|
|||
|
|
* src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormBase.[Ch]: new base class for xforms
|
|||
|
|
dialogs. I think that this can be used as the base to all these
|
|||
|
|
dialogs.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormError.[Ch]
|
|||
|
|
* src/frontends/xforms/forms/form_error.fd: new files. Xforms
|
|||
|
|
implementation of InsetError dialog.
|
|||
|
|
|
|||
|
|
* src/insets/inseterror.[Ch]: rendered GUI-independent.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
|
|||
|
|
* src/frontends/kde/Makefile.am: ditto
|
|||
|
|
|
|||
|
|
2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/math_cursor.[Ch]: Removed class members macroln and
|
|||
|
|
macrobf. This fixes a bug of invisible text.
|
|||
|
|
|
|||
|
|
2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/doc/LaTeXConfig.lyx.in: updated.
|
|||
|
|
|
|||
|
|
* src/language.C (initL): remove language "francais" and change a
|
|||
|
|
bit the names of the two other french variations.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (lyxstring): do not apply strlen() on a
|
|||
|
|
string that may not be 0-terminated.
|
|||
|
|
|
|||
|
|
2000-09-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
|
|||
|
|
|
|||
|
|
2000-09-20 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/FormCitation.C
|
|||
|
|
* src/frontends/gnome/FormIndex.C
|
|||
|
|
* src/frontends/gnome/FormToc.C
|
|||
|
|
* src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
|
|||
|
|
the variable initialization to shut up the warnings
|
|||
|
|
|
|||
|
|
2000-09-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/table.[Ch]: deleted files
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
|
|||
|
|
second arg.
|
|||
|
|
|
|||
|
|
2000-09-18 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
|
|||
|
|
problems with selection. Inserted new LFUN_PASTESELECTION.
|
|||
|
|
(InsetButtonPress): inserted handling of middle mouse-button paste.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: changed word to word.c_str().
|
|||
|
|
|
|||
|
|
2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
|
|||
|
|
|
|||
|
|
* src/Makefile.am: Add sources to lyx_SOURCES so they will be
|
|||
|
|
included in the ``make dist'' tarball.
|
|||
|
|
|
|||
|
|
2000-09-15 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C (cutSelection): small fix return the right
|
|||
|
|
end position after cut inside one paragraph only.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (resizeLyXText): only reset the cursor if
|
|||
|
|
we are locked as otherwise we don't have a valid cursor position!
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (draw): small bugfix but why is this needed???
|
|||
|
|
|
|||
|
|
2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormRef.C: added using directive.
|
|||
|
|
* src/frontends/kde/FormToc.C: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/kde/formtocdialog.h: changed endl to std::endl.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormRef.h: removed trailing comma from enums.
|
|||
|
|
|
|||
|
|
2000-09-19 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.C
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
|
|||
|
|
Toc, ViewFormats, UpdateFormats, and ExportFormats.
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/mainapp.C
|
|||
|
|
* src/frontends/gnome/mainapp.h: support for menu update used
|
|||
|
|
by Toc menu.
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/mainapp.C
|
|||
|
|
* src/frontends/gnome/mainapp.h: support for "action" area in the
|
|||
|
|
main window. This area is used by small simple dialogs, such as
|
|||
|
|
FormUrl.
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/FormIndex.C
|
|||
|
|
* src/frontends/gnome/FormIndex.h
|
|||
|
|
* src/frontends/gnome/FormUrl.C
|
|||
|
|
* src/frontends/gnome/FormUrl.h: rewrite to use main window action
|
|||
|
|
area
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/FormCitation.C
|
|||
|
|
* src/frontends/gnome/FormCitation.h: rewrite to use main window
|
|||
|
|
action area. Only "Insert new citation" is implemented.
|
|||
|
|
|
|||
|
|
2000-09-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/buffer.C (Dispatch): fix call to Dispatch
|
|||
|
|
* src/insets/insetref.C (Edit): likewise
|
|||
|
|
* src/insets/insetparent.C (Edit): likewise
|
|||
|
|
* src/insets/insetinclude.C (include_cb): likewise
|
|||
|
|
* src/frontends/xforms/FormUrl.C (apply): likewise
|
|||
|
|
* src/frontends/xforms/FormToc.C (apply): likewise
|
|||
|
|
* src/frontends/xforms/FormRef.C (apply): likewise
|
|||
|
|
* src/frontends/xforms/FormIndex.C (apply): likewise
|
|||
|
|
* src/frontends/xforms/FormCitation.C (apply): likewise
|
|||
|
|
* src/lyxserver.C (callback): likewise
|
|||
|
|
* src/lyxfunc.C (processKeySym): likewise
|
|||
|
|
(Dispatch): likewise
|
|||
|
|
(Dispatch): likewise
|
|||
|
|
* src/lyx_cb.C (LayoutsCB): likewise
|
|||
|
|
|
|||
|
|
* Makefile.am (sourcedoc): small change
|
|||
|
|
|
|||
|
|
2000-09-18 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/main.C (main): Don't make an empty GUIRunTime object. all
|
|||
|
|
methods are static. constify a bit remove unneded using + headers.
|
|||
|
|
|
|||
|
|
* src/tabular.C: some more const to local vars move some loop vars
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: added some c_str after some word for pspell
|
|||
|
|
|
|||
|
|
* src/frontends/GUIRunTime.h: add new static method setDefaults
|
|||
|
|
* src/frontends/xforms/GUIRunTime.C (setDefaults):
|
|||
|
|
* src/frontends/kde/GUIRunTime.C (setDefaults):
|
|||
|
|
* src/frontends/gnome/GUIRunTime.C (setDefaults): new method
|
|||
|
|
|
|||
|
|
* src/mathed/math_cursor.C (MacroModeClose): don't call SetName
|
|||
|
|
with strnew in arg, use correct emptystring when calling SetName.
|
|||
|
|
|
|||
|
|
* several files: remove all commented code with relation to
|
|||
|
|
HAVE_SSTREAM beeing false. We now only support stringstream and
|
|||
|
|
not strstream.
|
|||
|
|
|
|||
|
|
2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: construct correctly the automatic new file
|
|||
|
|
names.
|
|||
|
|
|
|||
|
|
* src/text2.C (IsStringInText): change type of variable i to shut
|
|||
|
|
off a warning.
|
|||
|
|
|
|||
|
|
* src/support/sstream.h: do not use namespaces if the compiler
|
|||
|
|
does not support them.
|
|||
|
|
|
|||
|
|
2000-09-15 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
* src/frontends/gnome/FormCitation.C
|
|||
|
|
* src/frontends/gnome/FormCitation.h
|
|||
|
|
* src/frontends/gnome/diainsertcitation_interface.c
|
|||
|
|
* src/frontends/gnome/dialogs/diainsertcitation.glade: adds
|
|||
|
|
regexp support to FormCitation [Gnome].
|
|||
|
|
|
|||
|
|
2000-09-15 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* acconfig.h
|
|||
|
|
* configure.in: remove unused KDE/GTKGUI define
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormRef.C
|
|||
|
|
* src/frontends/kde/FormRef.h
|
|||
|
|
* src/frontends/kde/formrefdialog.C
|
|||
|
|
* src/frontends/kde/formrefdialog.h: double click will
|
|||
|
|
go to reference, now it is possible to change a cross-ref
|
|||
|
|
after the fact
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormToc.C
|
|||
|
|
* src/frontends/kde/FormToc.h
|
|||
|
|
* src/frontends/kde/formtocdialog.C
|
|||
|
|
* src/frontends/kde/formtocdialog.h: add a depth
|
|||
|
|
slider
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am: add QtLyXView.h
|
|||
|
|
to the sources list
|
|||
|
|
|
|||
|
|
2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormCitation.h: added some using directives.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormToc.h: corrected definition of doTree.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
|
|||
|
|
cerr.
|
|||
|
|
|
|||
|
|
* src/mathed/math_defs.h: redefine SetAlign to use string rather
|
|||
|
|
than char *.
|
|||
|
|
|
|||
|
|
2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (pop_tag): revert for the second time a change by
|
|||
|
|
Lars, who seems to really hate having non-local loop variables :)
|
|||
|
|
|
|||
|
|
* src/Lsstream.h: add "using" statements.
|
|||
|
|
|
|||
|
|
* src/support/copy.C (copy): add a bunch of std:: qualifiers
|
|||
|
|
* src/buffer.C (writeFile): ditto
|
|||
|
|
|
|||
|
|
2000-09-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFile): try to fix the locale modified format
|
|||
|
|
number to always be as we want it.
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (work_area_handler): try to workaround the bugs
|
|||
|
|
in XForms 0.89. C-space is now working again.
|
|||
|
|
|
|||
|
|
* src/Lsstream.h src/support/sstream.h: new files.
|
|||
|
|
|
|||
|
|
* also commented out all cases where strstream were used.
|
|||
|
|
|
|||
|
|
* src/Bullet.h (c_str): remove method.
|
|||
|
|
|
|||
|
|
* remove all stuff that is irrelevant when NEW_MENUBAR is defined
|
|||
|
|
|
|||
|
|
* a lot of files: get rid of "char const *" and "char *" is as
|
|||
|
|
many places as possible. We only want to use them in interaction
|
|||
|
|
with system of other libraries, not inside lyx.
|
|||
|
|
|
|||
|
|
* a lot of files: return const object is not of pod type. This
|
|||
|
|
helps ensure that temporary objects is not modified. And fits well
|
|||
|
|
with "programming by contract".
|
|||
|
|
|
|||
|
|
* configure.in: check for the locale header too
|
|||
|
|
|
|||
|
|
* Makefile.am (sourcedoc): new tag for generation of doc++
|
|||
|
|
documentation
|
|||
|
|
|
|||
|
|
2000-09-14 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
|
|||
|
|
callback to check which combo called it and do the right action.
|
|||
|
|
|
|||
|
|
* src/combox.C (combo_cb): added combo * to the callbacks.
|
|||
|
|
(Hide): moved call of callback after Ungrab of the pointer.
|
|||
|
|
|
|||
|
|
* src/intl.h: removed LCombo2 function.
|
|||
|
|
|
|||
|
|
* src/intl.C (LCombo): added Combox * to call and removed LCombo2
|
|||
|
|
function as this can now be handled in one function.
|
|||
|
|
|
|||
|
|
* src/combox.h: added Combox * to callback prototype.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Toolbar_pimpl.C:
|
|||
|
|
* src/lyx_cb.C (LayoutsCB): added Combox * to function call.
|
|||
|
|
|
|||
|
|
2000-09-14 Garst Reese <reese@isn.net>
|
|||
|
|
|
|||
|
|
* lib/tex/hollywood.cls changed length of parenthicals to 1.5in
|
|||
|
|
moved usepackage{xxx}'s to beginning of file. Changed left margin
|
|||
|
|
to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
|
|||
|
|
underlining from title. Thanks to John Culleton for useful suggestions.
|
|||
|
|
|
|||
|
|
2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.C (setFile): change error message to debug
|
|||
|
|
message.
|
|||
|
|
|
|||
|
|
2000-09-13 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C: implemented choice_class
|
|||
|
|
as combox and give callback to combo_language so OK/Apply is activated
|
|||
|
|
on change.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (newFile): small fix so already named files
|
|||
|
|
(via an open call) are not requested to be named again on the
|
|||
|
|
first save!
|
|||
|
|
|
|||
|
|
2000-09-13 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am
|
|||
|
|
* src/frontends/kde/FormRef.C
|
|||
|
|
* src/frontends/kde/FormRef.h
|
|||
|
|
* src/frontends/kde/formrefdialog.C
|
|||
|
|
* src/frontends/kde/formrefdialog.h: implement
|
|||
|
|
cross-ref dialog
|
|||
|
|
|
|||
|
|
2000-09-13 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/formtocdialog.C
|
|||
|
|
* src/frontends/kde/formtocdialog.h
|
|||
|
|
* src/frontends/kde/FormToc.C
|
|||
|
|
* src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
|
|||
|
|
|
|||
|
|
2000-09-11 John Levon <moz@compsoc.man.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/FormCitation.C: fix thinko
|
|||
|
|
where we didn't always display the reference text
|
|||
|
|
properly
|
|||
|
|
|
|||
|
|
* src/frontends/kde/formurldialog.C
|
|||
|
|
* src/frontends/kde/formurldialog.h
|
|||
|
|
* src/frontends/kde/FormUrl.C
|
|||
|
|
* src/frontends/kde/FormUrl.h: minor cleanups
|
|||
|
|
|
|||
|
|
* src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am
|
|||
|
|
* src/frontends/kde/FormToc.C
|
|||
|
|
* src/frontends/kde/FormToc.h
|
|||
|
|
* src/frontends/kde/FormCitation.C
|
|||
|
|
* src/frontends/kde/FormCitation.h
|
|||
|
|
* src/frontends/kde/FormIndex.C
|
|||
|
|
* src/frontends/kde/FormIndex.h
|
|||
|
|
* src/frontends/kde/formtocdialog.C
|
|||
|
|
* src/frontends/kde/formtocdialog.h
|
|||
|
|
* src/frontends/kde/formcitationdialog.C
|
|||
|
|
* src/frontends/kde/formcitationdialog.h
|
|||
|
|
* src/frontends/kde/formindexdialog.C
|
|||
|
|
* src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
|
|||
|
|
|
|||
|
|
2000-09-12 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
|
|||
|
|
static strings.
|
|||
|
|
|
|||
|
|
2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
|
|||
|
|
not cerr.
|
|||
|
|
|
|||
|
|
2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.C (Add, Convert): Added support for converter flags:
|
|||
|
|
needaux, resultdir, resultfile.
|
|||
|
|
(Convert): Added new parameter view_file.
|
|||
|
|
(dvips_options): Fixed letter paper option.
|
|||
|
|
|
|||
|
|
* src/exporter.C (Export, BufferExtension): Added support for Docbook.
|
|||
|
|
(Export, GetExportableFormats, GetViewableFormats): Added support
|
|||
|
|
for Ascii.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
|
|||
|
|
directory!
|
|||
|
|
(easyParse): Fixed to work with new export code.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
|
|||
|
|
directories.
|
|||
|
|
|
|||
|
|
* lyx-devel-export/lib/configure.m4: Changed flags of tth.
|
|||
|
|
|
|||
|
|
* lib/bind/*.bind: Replaced
|
|||
|
|
buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
|
|||
|
|
buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
|
|||
|
|
|
|||
|
|
2000-09-11 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (runTime): uses global guiruntime variable.
|
|||
|
|
|
|||
|
|
* src/main.C (main): now GUII defines global guiruntime!
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/GUIRunTime.C (initApplication):
|
|||
|
|
* src/frontends/kde/GUIRunTime.C (initApplication):
|
|||
|
|
* src/frontends/xforms/GUIRunTime.C (initApplication):
|
|||
|
|
* src/frontends/GUIRunTime.h: added new function initApplication.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (sc_accept_word): change to add_to_session.
|
|||
|
|
|
|||
|
|
* src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
|
|||
|
|
|
|||
|
|
2000-09-08 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): don't display the "default" entry as
|
|||
|
|
we have already "Reset".
|
|||
|
|
|
|||
|
|
* src/language.C (initL): inserted "default" language and made this
|
|||
|
|
THE default language (and not american!)
|
|||
|
|
|
|||
|
|
* src/paragraph.C: inserted handling of "default" language!
|
|||
|
|
|
|||
|
|
* src/lyxfont.C: ditto
|
|||
|
|
|
|||
|
|
* src/text.C: ditto
|
|||
|
|
|
|||
|
|
* src/paragraph.C: output the \\par only if we have a following
|
|||
|
|
paragraph otherwise it's not needed.
|
|||
|
|
|
|||
|
|
2000-09-05 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* config/pspell.m4: added entry to lyx-flags
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: modified version from Kevin for using pspell
|
|||
|
|
|
|||
|
|
2000-09-01 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
* src/frontends/gnome/Makefile.am
|
|||
|
|
* src/frontends/gnome/FormCitation.C
|
|||
|
|
* src/frontends/gnome/FormCitation.h
|
|||
|
|
* src/frontends/gnome/diainsertcitation_callbacks.c
|
|||
|
|
* src/frontends/gnome/diainsertcitation_callbacks.h
|
|||
|
|
* src/frontends/gnome/diainsertcitation_interface.c
|
|||
|
|
* src/frontends/gnome/diainsertcitation_interface.h
|
|||
|
|
* src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
|
|||
|
|
dialog for Gnome frontend
|
|||
|
|
|
|||
|
|
* src/main.C: Gnome libraries require keeping application name
|
|||
|
|
and its version as strings
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/mainapp.C: Change the name of the main window
|
|||
|
|
from GnomeLyX to PACKAGE
|
|||
|
|
|
|||
|
|
2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/Liason.C: add "using: declaration.
|
|||
|
|
|
|||
|
|
2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/math_macro.C (Metrics): Set the size of the template
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.C (Latex): Fixed the returned value
|
|||
|
|
|
|||
|
|
2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.C (add_options): New function.
|
|||
|
|
(SetViewer): Change $$FName into '$$FName'.
|
|||
|
|
(View): Add options when running xdvi
|
|||
|
|
(Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
|
|||
|
|
(Convert): The 3rd parameter is now the desired filename. Converts
|
|||
|
|
calls to lyx::rename if necessary.
|
|||
|
|
Add options when running dvips.
|
|||
|
|
(dvi_papersize,dvips_options): New methods.
|
|||
|
|
|
|||
|
|
* src/exporter.C (Export): Use getLatexName() instead of fileName().
|
|||
|
|
|
|||
|
|
* src/frontends/Liason.C (printBuffer): Removed duplicate code by
|
|||
|
|
using a call to Converter::dvips_options.
|
|||
|
|
Fixed to work with nex export code.
|
|||
|
|
|
|||
|
|
* src/support/copy.C
|
|||
|
|
* src/support/rename.C: New files
|
|||
|
|
|
|||
|
|
* src/support/syscall.h
|
|||
|
|
* src/support/syscall.C: Added Starttype SystemDontWait.
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: Changed to work with new export code
|
|||
|
|
|
|||
|
|
* lib/configure.m4: Changed to work with new export code
|
|||
|
|
|
|||
|
|
* src/encoding.C: Changed latex name for iso8859_7 encoding.
|
|||
|
|
|
|||
|
|
2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C: added two using directives
|
|||
|
|
so that code compiles with DEC cxx.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
|
|||
|
|
to work correctly! Also now supports the additional elements
|
|||
|
|
neeeded by natbib.
|
|||
|
|
|
|||
|
|
2000-09-01 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.C: renamed all the references to
|
|||
|
|
PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
|
|||
|
|
since it's a const not a type.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/ButtonController.h: cleanup before Lars does.
|
|||
|
|
|
|||
|
|
2000-08-31 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: Various changes to look if the filename has
|
|||
|
|
an extension and if not add it for inline previewing.
|
|||
|
|
|
|||
|
|
2000-08-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.h: add a Button AllButtons.
|
|||
|
|
make buttonStatus and isReadOnly be const methods. (also reflect
|
|||
|
|
this in derived classes.)
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.C: remove sum_ and bogus_
|
|||
|
|
(nextState): change to be static inline, pass the StateMachine as
|
|||
|
|
a const reference
|
|||
|
|
(PreferencesPolicy): remove casts
|
|||
|
|
(OkCancelPolicy): remvoe casts
|
|||
|
|
(OkCancelReadOnlyPolicy): remove casts
|
|||
|
|
(NoRepeatedApplyReadOnlyPolicy): remove casts
|
|||
|
|
(OkApplyCancelReadOnlyPolicy): remove casts
|
|||
|
|
(OkApplyCancelPolicy): remove casts
|
|||
|
|
(NoRepeatedApplyPolicy): remove casts
|
|||
|
|
|
|||
|
|
2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/converter.C: added some using directives
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.C: changes to overcome
|
|||
|
|
"need lvalue" error with DEC c++
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (c-tor): use C callback
|
|||
|
|
to WMHideCB for DEC c++
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C: added using directive
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_document.C.patch: use C callback
|
|||
|
|
to BulletBMTableCB for DEC c++
|
|||
|
|
|
|||
|
|
2000-08-31 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): build combo_language2 which is part of
|
|||
|
|
character dialog separately from old document dialogs combo_language.
|
|||
|
|
Stops a segfault.
|
|||
|
|
|
|||
|
|
2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
|
|||
|
|
Removed LFUN_REF_CREATE.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C: Added new tags: toc and references
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
|
|||
|
|
(add_lastfiles, add_documents, add_formats): Removed the unused smn
|
|||
|
|
parameter.
|
|||
|
|
(add_toc, add_references): New methods.
|
|||
|
|
(create_submenu): Handle correctly the case when there is a
|
|||
|
|
seperator after optional menu items.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
|
|||
|
|
(dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
|
|||
|
|
(dispatch): New code for LFUN_GOTO_PARAGRAPH.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormToc.C (apply): Use Dispatch.
|
|||
|
|
|
|||
|
|
2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/converter.[Ch]: New file for converting between different
|
|||
|
|
formats.
|
|||
|
|
|
|||
|
|
* src/export.[Ch]: New file for exporting a LyX file to different
|
|||
|
|
formats.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
|
|||
|
|
MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
|
|||
|
|
PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
|
|||
|
|
MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
|
|||
|
|
MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
|
|||
|
|
RunDocBook, MenuExport.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): Use the Exporter::Export and
|
|||
|
|
Exporter::Preview methods if NEW_EXPORT is defined.
|
|||
|
|
|
|||
|
|
* src/buffer.C (Dispatch): Use Exporter::Export.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: Added new tags: \converter and \viewer.
|
|||
|
|
|
|||
|
|
* src/commandtags.h
|
|||
|
|
* src/LyXAction.C: Define new lyx-function: buffer-update.
|
|||
|
|
Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
|
|||
|
|
when NEW_EXPORT is defined.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C: Added new tags: updateformats and viewformats.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: Added submenus "view" and "update" to the
|
|||
|
|
"file" menu.
|
|||
|
|
|
|||
|
|
* src/filetools.C (GetExtension): New function.
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
|
|||
|
|
|
|||
|
|
2000-08-29 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/bind/xemacs.bind: update a binding due to Juergen's recent work
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (checkReadOnly): new function
|
|||
|
|
(EnableDocumentLayout): removed
|
|||
|
|
(DisableDocumentLayout): removed
|
|||
|
|
(build): make use of ButtonController's read-only handling to
|
|||
|
|
de/activate various objects. Replaces both of the above functions.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/ButtonController.h (readWrite): was read_write
|
|||
|
|
(readOnly): was read_only
|
|||
|
|
(refresh): fixed dumb mistakes with read_only_ handling
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_document.fd:
|
|||
|
|
* src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
|
|||
|
|
tabbed dialogs so the tabs look more like tabs and so its easier to
|
|||
|
|
work out which is the current tab.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
|
|||
|
|
segfault with form_table
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
|
|||
|
|
|
|||
|
|
2000-08-28 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* acconfig.h: added USE_PSPELL.
|
|||
|
|
|
|||
|
|
* src/config.h.in: added USE_PSPELL.
|
|||
|
|
|
|||
|
|
* autogen.sh: added pspell.m4
|
|||
|
|
|
|||
|
|
* config/pspell.m4: new file.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: implemented support for pspell libary.
|
|||
|
|
|
|||
|
|
2000-08-25 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): renamed LFUN_TABLE to
|
|||
|
|
LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
|
|||
|
|
|
|||
|
|
* src/lyxscreen.h: add force_clear variable and fuction to force
|
|||
|
|
a clear area when redrawing in LyXText.
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): look if the screen forces a redraw.
|
|||
|
|
|
|||
|
|
2000-08-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* some whitespace and comment changes.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
|
|||
|
|
|
|||
|
|
* src/buffer.C: up te LYX_FORMAT to 2.17
|
|||
|
|
|
|||
|
|
2000-08-23 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (tripleClick): disable this when in a
|
|||
|
|
locking_inset.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (pasteSelection): delete the insets
|
|||
|
|
LyXText as it is not valid anymore.
|
|||
|
|
(copySelection): new function.
|
|||
|
|
(pasteSelection): new function.
|
|||
|
|
(cutSelection): new function.
|
|||
|
|
(LocalDispatch): implemented cut/copy/paste of cell selections.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (resizeLyXText): don't need resize if I still
|
|||
|
|
don't have a LyXText.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): a NEW_TABULAR define too much.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
|
|||
|
|
NEW_TABULAR define.
|
|||
|
|
|
|||
|
|
2000-08-22 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
|
|||
|
|
ifdef form_table out if NEW_TABULAR.
|
|||
|
|
|
|||
|
|
2000-08-21 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
|
|||
|
|
(draw): fixed draw position so that the cursor is positioned in the
|
|||
|
|
right place.
|
|||
|
|
(InsetMotionNotify): hide/show cursor so the position is updated.
|
|||
|
|
(GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
|
|||
|
|
using cellstart() function where it should be used.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (draw): ditto.
|
|||
|
|
|
|||
|
|
* src/tabular.C: fixed initialization of some missing variables and
|
|||
|
|
made BoxType into an enum.
|
|||
|
|
|
|||
|
|
2000-08-22 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
|
|||
|
|
stock menu item using action numerical value, not its string
|
|||
|
|
representation.
|
|||
|
|
|
|||
|
|
|
|||
|
|
2000-08-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
|
|||
|
|
GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/GUIRunTime.C: new file
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
|
|||
|
|
GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
|
|||
|
|
|
|||
|
|
* src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
|
|||
|
|
|
|||
|
|
* src/frontends/kde/GUIRunTime.C: new file
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
|
|||
|
|
GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/GUIRunTime.C: new file
|
|||
|
|
|
|||
|
|
* src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
|
|||
|
|
GUIRunTime.C
|
|||
|
|
|
|||
|
|
* src/frontends/GUIRunTime.h: removed constructor and destructor,
|
|||
|
|
small change to documetentation.
|
|||
|
|
|
|||
|
|
* src/frontends/GUIRunTime.C: removed file
|
|||
|
|
|
|||
|
|
* src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: enable NEW_TABULAR as default
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeySym): remove some commented code
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
|
|||
|
|
NEW_TABULAR around the fd_form_table_options.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (runTime): call the static member function as
|
|||
|
|
GUIRunTime::runTime().
|
|||
|
|
|
|||
|
|
2000-08-21 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
|
|||
|
|
policy here also.
|
|||
|
|
|
|||
|
|
2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
|
|||
|
|
|
|||
|
|
2000-08-21 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
|
|||
|
|
keep Garst happy ;-)
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (build): use setOK
|
|||
|
|
* src/frontends/xforms/FormDocument.C (build): use setOK
|
|||
|
|
(FormDocument): use the appropriate policy.
|
|||
|
|
|
|||
|
|
2000-08-21 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/ButtonController.h (class ButtonController): Allow
|
|||
|
|
automatic [de]activation of arbitrary objects when in a read-only state.
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.h: More documentation
|
|||
|
|
(isReadOnly): added to support the above.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
|
|||
|
|
|
|||
|
|
2000-08-18 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (getStatus): changed to return func_status.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
|
|||
|
|
display toggle menu entries if they are.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
|
|||
|
|
new document layout now.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: ditto
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C: ditto
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C: ditto
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: removed paper and quotes layout as they are now
|
|||
|
|
all in the document layout tabbed folder.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_document.fd: added Restore
|
|||
|
|
button and callbacks for all inputs for Allan's ButtonPolicy.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
|
|||
|
|
(CheckChoiceClass): added missing params setting on class change.
|
|||
|
|
(UpdateLayoutDocument): added for updating the layout on params.
|
|||
|
|
(build): forgot to RETURN_ALWAYS input_doc_spacing.
|
|||
|
|
(FormDocument): Implemented Allan's ButtonPolicy with the
|
|||
|
|
PreferencesPolicy.
|
|||
|
|
|
|||
|
|
2000-08-17 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
|
|||
|
|
so we can at least see the credits again.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C: Used the appropriate button
|
|||
|
|
controller calls for the appropriate callbacks. Note that since Ok
|
|||
|
|
calls apply followed by cancel, and apply isn't a valid input for the
|
|||
|
|
APPLIED state, the bc_ calls have to be made in the static callback not
|
|||
|
|
within each of the real callbacks.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
|
|||
|
|
(setOk): renamed from setOkay()
|
|||
|
|
|
|||
|
|
2000-08-17 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
|
|||
|
|
in the implementation part.
|
|||
|
|
(composeUIInfo): don't show optional menu-items.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
|
|||
|
|
|
|||
|
|
* src/bufferview_funcs.C (CurrentState): fixed to show also the
|
|||
|
|
text-state when in a text-inset.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
|
|||
|
|
|
|||
|
|
2000-08-17 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
* src/frontends/gnome/FormIndex.C
|
|||
|
|
* src/frontends/gnome/FormIndex.h
|
|||
|
|
* src/frontends/gnome/FormToc.C
|
|||
|
|
* src/frontends/gnome/FormToc.h
|
|||
|
|
* src/frontends/gnome/dialogs
|
|||
|
|
* src/frontends/gnome/diatoc_callbacks.c
|
|||
|
|
* src/frontends/gnome/diatoc_callbacks.h
|
|||
|
|
* src/frontends/gnome/diainsertindex_callbacks.h
|
|||
|
|
* src/frontends/gnome/diainsertindex_callbacks.c
|
|||
|
|
* src/frontends/gnome/diainsertindex_interface.c
|
|||
|
|
* src/frontends/gnome/diainsertindex_interface.h
|
|||
|
|
* src/frontends/gnome/diatoc_interface.h
|
|||
|
|
* src/frontends/gnome/diatoc_interface.c
|
|||
|
|
* src/frontends/gnome/Makefile.am: Table of Contents and
|
|||
|
|
Insert Index dialogs implementation for Gnome frontend
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.C: remove historical comments
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/diainserturl_interface.c: make the dialog
|
|||
|
|
resizable
|
|||
|
|
|
|||
|
|
2000-08-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
|
|||
|
|
destructor. Don't definde if you don't need it
|
|||
|
|
(processEvents): made static, non-blocking events processing for
|
|||
|
|
xforms.
|
|||
|
|
(runTime): static method. event loop for xforms
|
|||
|
|
* similar as above for kde and gnome.
|
|||
|
|
|
|||
|
|
* src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
|
|||
|
|
new Pimpl is correct
|
|||
|
|
(runTime): new method calss the real frontends runtime func.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
|
|||
|
|
|
|||
|
|
2000-08-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): fix the "No change" gettext missing
|
|||
|
|
|
|||
|
|
2000-08-16 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (runTime): added GUII RunTime support.
|
|||
|
|
|
|||
|
|
* src/frontends/Makefile.am:
|
|||
|
|
* src/frontends/GUIRunTime.[Ch]:
|
|||
|
|
* src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
|
|||
|
|
* src/frontends/kde/GUIRunTime_pimpl.[Ch]:
|
|||
|
|
* src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
|
|||
|
|
|
|||
|
|
* src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
|
|||
|
|
as this is already set in ${FRONTEND_INCLUDE} if needed.
|
|||
|
|
|
|||
|
|
* configure.in (CPPFLAGS): setting the include dir for the frontend
|
|||
|
|
directory and don't set FRONTEND=xforms for now as this is executed
|
|||
|
|
always.
|
|||
|
|
|
|||
|
|
2000-08-16 John Levon (moz@compsoc.man.ac.uk)
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am:
|
|||
|
|
* src/frontends/kde/FormUrl.C:
|
|||
|
|
* src/frontends/kde/FormUrl.h:
|
|||
|
|
* src/frontends/kde/formurldialog.h:
|
|||
|
|
* src/frontends/kde/formurldialog.C: Add KDE URL dialog
|
|||
|
|
|
|||
|
|
2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
|
|||
|
|
|
|||
|
|
* src/frontend/Makefile.am: Add gnome and kde to dist tar file.
|
|||
|
|
|
|||
|
|
2000-08-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (workAreaKeyPress): enable the
|
|||
|
|
processKeySym
|
|||
|
|
|
|||
|
|
2000-08-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (work_area_handler): more work to get te
|
|||
|
|
FL_KEYBOARD to work with xforms 0.88 too, please test.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
|
|||
|
|
|
|||
|
|
2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.C: make gcc happy when compiling with
|
|||
|
|
-pedantic
|
|||
|
|
|
|||
|
|
2000-08-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/Timeout.h: remove Qt::emit hack.
|
|||
|
|
|
|||
|
|
* several files: changes to allo doc++ compilation
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeySym): new method
|
|||
|
|
(processKeyEvent): comment out if FL_REVISION < 89
|
|||
|
|
|
|||
|
|
* src/WorkArea.C: change some debugging levels.
|
|||
|
|
(WorkArea): set wantkey to FL_KEY_ALL
|
|||
|
|
(work_area_handler): enable the FL_KEYBOARD clause, this enables
|
|||
|
|
clearer code and the use of compose with XForms 0.89. Change to
|
|||
|
|
use signals instead of calling methods in bufferview directly.
|
|||
|
|
|
|||
|
|
* src/Painter.C: change some debugging levels.
|
|||
|
|
|
|||
|
|
* src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
|
|||
|
|
if FL_REVISION < 89
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
|
|||
|
|
(workAreaKeyPress): new method
|
|||
|
|
|
|||
|
|
2000-08-14 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
|
|||
|
|
|
|||
|
|
* config/kde.m4: addes some features
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
|
|||
|
|
include missing xforms dialogs.
|
|||
|
|
|
|||
|
|
* src/Timeout.h: a hack to be able to compile with qt/kde.
|
|||
|
|
|
|||
|
|
* sigc++/.cvsignore: added acinclude.m4
|
|||
|
|
|
|||
|
|
* lib/.cvsignore: added listerros
|
|||
|
|
|
|||
|
|
* src/frontends/Makefile.am: modified for now to ALWAYS compile the
|
|||
|
|
xforms tree as objects are needed for other frontends.
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
|
|||
|
|
linking with not yet implemented xforms objects.
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
|
|||
|
|
|
|||
|
|
2000-08-14 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormGraphics.h:
|
|||
|
|
* src/frontends/xforms/FormGraphics.C:
|
|||
|
|
* src/frontends/xforms/RadioButtonGroup.h:
|
|||
|
|
* src/frontends/xforms/RadioButtonGroup.C:
|
|||
|
|
* src/insets/insetgraphics.h:
|
|||
|
|
* src/insets/insetgraphics.C:
|
|||
|
|
* src/insets/insetgraphicsParams.h:
|
|||
|
|
* src/insets/insetgraphicsParams.C: Changed indentation to use tabs
|
|||
|
|
instead of spaces, and various other indentation issues to make the
|
|||
|
|
sources more consistent.
|
|||
|
|
|
|||
|
|
2000-08-14 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/dialogs/diaprint.glade
|
|||
|
|
* src/frontends/gnome/FormPrint.C
|
|||
|
|
* src/frontends/gnome/FormPrint.h
|
|||
|
|
* src/frontends/gnome/diaprint_callbacks.c
|
|||
|
|
* src/frontends/gnome/diaprint_callbacks.h
|
|||
|
|
* src/frontends/gnome/diaprint_interface.c
|
|||
|
|
* src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
|
|||
|
|
implementation
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/dialogs/diainserturl.glade
|
|||
|
|
* src/frontends/gnome/FormUrl.C
|
|||
|
|
* src/frontends/gnome/FormUrl.h
|
|||
|
|
* src/frontends/gnome/diainserturl_callbacks.c
|
|||
|
|
* src/frontends/gnome/diainserturl_callbacks.h
|
|||
|
|
* src/frontends/gnome/diainserturl_interface.c
|
|||
|
|
* src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
|
|||
|
|
Gnome implementation
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Dialogs.C
|
|||
|
|
* src/frontends/gnome/Makefile.am: added Print, Insert Url and
|
|||
|
|
all other dialogs. Copy all unimplemented dialogs from Xforms
|
|||
|
|
frontend
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/support.c
|
|||
|
|
* src/frontends/gnome/support.h: support files generated by Glade
|
|||
|
|
|
|||
|
|
* autogen.sh
|
|||
|
|
* configure.in
|
|||
|
|
* config/gnome.m4: Gnome configuration scripts
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
|
|||
|
|
configure --help message
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
|
|||
|
|
only if there are no events pendling in Gnome/Gtk. This enhances
|
|||
|
|
the performance of menus.
|
|||
|
|
|
|||
|
|
|
|||
|
|
2000-08-14 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/Makefile.am: listerrors cleaning
|
|||
|
|
|
|||
|
|
* lib/listerrors: removed -- generated file
|
|||
|
|
* acinclude.m4: ditto
|
|||
|
|
* sigc++/acinclude.m4: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_citation.fd:
|
|||
|
|
* src/frontends/xforms/FormCitation.C (setSize): Made the form a more
|
|||
|
|
manageable size.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/makefile: I renamed the `install` target
|
|||
|
|
`updatesrc` and now we have a `test` target that does what `updatesrc`
|
|||
|
|
used to do. I didn't like having an install target that wasn't related
|
|||
|
|
to the dist.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Form*.[hC]: Removed the free() member functions
|
|||
|
|
on all except FormGraphics. This may yet happen. Followed by a major
|
|||
|
|
cleanup including using FL_TRANSIENT for most of the dialogs. More
|
|||
|
|
changes to come when the ButtonController below is introduced.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/ButtonController.h: New file for managing up to
|
|||
|
|
four buttons on a dialog according to an externally defined policy.
|
|||
|
|
* src/frontends/xforms/Makefile.am: added above
|
|||
|
|
|
|||
|
|
* src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
|
|||
|
|
Apply and Cancel/Close buttons and everything in between and beyond.
|
|||
|
|
* src/frontends/Makefile.am: added above.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd:
|
|||
|
|
* src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
|
|||
|
|
and removed variable 'status' as a result. Fixed the set_minsize thing.
|
|||
|
|
Use the new screen-font-update after checking screen fonts were changed
|
|||
|
|
Added a "Restore" button to restore the original lyxrc values while
|
|||
|
|
editing. This restores everything not just the last input changed.
|
|||
|
|
That's still a tricky one. As is the "LyX: this shouldn't happen..."
|
|||
|
|
|
|||
|
|
* src/LyXAction.C: screen-font-update added for updating buffers after
|
|||
|
|
screen font settings have been changed.
|
|||
|
|
* src/commandtags.h: ditto
|
|||
|
|
* src/lyxfunc.C: ditto
|
|||
|
|
|
|||
|
|
* forms/lyx.fd: removed screen fonts dialog.
|
|||
|
|
* src/lyx_gui.C: ditto
|
|||
|
|
* src/menus.[Ch]: ditto
|
|||
|
|
* src/lyx.[Ch]: ditto
|
|||
|
|
* src/lyx_cb.C: ditto + code from here moved to make
|
|||
|
|
screen-font-update. And people wonder why progress on GUII is
|
|||
|
|
slow. Look at how scattered this stuff was! It takes forever
|
|||
|
|
just find it all.
|
|||
|
|
|
|||
|
|
* forms/fdfix.sh: Fixup the spacing after commas.
|
|||
|
|
* forms/makefile: Remove date from generated files. Fewer clashes now.
|
|||
|
|
* forms/bullet_forms.C.patch: included someones handwritten changes
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
|
|||
|
|
once I've discovered why LyXRC was made noncopyable.
|
|||
|
|
* src/lyx_main.C: ditto
|
|||
|
|
|
|||
|
|
2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/fdfix.sh:
|
|||
|
|
* src/frontends/xforms/forms/fdfixh.sed:
|
|||
|
|
* src/frontends/xforms/forms/fdfixc.sed: New file from Angus
|
|||
|
|
* src/frontends/xforms/Form*.[hC]:
|
|||
|
|
* src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
|
|||
|
|
scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
|
|||
|
|
provide a destructor for the struct FD_form_xxxx. Another version of
|
|||
|
|
the set_[max|min]size workaround and a few other cleanups. Actually,
|
|||
|
|
Angus' patch from 20000809.
|
|||
|
|
|
|||
|
|
2000-08-13 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.C (Clone): Added several fields that needed
|
|||
|
|
copying.
|
|||
|
|
|
|||
|
|
2000-08-11 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.C (InsetGraphics): changing init
|
|||
|
|
order because of warnings.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/makefile: adding patching .C with
|
|||
|
|
.C.patch files.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/fdfix.sh: changing patching file .c
|
|||
|
|
from .C.patch to .c.patch
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.C (FormCommand): changing init
|
|||
|
|
order because of warning.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
|
|||
|
|
|
|||
|
|
* src/frontends/Liason.C (setMinibuffer): new helper function
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): calling new Document-Layout
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: commented out PaperLayout entry
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/form_document.[Ch]: new added files
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormDocument.[Ch]: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_document.fd: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_document.C.patch: ditto
|
|||
|
|
|
|||
|
|
2000-08-10 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
|
|||
|
|
(InsetGraphics): initialized cacheHandle to 0.
|
|||
|
|
(draw): changed call to updateInset to status=CHANGE_IN_DRAW.
|
|||
|
|
|
|||
|
|
2000-08-10 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCache.h:
|
|||
|
|
* src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
|
|||
|
|
correctly as a cache.
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCacheItem.h:
|
|||
|
|
* src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
|
|||
|
|
reference counting.
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCacheItem_pimpl.h:
|
|||
|
|
* src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
|
|||
|
|
GraphicsCacheItem.
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.h:
|
|||
|
|
* src/insets/insetgraphics.C: Changed from using a signal notification
|
|||
|
|
to polling when image is not loaded.
|
|||
|
|
|
|||
|
|
2000-08-10 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
|
|||
|
|
that there are two functions that have to been taken out of line by
|
|||
|
|
hand and aren't taken care of in the script. (Just a reminder note)
|
|||
|
|
|
|||
|
|
* sigc++/macros/*.h.m4: Updated as above.
|
|||
|
|
|
|||
|
|
2000-08-09 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (draw): small fix for clearing rectangle.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C: make drawing of single cell smarter.
|
|||
|
|
|
|||
|
|
2000-08-09 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.C
|
|||
|
|
* src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
|
|||
|
|
implementation: new files
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/mainapp.C
|
|||
|
|
* src/frontends/gnome/mainapp.h: Gnome main window (temporary
|
|||
|
|
implementation)
|
|||
|
|
|
|||
|
|
* src/main.C: create Gnome main window
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.h
|
|||
|
|
* src/frontends/Menubar.C
|
|||
|
|
* src/frontends/Menubar.h: added method Menubar::update that calls
|
|||
|
|
Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
|
|||
|
|
|
|||
|
|
* src/LyXView.C: calls Menubar::update to update the state
|
|||
|
|
of menu items
|
|||
|
|
|
|||
|
|
* src/frontends/gnome/Makefile.am: added new files
|
|||
|
|
|
|||
|
|
* src/frontends/Makefile.am: added frontend compiler options
|
|||
|
|
|
|||
|
|
2000-08-08 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (close):
|
|||
|
|
* src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
|
|||
|
|
documents if exiting without saving.
|
|||
|
|
|
|||
|
|
* src/buffer.C (save): use removeAutosaveFile()
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (removeAutosaveFile): new function.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuWrite): returns a bool now.
|
|||
|
|
(MenuWriteAs): check if file could really be saved and revert to the
|
|||
|
|
old name if not.
|
|||
|
|
(MenuWriteAs): removing old autosavefile if existant.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
|
|||
|
|
before Goto toggle declaration, because of compiler warning.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormRef.C: forgot include of <algorithm>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (MenuNew): small fix.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (newFile):
|
|||
|
|
* src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: added new_ask_filename tag
|
|||
|
|
|
|||
|
|
2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/lyx.fd: removed code pertaining to form_ref
|
|||
|
|
* src/lyx.[Ch]: ditto
|
|||
|
|
* src/lyx_cb.C: ditto
|
|||
|
|
* src/lyx_gui.C: ditto
|
|||
|
|
* src/lyx_gui_misc.C: ditto
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (restorePosition): update buffer only
|
|||
|
|
if file has changed
|
|||
|
|
|
|||
|
|
* src/commandtags.h (LFUN_REFTOGGLE): removed
|
|||
|
|
(LFUN_INSERT_REF): renamed LFUN_REF_INSERT
|
|||
|
|
(LFUN_REFGOTO): renamed LFUN_REF_GOTO
|
|||
|
|
(LFUN_REFBACK): renamed LFUN_REF_BACK
|
|||
|
|
|
|||
|
|
* src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
|
|||
|
|
* src/menus.C: ditto
|
|||
|
|
* src/lyxfunc.C (Dispatch): ditto.
|
|||
|
|
InsertRef dialog is now GUI-independent.
|
|||
|
|
|
|||
|
|
* src/texrow.C: added using std::endl;
|
|||
|
|
|
|||
|
|
* src/insets/insetref.[Ch]: strip out large amounts of code.
|
|||
|
|
The inset is now a container and this functionality is now
|
|||
|
|
managed by a new FormRef dialog
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h (showRef, createRef): new signals
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormIndex.[Ch],
|
|||
|
|
src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
|
|||
|
|
when setting dialog's min/max size
|
|||
|
|
* src/frontends/xforms/FormIndex.[Ch]: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormRef.[Ch],
|
|||
|
|
src/frontends/xforms/forms/form_ref.fd: new xforms
|
|||
|
|
implementation of an InsetRef dialog
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCache.[Ch]: small changes to compile with
|
|||
|
|
DEC cxx
|
|||
|
|
|
|||
|
|
* src/graphics/XPM_Renderer.C (isImageFormatOK):
|
|||
|
|
ios::nocreate is not part of the standard. Removed.
|
|||
|
|
|
|||
|
|
2000-08-07 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/graphics/Renderer.h:
|
|||
|
|
* src/graphics/Renderer.C: Added base class for rendering of different
|
|||
|
|
image formats into Pixmaps.
|
|||
|
|
|
|||
|
|
* src/graphics/XPM_Renderer.h:
|
|||
|
|
* src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
|
|||
|
|
in a different class.
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
|
|||
|
|
easily add support for other formats.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: plugged a leak of an X resource.
|
|||
|
|
|
|||
|
|
2000-08-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.[Ch]: make all metods static.
|
|||
|
|
|
|||
|
|
* development/Code_rules/Rules: more work, added section on
|
|||
|
|
Exceptions, and a References section.
|
|||
|
|
|
|||
|
|
* a lot of header files: work to make doc++ able to generate the
|
|||
|
|
source documentation, some workarounds of doc++ problems. Doc++ is
|
|||
|
|
now able to generate the documentation.
|
|||
|
|
|
|||
|
|
2000-08-07 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (recomputeTextInsets): removed function
|
|||
|
|
|
|||
|
|
* src/tabular.C (SetWidthOfMulticolCell):
|
|||
|
|
(SetWidthOfCell):
|
|||
|
|
(calculate_width_of_column_NMC): fixed return value so that it really
|
|||
|
|
only returns true if the column-width has changed (there where
|
|||
|
|
problems with muliticolumn-cells in this column).
|
|||
|
|
|
|||
|
|
2000-08-04 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
|
|||
|
|
also on the scrollstatus of the inset.
|
|||
|
|
(workAreaMotionNotify): ditto.
|
|||
|
|
|
|||
|
|
* src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
|
|||
|
|
|
|||
|
|
2000-08-01 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (resetPos): scroll tabular automatically.
|
|||
|
|
|
|||
|
|
* src/commandtags.h:
|
|||
|
|
* src/LyXAction.C (init):
|
|||
|
|
* src/insets/inset.C (LocalDispatch): added support for
|
|||
|
|
LFUN_SCROLL_INSET.
|
|||
|
|
|
|||
|
|
* src/insets/inset.C (scroll): new functions.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (removeNewlines): new function.
|
|||
|
|
(SetAutoBreakRows): removes forced newlines in the text of the
|
|||
|
|
paragraph if autoBreakRows is set to false.
|
|||
|
|
|
|||
|
|
* src/tabular.C (Latex): generates a parbox around the cell contents
|
|||
|
|
if needed.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormTabular.C (local_update): removed
|
|||
|
|
the radio_useparbox button.
|
|||
|
|
|
|||
|
|
* src/tabular.C (UseParbox): new function
|
|||
|
|
|
|||
|
|
2000-08-06 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCache.h:
|
|||
|
|
* src/graphics/GraphicsCache.C:
|
|||
|
|
* src/graphics/GraphicsCacheItem.h:
|
|||
|
|
* src/graphics/GraphicsCacheItem.C: Made them to actually do something
|
|||
|
|
usefull.
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.h:
|
|||
|
|
* src/insets/insetgraphics.C: Added the use of the GraphicsCache
|
|||
|
|
and the drawing of the inline image.
|
|||
|
|
|
|||
|
|
* src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
|
|||
|
|
loaded into the wrong position.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
|
|||
|
|
launched.
|
|||
|
|
|
|||
|
|
2000-08-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/translator.h: move all typedefs to public section
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (MakeLatexName): return string const
|
|||
|
|
(QuoteName): ditto
|
|||
|
|
(TmpFileName): ditto
|
|||
|
|
(FileOpenSearch): ditto
|
|||
|
|
(FileSearch): ditto
|
|||
|
|
(LibFileSearch): ditto
|
|||
|
|
(i18nLibFileSearch): ditto
|
|||
|
|
(GetEnv): ditto
|
|||
|
|
(GetEnvPath): ditto
|
|||
|
|
(CreateTmpDir): ditto
|
|||
|
|
(CreateBufferTmpDir): ditto
|
|||
|
|
(CreateLyXTmpDir): ditto
|
|||
|
|
(GetCWD): ditto
|
|||
|
|
(OnlyPath): ditto
|
|||
|
|
(MakeAbsPath): ditto
|
|||
|
|
(AddName): ditto
|
|||
|
|
(OnlyFilename): ditto
|
|||
|
|
(ExpandPath): ditto
|
|||
|
|
(NormalizePath): ditto
|
|||
|
|
(CleanupPath): ditto
|
|||
|
|
(GetFileContents): ditto
|
|||
|
|
(ReplaceEnvironmentPath): ditto
|
|||
|
|
(MakeRelPath): ditto
|
|||
|
|
(AddPath): ditto
|
|||
|
|
(ChangeExtension): ditto
|
|||
|
|
(MakeDisplayPath): ditto
|
|||
|
|
(do_popen): return cmdret const
|
|||
|
|
(findtexfile): return string const
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.h: add some /// to please doc++
|
|||
|
|
|
|||
|
|
* src/frontends/DialogBase.h (endif): add some /// to please doc++
|
|||
|
|
|
|||
|
|
* src/texrow.C (same_rownumber): functor to use with find_if
|
|||
|
|
(getIdFromRow): rewritten to use find_if and to not update the
|
|||
|
|
positions. return true if row is found
|
|||
|
|
(increasePos): new method, use to update positions
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.C (verifyTable): new method
|
|||
|
|
(pushTable): use it
|
|||
|
|
(Pimpl): use it
|
|||
|
|
(GetString): return string const
|
|||
|
|
(pushTable): rewrite to use std::stack
|
|||
|
|
(popTable): ditto
|
|||
|
|
(setFile): better check
|
|||
|
|
(setStream): ditto
|
|||
|
|
|
|||
|
|
* src/lyxlex.h: make LyXLex noncopyable
|
|||
|
|
|
|||
|
|
* src/lyxlex.C (text): return char const * const
|
|||
|
|
(GetString): return string const
|
|||
|
|
(getLongString): return string const
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (askForText): return pair<...> const
|
|||
|
|
|
|||
|
|
* src/lastfiles.[Ch] (operator): return string const
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): pass string to
|
|||
|
|
istringstream not char const *.
|
|||
|
|
move token.end() out of loop.
|
|||
|
|
(readFile): move initializaton of token
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (insertErrors): run texrow.increasePos if
|
|||
|
|
getIdFromRow is successful.
|
|||
|
|
|
|||
|
|
* lib/bind/emacs.bind: don't include menus bind
|
|||
|
|
|
|||
|
|
* development/Code_rules/Rules: the beginnings of making this
|
|||
|
|
better and covering more of the unwritten rules that we have.
|
|||
|
|
|
|||
|
|
* development/Code_rules/Recommendations: a couple of wording
|
|||
|
|
changes.
|
|||
|
|
|
|||
|
|
2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/strerror.c: remove C++ comment.
|
|||
|
|
|
|||
|
|
2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
|
|||
|
|
LFUN_INDEX_INSERT_LAST
|
|||
|
|
|
|||
|
|
* src/texrow.C (getIdFromRow): changed from const_iterator to
|
|||
|
|
iterator, allowing code to compile with DEC cxx
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch]: made vector<string>
|
|||
|
|
stores part of the class, as suggested by Allan. Will allow
|
|||
|
|
multiple LyXViews.
|
|||
|
|
(apply): test to apply uses InsetCommandParams operator!=
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormIndex.C: moved set_minsize into build
|
|||
|
|
(apply): test to apply uses InsetCommandParams operator!=
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormToc.[Ch]: made vector<string>
|
|||
|
|
stores part of the class.
|
|||
|
|
(update): removed limits on min/max size.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormUrl.C: moved set_minsize into build
|
|||
|
|
(apply): test to apply uses InsetCommandParams operator!=
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.[Ch] InsetCommand made noncopyable
|
|||
|
|
(Read, Write, scanCommand, getCommand): moved functionality
|
|||
|
|
into InsetCommandParams.
|
|||
|
|
(Clone): removed
|
|||
|
|
(getScreenLabel): made pure virtual
|
|||
|
|
new InsetCommandParams operators== and !=
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
|
|||
|
|
c-tors based on InsetCommandParams. Removed others.
|
|||
|
|
* src/insets/insetinclude.[Ch]: ditto
|
|||
|
|
* src/insets/insetlabel.[Ch]: ditto
|
|||
|
|
* src/insets/insetparent.[Ch]: ditto
|
|||
|
|
* src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token, readInset): all
|
|||
|
|
insets derived from InsetCommand created using similar c-tors
|
|||
|
|
based on InsetCommandParams
|
|||
|
|
* src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
|
|||
|
|
* src/menus.C (ShowRefsMenu): ditto
|
|||
|
|
* src/paragraph.C (Clone): ditto
|
|||
|
|
* src/text2.C (SetCounter): ditto
|
|||
|
|
* src/lyxfunc.C (Dispatch) ditto
|
|||
|
|
Also recreated old InsetIndex behaviour exactly. Can now
|
|||
|
|
index-insert at the start of a paragraph and index-insert-last
|
|||
|
|
without launching the pop-up.
|
|||
|
|
|
|||
|
|
2000-08-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: mark te pdf options as non functional.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (strToInt): move initalization of tmpstr
|
|||
|
|
(isStrDbl): move tmpstr.end() out of loop.
|
|||
|
|
(strToDbl): move intialization of tmpstr
|
|||
|
|
(lowercase): return string const and move tmp.end() out of loop.
|
|||
|
|
(uppercase): return string const and move tmp.edn() out of loop.
|
|||
|
|
(prefixIs): add assertion
|
|||
|
|
(suffixIs): ditto
|
|||
|
|
(contains): ditto
|
|||
|
|
(contains): ditto
|
|||
|
|
(contains): ditto
|
|||
|
|
(containsOnly): ditto
|
|||
|
|
(containsOnly): ditto
|
|||
|
|
(containsOnly): ditto
|
|||
|
|
(countChar): make last arg char not char const
|
|||
|
|
(token): return string const
|
|||
|
|
(subst): return string const, move tmp.end() out of loop.
|
|||
|
|
(subst): return string const, add assertion
|
|||
|
|
(strip): return string const
|
|||
|
|
(frontStrip): return string const, add assertion
|
|||
|
|
(frontStrip): return string const
|
|||
|
|
(split): ditto
|
|||
|
|
(split): ditto
|
|||
|
|
(rsplit): ditto
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C: add inclde "LAssert.h"
|
|||
|
|
(isStrInt): move tmpstr.end() out of loop.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Toolbar_pimpl.C (activate): move
|
|||
|
|
toollist.end() out of loop.
|
|||
|
|
(deactivate): move toollist.end() out of loop.
|
|||
|
|
(update): move toollist.end() out of loop.
|
|||
|
|
(updateLayoutList): move tc.end() out of loop.
|
|||
|
|
(add): move toollist.end() out of loop.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
|
|||
|
|
md.end() out of loop.
|
|||
|
|
|
|||
|
|
* src/texrow.h: make getIdFromRow const, make rowlist mutable.
|
|||
|
|
|
|||
|
|
* src/texrow.C (getIdFromRow): make const, more rowlist.end() out
|
|||
|
|
of loop.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (Erase): move fontlist.end() out of loop.
|
|||
|
|
(Erase): move insetlist.end() out of loop.
|
|||
|
|
|
|||
|
|
* src/lyx_sendfax_main.C: make show_logfile static and to take a
|
|||
|
|
ref to const string as first arg. Move initialization of some
|
|||
|
|
variables, whitespace changes.
|
|||
|
|
|
|||
|
|
* src/kbmap.C (defkey): move table.end() out of loop.
|
|||
|
|
(kb_keymap): move table.end() out of loop.
|
|||
|
|
(findbinding): move table.end() out of loop.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (hasMenu): move end() out of loop.
|
|||
|
|
(getMenu): move end() out of loop.
|
|||
|
|
(getMenu): move menulist_.end() out of loop.
|
|||
|
|
|
|||
|
|
* src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
|
|||
|
|
out of loop.
|
|||
|
|
|
|||
|
|
* src/LColor.C (getFromGUIName): move infotab.end() out of loop.
|
|||
|
|
(getFromLyXName): move infotab.end() out of loop.
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
|
|||
|
|
-fvtable-thunks -ffunction-sections -fdata-sections
|
|||
|
|
|
|||
|
|
2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
|
|||
|
|
FORMS_H_LOCATION.
|
|||
|
|
|
|||
|
|
2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch],
|
|||
|
|
src/frontends/xforms/FormIndex.[Ch],
|
|||
|
|
src/frontends/xforms/FormToc.[Ch],
|
|||
|
|
src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
|
|||
|
|
|
|||
|
|
2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/commandtags.h: renamed, created some flags for citation
|
|||
|
|
and index
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C: stripped out old FD_index_form code
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (dispatch): use signals to insert index entry
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h: new signal createIndex
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.[Ch],
|
|||
|
|
src/frontends/xforms/FormCitation.[Ch],
|
|||
|
|
src/frontends/xforms/FormToc.[Ch],
|
|||
|
|
src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
|
|||
|
|
|
|||
|
|
* src/insets/insetindex.[Ch]: GUI-independent
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormIndex.[Ch],
|
|||
|
|
* src/frontends/xforms/forms/form_index.fd: xforms implementation
|
|||
|
|
of the Index dialog
|
|||
|
|
|
|||
|
|
2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
|
|||
|
|
before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
|
|||
|
|
|
|||
|
|
2000-08-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insetref.C (Latex): rewrite so that there is now
|
|||
|
|
question that a initialization is requested.
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.h: reenable the hide signal
|
|||
|
|
|
|||
|
|
2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
|
|||
|
|
fix handling of shortcuts (many bugs :)
|
|||
|
|
(add_lastfiles): ditto.
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: fix a few shortcuts.
|
|||
|
|
|
|||
|
|
2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
|
|||
|
|
|
|||
|
|
* Makefile.am: Fix ``rpmdist'' target to return the exit
|
|||
|
|
status of the ``rpm'' command, instead of the last command in
|
|||
|
|
the chain (the ``rm lyx.xpm'' command, which always returns
|
|||
|
|
success).
|
|||
|
|
|
|||
|
|
2000-08-02 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
|
|||
|
|
* src/frontends/xforms/FormCitation.C (FormCitation): ditto
|
|||
|
|
* src/frontends/xforms/FormToc.C (FormToc): ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am: A few forgotten files
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.C (showInset): The rest of the
|
|||
|
|
Signals-not-copyable-problem Lars' started commenting out.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
|
|||
|
|
|
|||
|
|
2000-08-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.h: Signals is not copyable so anoter
|
|||
|
|
scheme for automatic hiding of forms must be used.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.h: don't inerit from
|
|||
|
|
noncopyable, FormCommand already does that.
|
|||
|
|
* src/frontends/xforms/FormToc.h: ditto
|
|||
|
|
* src/frontends/xforms/FormUrl.h: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C: add include <algorithm>
|
|||
|
|
|
|||
|
|
2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.h (hide): new SigC::Signal0
|
|||
|
|
(d-tor) new virtual destructor emits hide signal
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
|
|||
|
|
* src/insets/inseturl.[Ch] (hide, d-tor): ditto
|
|||
|
|
|
|||
|
|
* src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
|
|||
|
|
LOF and LOT. Inset is now GUI-independent
|
|||
|
|
|
|||
|
|
* src/insets/insetloa.[Ch]: redundant
|
|||
|
|
* src/insets/insetlof.[Ch]: ditto
|
|||
|
|
* src/insets/insetlot.[Ch]: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_url.fd: tweaked!
|
|||
|
|
* src/frontends/xforms/forms/form_citation.fd: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCommand.[Ch]: new base class to those
|
|||
|
|
dialogs dealing with InsetCommand insets
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch]: now makes use of
|
|||
|
|
FormCommand base class
|
|||
|
|
* src/frontends/xforms/FormUrl.[Ch]: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_toc.fd: Xforms implementation
|
|||
|
|
of the TOC dialog
|
|||
|
|
* src/frontends/xforms/FormToc.[Ch]: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
|
|||
|
|
passed a generic InsetCommand pointer
|
|||
|
|
* src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
|
|||
|
|
and modified InsetTOC class
|
|||
|
|
* src/buffer.C: ditto
|
|||
|
|
|
|||
|
|
* forms/lyx.fd: strip out old FD_form_toc code
|
|||
|
|
* src/lyx_gui_misc.C: ditto
|
|||
|
|
* src/lyx_gui.C: ditto
|
|||
|
|
* src/lyx_cb.C: ditto
|
|||
|
|
* src/lyx.[Ch]: ditto
|
|||
|
|
|
|||
|
|
2000-08-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/utility.hpp: tr -d '\r'
|
|||
|
|
|
|||
|
|
2000-08-01 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.h: removed initFeatures() as it's not needed.
|
|||
|
|
|
|||
|
|
* src/commandtags.h:
|
|||
|
|
* src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
|
|||
|
|
LFUN_TABULAR_FEATURES.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
|
|||
|
|
LFUN_LAYOUT_TABULAR.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (getStatus): implemented helper function.
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
|
|||
|
|
|
|||
|
|
2000-07-31 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/text.C (draw): fixed screen update problem for text-insets.
|
|||
|
|
|
|||
|
|
* src/text2.C (SetParagrpah): call an update of the inset-owner when
|
|||
|
|
something changed probably this has to be added in various other
|
|||
|
|
functions too.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (cy): fixed to give back the right cursor.y().
|
|||
|
|
|
|||
|
|
2000-07-31 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
|
|||
|
|
templates to satisfy compaq cxx.
|
|||
|
|
|
|||
|
|
|
|||
|
|
2000-07-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/translator.h (equal_1st_in_pair::operator()): take
|
|||
|
|
const ref pair_type as arg.
|
|||
|
|
(equal_2nd_in_pair::operator()): ditto
|
|||
|
|
(Translator::~Translator): remove empty d-tor.
|
|||
|
|
|
|||
|
|
* src/graphics/GraphicsCache.C: move include config.h to top, also
|
|||
|
|
put initialization of GraphicsCache::singleton here.
|
|||
|
|
(~GraphicsCache): move here
|
|||
|
|
(addFile): take const ref as arg
|
|||
|
|
(removeFile): ditto
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.C (setFile): comment in old behaviour
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (insertLyXFile): change te with/without header
|
|||
|
|
check slightly.
|
|||
|
|
|
|||
|
|
2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormGraphics.C (apply): add some
|
|||
|
|
static_cast. Not very nice, but required by compaq cxx.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/RadioButtonGroup.h: include header
|
|||
|
|
<utility> instead of <pair.h>
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphicsParams.C: add using directive.
|
|||
|
|
(readResize): change return type to void.
|
|||
|
|
(readOrigin): ditto.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): add missing break for build-program
|
|||
|
|
function; add test for Literate for export functions.
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
|
|||
|
|
entries in Options menu.
|
|||
|
|
|
|||
|
|
2000-07-31 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
|
|||
|
|
protect against auto-allocation; release icon when needed.
|
|||
|
|
|
|||
|
|
2000-07-31 Matej Cepl <CeplM@seznam.cz>
|
|||
|
|
|
|||
|
|
* lib/kbd/czech.kmap: new file. standard Czech keyboard as found
|
|||
|
|
on usual typewriter.
|
|||
|
|
|
|||
|
|
* lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
|
|||
|
|
earlier czech.kmap), useful only for programming.
|
|||
|
|
|
|||
|
|
2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.h: fix conditioning around
|
|||
|
|
#pragma.
|
|||
|
|
|
|||
|
|
2000-07-31 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormTabular.C (local_update): changed
|
|||
|
|
radio_linebreaks to radio_useparbox and added radio_useminipage.
|
|||
|
|
|
|||
|
|
* src/tabular.C: made support for using minipages/parboxes.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (QwriteAll): small fix for asking for save.
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.C (draw): just draw the inset so that the
|
|||
|
|
cursor is visible.
|
|||
|
|
(descent): so the cursor is in the middle.
|
|||
|
|
(width): bit smaller box.
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.h: added display() function.
|
|||
|
|
|
|||
|
|
2000-07-31 Baruch Even <baruch.even@writeme.com>
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h: Added showGraphics signals.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_graphics.fd: Added file, the
|
|||
|
|
xforms form definition of the graphics dialog.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormGraphics.h:
|
|||
|
|
* src/frontends/xforms/FormGraphics.C: Added files, the
|
|||
|
|
GUIndependent code of InsetGraphics
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.h:
|
|||
|
|
* src/insets/insetgraphics.C: Major writing to make it work.
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphicsParams.h:
|
|||
|
|
* src/insets/insetgraphicsParams.C: Added files, parameter passing
|
|||
|
|
struct between InsetGraphics and GUI.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.h:
|
|||
|
|
* src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
|
|||
|
|
support for graphicx package.
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): Fixed read support
|
|||
|
|
for the graphics inset.
|
|||
|
|
|
|||
|
|
* src/support/translator.h: Added file, used in
|
|||
|
|
InsetGraphicsParams. this is a template to translate between two
|
|||
|
|
types.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/RadioButtonGroup.h:
|
|||
|
|
* src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
|
|||
|
|
way to easily control a radio button group.
|
|||
|
|
|
|||
|
|
2000-07-28 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (LocalDispatch):
|
|||
|
|
(TabularFeatures): added support for lyx-functions of tabular features.
|
|||
|
|
(cellstart): refixed this function after someone wrongly changed it.
|
|||
|
|
|
|||
|
|
* src/commandtags.h:
|
|||
|
|
* src/LyXAction.C (init): added support for tabular-features
|
|||
|
|
|
|||
|
|
2000-07-28 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.C (build): Setup input return
|
|||
|
|
checking. NOTE: It seems that pressing ESC to cancel the dialog also
|
|||
|
|
triggers the callback for input checking. As a result we sometimes get
|
|||
|
|
"LyX: This shouldn't happen..." printed to cerr.
|
|||
|
|
(input): Started using status variable since I only free() on
|
|||
|
|
destruction. Some input checking for paths and font sizes.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.h: Use status to control
|
|||
|
|
activation of Ok and Apply
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_preferences.fd: Setup input return
|
|||
|
|
callback. Also resized to stop segfaults with 0.88. The problem is
|
|||
|
|
that xforms-0.88 requires the folder to be wide enough to fit all the
|
|||
|
|
tabs. If it isn't it causes all sorts of problems.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/README: Reflect reality.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/fdfix.sh: Clean up comments
|
|||
|
|
* src/frontends/xforms/forms/makefile: ditto.
|
|||
|
|
|
|||
|
|
* src/commandtags.h: Get access to new Preferences dialog
|
|||
|
|
* src/LyXAction.C: ditto
|
|||
|
|
* src/lyxfunc.C: ditto
|
|||
|
|
* lib/ui/default.ui: ditto
|
|||
|
|
|
|||
|
|
2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
|
|||
|
|
few files.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/form_url.[Ch]: added.
|
|||
|
|
|
|||
|
|
2000-07-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.h: fixed bug in previous commit
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormUrl.h: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPrint.h: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.h: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.h: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C: ditto
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
|
|||
|
|
private copyconstructor and private default contructor
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am: add utility.hpp
|
|||
|
|
|
|||
|
|
* src/support/utility.hpp: new file from boost
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.h: set owner in clone
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C: added missing include
|
|||
|
|
algorithm
|
|||
|
|
|
|||
|
|
* src/insets/form_url.[Ch]: removed
|
|||
|
|
|
|||
|
|
2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
|
|||
|
|
|
|||
|
|
* development/lyx.spec.in
|
|||
|
|
* Makefile.am: Fix buglet for LyX RPM generation resulting from
|
|||
|
|
file/directory re-organization.
|
|||
|
|
|
|||
|
|
2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.[Ch]: moved the string data and
|
|||
|
|
associated manipulation methods into a new stand-alone class
|
|||
|
|
InsetCommandParams. This class has two additional methods
|
|||
|
|
getAsString() and setFromString() allowing the contents to be
|
|||
|
|
moved around as a single string.
|
|||
|
|
(addContents) method removed.
|
|||
|
|
(setContents) method no longer virtual.
|
|||
|
|
|
|||
|
|
* src/buffer.C (readInset): made use of new InsetCitation,
|
|||
|
|
InsetUrl constructors based on InsetCommandParams.
|
|||
|
|
|
|||
|
|
* src/commandtags.h: add LFUN_INSERT_URL
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): changed to accomadate GUI-
|
|||
|
|
independent InsetUrl and use InsetCommandParams to extract
|
|||
|
|
string info and create new Insets.
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h: add signals showUrl, createUrl.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C (apply): uses
|
|||
|
|
InsetCommandParams.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/form_url.C
|
|||
|
|
* src/frontends/xforms/form_url.h
|
|||
|
|
* src/frontends/xforms/FormUrl.h
|
|||
|
|
* src/frontends/xforms/FormUrl.C
|
|||
|
|
* src/frontends/xforms/forms/form_url.fd: new files
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.[Ch]: removed unused constructors.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.[Ch]: no longer store filename
|
|||
|
|
|
|||
|
|
* src/insets/inseturl.[Ch]: GUI-independent.
|
|||
|
|
|
|||
|
|
2000-07-26 Juergen Vigna <jug@sad.it>
|
|||
|
|
* renamed frontend from gtk to gnome as it is that what is realized
|
|||
|
|
and did the necessary changes in the files.
|
|||
|
|
|
|||
|
|
2000-07-26 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
* autogen.sh
|
|||
|
|
* configure.in: cleaning up gnome configuration scripts
|
|||
|
|
|
|||
|
|
2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
|
|||
|
|
shortcuts syndrom by redrawing them explicitely (a better solution
|
|||
|
|
would be appreciated).
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): fix crash when functions are disabled.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
|
|||
|
|
the button.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuExport): change html export to do the right
|
|||
|
|
thing depending of the document type (instead of having
|
|||
|
|
html-linuxdoc and html-docbook).
|
|||
|
|
* src/lyxfunc.C (getStatus): update for html
|
|||
|
|
* lib/ui/default.ui: simplify due to the above change.
|
|||
|
|
* src/menus.C (ShowFileMenu): update too (in case we need it).
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (read): if a menu is defined twice, add the
|
|||
|
|
new entries to the exiting one.
|
|||
|
|
|
|||
|
|
2000-07-26 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
|
|||
|
|
and return a bool if it did actual save the file.
|
|||
|
|
(AutoSave): don't autosave a unnamed doc.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
|
|||
|
|
check if this is an UNNAMED new file and react to it.
|
|||
|
|
(newFile): set buffer to unnamed and change to not mark a new
|
|||
|
|
buffer dirty if I didn't do anything with it.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
|
|||
|
|
|
|||
|
|
2000-07-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/Menubar.h: make "struct Pimpl;" public + the
|
|||
|
|
friend as per Angus's patch posted to lyx-devel.
|
|||
|
|
|
|||
|
|
* src/ext_l10n.h: updated
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
|
|||
|
|
gettext on the style string right before inserting them into the
|
|||
|
|
combox.
|
|||
|
|
|
|||
|
|
* autogen.sh: add code to extract style strings form layout files,
|
|||
|
|
not good enough yet.
|
|||
|
|
|
|||
|
|
* src/frontends/gtk/.cvsignore: add MAKEFILE
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (read): run the label strings through gettext
|
|||
|
|
before storing them in the containers.
|
|||
|
|
|
|||
|
|
* src/ext_l10n.h: new file
|
|||
|
|
|
|||
|
|
* autogen.sh : generate the ext_l10n.h file here
|
|||
|
|
|
|||
|
|
2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
|
|||
|
|
arguments.
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: fix a couple of typos.
|
|||
|
|
|
|||
|
|
* config/gnome/gtk.m4: added (and added to the list of files in
|
|||
|
|
autogen.sh).
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (unique_id): fix when we are using
|
|||
|
|
lyxstring instead of basic_string<>.
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): ditto.
|
|||
|
|
* src/support/filetools.C: ditto.
|
|||
|
|
|
|||
|
|
* lib/configure.m4: create the ui/ directory if necessary.
|
|||
|
|
|
|||
|
|
* src/LyXView.[Ch] (updateToolbar): new method.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (buffer): update the toolbar when
|
|||
|
|
opening/closing buffer.
|
|||
|
|
|
|||
|
|
2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (getActionName): enhance to return also the name
|
|||
|
|
and options of pseudo-actions.
|
|||
|
|
(init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: use OptItem in the vc submenu (intented just
|
|||
|
|
as an example of what is possible). Used in File->Build too (more
|
|||
|
|
useful) and in the import/export menus (to mimick the complicated
|
|||
|
|
handling of linuxdoc and friends). Try to update all the entries.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
|
|||
|
|
optional entries.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (read): Parse the new OptItem tag.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.h: Add a new optional_ data member (used if the
|
|||
|
|
entry should be omitted when the lyxfunc is disabled).
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Menubar_pimpl.C (string_width): new
|
|||
|
|
function, used as a shortcut.
|
|||
|
|
(create_submenu): align correctly the shortcuts on the widest
|
|||
|
|
entry.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.h: MenuItem.label() only returns the label of
|
|||
|
|
the menu without shortcut; new method shortcut().
|
|||
|
|
|
|||
|
|
2000-07-14 Marko Vendelin <markov@ioc.ee>
|
|||
|
|
|
|||
|
|
* src/frontends/gtk/Dialogs.C:
|
|||
|
|
* src/frontends/gtk/FormCopyright.C:
|
|||
|
|
* src/frontends/gtk/FormCopyright.h:
|
|||
|
|
* src/frontends/gtk/Makefile.am: added these source-files for the
|
|||
|
|
Gtk/Gnome support of the Copyright-Dialog.
|
|||
|
|
|
|||
|
|
* src/main.C: added Gnome::Main initialization if using
|
|||
|
|
Gtk/Gnome frontend-GUI.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
|
|||
|
|
frontend-GUI.
|
|||
|
|
* config/gnome/aclocal-include.m4
|
|||
|
|
* config/gnome/compiler-flags.m4
|
|||
|
|
* config/gnome/curses.m4
|
|||
|
|
* config/gnome/gnome--.m4
|
|||
|
|
* config/gnome/gnome-bonobo-check.m4
|
|||
|
|
* config/gnome/gnome-common.m4
|
|||
|
|
* config/gnome/gnome-fileutils.m4
|
|||
|
|
* config/gnome/gnome-ghttp-check.m4
|
|||
|
|
* config/gnome/gnome-gnorba-check.m4
|
|||
|
|
* config/gnome/gnome-guile-checks.m4
|
|||
|
|
* config/gnome/gnome-libgtop-check.m4
|
|||
|
|
* config/gnome/gnome-objc-checks.m4
|
|||
|
|
* config/gnome/gnome-orbit-check.m4
|
|||
|
|
* config/gnome/gnome-print-check.m4
|
|||
|
|
* config/gnome/gnome-pthread-check.m4
|
|||
|
|
* config/gnome/gnome-support.m4
|
|||
|
|
* config/gnome/gnome-undelfs.m4
|
|||
|
|
* config/gnome/gnome-vfs.m4
|
|||
|
|
* config/gnome/gnome-x-checks.m4
|
|||
|
|
* config/gnome/gnome-xml-check.m4
|
|||
|
|
* config/gnome/gnome.m4
|
|||
|
|
* config/gnome/gperf-check.m4
|
|||
|
|
* config/gnome/gtk--.m4
|
|||
|
|
* config/gnome/linger.m4
|
|||
|
|
* config/gnome/need-declaration.m4: added configuration scripts
|
|||
|
|
for Gtk/Gnome frontend-GUI
|
|||
|
|
|
|||
|
|
* configure.in: added support for the --with-frontend=gtk option
|
|||
|
|
|
|||
|
|
* autogen.sh: added config/gnome/* to list of config-files
|
|||
|
|
|
|||
|
|
* acconfig.h: added define for GTKGUI-support
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4: added --with-frontend[=value] option value
|
|||
|
|
for Gtk/Gnome frontend-GUI support.
|
|||
|
|
|
|||
|
|
2000-07-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
|
|||
|
|
can be used.
|
|||
|
|
(suffixIs): ditto
|
|||
|
|
|
|||
|
|
* src/paragraph.C (GetChar): remove non-const version
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
|
|||
|
|
(search_kw): use it.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init): if "preferences" exist, read that instead
|
|||
|
|
of "lyxrc".
|
|||
|
|
(ReadRcFile): return bool if the file could be read ok.
|
|||
|
|
(ReadUIFile): add a check to see if lex file is set ok.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
|
|||
|
|
bastring can be used instead of lyxstring (still uses the old code
|
|||
|
|
if std::string is good enough or if lyxstring is used.)
|
|||
|
|
|
|||
|
|
* src/encoding.C: make the arrays static, move ininle functions
|
|||
|
|
here
|
|||
|
|
* src/encoding.h: from here.
|
|||
|
|
|
|||
|
|
* src/buffer.C: have last_isnet_read as a file scope variable for now.
|
|||
|
|
(parseSingleLyXformat2Token): move inset parsing to separate method
|
|||
|
|
(readInset): new private method
|
|||
|
|
|
|||
|
|
* src/Variables.h: remove virtual from get().
|
|||
|
|
|
|||
|
|
* src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
|
|||
|
|
access to NEW_INSETS and NEW_TABULAR
|
|||
|
|
|
|||
|
|
* src/MenuBackend.h: remove superfluous forward declaration of
|
|||
|
|
MenuItem. Add documentations tags "///", remove empty MenuItem
|
|||
|
|
destructor, remove private default contructor.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.C (MenuItem): remove unneeded copy contructor
|
|||
|
|
(add): return *this
|
|||
|
|
(read): more string mlabel and mname to where they are used
|
|||
|
|
(read): remove unused variables mlabel and mname
|
|||
|
|
(defaults): unconditional clear, make menusetup take advantage of
|
|||
|
|
add returning Menu &.
|
|||
|
|
|
|||
|
|
* src/LyXView.h: define NEW_MENUBAR as default
|
|||
|
|
|
|||
|
|
* src/LyXAction.C: include lyxparagraph.h temporary to get access
|
|||
|
|
to NEW_INSETS and NEW_TABULAR.
|
|||
|
|
(init): commetn out some funcs that is obsolete when NEW_INSETS is
|
|||
|
|
defined. Change some of the "xxxx-inset-insert" functions names to
|
|||
|
|
"xxxx-insert".
|
|||
|
|
|
|||
|
|
* several files: more enahncements to NEW_INSETS and the resulting
|
|||
|
|
LyXParagraph code.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example (\date_insert_format): move to misc section
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
|
|||
|
|
bastring and use AC_CACHE_CHECK.
|
|||
|
|
(LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
|
|||
|
|
the system have the newest methods. uses AC_CACHE_CHECK
|
|||
|
|
(LYX_CXX_MUTABLE): use AC_CACHE_CHECK
|
|||
|
|
(LYX_CXX_PARTIAL): use AC_CACHE_CHECK
|
|||
|
|
(LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
|
|||
|
|
|
|||
|
|
* configure.in: add LYX_CXX_GOOD_STD_STRING
|
|||
|
|
|
|||
|
|
* acinclude.m4: recreated
|
|||
|
|
|
|||
|
|
2000-07-24 Amir Karger <karger@lyx.org>
|
|||
|
|
|
|||
|
|
* README: add Hebrew, Arabic kmaps
|
|||
|
|
* ANNOUNCE: typo
|
|||
|
|
|
|||
|
|
2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFileAscii): Define actcell as an int instead
|
|||
|
|
of int*.
|
|||
|
|
|
|||
|
|
2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* Lot of files: add pragma interface/implementation.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (ReadUFile): new method. Read the UI file.
|
|||
|
|
|
|||
|
|
* lib/ui/default.ui: new file (ans new directory). Contains the
|
|||
|
|
default menu and toolbar.
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
|
|||
|
|
global space. Toolbars are now read (as menus) in ui files.
|
|||
|
|
|
|||
|
|
* src/debug.C: change Debug::TOOLBAR to Debug::GUI.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): do not exit immediately if a command
|
|||
|
|
is disabled because the document is read-only. We want to have the
|
|||
|
|
toggle state of the function anyway.
|
|||
|
|
(getStatus): add code for LFUN_VC* functions (mimicking what is
|
|||
|
|
done in old-style menus)
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
|
|||
|
|
LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
|
|||
|
|
|
|||
|
|
* src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
|
|||
|
|
* src/BufferView_pimpl.C: ditto.
|
|||
|
|
* src/lyxfunc.C: ditto.
|
|||
|
|
|
|||
|
|
* src/LyXView.h: add a define NEW_MENUBAR (commented out by
|
|||
|
|
default). This replaces old-style menus by new ones.
|
|||
|
|
|
|||
|
|
* src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
|
|||
|
|
MenuItem. Contain the data structure of a menu.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C: use LyXView::setLayout instead of
|
|||
|
|
accessing directly the toolbar combox.
|
|||
|
|
* src/lyxfunc.C (Dispatch): ditto.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (setLayout): new method, which just calls
|
|||
|
|
Toolbar::setLayout().
|
|||
|
|
(updateLayoutChoice): move part of this method in Toolbar.
|
|||
|
|
|
|||
|
|
* src/toolbar.[Ch]: removed.
|
|||
|
|
|
|||
|
|
* src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
|
|||
|
|
implementation the toolbar.
|
|||
|
|
|
|||
|
|
* src/frontend/Toolbar.[Ch]: new files. The abstract interface of
|
|||
|
|
the toolbar. It might make sense to merge it with ToolbarDefaults
|
|||
|
|
later.
|
|||
|
|
(setLayout): new function.
|
|||
|
|
(updateLayoutList): ditto.
|
|||
|
|
(openLayoutList): ditto.
|
|||
|
|
|
|||
|
|
* src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
|
|||
|
|
xforms implementation of the toolbar.
|
|||
|
|
(get_toolbar_func): comment out, since I do not
|
|||
|
|
know what it is good for.
|
|||
|
|
|
|||
|
|
* src/ToolbarDefaults.h: Add the ItemType enum.
|
|||
|
|
|
|||
|
|
* src/support/StrPool.[Ch]: new class. Acts as a reference holder
|
|||
|
|
for a list of allocated C strings. Used in Menubar xforms
|
|||
|
|
implementation to avoid memory leaks.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.[Ch] (uppercase): new version taking and
|
|||
|
|
returning a char.
|
|||
|
|
(lowercase): ditto.
|
|||
|
|
|
|||
|
|
* lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
|
|||
|
|
* lib/bind/emacs.bind: ditto.
|
|||
|
|
|
|||
|
|
2000-07-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/toolbar.h: include commandtags.h instead of lyxfunc.h,
|
|||
|
|
forward decl of LyXView.
|
|||
|
|
|
|||
|
|
* src/toolbar.C (toolbarItem): moved from toolbar.h
|
|||
|
|
(toolbarItem::clean): ditto
|
|||
|
|
(toolbarItem::~toolbarItem): ditto
|
|||
|
|
(toolbarItem::operator): ditto
|
|||
|
|
|
|||
|
|
* src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
|
|||
|
|
|
|||
|
|
* src/paragraph.h: control the NEW_TABULAR define from here
|
|||
|
|
|
|||
|
|
* src/buffer.C: remove define USE_PARSE_FUNCTION, change
|
|||
|
|
USE_TABULAR_INSETS to NEW_TABULAR
|
|||
|
|
|
|||
|
|
* src/ToolbarDefaults.C: add include "lyxlex.h"
|
|||
|
|
|
|||
|
|
* files using the old table/tabular: use NEW_TABULAR to control
|
|||
|
|
compilation of old tabular stuff.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (SimpleTeXOnePar): NEW_INSETS:<3A>move some #ifdef
|
|||
|
|
to correct place.
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS:<3A>fix the
|
|||
|
|
planemet in reading of old style floats, fix the \end_deeper
|
|||
|
|
problem when reading old style floats.
|
|||
|
|
|
|||
|
|
2000-07-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
|
|||
|
|
|
|||
|
|
2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
|
|||
|
|
|
|||
|
|
* lib/bind/sciword.bind: updated.
|
|||
|
|
|
|||
|
|
2000-07-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
|
|||
|
|
layout write problem
|
|||
|
|
|
|||
|
|
2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/Makefile.am (INCLUDES): remove image directory from include
|
|||
|
|
path.
|
|||
|
|
|
|||
|
|
* src/bullet_forms.C (create_form_form_bullet): small cleanup.
|
|||
|
|
* src/bullet_forms_cb.C (BulletPanelCB): ditto.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (create_form_form_main): read the application icon
|
|||
|
|
from the disk.
|
|||
|
|
|
|||
|
|
* lib/images/*.xpm: change the icons to use transparent color for
|
|||
|
|
background.
|
|||
|
|
|
|||
|
|
* src/toolbar.C (update): change the color of the button when it
|
|||
|
|
is toggled on.
|
|||
|
|
|
|||
|
|
2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
|
|||
|
|
setting explicitely the minibuffer.
|
|||
|
|
* src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (showState): new function. Shows font information
|
|||
|
|
in minibuffer and update toolbar state.
|
|||
|
|
(LyXView): call Toolbar::update after creating the
|
|||
|
|
view.
|
|||
|
|
|
|||
|
|
* src/toolbar.C: change toollist to be a vector instead of a
|
|||
|
|
linked list.
|
|||
|
|
(BubbleTimerCB): get help string directly from the callback
|
|||
|
|
argument of the corresponding icon (which is the action)
|
|||
|
|
(set): remove unnecessary ugliness.
|
|||
|
|
(update): new function. update the icons (depressed, disabled)
|
|||
|
|
depending of the status of the corresponding action.
|
|||
|
|
|
|||
|
|
* src/toolbar.h: remove help in toolbarItem
|
|||
|
|
|
|||
|
|
2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/Painter.C (text): Added code for using symbol glyphs from
|
|||
|
|
iso10646 fonts. Currently diabled.
|
|||
|
|
|
|||
|
|
* src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
|
|||
|
|
symbol_encoding.
|
|||
|
|
|
|||
|
|
* src/language.C (initL): Fixed encodings for esperanto,lsorbian,
|
|||
|
|
magyar,turkish and usorbian.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (isMultiLingual): Made more efficient.
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
|
|||
|
|
keyboard.
|
|||
|
|
|
|||
|
|
* src/mathed/math_symbols.C (math_insert_greek): Changed to use
|
|||
|
|
LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
|
|||
|
|
Also changed the prototype to "bool math_insert_greek(char)".
|
|||
|
|
|
|||
|
|
2000-07-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lots of files: apply the NEW_INSETS on all code that will not be
|
|||
|
|
needed when we move to use the new insets. Enable the define in
|
|||
|
|
lyxparagrah.h to try it.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (cellstart): change to be a static
|
|||
|
|
inline function
|
|||
|
|
(InsetTabular): initialize buffer in the initializer list.
|
|||
|
|
|
|||
|
|
2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPrint.[Ch] : moved #include
|
|||
|
|
form_print.h out of the header file. Replaced with forward
|
|||
|
|
declarations of the relevant struct.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPreferences.[Ch] : ditto for
|
|||
|
|
form_preferences.h.
|
|||
|
|
|
|||
|
|
* src/commandtags.h: do not include "debug.h" which does not
|
|||
|
|
belong there. #include it in some other places because of this
|
|||
|
|
change.
|
|||
|
|
|
|||
|
|
2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insetcaption.C: add a couple "using" directives.
|
|||
|
|
|
|||
|
|
* src/toolbar.C (add): get the help text directly from lyxaction.
|
|||
|
|
(getPixmap): nuked.
|
|||
|
|
(setPixmap): new function. Loads from disk and sets a pixmap on a
|
|||
|
|
botton; the name of the pixmap file is derived from the command
|
|||
|
|
name.
|
|||
|
|
|
|||
|
|
* src/toolbar.h: remove members isBitmap and pixmap from
|
|||
|
|
toobarItem struct.
|
|||
|
|
|
|||
|
|
* lib/images/*.xbm *_bw.xpm: remove (not used any more).
|
|||
|
|
* lib/images/: move many files from images/banner.xpm.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): read banner pixmap from file.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
|
|||
|
|
* src/toolbar.C: ditto.
|
|||
|
|
* configure.in: ditto.
|
|||
|
|
* INSTALL: document.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
|
|||
|
|
the spellchecker popup is closed from the WM.
|
|||
|
|
|
|||
|
|
2000-07-19 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetfloat.C (Write): small fix because we use the
|
|||
|
|
insetname for the type now!
|
|||
|
|
|
|||
|
|
2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_citation.fd: object sizes are
|
|||
|
|
now set here
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h: removed hideCitation signal
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.h: added hide signal
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.C (~InsetCitation): emits new signal
|
|||
|
|
(getScreenLabel): "intelligent" label should now fit on the screen!
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCitation.C (showInset): connects
|
|||
|
|
hide() to the inset's hide signal
|
|||
|
|
(show): modified to use fl_set_object_position rather than
|
|||
|
|
fl_set_object_geometry wherever possible
|
|||
|
|
|
|||
|
|
2000-07-18 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: add caption code
|
|||
|
|
|
|||
|
|
* src/insets/insetfloat.C (type): new method
|
|||
|
|
|
|||
|
|
* src/insets/insetcaption.C (Write): new method
|
|||
|
|
(Read): new method
|
|||
|
|
(LyxCode): new method
|
|||
|
|
|
|||
|
|
* src/text2.C (SetCounter): revert J<>rgens code, but use his idea
|
|||
|
|
to get it right together with using the FloatList.
|
|||
|
|
|
|||
|
|
* src/commandtags.h: add LFUN_INSET_CAPTION
|
|||
|
|
* src/lyxfunc.C (Dispatch): handle it
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): add code to read a
|
|||
|
|
caption inset.
|
|||
|
|
|
|||
|
|
* src/Variables.[Ch]: make expand take a const reference, remove
|
|||
|
|
the destructor, some whitespace changes.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): add caption-inset-insert
|
|||
|
|
|
|||
|
|
* src/FloatList.C (FloatList): update the default floats a bit.
|
|||
|
|
|
|||
|
|
2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/Variables.[Ch]: new files. Intended to be used for language
|
|||
|
|
specific strings (like \chaptername) and filename substitution in
|
|||
|
|
commands.
|
|||
|
|
|
|||
|
|
* src/trans.C (AddDeadkey): replace keyword "all" with "native" in
|
|||
|
|
kmap files.
|
|||
|
|
* lib/kbd/american.kmap: update
|
|||
|
|
|
|||
|
|
* src/trans_mgr.C (normalkey): do not test allowAccent anymore.
|
|||
|
|
|
|||
|
|
* src/bufferparams.[Ch]: remove member allowAccents.
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
|
|||
|
|
|
|||
|
|
* src/LaTeXLog.C: use the log_form.h header.
|
|||
|
|
* src/lyx_gui.C: ditto.
|
|||
|
|
* src/lyx_gui_misc.C: ditto.
|
|||
|
|
* src/lyxvc.h: ditto.
|
|||
|
|
|
|||
|
|
* forms/log_form.fd: new file, created from latexoptions.fd. I
|
|||
|
|
kept the log popup and nuked the options form.
|
|||
|
|
|
|||
|
|
* src/{la,}texoptions.[Ch]: removed.
|
|||
|
|
* src/lyx_cb.C (LaTeXOptions): ditto
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): do not handle the
|
|||
|
|
fd_latex_options form.
|
|||
|
|
|
|||
|
|
2000-07-18 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
|
|||
|
|
name of the inset so that it can be requested outside (text2.C).
|
|||
|
|
|
|||
|
|
* src/text2.C (SetCounter): modified so it sees insetfloat for caption
|
|||
|
|
labels.
|
|||
|
|
|
|||
|
|
2000-07-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.h (ConvertFont): constify
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (Read): add warning if \end_inset is not
|
|||
|
|
found on expected place.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h (ConvertFont): consify
|
|||
|
|
|
|||
|
|
* src/insets/insetquotes.C (ConvertFont): constify
|
|||
|
|
* src/insets/insetquotes.h: ditto
|
|||
|
|
|
|||
|
|
* src/insets/insetinfo.h: add labelfont
|
|||
|
|
|
|||
|
|
* src/insets/insetinfo.C (InsetInfo): set the labelfont
|
|||
|
|
(ascent): use labelfont
|
|||
|
|
(descent): likewise
|
|||
|
|
(width): likewise
|
|||
|
|
(draw): likewise
|
|||
|
|
(Write): make .lyx file a bit nicer
|
|||
|
|
|
|||
|
|
* src/insets/insetfloat.C (Write): simplify somewhat...
|
|||
|
|
(Read): add warning if arg is not found
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C: add using std::max
|
|||
|
|
(Read): move string token and add warning in arg is not found
|
|||
|
|
(draw): use std::max to get the right ty
|
|||
|
|
(getMaxWidth): simplify by using std::max
|
|||
|
|
|
|||
|
|
* src/insets/insetsection.h: new file
|
|||
|
|
* src/insets/insetsection.C: new file
|
|||
|
|
* src/insets/insetcaption.h: new file
|
|||
|
|
* src/insets/insetcaption.C: new file
|
|||
|
|
|
|||
|
|
* src/insets/inset.C (ConvertFont): constify signature
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am (libinsets_la_SOURCES): add
|
|||
|
|
insetcaption.[Ch] and insetsection.[Ch]
|
|||
|
|
|
|||
|
|
* src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
|
|||
|
|
uses to use LABEL_COUNTER_CHAPTER instead.
|
|||
|
|
* src/text2.C (SetCounter): here
|
|||
|
|
|
|||
|
|
* src/counters.h: new file
|
|||
|
|
* src/counters.C: new file
|
|||
|
|
* src/Sectioning.h: new file
|
|||
|
|
* src/Sectioning.C: new file
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
|
|||
|
|
|
|||
|
|
2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
|
|||
|
|
not always in "."!
|
|||
|
|
|
|||
|
|
* src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
|
|||
|
|
the last argument.
|
|||
|
|
|
|||
|
|
2000-07-17 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/tabular.C (Validate): check if array-package is needed.
|
|||
|
|
(SetVAlignment): added support for vertical alignment.
|
|||
|
|
(SetLTFoot): better support for longtable header/footers
|
|||
|
|
(Latex): modified to support added features.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.[Ch]: added array-package.
|
|||
|
|
|
|||
|
|
2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (LyXGUI): make sure that the height is large
|
|||
|
|
enough.
|
|||
|
|
|
|||
|
|
2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
|
|||
|
|
|
|||
|
|
* configure.in: do not forget to put a space after -isystem.
|
|||
|
|
|
|||
|
|
2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/kbd/arabic.kmap: a few fixes.
|
|||
|
|
|
|||
|
|
2000-07-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* some whitespace chagnes to a number of files.
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.h: change to make it easier for
|
|||
|
|
doc++ to parse correctly.
|
|||
|
|
* src/support/lyxstring.h: ditto
|
|||
|
|
|
|||
|
|
* src/mathed/math_utils.C (compara): change to have only one
|
|||
|
|
operator()
|
|||
|
|
(MathedLookupBOP): change because of the above.
|
|||
|
|
|
|||
|
|
* src/mathed/math_delim.C (math_deco_compare): change to have only
|
|||
|
|
one operator()
|
|||
|
|
(search_deco): change becasue of the above.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (DrawCellSelection): use std::swap
|
|||
|
|
instead of manually coded one.
|
|||
|
|
|
|||
|
|
* src/insets/insetquotes.C (Read): read the \end_inset too
|
|||
|
|
|
|||
|
|
* src/insets/insetlatex.h: remove file
|
|||
|
|
* src/insets/insetlatex.C: remove file
|
|||
|
|
|
|||
|
|
* src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
|
|||
|
|
constructor
|
|||
|
|
(InsetPrintIndex): remove destructor
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.h: remove default constructor
|
|||
|
|
|
|||
|
|
* src/insets/insetfloat.C: work to make it work better
|
|||
|
|
|
|||
|
|
* src/insets/inseterror.[Ch] (InsetError): remove default constructor
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.h (InsetCitation): remove default constructor
|
|||
|
|
|
|||
|
|
* src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
|
|||
|
|
|
|||
|
|
* src/text.C (GetColumnNearX): comment out some currently unused code.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (writeFile): move some initializations closer to
|
|||
|
|
first use.
|
|||
|
|
(CutIntoMinibuffer): small change to use new matchIT operator
|
|||
|
|
(Erase): ditto
|
|||
|
|
(Erase): ditto
|
|||
|
|
(InsertChar): ditto
|
|||
|
|
(InsertInset): ditto
|
|||
|
|
(GetInset): ditto
|
|||
|
|
(GetInset): ditto
|
|||
|
|
(InsetIterator): ditto
|
|||
|
|
(Erase): small change to use new matchFT operator
|
|||
|
|
(InsertChar): ditto
|
|||
|
|
(GetFontSettings): ditto
|
|||
|
|
(HighestFontInRange): ditto
|
|||
|
|
(SetFont): ditto
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: some chars changed to value_type
|
|||
|
|
(matchIT): because of some stronger checking (perhaps too strong)
|
|||
|
|
in SGI STL, the two operator() unified to one.
|
|||
|
|
(matchFT): ditto
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): static string to hold
|
|||
|
|
the last inset read added
|
|||
|
|
(parseSingleLyXformat2Token): some more (future) compability code added
|
|||
|
|
(parseSingleLyXformat2Token): warning about solitary \end_inset added
|
|||
|
|
(parseSingleLyXformat2Token): set last_inset_read
|
|||
|
|
(parseSingleLyXformat2Token): more code to read new "Float" correctly
|
|||
|
|
(parseSingleLyXformat2Token): don't double intializw string next_token
|
|||
|
|
|
|||
|
|
* src/TextCache.C (text_fits::operator()): add const's to the signature
|
|||
|
|
(has_buffer::operator()): ditto
|
|||
|
|
|
|||
|
|
* src/Floating.h: add some comments on the class
|
|||
|
|
|
|||
|
|
* src/FloatList.[Ch] (typeExist): new method
|
|||
|
|
(getType): ditto
|
|||
|
|
|
|||
|
|
* src/BackStack.h: added default constructor, wanted by Gcc.
|
|||
|
|
|
|||
|
|
2000-07-14 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms/form_tabular.fd: updated a bit.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (resizeLyXText): need this to be able to
|
|||
|
|
do a redraw when the window is resized!
|
|||
|
|
(LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (resizeLyXText): added function to correctly
|
|||
|
|
being able to resize the LyXWindow.
|
|||
|
|
|
|||
|
|
* src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
|
|||
|
|
|
|||
|
|
2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/frontends/Dialogs.h (hideCitation) : new signal to prevent
|
|||
|
|
crashes when closing dialog to a deleted inset.
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.[Ch] (Edit) : the return of this former
|
|||
|
|
method! Now similar to other insets.
|
|||
|
|
|
|||
|
|
2000-07-13 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): fixed clearing of rows with insets!
|
|||
|
|
|
|||
|
|
* lib/examples/Literate.lyx: small patch!
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (Read): added this function because of wrong
|
|||
|
|
Write (without [begin|end]_inset).
|
|||
|
|
|
|||
|
|
2000-07-11 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (open_new_inset): changed to a bool returnvalue
|
|||
|
|
as the insertInset could not be good!
|
|||
|
|
|
|||
|
|
* src/screen.C (ToggleSelection): fixed toggle selection bug as
|
|||
|
|
the bool param should not be last.
|
|||
|
|
|
|||
|
|
2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* sigc++/configure.in: fix bug in threading-related code (Yes, I
|
|||
|
|
did submit that to Karl).
|
|||
|
|
|
|||
|
|
* configure.in: use -isystem instead of -I for X headers. This
|
|||
|
|
fixes a problem on solaris with a recent gcc;
|
|||
|
|
put the front-end code after the X detection code;
|
|||
|
|
configure in sigc++ before lib/
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (commandLineHelp): remove -display from command
|
|||
|
|
line help.
|
|||
|
|
|
|||
|
|
2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
|
|||
|
|
|
|||
|
|
* lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
|
|||
|
|
Also put in Makefile rules for building the ``listerrors''
|
|||
|
|
program for parsing errors from literate programs written in LyX.
|
|||
|
|
|
|||
|
|
* lib/build-listerrors: Added small shell script as part of compile
|
|||
|
|
process. This builds a working ``listerrors'' binary if noweb is
|
|||
|
|
installed and either 1) the VNC X server is installed on the machine,
|
|||
|
|
or 2) the user is compiling from within a GUI. The existence of a GUI
|
|||
|
|
is necessary to use the ``lyx --export'' feature for now. This
|
|||
|
|
hack can be removed once ``lyx --export'' no longer requires a GUI to
|
|||
|
|
function.
|
|||
|
|
|
|||
|
|
2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
|
|||
|
|
|
|||
|
|
* lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
|
|||
|
|
now passed back correctly from gcc and placed "under" error
|
|||
|
|
buttons in a Literate LyX source.
|
|||
|
|
|
|||
|
|
2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/text.C (GetColumnNearX): Better behavior when a RTL
|
|||
|
|
paragraph is ended by LTR text.
|
|||
|
|
|
|||
|
|
* src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
|
|||
|
|
Ditto
|
|||
|
|
|
|||
|
|
2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
|
|||
|
|
true when clipboard is empty.
|
|||
|
|
|
|||
|
|
2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* text.C (Backspace): Prevent rebreaking of a row if it is the last
|
|||
|
|
row of the paragraph.
|
|||
|
|
(SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
|
|||
|
|
to prevent calculation of bidi tables
|
|||
|
|
|
|||
|
|
2000-07-07 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/screen.C (ToggleSelection): added y_offset and x_offset
|
|||
|
|
parameters.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (InsetMotionNotify): fixed selection with
|
|||
|
|
mouse.
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): fixed selection drawing in insets.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C: fixed Layout-Display!
|
|||
|
|
|
|||
|
|
2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* configure.in: add check for strings.h header.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: include <strings.h> in order to have a
|
|||
|
|
definition for bzero().
|
|||
|
|
|
|||
|
|
2000-07-07 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (draw): set the status of the bv->text to
|
|||
|
|
CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
|
|||
|
|
|
|||
|
|
* src/screen.C (DrawOneRow):
|
|||
|
|
(DrawFromTo): redraw the actual row if something has changed in it
|
|||
|
|
while drawing.
|
|||
|
|
|
|||
|
|
* src/text.C (draw): call an update of the toplevel-inset if something
|
|||
|
|
has changed inside while drawing.
|
|||
|
|
|
|||
|
|
* src/lyxtext.h: added CHANGED_IN_DRAW status.
|
|||
|
|
|
|||
|
|
2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.[Ch] (callback) new method, moving callback
|
|||
|
|
processing inside class.
|
|||
|
|
|
|||
|
|
* src/insets/insetindex.[Ch] (callback) new method, moving callback
|
|||
|
|
processing inside class.
|
|||
|
|
|
|||
|
|
* src/insets/insetindex.h new struct Holder, consistent with other
|
|||
|
|
insets.
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
|
|||
|
|
citation dialog from main code and placed it in src/frontends/xforms.
|
|||
|
|
Dialog launched through signals instead of callbacks
|
|||
|
|
|
|||
|
|
2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
|
|||
|
|
|
|||
|
|
* lyx.man: update the options description.
|
|||
|
|
|
|||
|
|
2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
|
|||
|
|
handle neg values, set min width to 590, add doc about -display
|
|||
|
|
|
|||
|
|
2000-07-05 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: changed Painter & in ascent(), descent()
|
|||
|
|
calls to BufferView *.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (checkAndActivateInset): small fix non
|
|||
|
|
HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.C (Read): Fixed as insets should read till
|
|||
|
|
their \end_inset token!
|
|||
|
|
|
|||
|
|
2000-07-04 edscott <edscott@imp.mx>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
|
|||
|
|
lib/lyxrc.example: added option \wheel_jump
|
|||
|
|
|
|||
|
|
2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
|
|||
|
|
remove support for -width,-height,-xpos and -ypos.
|
|||
|
|
|
|||
|
|
2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/encoding.[Ch]: New files.
|
|||
|
|
|
|||
|
|
* src/painter.C (text(int,int,XChar2b const *,...)): New method.
|
|||
|
|
(text): Call to the underline() method only when needed.
|
|||
|
|
|
|||
|
|
* src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): Compute automatically the input
|
|||
|
|
encoding(s) for the document.
|
|||
|
|
|
|||
|
|
* src/bufferparams.C (BufferParams): Changed default value of
|
|||
|
|
inputenc to "auto".
|
|||
|
|
|
|||
|
|
* src/language.C (newLang): Removed.
|
|||
|
|
(items[]): Added encoding information for all defined languages.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): Added "auto" option to the input
|
|||
|
|
encoding choice button.
|
|||
|
|
|
|||
|
|
* src/lyxrc.h (font_norm_type): New member variable.
|
|||
|
|
(set_font_norm_type): New method.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
|
|||
|
|
paragraphs with different encodings.
|
|||
|
|
|
|||
|
|
* src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
|
|||
|
|
(TransformChar): Changed to work correctly with Arabic points.
|
|||
|
|
(draw): Added support for drawing Arabic points.
|
|||
|
|
(draw): Removed code for drawing underbars (this is done by
|
|||
|
|
the Painter!)
|
|||
|
|
|
|||
|
|
* src/support/textutils.h (IsPrintableNonspace): New function.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.h: Added "using SigC::Object".
|
|||
|
|
* src/LyXView.h: ditto.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.h (include_label): Changed to mutable.
|
|||
|
|
|
|||
|
|
2000-07-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/math_iter.h: remove empty destructor
|
|||
|
|
|
|||
|
|
* src/mathed/math_cursor.h: remove empty destructor
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: add THEOREM_CODE
|
|||
|
|
|
|||
|
|
* src/insets/insettheorem.[Ch]: new files
|
|||
|
|
|
|||
|
|
* src/insets/insetminipage.C: (InsertInset): remove
|
|||
|
|
|
|||
|
|
* src/insets/insetmarginal.C: inherit from InsetFootLike instead
|
|||
|
|
of InsetCollapsable
|
|||
|
|
(InsertInset): remove
|
|||
|
|
|
|||
|
|
* src/insets/insetlist.C: (InsertList): remove
|
|||
|
|
|
|||
|
|
* src/insets/insetfootlike.[Ch]: new files
|
|||
|
|
|
|||
|
|
* src/insets/insetfoot.C: inherit from InsetFootLike instead of
|
|||
|
|
InsetCollapsable.
|
|||
|
|
(Write): remove
|
|||
|
|
(InsertInset): ditto
|
|||
|
|
|
|||
|
|
* src/insets/insetert.C: remove include Painter.h, reindent
|
|||
|
|
(InsertInset): move to header
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.h: remove explicit from default
|
|||
|
|
contructor, remove empty destructor, add InsertInset
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C (InsertInset): new func
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am (libinsets_la_SOURCES): add new files
|
|||
|
|
|
|||
|
|
* src/vspace.h: add explicit to constructor
|
|||
|
|
|
|||
|
|
* src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
|
|||
|
|
\textcompwordmark, please test this.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: set ascii_linelen to 65 by default
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
|
|||
|
|
|
|||
|
|
* src/commandtags.h: add LFUN_INSET_THEOREM
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
|
|||
|
|
(makeLinuxDocFile): remove _some_ of the nice logic
|
|||
|
|
(makeDocBookFile): ditto
|
|||
|
|
|
|||
|
|
* src/Painter.[Ch]: (~Painter): removed
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): entry for insettheorem added
|
|||
|
|
|
|||
|
|
* src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
|
|||
|
|
enum
|
|||
|
|
(deplog): code to detect files generated by LaTeX, needs testing
|
|||
|
|
(deptex): removed
|
|||
|
|
|
|||
|
|
2000-07-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/FloatList.[Ch]: moved inlines out of line to FloatList.C
|
|||
|
|
|
|||
|
|
2000-07-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (deplog): Add a check for files that are going to be
|
|||
|
|
created by the first latex run, part of the project to remove the
|
|||
|
|
all_files array.
|
|||
|
|
|
|||
|
|
* src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
|
|||
|
|
contents to the extension list.
|
|||
|
|
|
|||
|
|
2000-07-04 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/text.C (NextBreakPoint): added support for needFullRow()
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: added needFullRow()
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C: redone now this uses a text-inset
|
|||
|
|
and isn't one.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C: lots of changes for update!
|
|||
|
|
|
|||
|
|
2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.h: add a missing std:: qualifier.
|
|||
|
|
|
|||
|
|
2000-07-02 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (InsetInclude): fixed
|
|||
|
|
initialization of include_label.
|
|||
|
|
(unique_id): now returns a string.
|
|||
|
|
|
|||
|
|
2000-07-01 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.h: new member IncludedFiles, for
|
|||
|
|
a map of key, included file name.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.C (getIncludedFiles): returns a string
|
|||
|
|
with the included files for inclusion in SGML preamble,
|
|||
|
|
i. e., linuxdoc and docbook.
|
|||
|
|
|
|||
|
|
* src/buffer.h:
|
|||
|
|
* src/buffer.C (makeLinuxDocFile): takes two new arguments,
|
|||
|
|
nice (is the generated linuxdoc code to be exported?), that
|
|||
|
|
allows to remove column, and only_body that will be true for
|
|||
|
|
slave documents. Insets are allowed inside SGML font type.
|
|||
|
|
New handling of the SGML preamble for included files.
|
|||
|
|
(makeDocBookFile): the same for docbook.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.h:
|
|||
|
|
* src/insets/insetinclude.C (Validate): keeps a list of included files.
|
|||
|
|
(Linuxdoc):
|
|||
|
|
(DocBook): new export methods.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
|
|||
|
|
and makeDocBookFile.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (easyParse): accept linuxdoc and docbook as
|
|||
|
|
formats to export with command line argument -x.
|
|||
|
|
|
|||
|
|
2000-06-29 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
|
|||
|
|
to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
|
|||
|
|
region could already been cleared by an inset!
|
|||
|
|
|
|||
|
|
2000-06-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.h: remove member variables lyx_focus and
|
|||
|
|
work_area_focus
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
|
|||
|
|
and lyx_focus
|
|||
|
|
(cursorToggle): remove special handling of lyx focus.
|
|||
|
|
|
|||
|
|
2000-06-28 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
|
|||
|
|
insetHeight.
|
|||
|
|
|
|||
|
|
2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insetindex.C (Edit): add a callback when popup is
|
|||
|
|
closed by the WM.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch):
|
|||
|
|
* src/insets/insetmarginal.h:
|
|||
|
|
* src/insets/insetlist.h:
|
|||
|
|
* src/insets/insetfoot.h:
|
|||
|
|
* src/insets/insetfloat.h:
|
|||
|
|
* src/insets/insetert.h: add a missing std:: qualifier.
|
|||
|
|
|
|||
|
|
2000-06-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxsum.C (sum): '\0' teminate file read when using
|
|||
|
|
strstream.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (Read): remove tmptok unused variable
|
|||
|
|
(LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
|
|||
|
|
(InsertInset): change for new InsetInset code
|
|||
|
|
|
|||
|
|
* src/insets/insettext.h: add TEXT inline method
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C: remove TEXT macro
|
|||
|
|
|
|||
|
|
* src/insets/insetmarginal.C (Write): new method
|
|||
|
|
(Latex): change output slightly
|
|||
|
|
|
|||
|
|
* src/insets/insetfoot.C (Write): new method
|
|||
|
|
(Latex): change output slightly (don't use endl when no need)
|
|||
|
|
|
|||
|
|
* src/insets/insetert.C (Write): new method
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.h: make button_length, button_top_y
|
|||
|
|
and button_bottm_y protected.
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C (Write): simplify code by using
|
|||
|
|
tostr. Also do not output the float name, the children class
|
|||
|
|
should to that to get control over own arguments
|
|||
|
|
|
|||
|
|
* src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
|
|||
|
|
src/insets/insetminipage.[Ch]:
|
|||
|
|
new files
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am (libinsets_la_SOURCES): add new files
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): cases for new insets/commands
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): add the new files
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
|
|||
|
|
LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
|
|||
|
|
* src/commandtags.h: ditto
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.h: add a std::set of used floattypes
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.C (getPackages): add basic support for float.sty
|
|||
|
|
|
|||
|
|
* src/FloatList.[Ch] src/Floating.h: new files
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
|
|||
|
|
InsertInset.
|
|||
|
|
* src/lyx_cb.C (TableApplyCB): ditto
|
|||
|
|
* src/text.C: ditto
|
|||
|
|
* src/text2.C: ditto
|
|||
|
|
* src/buffer.C (SimpleLinuxDocOnePar): ditto
|
|||
|
|
(parseSingleLyXformat2Token): ditto + add code for
|
|||
|
|
backwards compability for old float styles + add code for new insets
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
|
|||
|
|
method
|
|||
|
|
(InsertInset(size_type, Inset *, LyXFont)): new method
|
|||
|
|
(InsetChar(size_type, char)): changed to use the other InsetChar
|
|||
|
|
with a LyXFont(ALL_INHERIT).
|
|||
|
|
(InsetInset(size_type, Inset*)): changed to use InsetChar to
|
|||
|
|
insert the META_INSET.
|
|||
|
|
|
|||
|
|
* sigc++/thread.cc (Privete<int>::operator int&): move definition
|
|||
|
|
out of line.
|
|||
|
|
* sigc++/thread.h (Threads): from here
|
|||
|
|
|
|||
|
|
* sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
|
|||
|
|
definition out of line
|
|||
|
|
* sigc++/scope.h: from here
|
|||
|
|
|
|||
|
|
2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (read): make sure the .kmap files exist when a keymap
|
|||
|
|
is specified (adapted from a patch from edscott <edscott@imp.mx>).
|
|||
|
|
|
|||
|
|
* Makefile.am (bindist): new target.
|
|||
|
|
|
|||
|
|
* INSTALL: add instructions for doing a binary distribution.
|
|||
|
|
|
|||
|
|
* development/tools/README.bin.example: update a bit.
|
|||
|
|
|
|||
|
|
2000-06-26 Lior Silberman <slior@math.huji.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C:
|
|||
|
|
* lib/lyxrc.example: new lyxrc tag \set_color.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch):
|
|||
|
|
* src/commandtags.h:
|
|||
|
|
* src/LyXAction.C: new lyxfunc "set-color".
|
|||
|
|
|
|||
|
|
* src/LColor.[Ch] (setColor): new method to set colors from a lyxname
|
|||
|
|
and an x11name given as strings.
|
|||
|
|
|
|||
|
|
* src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
|
|||
|
|
cache when a color is changed.
|
|||
|
|
|
|||
|
|
2000-06-26 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyxrow.C (width): added this functions and variable.
|
|||
|
|
|
|||
|
|
* src/insets/insetcite.C (create_form_citation_form): some Gravity
|
|||
|
|
changes.
|
|||
|
|
|
|||
|
|
* src/text.C (SetHeightOfRow): fixed calcualting of width.
|
|||
|
|
|
|||
|
|
2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* images/undo_bw.xpm: new icon.
|
|||
|
|
* images/redo_bw.xpm: ditto.
|
|||
|
|
|
|||
|
|
* configure.in (INSTALL_SCRIPT): change value to
|
|||
|
|
${INSTALL} to avoid failures of install-script target.
|
|||
|
|
* lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
|
|||
|
|
|
|||
|
|
* src/BufferView.h: add a magic "friend" declaration to please
|
|||
|
|
compaq cxx.
|
|||
|
|
|
|||
|
|
2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* forms/cite.fd: modified to allow resizing without messing
|
|||
|
|
up the dialog.
|
|||
|
|
|
|||
|
|
* src/insetcite.C: Uses code from cite.fd almost without
|
|||
|
|
tweaking. ;-)
|
|||
|
|
User can now resize dialog in the x-direction.
|
|||
|
|
Resizing the dialog in the y-direction is prevented, as the
|
|||
|
|
code does this intelligently already.
|
|||
|
|
|
|||
|
|
2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* INSTALL: remove obsolete entry in "problems" section.
|
|||
|
|
|
|||
|
|
* lib/examples/sl_*.lyx: update of the slovenian examples.
|
|||
|
|
|
|||
|
|
* src/support/FileInfo.[Ch] (getBlockSize): remove.
|
|||
|
|
|
|||
|
|
2000-06-23 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyxtext.h: added a 'cleared' flag to draw() function.
|
|||
|
|
|
|||
|
|
* src/buffer.C (resize): delete the LyXText of textinsets.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (SetInsetOwner): set the owner in the insets too.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: added another parameter 'cleared' to
|
|||
|
|
the draw() function.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent): move cursor to the right of the
|
|||
|
|
unlocking inset in inset.
|
|||
|
|
|
|||
|
|
2000-06-22 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
|
|||
|
|
of insets and moved first to LyXText.
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.[Ch]:
|
|||
|
|
* src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
|
|||
|
|
|
|||
|
|
2000-06-21 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): look if I should clear the area or not
|
|||
|
|
using Inset::doClearArea() function.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: added doClearArea() function and
|
|||
|
|
modified draw(Painter &, ...) to draw(BufferView *, ...)
|
|||
|
|
|
|||
|
|
* src/text2.C (UpdateInset): return bool insted of int
|
|||
|
|
|
|||
|
|
2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): Add "Reset" option to the language
|
|||
|
|
combox in the character popup
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (UserFreeFont): Add argument to the method:
|
|||
|
|
BufferParams const & params
|
|||
|
|
|
|||
|
|
2000-06-20 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (SetParagraphData): set insetowner on
|
|||
|
|
2- paragraphs.
|
|||
|
|
|
|||
|
|
2000-06-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/Timeout.[Ch]: Change to use signals instead of callbacks.
|
|||
|
|
* src/LyXView.h (struct FD_form_main): remove, LyXView inherits
|
|||
|
|
from SigC::Object
|
|||
|
|
(form_main_): remove
|
|||
|
|
|
|||
|
|
* src/LyXView.C (LyXView_AutosaveTimerCB): remove
|
|||
|
|
(create_form_form_main): remove FD_form_main stuff, connect to
|
|||
|
|
autosave_timeout signal
|
|||
|
|
|
|||
|
|
* src/LyXView.[Ch] (getMainForm): remove
|
|||
|
|
(UpdateTimerCB): remove
|
|||
|
|
* src/BufferView_pimpl.h: inherit from SigC::Object
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
|
|||
|
|
signal instead of callback
|
|||
|
|
|
|||
|
|
* src/BufferView.[Ch] (cursorToggleCB): remove
|
|||
|
|
|
|||
|
|
2000-06-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C: changes because of the one below
|
|||
|
|
|
|||
|
|
* src/screen.[Ch]: Made the lyxscreen take LyXText as argument
|
|||
|
|
instead of storing a pointer to a LyXText.
|
|||
|
|
|
|||
|
|
* src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
|
|||
|
|
|
|||
|
|
2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h
|
|||
|
|
|
|||
|
|
* src/paragraph.C: Changed fontlist to a sorted vector.
|
|||
|
|
|
|||
|
|
2000-06-19 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/BufferView.h: added screen() function.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): some selection code
|
|||
|
|
fixed.
|
|||
|
|
|
|||
|
|
* src/vspace.C (nextToken): use stringfunctions instead of sscanf.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (SetParagraphData):
|
|||
|
|
(Read):
|
|||
|
|
(InsetText): fixes for multiple paragraphs.
|
|||
|
|
|
|||
|
|
2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
|
|||
|
|
|
|||
|
|
* development/lyx.spec.in: Call configure with ``--without-warnings''
|
|||
|
|
to work around a bug with the Makefiles when doing ``make lyxrpm''.
|
|||
|
|
This should be fine, however, since we generally don't want to be
|
|||
|
|
verbose when making an RPM.
|
|||
|
|
|
|||
|
|
2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* lib/scripts/fig2pstex.py: New file
|
|||
|
|
|
|||
|
|
2000-06-16 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (UpdateLocal):
|
|||
|
|
* src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
|
|||
|
|
(LocalDispatch): Changed all functions to use LyXText.
|
|||
|
|
|
|||
|
|
2000-06-15 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/text.C (SetHeightOfRow): call inset::update before requesting
|
|||
|
|
any width/height.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (update):
|
|||
|
|
* src/insets/insettabular.C (update): added implementation
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: added update function
|
|||
|
|
|
|||
|
|
2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/text.C (SelectNextWord): protect against null pointers with
|
|||
|
|
old-style string streams. (fix from Paul Theo Gonciari
|
|||
|
|
<gptheo@yahoo.com>)
|
|||
|
|
|
|||
|
|
* src/cite.[Ch]: remove erroneous files.
|
|||
|
|
|
|||
|
|
* lib/configure.m4: update the list of created directories.
|
|||
|
|
|
|||
|
|
* src/lyxrow.C: include <config.h>
|
|||
|
|
* src/lyxcursor.C: ditto.
|
|||
|
|
|
|||
|
|
2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/examples/decimal.lyx: new example file from Mike.
|
|||
|
|
|
|||
|
|
* src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
|
|||
|
|
to find template definitions (from Dekel)
|
|||
|
|
|
|||
|
|
* src/frontends/.cvsignore: add a few things.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/input_validators.[ch]: remove C++ comments.
|
|||
|
|
|
|||
|
|
* src/Timeout.C (TimeOut): remove default argument.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
|
|||
|
|
"C" linkage.
|
|||
|
|
|
|||
|
|
* src/insets/ExternalTemplate.C: add a "using" directive.
|
|||
|
|
|
|||
|
|
* src/lyx_main.h: remove the act_ struct, which seems unused
|
|||
|
|
anyway.
|
|||
|
|
|
|||
|
|
2000-06-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* LyX Developers Meeting: All files changed, due to random C++ (by
|
|||
|
|
coincidence) code generator script.
|
|||
|
|
|
|||
|
|
- external inset (cool!)
|
|||
|
|
- initial online editing of preferences
|
|||
|
|
- insettabular breaks insettext(s contents)
|
|||
|
|
- cleanup
|
|||
|
|
- some DocBook fixes
|
|||
|
|
- example files update
|
|||
|
|
- other cool stuff, create a diff and look for yourself.
|
|||
|
|
|
|||
|
|
2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (computeTextRows): if the maxWidth is
|
|||
|
|
-1 this is a non-line-breaking textinset.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
|
|||
|
|
if there is no width set.
|
|||
|
|
|
|||
|
|
2000-06-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* Lots of files: Merged the dialogbase branch.
|
|||
|
|
|
|||
|
|
2000-06-09 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
|
|||
|
|
and the Dispatch methods that used it.
|
|||
|
|
|
|||
|
|
* src/frontends/Liason.[Ch]: replaced with a Liason namespace for
|
|||
|
|
access to functions formerly kept in Dispatch.
|
|||
|
|
|
|||
|
|
2000-05-19 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
|
|||
|
|
made to_page and count_copies integers again. from_page remains a
|
|||
|
|
string however because I want to allow entry of a print range like
|
|||
|
|
"1,4,22-25" using this field.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C: added action info and commands for buffer-print-xtl
|
|||
|
|
and printer-params-get. These aren't useful from the minibuffer but
|
|||
|
|
could be used by a script/LyXServer app provided it passes a suitable
|
|||
|
|
auto_mem_buffer. I guess I should take a look at how the LyXServer
|
|||
|
|
works and make it support xtl buffers.
|
|||
|
|
|
|||
|
|
* sigc++/: updated to libsigc++-1.0.1
|
|||
|
|
|
|||
|
|
* src/xtl/: updated to xtl-1.3.pl.11
|
|||
|
|
|
|||
|
|
* forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
|
|||
|
|
those changes done to the files in src/ are actually recreated when
|
|||
|
|
they get regenerated. Please don't ever accept a patch that changes a
|
|||
|
|
dialog unless that patch includes the changes to the corresponding *.fd
|
|||
|
|
file.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
|
|||
|
|
stringOnlyContains, renamed it and generalised it.
|
|||
|
|
|
|||
|
|
* lots-of-files: Rolled the "rae" branch over into the "dialogbase"
|
|||
|
|
branch. Removed the remaining old form_print code.
|
|||
|
|
|
|||
|
|
2000-04-26 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
|
|||
|
|
trap I was trying to fix with the ID: fields in src/xtl/ :-)
|
|||
|
|
|
|||
|
|
2000-04-25 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/xtl/: Updated to incorporate Angus's two patches as well as mine
|
|||
|
|
against a base of xtl-1.3.pl.4
|
|||
|
|
|
|||
|
|
* development/tools/lxtl.sh: fixed a couple of silly typos and now
|
|||
|
|
filter the Id: entries so they still show the xtl version number
|
|||
|
|
they are based on.
|
|||
|
|
|
|||
|
|
* src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
|
|||
|
|
into the src/xtl code. Patch still pending with Jos<6F> (XTL)
|
|||
|
|
|
|||
|
|
2000-04-24 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
|
|||
|
|
both more generic and much safer. Use the new template functions.
|
|||
|
|
* src/buffer.[Ch] (Dispatch): ditto.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPrint.C (update): Use new template functions
|
|||
|
|
and mem buffer more intelligently. Also a little general cleanup.
|
|||
|
|
(apply): ditto.
|
|||
|
|
|
|||
|
|
* configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
|
|||
|
|
* development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
|
|||
|
|
* src/xtl/Makefile.am: ditto.
|
|||
|
|
* src/xtl/.cvsignore: ditto.
|
|||
|
|
* src/Makefile.am: ditto.
|
|||
|
|
|
|||
|
|
* src/PrinterParams.h: Removed the macros member functions. Added a
|
|||
|
|
testInvariant member function. A bit of tidying up and commenting.
|
|||
|
|
Included Angus's idea for fixing operation with egcs-1.1.2.
|
|||
|
|
|
|||
|
|
* src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
|
|||
|
|
cool expansion of XTL's mem_buffer to support automatic memory
|
|||
|
|
management within the buffer itself. Removed the various macros and
|
|||
|
|
replaced them with template functions that use either auto_mem_buffer
|
|||
|
|
or mem_buffer depending on a #define. The mem_buffer support will
|
|||
|
|
disappear as soon as the auto_mem_buffer is confirmed to be good on
|
|||
|
|
other platforms/compilers. That is, it's there so you've got something
|
|||
|
|
to compare against.
|
|||
|
|
|
|||
|
|
* src/xtl/objio.h: Changes to support auto_mem_buffer. This has
|
|||
|
|
effectively forked XTL. However I expect Jos<6F> will include my code
|
|||
|
|
into the next major release. Also fixed a memory leak.
|
|||
|
|
* src/xtl/text.h: ditto.
|
|||
|
|
* src/xtl/xdr.h: ditto.
|
|||
|
|
* src/xtl/giop.h: ditto.
|
|||
|
|
|
|||
|
|
2000-04-16 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
|
|||
|
|
by autogen.sh and removed by maintainer-clean anyway.
|
|||
|
|
* .cvsignore, sigc++/.cvsignore: Support the above.
|
|||
|
|
|
|||
|
|
* sigc++/.cvsignore: Forgot that retbind.h was generated.
|
|||
|
|
|
|||
|
|
* src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
|
|||
|
|
macros, renamed static callback-target member functions to suit new
|
|||
|
|
scheme and made them public.
|
|||
|
|
* src/frontends/xforms/forms/form_print.fd: ditto.
|
|||
|
|
* src/frontends/xforms/forms/form_copyright.fd: ditto.
|
|||
|
|
|
|||
|
|
* src/support/lxtl.h: small cleanup to use typedef instead of #define
|
|||
|
|
for gui_format.
|
|||
|
|
|
|||
|
|
* src/xtl/: New directory containing a minimal distribution of XTL.
|
|||
|
|
This is XTL-1.3.pl.4.
|
|||
|
|
|
|||
|
|
* development/tools/lxtl.sh: A script to generate the above mini-dist.
|
|||
|
|
|
|||
|
|
2000-04-15 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* development/tools/makeLyXsigc.sh: Remove the library version numbers
|
|||
|
|
|
|||
|
|
* sigc++/: Updated to libsigc++-1.0.0
|
|||
|
|
|
|||
|
|
2000-04-14 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_macros.h: Remove specific macros and just
|
|||
|
|
use the generic ones in future. I'll modify my conversion script.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.[Ch]: Removed references to form_print.
|
|||
|
|
(CloseAllBufferRelatedDialogs): Renamed.
|
|||
|
|
(updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.C: Use the specific macros instead
|
|||
|
|
of the generic ones. These are the same ones my conversion script
|
|||
|
|
generates.
|
|||
|
|
|
|||
|
|
* src/PrinterParams.h: Allow you to print a range of odd or even pages.
|
|||
|
|
* src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
|
|||
|
|
* src/buffer.C (Dispatch): ditto
|
|||
|
|
|
|||
|
|
* src/LyXView.C (LyXView): Use new signals instead of old hard coded
|
|||
|
|
functions for updating and hiding buffer dependent dialogs.
|
|||
|
|
* src/BufferView.C (buffer): ditto
|
|||
|
|
* src/buffer.C (setReadonly): ditto
|
|||
|
|
* src/lyxfunc.C (CloseBuffer): ditto
|
|||
|
|
|
|||
|
|
* src/buffer.h: Take setReadonly() out of line so I don't have to include
|
|||
|
|
Dialogs.h, and hence all the SigC stuff, into every file that includes
|
|||
|
|
buffer.h. We also don't need to include lyx_gui_misc.h in everything.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C: reduce the number of headers included by buffer.h
|
|||
|
|
|
|||
|
|
2000-04-11 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/xform_macros.h: A small collection of macros
|
|||
|
|
for building C callbacks.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am: Added above file.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
|
|||
|
|
scheme again. This time it should work for JMarc. If this is
|
|||
|
|
successful I'll revise my conversion script to automate some of this.
|
|||
|
|
The static member functions in the class also have to be public for
|
|||
|
|
this scheme will work. If the scheme works (it's almost identical to
|
|||
|
|
the way BufferView::cursorToggleCB is handled so it should work) then
|
|||
|
|
FormCopyright and FormPrint will be ready for inclusion into the main
|
|||
|
|
trunk immediately after 1.1.5 is released -- provided we're prepared
|
|||
|
|
for complaints about lame compilers not handling XTL.
|
|||
|
|
|
|||
|
|
* src/support/lxtl.h: Switched to XDR_format instead of raw_format.
|
|||
|
|
|
|||
|
|
2000-04-07 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4: A bit more tidying up (Angus)
|
|||
|
|
|
|||
|
|
* src/LString.h: JMarc's <string> header fix
|
|||
|
|
|
|||
|
|
* src/PrinterParams.h: Used string for most data to remove some
|
|||
|
|
ugly code in the Print dialog and avoid even uglier code when
|
|||
|
|
appending the ints to a string for output.
|
|||
|
|
|
|||
|
|
* src/buffer.C (Dispatch): Added a couple of braces to fix an error
|
|||
|
|
and moved "default:" back to the end of switch statement. Cleaned
|
|||
|
|
up the printing so it uses the right function calls and so the
|
|||
|
|
"print to file" option actually puts the file in the right directory.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
|
|||
|
|
and Ok+Apply button control into a separate method: input (Angus).
|
|||
|
|
(input) Cleaned it up and improved it to be very thorough now.
|
|||
|
|
(All CB) static_cast used instead of C style cast (Angus). This will
|
|||
|
|
probably change again once we've worked out how to keep gcc-2.8.1 happy
|
|||
|
|
with real C callbacks.
|
|||
|
|
(update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
|
|||
|
|
ignore some of the bool settings and has random numbers instead. Needs
|
|||
|
|
some more investigation. Added other input length checks and checking
|
|||
|
|
of file and printer names.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormPrint.h: Removed pragma statement so it
|
|||
|
|
would link (Angus). Seems the old code doesn't compile with the pragma
|
|||
|
|
statement either. Separated callback entries from internal methods.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
|
|||
|
|
|
|||
|
|
2000-03-17 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
|
|||
|
|
need it? Maybe it could go in Dialogs instead? I could make it a
|
|||
|
|
LFUN but you'd have to call Dispatch(int, int, char*) with dummy
|
|||
|
|
values to get the bool return value.
|
|||
|
|
(Dispatch): New overloaded method for xtl support.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
|
|||
|
|
extern "C" callback instead of static member functions. Hopefully,
|
|||
|
|
JMarc will be able to compile this. I haven't changed
|
|||
|
|
forms/form_copyright.fd yet. Breaking one of my own rules already.
|
|||
|
|
|
|||
|
|
* src/commandtags.h: New xtl-based LFUN's no description in LyXAction
|
|||
|
|
because they aren't useful from the minibuffer. Maybe a LyXServer
|
|||
|
|
might want a help message though?
|
|||
|
|
|
|||
|
|
* src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4: Changes to g++ flags to suit compiling with
|
|||
|
|
xtl which needs both rtti and exceptions.
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am:
|
|||
|
|
* src/support/lxtl.h: New file. Some helper macros for using XTL.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/input_validators.[ch]: input filters and
|
|||
|
|
validators. These conrol what keys are valid in input boxes.
|
|||
|
|
Use them and write some more. Much better idea than waiting till
|
|||
|
|
after the user has pressed Ok to say that the input fields don't make
|
|||
|
|
sense.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/Makefile.am:
|
|||
|
|
* src/frontends/xforms/forms/form_print.fd:
|
|||
|
|
* src/frontends/xforms/forms/makefile:
|
|||
|
|
* src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
|
|||
|
|
new scheme. Still have to make sure I haven't missed anything from
|
|||
|
|
the current implementation.
|
|||
|
|
|
|||
|
|
* src/Makefile.am, src/PrinterParams.h: New data store.
|
|||
|
|
|
|||
|
|
* other files: Added a couple of copyright notices.
|
|||
|
|
|
|||
|
|
2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.h: move Holder struct in public space.
|
|||
|
|
|
|||
|
|
* src/frontends/include/DialogBase.h: use SigC:: only when
|
|||
|
|
SIGC_CXX_NAMESPACES is defined.
|
|||
|
|
* src/frontends/include/Dialogs.h: ditto.
|
|||
|
|
|
|||
|
|
* sigc++/Makefile.am (%.h): use the autodected GNU m4.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/FormCopyright.[Ch]: do not
|
|||
|
|
mention SigC:: explicitely.
|
|||
|
|
|
|||
|
|
2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
|
|||
|
|
deals with testing KDE in main configure.in
|
|||
|
|
* configure.in: ditto.
|
|||
|
|
|
|||
|
|
2000-02-22 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* Lots of files: Merged from HEAD
|
|||
|
|
|
|||
|
|
* All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
|
|||
|
|
with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
|
|||
|
|
|
|||
|
|
* autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
|
|||
|
|
|
|||
|
|
* sigc++/: new minidist.
|
|||
|
|
|
|||
|
|
2000-02-14 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* development/tools/makeLyXsigc.sh: Small fix for Makefile.am
|
|||
|
|
|
|||
|
|
2000-02-08 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
|
|||
|
|
file for the buildin GUI builder of KDevelop of the copyright-dialog.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
|
|||
|
|
for this port and so it is much easier for other people to port
|
|||
|
|
dialogs in a common development environment.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
|
|||
|
|
the QT/KDE implementation.
|
|||
|
|
|
|||
|
|
* src/frontends/kde/Dialogs.C:
|
|||
|
|
* src/frontends/kde/FormCopyright.C:
|
|||
|
|
* src/frontends/kde/FormCopyright.h:
|
|||
|
|
* src/frontends/kde/Makefile.am:
|
|||
|
|
* src/frontends/kde/formcopyrightdialog.C:
|
|||
|
|
* src/frontends/kde/formcopyrightdialog.h:
|
|||
|
|
* src/frontends/kde/formcopyrightdialogdata.C: added this source-files
|
|||
|
|
for the kde support of the Copyright-Dialog.
|
|||
|
|
|
|||
|
|
* src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
|
|||
|
|
subdir-substitution instead of hardcoded 'xforms' as we now have also
|
|||
|
|
the kde subdir.
|
|||
|
|
|
|||
|
|
* src/frontends/include/DialogBase.h (Object): just commented the
|
|||
|
|
label after #endif (nasty warning and I don't like warnings ;)
|
|||
|
|
|
|||
|
|
* src/main.C (main): added KApplication initialization if using
|
|||
|
|
KDE frontend-GUI.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (runTime): added support for multiple toolkit support.
|
|||
|
|
For now only the KDE event-loop is added if frontend==kde.
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
|
|||
|
|
|
|||
|
|
* configure.in: added support for the --with-frontend[=value] option
|
|||
|
|
|
|||
|
|
* autogen.sh: added kde.m4 file to list of config-files
|
|||
|
|
|
|||
|
|
* acconfig.h: added define for KDEGUI-support
|
|||
|
|
|
|||
|
|
* config/kde.m4: added configuration functions for KDE-port
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4: added --with-frontend[=value] option with
|
|||
|
|
support for xforms and KDE.
|
|||
|
|
|
|||
|
|
2000-02-08 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* all Makefile.am: Fixed up so the make targets dist, distclean,
|
|||
|
|
install and uninstall all work even if builddir != srcdir. Still
|
|||
|
|
have a new sigc++ minidist update to come.
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4: Some more builddir!=srcdir fixes.
|
|||
|
|
|
|||
|
|
2000-02-01 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
|
|||
|
|
Many mods to get builddir != srcdir working.
|
|||
|
|
|
|||
|
|
* sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
|
|||
|
|
for building on NT and so we can do the builddir != srcdir stuff.
|
|||
|
|
|
|||
|
|
2000-01-30 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
|
|||
|
|
This will stay in "rae" branch. We probably don't really need it in
|
|||
|
|
the main trunk as anyone who wants to help programming it should get
|
|||
|
|
a full library installed also. So they can check both included and
|
|||
|
|
system supplied library compilation.
|
|||
|
|
|
|||
|
|
* sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
|
|||
|
|
Added a 'mini' distribution of libsigc++. If you feel the urge to
|
|||
|
|
change something in these directories - Resist it. If you can't
|
|||
|
|
resist the urge then you should modify the following script and rebuild
|
|||
|
|
the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
|
|||
|
|
all happen. Still uses a hacked version of libsigc++'s configure.in.
|
|||
|
|
I'm quite happy with the results. I'm not sure the extra work to turn
|
|||
|
|
the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
|
|||
|
|
worth the trouble and would probably lead to extra maintenance
|
|||
|
|
headaches.
|
|||
|
|
I haven't tested the following important make targets: install, dist.
|
|||
|
|
Not ready for prime time but very close. Maybe 1.1.5.
|
|||
|
|
|
|||
|
|
* development/tools/makeLyXsigc.sh: A shell script to automatically
|
|||
|
|
generate our mini-dist of libsigc++. It can only be used with a CVS
|
|||
|
|
checkout of libsigc++ not a tarball distribution. It's well commented.
|
|||
|
|
This will end up as part of the libsigc++ distribution so other apps
|
|||
|
|
can easily have an included mini-dist. If someone makes mods to the
|
|||
|
|
sigc++ subpackage without modifying this script to generate those
|
|||
|
|
changes I'll be very upset!
|
|||
|
|
|
|||
|
|
* src/frontends/: Started the gui/system indep structure.
|
|||
|
|
|
|||
|
|
* src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
|
|||
|
|
to access the gui-indep dialogs are in this class. Much improved
|
|||
|
|
design compared to previous revision. Lars, please refrain from
|
|||
|
|
moving this header into src/ like you did with Popups.h last time.
|
|||
|
|
|
|||
|
|
* src/frontends/include/DialogBase.h: Abstract base class for dialogs.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/: Started the gui-indep system with a single
|
|||
|
|
dialog: FormCopyright. Initial testing of use of libsigc++ was very
|
|||
|
|
successful.
|
|||
|
|
|
|||
|
|
* src/frontends/xforms/forms: Repository for the xforms .fd files.
|
|||
|
|
Here you'll find a very useful makefile and automated fdfix.sh that
|
|||
|
|
makes updating dailogs a no-brainer -- provided you follow the rules
|
|||
|
|
set out in the README. I'm thinking about adding another script to
|
|||
|
|
automatically generate skeleton code for a new dialog given just the
|
|||
|
|
name of the dialog.
|
|||
|
|
|
|||
|
|
* src/commandtags.h, src/lyxfunc.C, src/menus.C:
|
|||
|
|
* src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
|
|||
|
|
Made FormCopyright gui-indep and added a lyxfunc to get to it.
|
|||
|
|
|
|||
|
|
2000-06-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/LSubstring.C (operator): simplify
|
|||
|
|
|
|||
|
|
* src/lyxtext.h: removed bparams, use buffer_->params instead
|
|||
|
|
|
|||
|
|
* src/lyxrow.h: make Row a real class, move all variables to
|
|||
|
|
private and use accessors.
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h (getParLanguage):<3A>add BufferParamas as
|
|||
|
|
arguament.
|
|||
|
|
(isRightToLeftPar): ditto
|
|||
|
|
(ChangeLanguage): ditto
|
|||
|
|
(isMultiLingual): ditto
|
|||
|
|
(String): ditto
|
|||
|
|
(TeXOnePar): ditto
|
|||
|
|
(SimpleTeXOnePar): ditto
|
|||
|
|
(TeXEnvironment): ditto
|
|||
|
|
(GetEndLabel): ditto
|
|||
|
|
(SetLayout): ditto
|
|||
|
|
(SetOnlyLayout): ditto
|
|||
|
|
(BreakParagraph): ditto
|
|||
|
|
(BreakParagraphConservative): ditto
|
|||
|
|
(GetFontSettings): ditto
|
|||
|
|
(getFont): ditto
|
|||
|
|
(CopyIntoMinibuffer): ditto
|
|||
|
|
(CutIntoMinibuffer): ditto
|
|||
|
|
(PasteParagraph): ditto
|
|||
|
|
(SetPExtraType): ditto
|
|||
|
|
(UnsetPExtraType): ditto
|
|||
|
|
(DocBookContTableRows): ditto
|
|||
|
|
(SimpleDocBookOneTablePar): ditto
|
|||
|
|
(TeXDeeper): ditto
|
|||
|
|
(TeXFootnote): ditto
|
|||
|
|
(SimpleTeXOneTablePar): ditto
|
|||
|
|
(TeXContTableRows): ditto
|
|||
|
|
(SimpleTeXSpecialChars): ditto
|
|||
|
|
|
|||
|
|
|
|||
|
|
* src/lyxcursor.h: make LyXCursor a real class, move all variables
|
|||
|
|
to private and use accessors.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: remove char updatetimer, and all code that uses
|
|||
|
|
this, we did not use it anymore and has not been for ages. Just a
|
|||
|
|
waste of cpu cycles.
|
|||
|
|
|
|||
|
|
* src/language.h: make Language a real class, move all variables
|
|||
|
|
to private and use accessors.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (Pimpl): use new timer code.
|
|||
|
|
(create_view): remove
|
|||
|
|
(update): some changes for new timer
|
|||
|
|
(cursorToggle): use new timer
|
|||
|
|
(beforeChange): change for new timer
|
|||
|
|
|
|||
|
|
* src/BufferView.h (cursorToggleCB): removed last paramter because
|
|||
|
|
of new timer code.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (C_BufferView_CursorToggleCB): removed
|
|||
|
|
(cursorToggleCB): change because of new timer code
|
|||
|
|
|
|||
|
|
* lib/CREDITS: updated own mailaddress
|
|||
|
|
|
|||
|
|
2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (PutEnv): fix the code in case neither
|
|||
|
|
putenv() nor setenv() have been found.
|
|||
|
|
|
|||
|
|
* INSTALL: mention the install-strip Makefile target.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): make LFUN_BUILDPROG available in
|
|||
|
|
read-only documents.
|
|||
|
|
|
|||
|
|
2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/reLyX/configure.in (VERSION): avoid using a previously
|
|||
|
|
generated reLyX wrapper to find out $prefix.
|
|||
|
|
|
|||
|
|
* lib/examples/eu_adibide_lyx-atua.lyx:
|
|||
|
|
* lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
|
|||
|
|
translation of the Tutorial (Dooteo)
|
|||
|
|
|
|||
|
|
2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
|
|||
|
|
|
|||
|
|
* forms/cite.fd: new citation dialog
|
|||
|
|
|
|||
|
|
* src/insetcite.[Ch]: the new citation dialog is moved into
|
|||
|
|
its own files.
|
|||
|
|
|
|||
|
|
* src/insetbib.C: InsetBibtex::getKeys() uses STL containers
|
|||
|
|
(Dekel).
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.h: data members made private.
|
|||
|
|
|
|||
|
|
2000-06-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* LyX 1.1.5 released
|
|||
|
|
|
|||
|
|
2000-06-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/version.h (LYX_RELEASE): to 1.1.5
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (RunSpellChecker): return false if the
|
|||
|
|
spellchecker dies upon creation.
|
|||
|
|
|
|||
|
|
2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
|
|||
|
|
in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
|
|||
|
|
|
|||
|
|
* NEWS: update.
|
|||
|
|
|
|||
|
|
* lib/CREDITS: update entry for Martin Vermeer.
|
|||
|
|
|
|||
|
|
2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/text.C (draw): Draw foreign language bars at the bottom of
|
|||
|
|
the row instead of at the baseline.
|
|||
|
|
|
|||
|
|
* lib/examples/Minipage.lyx: Use the new multi-lingual support.
|
|||
|
|
|
|||
|
|
2000-06-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/bind/de_menus.bind: updated
|
|||
|
|
|
|||
|
|
2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
|
|||
|
|
|
|||
|
|
2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/menus.C (Limit_string_length): New function
|
|||
|
|
(ShowTocMenu): Limit the number of items/length of items in the
|
|||
|
|
LOT/LOF/LOA menus.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (String): Correct result for a paragraph inside
|
|||
|
|
a footnote.
|
|||
|
|
|
|||
|
|
2000-06-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (close): test of buf->getuser() == NULL
|
|||
|
|
|
|||
|
|
2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (removeAutoInsets): Fix a bug:
|
|||
|
|
Do not call to SetCursor when the paragraph is a closed footnote!
|
|||
|
|
|
|||
|
|
2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
|
|||
|
|
label is changed.
|
|||
|
|
|
|||
|
|
* src/text.C (SetCursor): Made the computation of cursor_vpos safer.
|
|||
|
|
|
|||
|
|
2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* forms/lyx.fd
|
|||
|
|
* src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
|
|||
|
|
reference popup, that activates the reference-back action
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
|
|||
|
|
|
|||
|
|
* src/menus.C (Add_to_refs_menu): Limit the size of each item in
|
|||
|
|
the menus. Also fixed a bug.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
|
|||
|
|
the math panels when switching buffers (unless new buffer is readonly).
|
|||
|
|
|
|||
|
|
* src/BufferView.C (NoSavedPositions)
|
|||
|
|
* src/BufferView_pimpl.C (NoSavedPositions): New methods
|
|||
|
|
|
|||
|
|
2000-06-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
|
|||
|
|
less of dvi dirty or not.
|
|||
|
|
|
|||
|
|
* src/trans_mgr.[Ch] (insert): change first parameter to string
|
|||
|
|
const &.
|
|||
|
|
|
|||
|
|
* src/chset.[Ch] (encodeString): add const to first parameter
|
|||
|
|
|
|||
|
|
2000-05-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (begin): fix a "shared" string bug. use
|
|||
|
|
rep->get_own_copy()
|
|||
|
|
(end): ditto
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (deplog): better searching for dependency files in
|
|||
|
|
the latex log. Uses now regexps.
|
|||
|
|
|
|||
|
|
* lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
|
|||
|
|
instead of the box hack or \hfill.
|
|||
|
|
|
|||
|
|
2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (doImportHelper): do not create the file before
|
|||
|
|
doing the actual import.
|
|||
|
|
(doImportASCIIasLines): create a new file before doing the insert.
|
|||
|
|
(doImportASCIIasParagraphs): ditto.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: remove mention of non-existing commands
|
|||
|
|
|
|||
|
|
* lyx.man: remove mention of color-related switches.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C: remove all the color-related ressources, which
|
|||
|
|
are not used anymore.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
|
|||
|
|
name.
|
|||
|
|
|
|||
|
|
2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (read): Add a missing break in the switch
|
|||
|
|
|
|||
|
|
2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/text2.C (InsertStringA): Fix a bug with insertion into table
|
|||
|
|
|
|||
|
|
* src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
|
|||
|
|
text is Hebrew.
|
|||
|
|
|
|||
|
|
2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/text.C (draw): draw bars under foreign language words.
|
|||
|
|
|
|||
|
|
* src/LColor.[Ch]: add LColor::language
|
|||
|
|
|
|||
|
|
2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyxcursor.h (boundary): New member variable
|
|||
|
|
|
|||
|
|
* src/text.C (IsBoundary): New methods
|
|||
|
|
|
|||
|
|
* src/text.C: Use the above for currect cursor movement when there
|
|||
|
|
is both RTL & LTR text.
|
|||
|
|
|
|||
|
|
* src/text2.C: ditto
|
|||
|
|
|
|||
|
|
* src/bufferview_funcs.C (ToggleAndShow): ditto
|
|||
|
|
|
|||
|
|
2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/text.C (DeleteLineForward): set selection to true to avoid
|
|||
|
|
that DeleteEmptyParagraphMechanism does some magic. This is how it
|
|||
|
|
is done in all other functions, and seems reasonable.
|
|||
|
|
(DeleteWordForward): do not jump over non-word stuff, since
|
|||
|
|
CursorRightOneWord() already does it.
|
|||
|
|
|
|||
|
|
Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
|
|||
|
|
DeleteWordBackward, since they seem safe to me (since selection is
|
|||
|
|
set to "true") DeleteEmptyParagraphMechanism does nothing.
|
|||
|
|
|
|||
|
|
2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (easyParse): simplify the code by factoring the
|
|||
|
|
part that removes parameters from the command line.
|
|||
|
|
(LyX): check wether wrong command line options have been given.
|
|||
|
|
|
|||
|
|
2000-05-29 Lior Silberman <slior@math.huji.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyx_main.C : add support for specifying user LyX
|
|||
|
|
directory via command line option -userdir.
|
|||
|
|
|
|||
|
|
2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/menus.C (Add_to_toc_menu): Limit the number of popups, and
|
|||
|
|
the number of items per popup.
|
|||
|
|
(Add_to_refs_menu): Ditto.
|
|||
|
|
|
|||
|
|
2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: renamed ClearParagraph() to
|
|||
|
|
StripLeadingSpaces() and moved it to paragraph.C. We pass the
|
|||
|
|
textclass as parameter, and do nothing if free_spacing is
|
|||
|
|
true. This fixes part of the line-delete-forward problems.
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
|
|||
|
|
(pasteSelection): ditto.
|
|||
|
|
(SwitchLayoutsBetweenClasses): more translatable strings.
|
|||
|
|
|
|||
|
|
* src/text2.C (CutSelection): use StripLeadingSpaces.
|
|||
|
|
(PasteSelection): ditto.
|
|||
|
|
(DeleteEmptyParagraphMechanism): ditto.
|
|||
|
|
|
|||
|
|
2000-05-26 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
|
|||
|
|
is not needed in tabular insets.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (TabularFeatures): added missing features.
|
|||
|
|
|
|||
|
|
* src/tabular.C (DeleteColumn):
|
|||
|
|
(AppendColumn):
|
|||
|
|
(AppendRow): implemented this functions
|
|||
|
|
(cellsturct::operator=): clone the inset too;
|
|||
|
|
|
|||
|
|
2000-05-23 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (LocalDispatch): better selection support
|
|||
|
|
when having multicolumn-cells.
|
|||
|
|
|
|||
|
|
2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
|
|||
|
|
|
|||
|
|
* lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
|
|||
|
|
|
|||
|
|
2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/ColorHandler.C (getGCForeground): put more test into _()
|
|||
|
|
|
|||
|
|
* lib/examples/eu_splash.lyx: new file (Basque translation) from
|
|||
|
|
Dooteo.
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
|
|||
|
|
get the version.
|
|||
|
|
|
|||
|
|
2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
|
|||
|
|
there are no labels, or when buffer is readonly.
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowRefsMenu) disable appropriate menu items when
|
|||
|
|
there are no labels, buffer is SGML, or when buffer is readonly.
|
|||
|
|
|
|||
|
|
2000-05-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/LColor.C (LColor): change a couple of grey40 to grey60
|
|||
|
|
(LColor): rewore initalization to make compiles go some magnitude
|
|||
|
|
faster.
|
|||
|
|
(getGUIName): don't use gettext until we need the string.
|
|||
|
|
|
|||
|
|
2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/Bullet.[Ch]: Fixed a small bug.
|
|||
|
|
|
|||
|
|
2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (String): Several fixes/improvements
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
|
|||
|
|
|
|||
|
|
2000-05-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (String): give more correct output.
|
|||
|
|
|
|||
|
|
2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (stateText) Do not output the language if it is
|
|||
|
|
eqaul to the language of the document.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar): Do not put language switch commands
|
|||
|
|
between two paragraphs with the same language.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (getParLanguage) Return a correct answer for an
|
|||
|
|
empty dummy paragraph.
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
|
|||
|
|
menus.
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
|
|||
|
|
layout menu.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
|
|||
|
|
the menus/popup, if requested fonts are unavailable.
|
|||
|
|
|
|||
|
|
2000-05-22 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (LocalDispatch): added some more cursor
|
|||
|
|
movement support (Up/Down/Tab/Shift-Tab).
|
|||
|
|
(LocalDispatch): added also preliminari cursor-selection.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (PasteParagraph): Hopefully now right!
|
|||
|
|
|
|||
|
|
2000-05-22 Garst R. Reese <reese@isn.net>
|
|||
|
|
|
|||
|
|
* layouts/hollywood.layout, broadway.layout : move Dialogue to top
|
|||
|
|
of list, change all references to Environment to Command
|
|||
|
|
* tex/hollywood.cls : rewrite environments as commands, add
|
|||
|
|
\uppercase to interiorshot and exteriorshot to force uppecase.
|
|||
|
|
* tex/broadway.cls : rewrite environments as commands. Tweak
|
|||
|
|
whitespace.
|
|||
|
|
|
|||
|
|
2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/menus.C (Add_to_toc_menu): fix the code which limits the
|
|||
|
|
size of items: use a constant intead of the hardcoded 40, and more
|
|||
|
|
importantly do not remove the %m and %x tags added at the end.
|
|||
|
|
(Add_to_refs_menu): use vector::size_type instead of
|
|||
|
|
unsigned int as basic types for the variables. _Please_ do not
|
|||
|
|
assume that size_t is equal to unsigned int. On an alpha, this is
|
|||
|
|
unsigned long, which is _not_ the same.
|
|||
|
|
|
|||
|
|
* src/language.C (initL): remove language "hungarian", since it
|
|||
|
|
seems that "magyar" is better.
|
|||
|
|
|
|||
|
|
2000-05-22 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
|
|||
|
|
|
|||
|
|
* src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
|
|||
|
|
end markers!
|
|||
|
|
|
|||
|
|
* src/paragraph.C (PasteParagraph): Possibly a memory leak as
|
|||
|
|
next was deleted but not set to 0.
|
|||
|
|
|
|||
|
|
2000-05-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/language.C (initL): change the initialization of languages
|
|||
|
|
so that compiles goes _fast_.
|
|||
|
|
|
|||
|
|
* src/menus.C (Add_to_toc_menu): limit the line length in TOC to
|
|||
|
|
40 chars.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
|
|||
|
|
|
|||
|
|
2000-05-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* release 1.1.5pre3
|
|||
|
|
|
|||
|
|
2000-05-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (request_clipboard_cb): give "C" linkage.
|
|||
|
|
|
|||
|
|
2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/commandtags.h
|
|||
|
|
* src/LyXAction.C
|
|||
|
|
* src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
|
|||
|
|
and LFUN_LOAVIEW
|
|||
|
|
|
|||
|
|
* src/insets/insetlo*.[Ch]: Made editable
|
|||
|
|
|
|||
|
|
2000-05-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (SetSelection): call BufferView::stuffClipboard with
|
|||
|
|
the current selection.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (stuffClipboard): new method
|
|||
|
|
|
|||
|
|
* src/BufferView.C (stuffClipboard): new method
|
|||
|
|
|
|||
|
|
* src/paragraph.C (String): new method
|
|||
|
|
|
|||
|
|
* src/LColor.C (getFromLyXName): return LColor::inherit instead of
|
|||
|
|
LColor::ignore when lyxname is not found.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (pasteSelection): new method
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (pasteSelection): new method
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): use the new clipboard functions.
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (request_clipboard_cb): new static function
|
|||
|
|
(getClipboard): new method
|
|||
|
|
(putClipboard): new method
|
|||
|
|
|
|||
|
|
2000-05-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* LyX 1.1.5pre2 released
|
|||
|
|
|
|||
|
|
2000-05-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/vspace.C (operator=): removed
|
|||
|
|
(operator=): removed
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (askForText): manually set the type in make_pair
|
|||
|
|
|
|||
|
|
* src/layout.C (NumberOfClass): manually set the type in make_pair
|
|||
|
|
(NumberOfLayout): ditto
|
|||
|
|
|
|||
|
|
* src/language.C: use the Language constructor for ignore_lang
|
|||
|
|
|
|||
|
|
* src/language.h: add constructors to struct Language
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
|
|||
|
|
|
|||
|
|
* src/text2.C (SetCursorIntern): comment out #warning
|
|||
|
|
|
|||
|
|
* src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
|
|||
|
|
|
|||
|
|
* src/mathed/math_iter.h: initialize sx and sw to 0
|
|||
|
|
|
|||
|
|
2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* forms/lyx.fd: Redesign of form_ref
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.[Ch]
|
|||
|
|
* src/buffer.C
|
|||
|
|
* src/lyx_cb.C
|
|||
|
|
* src/menus.C
|
|||
|
|
* src/insets/insetref.[Ch]: Added support for varioref and prettyref.
|
|||
|
|
|
|||
|
|
* src/buffer.h
|
|||
|
|
* src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
|
|||
|
|
and Buffer::inset_iterator.
|
|||
|
|
|
|||
|
|
* src/menus.C: Added new menus: TOC and Refs.
|
|||
|
|
|
|||
|
|
* src/insets/insetlabel.C (Edit) Made InsetLabel editable.
|
|||
|
|
|
|||
|
|
* src/buffer.C (getTocList): New method.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (ChangeRefs): New method.
|
|||
|
|
|
|||
|
|
* src/buffer.C (getLabelList): New method. It replaces the old
|
|||
|
|
getReferenceList. The return type is vector<string> instead of
|
|||
|
|
string.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (getLabelList): New method. Replaces
|
|||
|
|
the old getLabel() and GetNumberOfLabels() methods.
|
|||
|
|
* src/insets/insetlabel.C (getLabelList): ditto
|
|||
|
|
* src/mathed/formula.C (getLabelList): ditto
|
|||
|
|
|
|||
|
|
* src/paragraph.C (String): New method.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
|
|||
|
|
Uses the new getTocList() method.
|
|||
|
|
TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
|
|||
|
|
which automatically updates the contents of the browser.
|
|||
|
|
(RefUpdateCB): Use the new getLabelList method.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): Give an error if the label is not found.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (gotoLabel) Use the new getLabelList method.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: Added using std::reverse;
|
|||
|
|
|
|||
|
|
2000-05-19 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (computeTextRows): small fix for display of
|
|||
|
|
1 character after a newline.
|
|||
|
|
|
|||
|
|
* src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
|
|||
|
|
to cont-rows!
|
|||
|
|
|
|||
|
|
2000-05-18 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (TabularFeatures): fixed update of display
|
|||
|
|
when changing width of column.
|
|||
|
|
|
|||
|
|
* src/tabular.C (set_row_column_number_info): setting of
|
|||
|
|
autobreak rows if necessary.
|
|||
|
|
|
|||
|
|
2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
|
|||
|
|
|
|||
|
|
* src/vc-backend.*: renamed stat() to status() and vcstat to
|
|||
|
|
vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
|
|||
|
|
compilation broke. The new name seems more relevant, anyway.
|
|||
|
|
|
|||
|
|
2000-05-17 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
|
|||
|
|
which was wrong if the removing caused removing of rows!
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
|
|||
|
|
(pushToken): new function.
|
|||
|
|
|
|||
|
|
* src/text2.C (CutSelection): fix problem discovered with purify
|
|||
|
|
|
|||
|
|
2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/debug.C (showTags): enlarge the first column, now that we
|
|||
|
|
have 6-digits debug codes.
|
|||
|
|
|
|||
|
|
* lib/layouts/hollywood.layout:
|
|||
|
|
* lib/tex/hollywood.cls:
|
|||
|
|
* lib/tex/brodway.cls:
|
|||
|
|
* lib/layouts/brodway.layout: more commands and fewer
|
|||
|
|
environments. Preambles moved in the .cls files. Broadway now has
|
|||
|
|
more options on scene numbering and less whitespace (from Garst)
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (getKeys): make sure that we are in the
|
|||
|
|
document directory, in case the bib file is there.
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (Latex): revert bogus change.
|
|||
|
|
|
|||
|
|
2000-05-16 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (UnlockInsetInInset): Changes to update
|
|||
|
|
the TabularLayout on cursor move.
|
|||
|
|
|
|||
|
|
* src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (Clone): Clone the LyXTabular for
|
|||
|
|
undo-handling.
|
|||
|
|
(getCellXPos):
|
|||
|
|
(draw): fixed cursor position and drawing so that the cursor is
|
|||
|
|
visible when before the tabular-inset.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (init): drawLockedFrame was not initialized
|
|||
|
|
when creating from old insettext.
|
|||
|
|
|
|||
|
|
* src/tabular.C (Clone): added Clone of text-inset for undo-handling.
|
|||
|
|
|
|||
|
|
2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
|
|||
|
|
* lib/tex/brodway.cls: ditto
|
|||
|
|
|
|||
|
|
* lib/layouts/brodway.layout: change alignment of parenthical
|
|||
|
|
layout (Garst)
|
|||
|
|
|
|||
|
|
2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
|
|||
|
|
versions 0.88 and 0.89 are supported.
|
|||
|
|
|
|||
|
|
2000-05-15 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C (draw): enhancements in drawing and
|
|||
|
|
width calculating.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (computeTextRows): redone completely this
|
|||
|
|
function in a much cleaner way, because of problems when having a
|
|||
|
|
fixed maxWidth.
|
|||
|
|
(draw): added a frame border when the inset is locked.
|
|||
|
|
(SetDrawLockedFrame): this sets if we draw the border or not.
|
|||
|
|
(SetFrameColor): this sets the frame color (default=insetframe).
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: added x() and y() functions which return
|
|||
|
|
the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
|
|||
|
|
function which is needed to see if we have a locking inset of some
|
|||
|
|
type in this inset (needed for now in insettabular).
|
|||
|
|
|
|||
|
|
* src/vspace.C (inPixels): the same function also without a BufferView
|
|||
|
|
parameter as so it is easier to use it in some ocasions.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: changed all places where insertInset was used so
|
|||
|
|
that now if it couldn't be inserted it is deleted!
|
|||
|
|
|
|||
|
|
* src/TabularLayout.C:
|
|||
|
|
* src/TableLayout.C: added support for new tabular-inset!
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (insertInset): this now returns a bool if the
|
|||
|
|
inset was really inserted!!!
|
|||
|
|
|
|||
|
|
* src/tabular.C (GetLastCellInRow):
|
|||
|
|
(GetFirstCellInRow): new helper functions.
|
|||
|
|
(Latex): implemented for new tabular class.
|
|||
|
|
(TeXCellPostamble):
|
|||
|
|
(TeXCellPreamble):
|
|||
|
|
(TeXBottomHLine):
|
|||
|
|
(TeXTopHLine): new Latex() helper functions.
|
|||
|
|
|
|||
|
|
2000-05-12 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.C (Read):
|
|||
|
|
* src/mathed/formula.C (Read): read also the \end_inset here!
|
|||
|
|
|
|||
|
|
2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
|
|||
|
|
crush when saving formulae with unbalanced parenthesis.
|
|||
|
|
|
|||
|
|
20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/layout.C: Add new keyword "endlabelstring" to layout file
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): Draw endlabel string.
|
|||
|
|
|
|||
|
|
* lib/layouts/broadway.layout
|
|||
|
|
* lib/layouts/hollywood.layout: Added endlabel for the
|
|||
|
|
Parenthetical layout.
|
|||
|
|
|
|||
|
|
* lib/layouts/heb-article.layout: Do not use slanted font shape
|
|||
|
|
for Theorem like environments.
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): Always add "american" to
|
|||
|
|
the UsedLanguages list if document language is RTL.
|
|||
|
|
|
|||
|
|
2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* add addendum to README.OS2 and small patch (from SMiyata)
|
|||
|
|
|
|||
|
|
2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* many files: correct the calls to ChangeExtension().
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (ChangeExtension): remove the no_path
|
|||
|
|
argument, which does not belong there. Use OnlyFileName() instead.
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (Latex): use absolute paths for bibtex
|
|||
|
|
files when LaTeXing a non-nice latex file.
|
|||
|
|
|
|||
|
|
* src/lyxlookup.C (isDeadEvent): use a switch statement instead of
|
|||
|
|
a chain of "if". Return false when deadkeys are not handled.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (LyX): adapted the code for default bindings.
|
|||
|
|
|
|||
|
|
* src/kbmap.C (defaultKeyBindings): new method. Performs the default
|
|||
|
|
bindings for basic functionality (except deadkeys).
|
|||
|
|
(deadKeyBindings): new method. Performs the bindings of deadkeys.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
|
|||
|
|
several methods: handle override_x_deadkeys.
|
|||
|
|
|
|||
|
|
* src/lyxrc.h: remove the "bindings" map, which did not make much
|
|||
|
|
sense anyway. New variable override_x_deadkeys, defaulting to "true".
|
|||
|
|
|
|||
|
|
2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (stateText): use a saner method to determine
|
|||
|
|
whether the font is "default". Seems to fix the crash with DEC
|
|||
|
|
cxx.
|
|||
|
|
|
|||
|
|
* src/Bullet.[Ch] (Bullet): remove const on parameters.
|
|||
|
|
|
|||
|
|
2000-05-08 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (InsetButtonRelease): Now opens the
|
|||
|
|
TabularLayoutMenu with mouse-button-3
|
|||
|
|
(LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
|
|||
|
|
|
|||
|
|
* src/TabularLayout.C: added this file for having a Layout for
|
|||
|
|
tabular-insets.
|
|||
|
|
|
|||
|
|
2000-05-05 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C (UpdateLocal): resetCursorPos when
|
|||
|
|
recalculating inset-widths.
|
|||
|
|
(TabularFeatures): activated this function so that I can change
|
|||
|
|
tabular-features via menu.
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowEditMenu): inserted support for insettabular so
|
|||
|
|
that I can test some functions with the Table menu.
|
|||
|
|
|
|||
|
|
2000-05-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (stateText): guard against stupid c++libs.
|
|||
|
|
|
|||
|
|
* src/tabular.C: add using std::vector
|
|||
|
|
some whitespace changes, + removed som autogenerated code.
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): stupid bug.
|
|||
|
|
|
|||
|
|
2000-05-05 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/tabular.[Ch]: now using std:vector instead of arrays for all the
|
|||
|
|
row, columns and cellstructures.
|
|||
|
|
|
|||
|
|
2000-05-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: remove obsolete entries.
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
|
|||
|
|
reading of protected_separator for free_spacing.
|
|||
|
|
|
|||
|
|
2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/text.C (draw): do not display an exclamation mark in the
|
|||
|
|
margin for margin notes. This is confusing, ugly and
|
|||
|
|
uninformative.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
|
|||
|
|
AMS math' is checked.
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): do not depend on the textclass
|
|||
|
|
name to see whether including the amsmath package is needed.
|
|||
|
|
|
|||
|
|
2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (validate): Compute UsedLanguages correctly
|
|||
|
|
(don't insert the american language if it doesn't appear in the
|
|||
|
|
document)
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
|
|||
|
|
The argument of \thanks{} command is considered moving argument
|
|||
|
|
|
|||
|
|
* src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
|
|||
|
|
moving argument.
|
|||
|
|
|
|||
|
|
2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): Improved drawing of vertical lines
|
|||
|
|
for appendix/minipage/depth. The lines can be now both in the footnote
|
|||
|
|
frame, and outside the frame.
|
|||
|
|
|
|||
|
|
* src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
|
|||
|
|
points ("nikud")
|
|||
|
|
|
|||
|
|
2000-05-05 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/table.[Ch]: removed the inset and buffer stuff as this is now
|
|||
|
|
neede only in tabular.[Ch].
|
|||
|
|
|
|||
|
|
2000-05-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insetspecialchar.C (Read): allow command == '~' for
|
|||
|
|
PROTECTED_SEPARATOR
|
|||
|
|
(Write): write '~' for PROTECTED_SEPARATOR
|
|||
|
|
|
|||
|
|
2000-05-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: add a friend struct matchIT after the struct
|
|||
|
|
InsetTable.
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (drawStr): rename size to siz.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (RestoreForm): rename pflags to piflags,
|
|||
|
|
possibly fix a bug by not changing the pflags = flags to piflags =
|
|||
|
|
flags.
|
|||
|
|
|
|||
|
|
2000-05-05 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C: moved using directive
|
|||
|
|
|
|||
|
|
* src/ImportNoweb.C: small fix for being able to compile (missing
|
|||
|
|
include cstdlib)
|
|||
|
|
|
|||
|
|
2000-05-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
|
|||
|
|
to use clear, since we don't depend on this in the code. Add test
|
|||
|
|
for string::compare
|
|||
|
|
|
|||
|
|
2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* (various *.C files): add using std::foo directives to please dec
|
|||
|
|
cxx.
|
|||
|
|
|
|||
|
|
* replace calls to string::clear() to string::erase() (Angus)
|
|||
|
|
|
|||
|
|
* src/cheaders/cmath: modified to provide std::abs.
|
|||
|
|
|
|||
|
|
2000-05-04 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C: Prepared all for inserting of multiple
|
|||
|
|
paragraphs. Still display stuff to do (alignment and other things),
|
|||
|
|
but I would like to use LyXText to do this when we cleaned out the
|
|||
|
|
table-support stuff.
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.C: Changed lot of stuff and added lots
|
|||
|
|
of functionality still a lot to do.
|
|||
|
|
|
|||
|
|
* src/tabular.C: Various functions changed name and moved to be
|
|||
|
|
const functions. Added new Read and Write functions and changed
|
|||
|
|
lots of things so it works good with tabular-insets (also removed
|
|||
|
|
some stuff which is not needed anymore * hacks *).
|
|||
|
|
|
|||
|
|
* src/lyxcursor.h: added operators == and != which just look if
|
|||
|
|
par and pos are (not) equal.
|
|||
|
|
|
|||
|
|
* src/buffer.C (latexParagraphs): inserted this function to latex
|
|||
|
|
all paragraphs form par to endpar as then I can use this too for
|
|||
|
|
text-insets.
|
|||
|
|
|
|||
|
|
* src/text2.C (SetLayout): Changed this to use a cursor this is needed
|
|||
|
|
so that I can call this to from text insets with their own cursor.
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): added the output of one \n after the
|
|||
|
|
output off all paragraphs (because of the fix below)!
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar): removed output of \n when we are in
|
|||
|
|
the very last paragraph (this could be also the last paragraph of an
|
|||
|
|
inset!)
|
|||
|
|
|
|||
|
|
* src/texrow.h: added rows() call which returns the count-variable.
|
|||
|
|
|
|||
|
|
2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: fix examples for exporting SGML to HTML.
|
|||
|
|
|
|||
|
|
* lib/configure.m4: better autodetection of DocBook tools.
|
|||
|
|
|
|||
|
|
2000-04-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (easyParse): use lyxerr instead of cerr.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: add using std::reverse;
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (run): on error always run deleteFilesOnError before
|
|||
|
|
returning.
|
|||
|
|
|
|||
|
|
* src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
|
|||
|
|
selected files. Should fix repeated errors from generated files.
|
|||
|
|
|
|||
|
|
2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
|
|||
|
|
the spellchecker popup.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Removed the \number_inset section
|
|||
|
|
|
|||
|
|
2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (various): Use IsFileReadable() to make
|
|||
|
|
sure that the file actually exist. Relying on ghostscripts errors
|
|||
|
|
is a bad idea since they can lead to X server crashes.
|
|||
|
|
|
|||
|
|
2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
|
|||
|
|
|
|||
|
|
* intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
|
|||
|
|
open under CYGWIN
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: smallish typo in description of
|
|||
|
|
\view_dvi_paper_option
|
|||
|
|
|
|||
|
|
2000-04-26 Andr<64> P<>nitz <poenitz@mathematik.tu-chemnitz.de>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.h:
|
|||
|
|
* src/lyxfunc.C: doImportHelper to factor out common code of the
|
|||
|
|
various import methods. New functions doImportASCIIasLines,
|
|||
|
|
doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
|
|||
|
|
doImportLinuxDoc for the format specific parts.
|
|||
|
|
|
|||
|
|
* buffer.h:
|
|||
|
|
* buffer.C: Dispatch returns now a bool to indicate success
|
|||
|
|
|
|||
|
|
* lyx_gui.h:
|
|||
|
|
* lyx_gui.C: Add getLyXView() for member access
|
|||
|
|
|
|||
|
|
* lyx_main.C: Change logic for batch commands: First try
|
|||
|
|
Buffer::Dispatch (possibly without GUI), if that fails, use
|
|||
|
|
LyXFunc::Dispatch
|
|||
|
|
|
|||
|
|
* lyx_main.C: Add support for --import command line switch.
|
|||
|
|
Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
|
|||
|
|
Available Formats: Everything accepted by 'buffer-import <format>'
|
|||
|
|
|
|||
|
|
2000-04-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): small oneliner from Garst to have
|
|||
|
|
unnumbered parts.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
|
|||
|
|
documents will be reformatted upon reentry.
|
|||
|
|
|
|||
|
|
2000-04-27 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C (pasteSelection): last paragraph was not returned
|
|||
|
|
correctly only last pos this was a bug.
|
|||
|
|
|
|||
|
|
2000-04-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* release of lyx-1.1.5pre1
|
|||
|
|
|
|||
|
|
2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insettabular.[Ch]: fix the Clone() declaration.
|
|||
|
|
|
|||
|
|
* src/menus.C: revert the change of naming (Figure->Graphic...)
|
|||
|
|
from 2000-04-11. It was incomplete and bad.
|
|||
|
|
|
|||
|
|
* src/LColor.[Ch]: add LColor::depthbar.
|
|||
|
|
* src/text.C (GetVisibleRow): use it.
|
|||
|
|
|
|||
|
|
* README: update the languages list.
|
|||
|
|
|
|||
|
|
2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): show the depth of paragraphs using
|
|||
|
|
vertical bars.
|
|||
|
|
|
|||
|
|
2000-04-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* README: remove sections that were just wrong.
|
|||
|
|
|
|||
|
|
* src/text2.C (GetRowNearY): remove currentrow code
|
|||
|
|
|
|||
|
|
* src/text.C (GetRow): remove currentrow code
|
|||
|
|
|
|||
|
|
* src/screen.C (Update): rewritten a bit.
|
|||
|
|
(SmallUpdate): removed func
|
|||
|
|
|
|||
|
|
* src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
|
|||
|
|
used.
|
|||
|
|
(FullRebreak): return bool
|
|||
|
|
(currentrow): remove var
|
|||
|
|
(currentrow_y): ditto
|
|||
|
|
|
|||
|
|
* src/lyxscreen.h (Draw): change arg to unsigned long
|
|||
|
|
(FitCursor): return bool
|
|||
|
|
(FitManualCursor): ditto
|
|||
|
|
(Smallpdate): remove func
|
|||
|
|
(first): change to unsigned long
|
|||
|
|
(DrawOneRow): change second arg to long (from long &)
|
|||
|
|
(screen_refresh_y): remove var
|
|||
|
|
(scree_refresh_row): ditto
|
|||
|
|
|
|||
|
|
* src/lyxrow.h: change baseline to usigned int from unsigned
|
|||
|
|
short, this brings some implicit/unsigned issues out in the open.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
|
|||
|
|
accordingly.
|
|||
|
|
(Dispatch): don't call updateScrollbar after fitCursor. Use update
|
|||
|
|
instead of smallUpdate.
|
|||
|
|
|
|||
|
|
* src/lyxcursor.h: change y to unsigned long
|
|||
|
|
|
|||
|
|
* src/buffer.h: don't call updateScrollbar after fitcursor
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): move variables to
|
|||
|
|
where they are used. Removed "\\direction", this was not present
|
|||
|
|
in 1.1.4 and is already obsolete. Commented out some code that I
|
|||
|
|
believe to never be called.
|
|||
|
|
(runLiterate): don't call updateScrollbar after fitCursor
|
|||
|
|
(runLaTeX): ditto
|
|||
|
|
(buildProgram): ditto
|
|||
|
|
(runChktex): ditto
|
|||
|
|
|
|||
|
|
* src/WorkArea.h (workWidth): change return val to unsigned
|
|||
|
|
(width): ditto
|
|||
|
|
(height): ditto
|
|||
|
|
(redraw): remove the button redraws
|
|||
|
|
(setScrollbarValue): change for scrollbar
|
|||
|
|
(getScrollbarValue): change for scrollbar
|
|||
|
|
(getScrollbarBounds): change for scrollbar
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (C_WorkArea_up_cb): removed func
|
|||
|
|
(C_WorkArea_down_cb): removed func
|
|||
|
|
(WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
|
|||
|
|
(resize): change for scrollbar
|
|||
|
|
(setScrollbar): ditto
|
|||
|
|
(setScrollbarBounds): ditto
|
|||
|
|
(setScrollbarIncrements): ditto
|
|||
|
|
(up_cb): removed func
|
|||
|
|
(down_cb): removed func
|
|||
|
|
(scroll_cb): change for scrollbar
|
|||
|
|
(work_area_handler): ditto
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
|
|||
|
|
when FitCursor did something.
|
|||
|
|
(updateScrollbar): some unsigned changes
|
|||
|
|
(downCB): removed func
|
|||
|
|
(scrollUpOnePage): removed func
|
|||
|
|
(scrollDownOnePage): remvoed func
|
|||
|
|
(workAreaMotionNotify): don't call screen->FitCursor but use
|
|||
|
|
fitCursor instead. and bool return val
|
|||
|
|
(workAreaButtonPress): ditto
|
|||
|
|
(workAreaButtonRelease): some unsigned changes
|
|||
|
|
(checkInsetHit): ditto
|
|||
|
|
(workAreaExpose): ditto
|
|||
|
|
(update): parts rewritten, comments about the signed char arg added
|
|||
|
|
(smallUpdate): removed func
|
|||
|
|
(cursorPrevious): call needed updateScrollbar
|
|||
|
|
(cursorNext): ditto
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (allFloats): don't call updateScrollbar after
|
|||
|
|
fitCursor.
|
|||
|
|
|
|||
|
|
* src/BufferView.[Ch] (upCB): removed func
|
|||
|
|
(downCB): removed func
|
|||
|
|
(smallUpdate): removed func
|
|||
|
|
|
|||
|
|
2000-04-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxtext.h src/text.C src/text2.C: removed support for the
|
|||
|
|
currentrow, currentrow_y optimization. This did not help a lot and
|
|||
|
|
if we want to do this kind of optimization we should rather use
|
|||
|
|
cursor.row instead of the currentrow.
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
|
|||
|
|
buffer spacing and klyx spacing support.
|
|||
|
|
|
|||
|
|
2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
|
|||
|
|
a factor of 50!
|
|||
|
|
|
|||
|
|
2000-04-26 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: fixes to Lars sstream changes!
|
|||
|
|
|
|||
|
|
2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* A lot of files: Added Ascii(ostream &) methods to all inset
|
|||
|
|
classes. Used when exporting to ASCII.
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFileAscii,RoffAsciiTable)
|
|||
|
|
* src/paragraph.C (RoffContTableRows): Use the Ascii() methods
|
|||
|
|
instead of Latex()
|
|||
|
|
|
|||
|
|
* src/text2.C (ToggleFree): Disabled implicit word selection when
|
|||
|
|
there is a change in the language
|
|||
|
|
|
|||
|
|
* src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
|
|||
|
|
no output was generated for end-of-sentence inset.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h
|
|||
|
|
* src/buffer.C
|
|||
|
|
* src/lyxfunc.C
|
|||
|
|
* src/paragraph.C: Removed the insetnumber code
|
|||
|
|
|
|||
|
|
* src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
|
|||
|
|
|
|||
|
|
2000-04-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
|
|||
|
|
no_babel and no_epsfig completely from the file.
|
|||
|
|
(parseSingleLyXformat2Token): add handling for per-paragraph
|
|||
|
|
spacing as written by klyx.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: applied patch by Andre. Made it work with
|
|||
|
|
ostringstream too.
|
|||
|
|
|
|||
|
|
2000-04-20 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (cutSelection):
|
|||
|
|
(copySelection): Fixed with selection from right to left.
|
|||
|
|
(draw): now the rows are not recalculated at every draw.
|
|||
|
|
(computeTextRows): for now reset the inset-owner here (this is
|
|||
|
|
important for an undo or copy where the inset-owner is not set
|
|||
|
|
automatically!)
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
|
|||
|
|
motion to the_locking_inset screen->first was forgotten, this was
|
|||
|
|
not important till we got multiline insets.
|
|||
|
|
|
|||
|
|
2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.C (Latex): remove CHECK comment, since
|
|||
|
|
code seems to be alright (it is code changed by Dekel, and the
|
|||
|
|
intent is indeed that all macros should be defined \protect'ed)
|
|||
|
|
|
|||
|
|
* NEWS: a bit of reorganisation of the new user-visible features.
|
|||
|
|
|
|||
|
|
2000-04-19 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (init): using a LyXCursor now for cursor
|
|||
|
|
position. Set the inset_owner of the used paragraph so that it knows
|
|||
|
|
that it is inside an inset. Fixed cursor handling with mouse and
|
|||
|
|
cursor keys. Fixed wrong timed inset redraws and lots of other changes
|
|||
|
|
and cleanups to make TextInsets work better.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
|
|||
|
|
Changed parameters of various functions and added LockInsetInInset().
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C:
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.h:
|
|||
|
|
* src/insets/insetcollapsable.C:
|
|||
|
|
* src/insets/insetfoot.h:
|
|||
|
|
* src/insets/insetfoot.C:
|
|||
|
|
* src/insets/insetert.h:
|
|||
|
|
* src/insets/insetert.C: cleaned up the code so that it works now
|
|||
|
|
correctly with insettext.
|
|||
|
|
|
|||
|
|
* src/insets/inset.C:
|
|||
|
|
* src/insets/lyxinset.h: inserted inset_owner and some more changes so
|
|||
|
|
that insets in insets are supported right.
|
|||
|
|
|
|||
|
|
* src/table.h:
|
|||
|
|
* src/table.C: lots of changes for use with inset tabular (and cleanup)
|
|||
|
|
|
|||
|
|
* src/paragraph.C: some small fixes
|
|||
|
|
|
|||
|
|
* src/debug.h: inserted INSETS debug info
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
|
|||
|
|
fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
|
|||
|
|
|
|||
|
|
* src/commandtags.h:
|
|||
|
|
* src/LyXAction.C: insert code for InsetTabular.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
|
|||
|
|
not Button1MotionMask.
|
|||
|
|
(workAreaButtonRelease): send always a InsetButtonRelease event to
|
|||
|
|
the_locking_inset.
|
|||
|
|
(checkInsetHit): some setCursor fixes (always with insets).
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (lockInset): returns a bool now and extended for
|
|||
|
|
locking insets inside insets.
|
|||
|
|
(showLockedInsetCursor): it is important to have the cursor always
|
|||
|
|
before the locked inset.
|
|||
|
|
(fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
|
|||
|
|
|
|||
|
|
* src/BufferView.h: made lockInset return a bool.
|
|||
|
|
|
|||
|
|
* src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
|
|||
|
|
|
|||
|
|
* src/text2.C (SetCursor): This now has a version with a LyXCursor
|
|||
|
|
that is used also internally but can be called as public to have back
|
|||
|
|
a cursor pos which is not set internally.
|
|||
|
|
(SetCursorIntern): Changed to use above function.
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
|
|||
|
|
|
|||
|
|
2000-04-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* ANNOUNCE:
|
|||
|
|
* INSTALL:
|
|||
|
|
* UPGRADING:
|
|||
|
|
* NEWS: updated for prerelease of 1.1.5. Please comment and send
|
|||
|
|
patches for things that should be in or should be changed.
|
|||
|
|
|
|||
|
|
* src/* [insetfiles]: change "usigned char fragile" to bool
|
|||
|
|
fragile. There was only one point that could that be questioned
|
|||
|
|
and that is commented in formulamacro.C. Grep for "CHECK".
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C (getBufferTextClass): unused func, removed.
|
|||
|
|
(DeleteBuffer): take it out of CutAndPaste and make it static.
|
|||
|
|
|
|||
|
|
2000-04-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar): use the new method in Spacing to
|
|||
|
|
output the spacing envir commands. Also the new commands used in
|
|||
|
|
the LaTeX output makes the result better.
|
|||
|
|
|
|||
|
|
* src/Spacing.C (writeEnvirBegin): new method
|
|||
|
|
(writeEnvirEnd): new method
|
|||
|
|
|
|||
|
|
2000-04-18 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.C: made textclass a static member of the class
|
|||
|
|
as otherwise it is not accesed right!!!
|
|||
|
|
|
|||
|
|
2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* forms/layout_forms.fd
|
|||
|
|
* src/layout_forms.h
|
|||
|
|
* src/layout_forms.C (create_form_form_character)
|
|||
|
|
* src/lyx_cb.C (UserFreeFont)
|
|||
|
|
* src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
|
|||
|
|
documents (in the layout->character popup).
|
|||
|
|
|
|||
|
|
2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (create_ispell_pipe): fix a bug where
|
|||
|
|
\spell_command was in fact not honored (from Kevin Atkinson).
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
|
|||
|
|
quitting (Angus)
|
|||
|
|
|
|||
|
|
* src/lyx_gui.h: make lyxViews private (Angus)
|
|||
|
|
|
|||
|
|
2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/mathed/math_write.C
|
|||
|
|
(MathMatrixInset::Write) Put \protect before \begin{array} and
|
|||
|
|
\end{array} if fragile
|
|||
|
|
(MathParInset::Write): Put \protect before \\ if fragile
|
|||
|
|
|
|||
|
|
2000-04-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
|
|||
|
|
initialization if the LyXColorHandler must be done after the
|
|||
|
|
connections to the XServer has been established.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (runqueue): change the grabing a bit. Also
|
|||
|
|
get the background pixel from the lyxColorhandler so that the
|
|||
|
|
figures are rendered with the correct background color.
|
|||
|
|
(NextToken): removed functions.
|
|||
|
|
(GetPSSizes): use ifs >> string instead of NextToken.
|
|||
|
|
|
|||
|
|
* src/Painter.[Ch]: the color cache moved out of this file.
|
|||
|
|
|
|||
|
|
* src/ColorHandler.[Ch]: new files. Holds the gc cache for color
|
|||
|
|
and lines.
|
|||
|
|
|
|||
|
|
2000-04-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (work_area_handler): call BufferView::enterView
|
|||
|
|
and Buffer::leaveView when FL_ENTER and FL_LEAVE.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (enterView): new func
|
|||
|
|
(leaveView): new func
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
|
|||
|
|
when approp.
|
|||
|
|
(leaveView): new func, undefines xterm cursor when approp.
|
|||
|
|
|
|||
|
|
* src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
|
|||
|
|
(AllowInput): delete the Workarea cursor handling from this func.
|
|||
|
|
|
|||
|
|
* src/Painter.C (underline): draw a slimer underline in most cases.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (error_handler): use extern "C"
|
|||
|
|
|
|||
|
|
2000-04-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
|
|||
|
|
sent directly to me.
|
|||
|
|
|
|||
|
|
* src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
|
|||
|
|
to the list by Dekel.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
|
|||
|
|
strstream too.
|
|||
|
|
|
|||
|
|
* src/bufferview_funcs.[Ch]: two new files, moved several of the
|
|||
|
|
methods from lyx_cb.here.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: in addition to the above; removed input_prohibited
|
|||
|
|
it was not used.
|
|||
|
|
|
|||
|
|
2000-04-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.[Ch]: made several functions take a BufferView* arg
|
|||
|
|
instead of using current_view directly.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): add the paragraph-spacing command.
|
|||
|
|
|
|||
|
|
* src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (CurrentState): output a string when the spacing is
|
|||
|
|
different from the documents.
|
|||
|
|
|
|||
|
|
* src/text.C (SetHeightOfRow): take paragraph spacing into
|
|||
|
|
account, paragraph spacing takes precedence over buffer spacing
|
|||
|
|
(GetVisibleRow): ditto
|
|||
|
|
|
|||
|
|
* src/paragraph.C (writeFile): output the spacing parameter too.
|
|||
|
|
(validate): set the correct features if spacing is used in the
|
|||
|
|
paragraph.
|
|||
|
|
(Clear): set spacing to default
|
|||
|
|
(MakeSameLayout): spacing too
|
|||
|
|
(HasSameLayout): spacing too
|
|||
|
|
(SetLayout): spacing too
|
|||
|
|
(TeXOnePar): output the spacing commands
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: added a spacing variable for use with
|
|||
|
|
per-paragraph spacing.
|
|||
|
|
|
|||
|
|
* src/Spacing.h: add a Default spacing and a method to check if
|
|||
|
|
the current spacing is default. also added an operator==
|
|||
|
|
|
|||
|
|
* src/text2.C (DeleteEmptyParagraphMechanism): added a
|
|||
|
|
RedoParagraphs.
|
|||
|
|
|
|||
|
|
2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxserver.C (callback): fix dispatch of functions
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (checkContents): turn bogus
|
|||
|
|
printf() into lyxerr call.
|
|||
|
|
|
|||
|
|
* src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
|
|||
|
|
fonts.
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
|
|||
|
|
"Table" to "Table Box", "Float" to "Floating Material"; deletes
|
|||
|
|
the "Float" from each of the subitems.
|
|||
|
|
(ShowHelpMenu): add entry for "FAQ" and "TOC".
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.h: add an #ifdef to work around a gcc
|
|||
|
|
2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
|
|||
|
|
documented the change so that the workaround can be nuked later.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
|
|||
|
|
LyX::init().
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.C (next): do not re-declare the default value
|
|||
|
|
of arguments.
|
|||
|
|
* src/buffer.C (getLatexName): ditto
|
|||
|
|
(setReadonly): ditto
|
|||
|
|
|
|||
|
|
2000-04-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.h: add a const reference to BufferParams, to
|
|||
|
|
avoid some uses of current_view. Added also a bufferParams()
|
|||
|
|
method to get at this.
|
|||
|
|
|
|||
|
|
* src/lyxtext.h: changed params->buffer and paramters->bparams.
|
|||
|
|
|
|||
|
|
2000-04-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.[Ch]: removed
|
|||
|
|
operator<(LyXParagraph::InsetTable..., added a struct matchIT
|
|||
|
|
with operators used by lower_bound and
|
|||
|
|
upper_bound in InsetTable's
|
|||
|
|
Make struct InsetTable private again. Used matchpos.
|
|||
|
|
|
|||
|
|
2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (DocumentApplyCB): When changing the language of the
|
|||
|
|
document, the language of existing text is changed (unless the
|
|||
|
|
document is multi-lingual)
|
|||
|
|
|
|||
|
|
* src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
|
|||
|
|
|
|||
|
|
* A lot of files: A rewrite of the Right-to-Left support.
|
|||
|
|
|
|||
|
|
2000-04-10 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (showLockedInsetCursor): small bugfix for
|
|||
|
|
misplaced cursor when inset in inset is locked.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): small fix so that a
|
|||
|
|
BREAKLINE is not inserted if we don't permit it with autBreakRows.
|
|||
|
|
|
|||
|
|
* src/insets/insetfoot.C (GetDrawFont): implemented this as the
|
|||
|
|
footnote font should be decreased in size twice when displaying.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (GetDrawFont): inserted this function as
|
|||
|
|
the drawing-font may differ from the real paragraph font.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
|
|||
|
|
insets (inset in inset!).
|
|||
|
|
|
|||
|
|
* src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
|
|||
|
|
function here because we don't want footnotes inside footnotes.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
|
|||
|
|
Cloned insets.
|
|||
|
|
(init): now set the inset_owner in paragraph.C
|
|||
|
|
(LocalDispatch): added some resetPos() in the right position
|
|||
|
|
(cutSelection):
|
|||
|
|
(copySelection):
|
|||
|
|
(pasteSelection): changed to use the new CutAndPaste-Class.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: inserted new function InsertInsetAllowed
|
|||
|
|
which tells if it is allowed to insert another inset inside this one.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
|
|||
|
|
SwitchLayoutsBetweenClasses.
|
|||
|
|
|
|||
|
|
* src/text2.C (InsertInset): checking of the new paragraph-function
|
|||
|
|
InsertInsetAllowed.
|
|||
|
|
(DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
|
|||
|
|
is not needed anymore here!
|
|||
|
|
(CutSelection):
|
|||
|
|
(CopySelection):
|
|||
|
|
(PasteSelection): redone (also with #ifdef) so that now this uses
|
|||
|
|
the CutAndPaste-Class.
|
|||
|
|
(SwitchLayoutsBetweenClasses): removed here and implemented in the
|
|||
|
|
CutAndPaste-Class.
|
|||
|
|
|
|||
|
|
* src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
|
|||
|
|
from/to text/insets.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
|
|||
|
|
so that the paragraph knows if it is inside an (text)-inset.
|
|||
|
|
(InsertFromMinibuffer): changed return-value to bool as now it
|
|||
|
|
may happen that an inset is not inserted in the paragraph.
|
|||
|
|
(InsertInsetAllowed): this checks if it is allowed to insert an
|
|||
|
|
inset in this paragraph.
|
|||
|
|
(PasteParagraph):
|
|||
|
|
(BreakParagraphConservative):
|
|||
|
|
(BreakParagraph) : small change for the above change of the return
|
|||
|
|
value of InsertFromMinibuffer.
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: added inset_owner and the functions to handle
|
|||
|
|
this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
|
|||
|
|
|
|||
|
|
2000-04-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
|
|||
|
|
functions from BufferView to BufferView::Pimpl to ease maintence.
|
|||
|
|
|
|||
|
|
* src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
|
|||
|
|
correctly. Also use SetCursorIntern instead of SetCursor.
|
|||
|
|
|
|||
|
|
* src/insets/insetinfo.C (draw): draw InsetInfo notes with the
|
|||
|
|
correct color.
|
|||
|
|
|
|||
|
|
2000-04-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (belowMouse): manually implement below mouse.
|
|||
|
|
|
|||
|
|
* src/*: Add "explicit" on several constructors, I added probably
|
|||
|
|
some unneeded ones. A couple of changes to code because of this.
|
|||
|
|
|
|||
|
|
* src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
|
|||
|
|
implementation and private parts from the users of BufferView. Not
|
|||
|
|
quite finished.
|
|||
|
|
|
|||
|
|
* src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
|
|||
|
|
implementation and private parts from the users of LyXLex. Not
|
|||
|
|
quite finished.
|
|||
|
|
|
|||
|
|
* src/BufferView_pimpl.[Ch]: new files
|
|||
|
|
|
|||
|
|
* src/lyxlex_pimpl.[Ch]: new files
|
|||
|
|
|
|||
|
|
* src/LyXView.[Ch]: some inline functions move out-of-line
|
|||
|
|
|
|||
|
|
2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: make struct InsetTable public.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h: change lyxstring::difference_type to be
|
|||
|
|
ptrdiff_t. Add std:: modifiers to streams.
|
|||
|
|
|
|||
|
|
* src/font.C: include the <cctype> header, for islower() and
|
|||
|
|
isupper().
|
|||
|
|
|
|||
|
|
2000-04-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/font.[Ch]: new files. Contains the metric functions for
|
|||
|
|
fonts, takes a LyXFont as parameter. Better separation of concepts.
|
|||
|
|
|
|||
|
|
* src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
|
|||
|
|
changes because of this.
|
|||
|
|
|
|||
|
|
* src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
|
|||
|
|
|
|||
|
|
* src/*: compile with -Winline and move functions that don't
|
|||
|
|
inline out of line.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
|
|||
|
|
instead of strspn.
|
|||
|
|
|
|||
|
|
2000-04-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (GetLabelstring): renamed from GetLabestring.
|
|||
|
|
(various files changed because of this)
|
|||
|
|
|
|||
|
|
* src/Painter.C (text): fixed the drawing of smallcaps.
|
|||
|
|
|
|||
|
|
* src/lyxfont.[Ch] (drawText): removed unused member func.
|
|||
|
|
(drawString): ditto
|
|||
|
|
|
|||
|
|
* src/*.C: added needed "using" statements and "std::" qualifiers.
|
|||
|
|
|
|||
|
|
2000-03-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/*.h: removed all use of "using" from header files use
|
|||
|
|
qualifier std:: instead.
|
|||
|
|
|
|||
|
|
2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/text.C (Backspace): some additional cleanups (we already
|
|||
|
|
know whether cursor.pos is 0 or not).
|
|||
|
|
|
|||
|
|
* lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
|
|||
|
|
automake does not provide one).
|
|||
|
|
|
|||
|
|
* src/bmtable.h: replace C++ comments with C comments.
|
|||
|
|
|
|||
|
|
2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/screen.C (ShowCursor): Change the shape of the cursor if
|
|||
|
|
the current language is not equal to the language of the document.
|
|||
|
|
(If the cursor change its shape unexpectedly, then you've found a bug)
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
|
|||
|
|
bugs [I hope...]
|
|||
|
|
|
|||
|
|
* src/insets/insetnumber.[Ch]: New files.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init)
|
|||
|
|
* src/lyxfunc.C (dispatch): Add command number-inset-insert
|
|||
|
|
|
|||
|
|
* lyxrc.example
|
|||
|
|
* src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h
|
|||
|
|
* src/paragraph.C: Changed insetlist to Vector<InsetTable>.
|
|||
|
|
(the vector is kept sorted).
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): Draw selection correctly when there
|
|||
|
|
is both LTR and RTL text.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (Clone): Use the assignment operator for cloning,
|
|||
|
|
which is much faster.
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow and other): Do not draw the last space
|
|||
|
|
in a row if the direction of the last letter is not equal to the
|
|||
|
|
direction of the paragraph.
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (latexWriteStartChanges):
|
|||
|
|
Check that font language is not equal to basefont language.
|
|||
|
|
(latexWriteEndChanges): ditto
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (StyleReset): Don't change the language while using
|
|||
|
|
the font-default command.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (GetFirstFontSettings): Handle correctly an
|
|||
|
|
empty paragraph before a footnote.
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.C (draw): Increase x correctly.
|
|||
|
|
|
|||
|
|
* src/screen.C (ShowCursor): Change cursor shape if
|
|||
|
|
current language != document language.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
|
|||
|
|
|
|||
|
|
2000-03-31 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (GetInset): commented out text[pos] = ' '
|
|||
|
|
(Clone): changed mode how the paragraph-data is copied to the
|
|||
|
|
new clone-paragraph.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): fixed small problem when calling
|
|||
|
|
GetInset(pos) with no inset anymore there (in inset UNDO)
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.C (draw): small fix as here x is
|
|||
|
|
incremented not as much as width() returns (2 before, 2 behind = 4)
|
|||
|
|
|
|||
|
|
2000-03-30 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (InsetText): small fix in initialize
|
|||
|
|
widthOffset (should not be done in the init() function)
|
|||
|
|
|
|||
|
|
2000-03-29 Amir Karger <karger@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/examples/it_ItemizeBullets.lyx: translation by
|
|||
|
|
Stefano Mastella
|
|||
|
|
|
|||
|
|
* Implemented \textasciitilde and fixed a tiny bug in reLyX
|
|||
|
|
|
|||
|
|
2000-03-29 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C (Clone): same as in InsetFoot
|
|||
|
|
|
|||
|
|
* src/insets/insetfoot.C (Clone): small change as for the below
|
|||
|
|
new init function in the text-inset
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (init): new function as I've seen that
|
|||
|
|
clone did not copy the Paragraph-Data!
|
|||
|
|
(LocalDispatch): Added code so that now we have some sort of Undo
|
|||
|
|
functionality (well actually we HAVE Undo ;)
|
|||
|
|
|
|||
|
|
* src/text.C (Backspace): Small fix for the a | a Backspace problem
|
|||
|
|
|
|||
|
|
2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
|
|||
|
|
were erased)
|
|||
|
|
|
|||
|
|
2000-03-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/main.C: added a runtime check that verifies that the xforms
|
|||
|
|
header used when building LyX and the library used when running
|
|||
|
|
LyX match. Exit with a message if they don't match. This is a
|
|||
|
|
version number check only.
|
|||
|
|
|
|||
|
|
* src/buffer.C (save): Don't allocate memory on the heap for
|
|||
|
|
struct utimbuf times.
|
|||
|
|
|
|||
|
|
* *: some using changes, use iosfwd instead of the real headers.
|
|||
|
|
|
|||
|
|
* src/lyxfont.C use char const * instead of string for the static
|
|||
|
|
strings. Rewrite some functions to use sstream.
|
|||
|
|
|
|||
|
|
2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/text.C (Backspace): hopefully fix the dreaded backaspace
|
|||
|
|
bug.
|
|||
|
|
|
|||
|
|
2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
|
|||
|
|
of Geodesy (from Martin Vermeer)
|
|||
|
|
|
|||
|
|
* lib/layouts/svjour.inc: include file for the Springer svjour
|
|||
|
|
class. It can be used to support journals other than JoG.
|
|||
|
|
|
|||
|
|
* lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
|
|||
|
|
Miskiewicz <misiek@pld.org.pl>)
|
|||
|
|
* lib/reLyX/Makefile.am: ditto.
|
|||
|
|
|
|||
|
|
2000-03-27 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C: added Cut/Copy/Paste inside insets,
|
|||
|
|
also some modifications with operations on selected text.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (checkInsetHit): Now hopefully fixed all the
|
|||
|
|
problems with clicking on insets (last famous words ;)
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.C (draw):
|
|||
|
|
(width): Changed to have a bit of space before and after the inset so
|
|||
|
|
that the blinking cursor can be seen (otherwise it was hidden)
|
|||
|
|
|
|||
|
|
2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
|
|||
|
|
would not be added to the link list when an installed gettext (not
|
|||
|
|
part of libc) is found.
|
|||
|
|
|
|||
|
|
2000-03-24 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C (Edit):
|
|||
|
|
* src/mathed/formula.C (InsetButtonRelease):
|
|||
|
|
(InsetButtonPress): fixed for new handling of ButtonPress/Release
|
|||
|
|
handling.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (workAreaButtonPress):
|
|||
|
|
(workAreaButtonRelease):
|
|||
|
|
(checkInsetHit): Finally fixed the clicking on insets be handled
|
|||
|
|
correctly!
|
|||
|
|
|
|||
|
|
* src/insets/insetert.C (Edit): inserted this call so that ERT
|
|||
|
|
insets work always with LaTeX-font
|
|||
|
|
|
|||
|
|
2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (easyParse): Removed misplaced gui=false which
|
|||
|
|
caused lyx to startup with no GUI in place, causing in a crash
|
|||
|
|
upon startup when called with arguments.
|
|||
|
|
|
|||
|
|
2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/FontLoader.C: better initialization of dummyXFontStruct.
|
|||
|
|
|
|||
|
|
2000-03-20 Jos<6F> Ab<41>lio Matos <jamatos@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
|
|||
|
|
for linuxdoc and docbook import and export format options.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example Example of default values for the previous flags.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C Use those flags instead of the hardwired values for
|
|||
|
|
linuxdoc and docbook export.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
|
|||
|
|
linuxdoc import.
|
|||
|
|
|
|||
|
|
* src/menus.C Added menus entries for the new import/exports formats.
|
|||
|
|
|
|||
|
|
2000-03-09 Andr<64> P<>nitz <poenitz@mathematik.tu-chemnitz.de>
|
|||
|
|
|
|||
|
|
* src/lyxrc.*: Added support for running without Gui
|
|||
|
|
(\use_gui false)
|
|||
|
|
|
|||
|
|
* src/FontLoader.C: sensible defaults if no fonts are needed
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: New function ShowMessage (writes either to the
|
|||
|
|
minibuffer or cout in case of no gui
|
|||
|
|
New function AskOverwrite for common stuff
|
|||
|
|
Consequently various changes to call these functions
|
|||
|
|
|
|||
|
|
* src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
|
|||
|
|
wild guess at sensible screen resolution when having no gui
|
|||
|
|
|
|||
|
|
* src/lyxfont.C: no gui, no fonts... set some defaults
|
|||
|
|
|
|||
|
|
2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/LColor.C: made the command inset background a bit lighter.
|
|||
|
|
|
|||
|
|
2000-03-20 Hartmut Goebel <goebel@noris.net>
|
|||
|
|
|
|||
|
|
* lib/layouts/stdstruct.inc: split into stdtitle.inc and
|
|||
|
|
stdstruct.inc. Koma-Script added some title elements which
|
|||
|
|
otherwise have been listed below "bibliography". This split allows
|
|||
|
|
adding title elements to where they belong.
|
|||
|
|
|
|||
|
|
* lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
|
|||
|
|
define the additional title elements and then include
|
|||
|
|
stdstruct.inc.
|
|||
|
|
|
|||
|
|
* many other layout files: changed to include stdtitle.inc just
|
|||
|
|
before stdstruct.inc.
|
|||
|
|
|
|||
|
|
2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* src/buffer.C: (save) Added the option to store all backup files
|
|||
|
|
in a single directory
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch]: Added variable \backupdir_path
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Added descriptions of recently added variables
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
|
|||
|
|
bibtex inset, not closing the bibtex popup when deleting the inset)
|
|||
|
|
|
|||
|
|
2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: add a couple using directives.
|
|||
|
|
|
|||
|
|
2000-03-17 Jos<6F> Ab<41>lio Matos <jamatos@lyx.org>
|
|||
|
|
* src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
|
|||
|
|
import based on the filename.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
|
|||
|
|
file would be imported at start, if the filename where of a sgml file.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
|
|||
|
|
|
|||
|
|
* src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
|
|||
|
|
|
|||
|
|
2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
* src/lyxfont.h Replaced the member variable bits.direction by the
|
|||
|
|
member variable lang. Made many changes in other files.
|
|||
|
|
This allows having a multi-lingual document
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
|
|||
|
|
that change the current language to <l>.
|
|||
|
|
Removed the command "font-rtl"
|
|||
|
|
|
|||
|
|
* src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
|
|||
|
|
format for Hebrew documents)
|
|||
|
|
|
|||
|
|
* src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
|
|||
|
|
When auto_mathmode is "true", pressing a digit key in normal mode
|
|||
|
|
will cause entering into mathmode.
|
|||
|
|
If auto_mathmode is "rtl" then this behavior will be active only
|
|||
|
|
when writing right-to-left text.
|
|||
|
|
|
|||
|
|
* src/text2.C (InsertStringA) The string is inserted using the
|
|||
|
|
current font.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (GetEndLabel) Gives a correct result for
|
|||
|
|
footnote paragraphs.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
|
|||
|
|
|
|||
|
|
2000-03-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text.C (Backspace): move RemoveParagraph and RemoveRow in
|
|||
|
|
front of PasteParagraph. Never insert a ' '. This should at least
|
|||
|
|
fix some cause for the segfaults that we have been experiencing,
|
|||
|
|
it also fixes backspace behaviour slightly. (Phu!)
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (compare_no_case): some change to make it
|
|||
|
|
compile with gcc 2.95.2 and stdlibc++-v3
|
|||
|
|
|
|||
|
|
* src/text2.C (MeltFootnoteEnvironment): change type o
|
|||
|
|
first_footnote_par_is_not_empty to bool.
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: make text private. Changes in other files
|
|||
|
|
because of this.
|
|||
|
|
(fitToSize): new function
|
|||
|
|
(setContentsFromPar): new function
|
|||
|
|
(clearContents): new function
|
|||
|
|
(SetChar): new function
|
|||
|
|
|
|||
|
|
* src/paragraph.C (readSimpleWholeFile): deleted.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
|
|||
|
|
the file, just use a simple string instead. Also read the file in
|
|||
|
|
a more maintainable manner.
|
|||
|
|
|
|||
|
|
* src/text2.C (InsertStringA): deleted.
|
|||
|
|
(InsertStringB): deleted.
|
|||
|
|
|
|||
|
|
2000-03-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (DeleteEmptyParagraphMechanism): don't run,
|
|||
|
|
RedoParagraphs from the doublespace handling part, just set status
|
|||
|
|
to NEED_MORE_REFRESH. Also don't update cursor position (should be
|
|||
|
|
done, but perhaps not like this.)
|
|||
|
|
|
|||
|
|
2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/text2.C (InsertStringA): don't forget to insert a META_INSET
|
|||
|
|
character when inserting an inset.
|
|||
|
|
|
|||
|
|
2000-03-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/bufferparams.C (readLanguage): now takes "default" into
|
|||
|
|
consideration.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
|
|||
|
|
also initialize the toplevel_keymap with the default bindings from
|
|||
|
|
lyxrc.
|
|||
|
|
|
|||
|
|
* src/buffer.C (Buffer): remove lyxrc from the parameters.
|
|||
|
|
|
|||
|
|
* all files using lyxrc: have lyxrc as a real variable and not a
|
|||
|
|
pointer. remove all extern LyXRC * lyxrc. The equiv to this is
|
|||
|
|
done in lyxrc.h.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: remove double call to defaultKeyBindings
|
|||
|
|
|
|||
|
|
* src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
|
|||
|
|
toolbar defauls using lyxlex. Remove enums, structs, functions
|
|||
|
|
related to this.
|
|||
|
|
|
|||
|
|
* src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
|
|||
|
|
toolbar defaults. Also store default keybindings in a map.
|
|||
|
|
|
|||
|
|
* src/ToolbarDefaults.[Ch]: New file. This class is used for
|
|||
|
|
storing the toolbar defaults without any xforms dependencies.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: patch posted to list by Andre Poenitz
|
|||
|
|
applied. Changed to use iterators.
|
|||
|
|
|
|||
|
|
2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
|
|||
|
|
|
|||
|
|
* development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
|
|||
|
|
systems that don't have LINGUAS set to begin with.
|
|||
|
|
|
|||
|
|
2000-03-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
|
|||
|
|
the list by Dekel Tsur.
|
|||
|
|
|
|||
|
|
2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
|
|||
|
|
* src/insets/form_graphics.C: ditto.
|
|||
|
|
|
|||
|
|
* src/insets/inseturl.C (Latex): the free_spc argument is not used.
|
|||
|
|
|
|||
|
|
2000-03-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/bufferparams.C (readLanguage): use the new language map
|
|||
|
|
|
|||
|
|
* src/intl.C (InitKeyMapper): use the new language map
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): use the new language map
|
|||
|
|
|
|||
|
|
* src/language.[Ch]: New files. Used for holding the information
|
|||
|
|
about each language. Now! Use this new language map enhance it and
|
|||
|
|
make it really usable for our needs.
|
|||
|
|
|
|||
|
|
2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
|
|||
|
|
|
|||
|
|
* screen.C (ShowCursor): Removed duplicate code.
|
|||
|
|
(ShowManualCursor): Support for 3 cursor shapes: Bar (default),
|
|||
|
|
L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
|
|||
|
|
|
|||
|
|
* src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
|
|||
|
|
|
|||
|
|
* src/lyxtext.h
|
|||
|
|
* src/text.C Added TransformChar method. Used for rendering Arabic
|
|||
|
|
text correctly (change the glyphs of the letter according to the
|
|||
|
|
position in the word)
|
|||
|
|
|
|||
|
|
* src/buffer.C
|
|||
|
|
* src/paragraph.C
|
|||
|
|
* src/lyxrc.h
|
|||
|
|
* src/lyxrc.C Added lyxrc command {language_command_begin,
|
|||
|
|
language_command_end,language_command_ltr,language_command_rtl,
|
|||
|
|
language_package} which allows the use of either arabtex or Omega
|
|||
|
|
for Arabic
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (init)
|
|||
|
|
* src/lyxrc.h
|
|||
|
|
* src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
|
|||
|
|
to use encoding for menu fonts which is different than the encoding
|
|||
|
|
for screen fonts
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): If params.language = "default",
|
|||
|
|
do not load the babel package.
|
|||
|
|
To write an English document with Hebrew/Arabic, change the document
|
|||
|
|
language to "english".
|
|||
|
|
|
|||
|
|
* src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
|
|||
|
|
(alphaCounter): changed to return char
|
|||
|
|
(loweralphaCounter, hebrewCounter, romanCounter): New functions
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example Added examples for Hebrew/Arabic
|
|||
|
|
|
|||
|
|
* src/layout.h
|
|||
|
|
* src/layout.C Added layout command endlabeltype
|
|||
|
|
|
|||
|
|
* src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): Draw a box at the end of proof layout
|
|||
|
|
|
|||
|
|
2000-03-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/math_delim.C (search_deco): return a
|
|||
|
|
math_deco_struct* instead of index.
|
|||
|
|
|
|||
|
|
2000-03-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* All files with a USE_OSTREAM_ONLY within: removed all code that
|
|||
|
|
was unused when USE_OSTREAM_ONLY is defined.
|
|||
|
|
|
|||
|
|
* src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
|
|||
|
|
of any less. Removed header and using.
|
|||
|
|
|
|||
|
|
* src/text.C (GetVisibleRow): draw the string "Page Break
|
|||
|
|
(top/bottom)" on screen when drawing a pagebreak line.
|
|||
|
|
|
|||
|
|
2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
|
|||
|
|
|
|||
|
|
* src/mathed/math_macro.C (draw): do some cast magic.
|
|||
|
|
(Metrics): ditto.
|
|||
|
|
|
|||
|
|
* src/mathed/math_defs.h: change byte* argument to byte const*.
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
|
|||
|
|
|
|||
|
|
* src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
|
|||
|
|
know it is right to return InsetFoot* too, but cxx does not like
|
|||
|
|
it...).
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.[Ch] (Clone): make const.
|
|||
|
|
|
|||
|
|
* development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
|
|||
|
|
|
|||
|
|
* src/mathed/math_delim.C: change == to proper assignment.
|
|||
|
|
|
|||
|
|
2000-03-09 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (setPos): fixed various cursor positioning
|
|||
|
|
problems (via mouse and cursor-keys)
|
|||
|
|
(LocalDispatch): added posibility to add a Ctrl-Enter inside a text
|
|||
|
|
inset (still a small display problem but it works ;)
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C (draw): added button_top_y and
|
|||
|
|
button_bottom_y to have correct values for clicking on the inset.
|
|||
|
|
|
|||
|
|
* src/support/lyxalgo.h: commented out 'using std::less'
|
|||
|
|
|
|||
|
|
2000-03-08 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.C (InsetButtonRelease): Now a
|
|||
|
|
Button-Release event closes as it is alos the Release-Event
|
|||
|
|
which opens it.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
|
|||
|
|
|
|||
|
|
2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
|
|||
|
|
|
|||
|
|
* lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
|
|||
|
|
can add multiple spaces in Scrap (literate programming) styles...
|
|||
|
|
which, by the way, is how I got hooked on LyX to begin with.
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (Write): Added dummy variable to an
|
|||
|
|
inset::Latex() call.
|
|||
|
|
(Latex): Add free_spacing boolean to inset::Latex()
|
|||
|
|
|
|||
|
|
* src/mathed/formula.h (Latex): Added free_spacing boolean arg.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: Changed definition of the inset::Latex()
|
|||
|
|
virtual function to include the free_spacing boolean from
|
|||
|
|
the containing paragraph's style.
|
|||
|
|
|
|||
|
|
* src/insets/inseturl.C, src/insets/inseturl.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C, src/insets/insettext.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
|
|||
|
|
Added free_spacing boolean and made sure that if in a free_spacing
|
|||
|
|
paragraph, that we output normal space if there is a protected space.
|
|||
|
|
|
|||
|
|
* src/insets/insetref.C, src/insets/insetref.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetparent.C, src/insets/insetparent.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
|
|||
|
|
free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/inseterror.C, src/insets/inseterror.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
|
|||
|
|
Added free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
|
|||
|
|
free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C, src/insets/figinset.h (Latex): Added
|
|||
|
|
free_spacing boolean arg to match inset.h
|
|||
|
|
|
|||
|
|
* src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
|
|||
|
|
ignore free_spacing paragraphs. The user's spaces are left
|
|||
|
|
alone.
|
|||
|
|
|
|||
|
|
* src/text.C (InsertChar): Fixed the free_spacing layout
|
|||
|
|
attribute behavior. Now, if free_spacing is set, you can
|
|||
|
|
add multiple spaces in a paragraph with impunity (and they
|
|||
|
|
get output verbatim).
|
|||
|
|
(SelectSelectedWord): Added dummy argument to inset::Latex()
|
|||
|
|
call.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
|
|||
|
|
calls.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
|
|||
|
|
paragraph layouts now only input a simple space instead.
|
|||
|
|
Special character insets don't make any sense in free-spacing
|
|||
|
|
paragraphs.
|
|||
|
|
|
|||
|
|
* src/buffer.C (parseSingleLyXformat2Token): Code to convert
|
|||
|
|
hard-spaces in the *input* file to simple spaces if the layout
|
|||
|
|
is free-spacing. This converts old files which had to have
|
|||
|
|
hard-spaces in free-spacing layouts where a simple space was
|
|||
|
|
preferrable.
|
|||
|
|
(writeFileAscii): Added free_spacing check to pass to the newly
|
|||
|
|
reworked inset::Latex(...) methods. The inset::Latex() code
|
|||
|
|
ensures that hard-spaces in free-spacing paragraphs get output
|
|||
|
|
as spaces (rather than "~").
|
|||
|
|
|
|||
|
|
2000-03-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/math_delim.C (draw): draw the empty placeholder
|
|||
|
|
delims with a onoffdash line.
|
|||
|
|
(struct math_deco_compare): struct that holds the "functors" used
|
|||
|
|
for the sort and the binary search in math_deco_table.
|
|||
|
|
(class init_deco_table): class used for initial sort of the
|
|||
|
|
math_deco_table.
|
|||
|
|
(search_deco): use lower_bound to do a binary search in the
|
|||
|
|
math_deco_table.
|
|||
|
|
|
|||
|
|
2000-03-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: a small secret thingie...
|
|||
|
|
|
|||
|
|
* src/lyxlex.C (printTable): changed to take a ostream as paramter
|
|||
|
|
and to not flush the stream as often as it used to.
|
|||
|
|
|
|||
|
|
* src/support/lyxalgo.h: new file
|
|||
|
|
(sorted): template function used for checking if a sequence is
|
|||
|
|
sorted or not. Two versions with and without user supplied
|
|||
|
|
compare. Uses same compare as std::sort.
|
|||
|
|
|
|||
|
|
* src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
|
|||
|
|
it and give warning on lyxerr.
|
|||
|
|
(pushTable): ditto
|
|||
|
|
(struct compare_tags): struct with function operators used for
|
|||
|
|
checking if sorted, sorting and lower_bound.
|
|||
|
|
(search_kw): use lower_bound instead of manually implemented
|
|||
|
|
binary search.
|
|||
|
|
|
|||
|
|
2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.h: fix Clone() declaration.
|
|||
|
|
* src/insets/insetfoot.h: ditto.
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: remove an extra comma at the end of enum.
|
|||
|
|
|
|||
|
|
2000-03-08 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: added owner call which tells us if
|
|||
|
|
this inset is inside another inset. Changed also the return-type
|
|||
|
|
of Editable to an enum so it tells clearer what the return-value is.
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (computeTextRows): fixed computing of
|
|||
|
|
textinsets which split automatically on more rows.
|
|||
|
|
|
|||
|
|
* src/insets/insetert.[Ch]: changed this to be of BaseType
|
|||
|
|
InsetCollapsable.
|
|||
|
|
|
|||
|
|
* src/insets/insetfoot.[Ch]: added footnote inset
|
|||
|
|
|
|||
|
|
* src/insets/insetcollapsable.[Ch]: added this BaseClass for
|
|||
|
|
collapsable insets (like footnote, ert, ...)
|
|||
|
|
|
|||
|
|
2000-03-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxdraw.h: remvoe file
|
|||
|
|
|
|||
|
|
* src/lyxdraw.C: remove file
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C: added <algorithm>.
|
|||
|
|
|
|||
|
|
2000-03-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
|
|||
|
|
(matrix_cb): case MM_OK use string stream
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
|
|||
|
|
stream.
|
|||
|
|
|
|||
|
|
* src/mathed/math_macro.C (draw): use string stream
|
|||
|
|
(Metrics): use string stream
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
|
|||
|
|
directly to the ostream.
|
|||
|
|
|
|||
|
|
* src/vspace.C (asString): use string stream.
|
|||
|
|
(asString): use string stream
|
|||
|
|
(asLatexString): use string stream
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (UpdateLayoutDocument): use string stream for
|
|||
|
|
setting Spacing::Other.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.C (getPackages): use string stream instead of
|
|||
|
|
sprintf when creating the stretch vale.
|
|||
|
|
|
|||
|
|
* src/text2.C (alphaCounter): changed to return a string and to
|
|||
|
|
not use a static variable internally. Also fixed a one-off bug.
|
|||
|
|
(SetCounter): changed the drawing of the labels to use string
|
|||
|
|
streams instead of sprintf.
|
|||
|
|
|
|||
|
|
* src/support/lyxmanip.h: rewrite the newlineanDepth ostream
|
|||
|
|
manipulator to use a scheme that does not require library support.
|
|||
|
|
This is also the way it is done in the new GNU libstdc++. Should
|
|||
|
|
work with DEC cxx now.
|
|||
|
|
|
|||
|
|
2000-03-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/math_inset.h (Write(ostream & os): add a space at the
|
|||
|
|
end. This fixes a bug.
|
|||
|
|
|
|||
|
|
* src/mathed (all files concerned with file writing): apply the
|
|||
|
|
USE_OSTREAM_ONLY changes to mathed too.
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.h: make the constructor explicit.
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (latexWriteStartChanges): small bug related to
|
|||
|
|
count and ostream squashed.
|
|||
|
|
|
|||
|
|
2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): add a .c_str(), since
|
|||
|
|
ostringstream uses STL strings, and we might not.
|
|||
|
|
|
|||
|
|
* src/insets/insetspecialchar.C: add using directive.
|
|||
|
|
* src/insets/insettext.C: ditto.
|
|||
|
|
|
|||
|
|
2000-03-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/layouts/seminar.layout: feeble attempt at a layout for
|
|||
|
|
seminar.cls, far from completet and could really use some looking
|
|||
|
|
at from people used to write layout files.
|
|||
|
|
|
|||
|
|
* src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
|
|||
|
|
use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
|
|||
|
|
a lot nicer and works nicely with ostreams.
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (draw): a slightly different solution that
|
|||
|
|
the one posted to the list, but I think this one works too. (font
|
|||
|
|
size wrong in headers.)
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (computeTextRows): some fiddling on
|
|||
|
|
J<>rgens turf, added some comments that he should read.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
|
|||
|
|
used and it gave compiler warnings.
|
|||
|
|
RC_SHOW_BANNER + "\\show_banner" added, also to reading and
|
|||
|
|
writing of lyxrc.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): do the right thing when
|
|||
|
|
show_banner is true/false.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (TimerCB): no need to close or do anything if
|
|||
|
|
show_banner is false.
|
|||
|
|
|
|||
|
|
* most file writing files: Now use iostreams to do almost all of
|
|||
|
|
the writing. Also instead of passing string &, we now use
|
|||
|
|
stringstreams. mathed output is still not adapted to iostreams.
|
|||
|
|
This change can be turned off by commenting out all the occurences
|
|||
|
|
of the "#define USE_OSTREAM_ONLY 1" lines.
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (createPixmap): don't output debug messages.
|
|||
|
|
(WorkArea): don't output debug messages.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: added a comment about the new variable
|
|||
|
|
\show_banner
|
|||
|
|
|
|||
|
|
* development/Code_rules/Rules: Added some more commente about how
|
|||
|
|
to build class interfaces and on how better encapsulation can be
|
|||
|
|
achieved.
|
|||
|
|
|
|||
|
|
2000-03-03 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insetert.C (InsetERT): Now ERT-insets break row
|
|||
|
|
automatically with the width of the LyX-Window
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (computeTextRows): fixed update bug in
|
|||
|
|
displaying text-insets (scrollvalues where not initialized!)
|
|||
|
|
|
|||
|
|
2000-03-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
|
|||
|
|
id in the check of the result from lower_bound is not enough since
|
|||
|
|
lower_bound can return last too, and then res->id will not be a
|
|||
|
|
valid construct.
|
|||
|
|
|
|||
|
|
* all insets and some code that use them: I have conditionalized
|
|||
|
|
removed the Latex(string & out, ...) this means that only the
|
|||
|
|
Latex(ostream &, ...) will be used. This is a work in progress to
|
|||
|
|
move towards using streams for all output of files.
|
|||
|
|
|
|||
|
|
* src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
|
|||
|
|
c to 0.
|
|||
|
|
|
|||
|
|
2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/math_utils.C (MathedLookupBOP): fix the search
|
|||
|
|
routine (this fixes bug where greek letters were surrounded by too
|
|||
|
|
much white space).
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (findtexfile): change a bit the search
|
|||
|
|
algorithm, to fix bug introduced in 1.1.4. Note that --format is
|
|||
|
|
no longer passed to kpsewhich, we may have to change that later.
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
|
|||
|
|
warning options to avoid problems with X header files (from Angus
|
|||
|
|
Leeming).
|
|||
|
|
* acinclude.m4: regenerated.
|
|||
|
|
|
|||
|
|
2000-03-02 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (WriteParagraphData): Using the
|
|||
|
|
par->writeFile() function for writing paragraph-data.
|
|||
|
|
(Read): Using buffer->parseSingleLyXformat2Token()-function
|
|||
|
|
for parsing paragraph data!
|
|||
|
|
|
|||
|
|
* src/buffer.C (readLyXformat2): removed all parse data and using
|
|||
|
|
the new parseSingleLyXformat2Token()-function.
|
|||
|
|
(parseSingleLyXformat2Token): added this function to parse (read)
|
|||
|
|
lyx-file-format (this is called also from text-insets now!)
|
|||
|
|
|
|||
|
|
2000-03-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (BeginningOfMainBody): initialize previous_char
|
|||
|
|
and temp.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
|
|||
|
|
directly instead of going through a func. One very bad thing: a
|
|||
|
|
static LyXFindReplace, but I don't know where to place it.
|
|||
|
|
|
|||
|
|
* src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
|
|||
|
|
string instead of char[]. Also changed to static.
|
|||
|
|
(GetSelectionOrWordAtCursor): changed to static inline
|
|||
|
|
(SetSelectionOverLenChars): ditto.
|
|||
|
|
|
|||
|
|
* src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
|
|||
|
|
current_view and global variables. both classes has changed names
|
|||
|
|
and LyXFindReplace is not inherited from SearchForm.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
|
|||
|
|
fl_form_search form.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): removed the fl_form_search form.
|
|||
|
|
|
|||
|
|
2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/bind/*.bind: make sure 'buffer-previous' function is not
|
|||
|
|
bound (from Kayvan).
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
|
|||
|
|
|
|||
|
|
* lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
|
|||
|
|
|
|||
|
|
2000-03-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* some things that I should comment but the local pub says head to
|
|||
|
|
swirly...
|
|||
|
|
|
|||
|
|
* comment out all code that belongs to the Roff code for Ascii
|
|||
|
|
export of tables. (this is unused)
|
|||
|
|
|
|||
|
|
* src/LyXView.C: use correct type for global variable
|
|||
|
|
current_layout. (LyXTextClass::size_type)
|
|||
|
|
|
|||
|
|
* some code to get the new insetgraphics closer to working I'd be
|
|||
|
|
grateful for any help.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C (insertInset): use the return type of
|
|||
|
|
NumberOfLayout properly. (also changes in other files)
|
|||
|
|
|
|||
|
|
* src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
|
|||
|
|
this as a test. I want to know what breaks because of this.
|
|||
|
|
|
|||
|
|
* src/BufferView.[Ch] (tripleClick): name change from trippleClick.
|
|||
|
|
|
|||
|
|
2000-02-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/layouts/stdlists.inc: changed the lyxlist latex definition
|
|||
|
|
to use a \makebox in the label, this allows proper justification
|
|||
|
|
with out using protected spaces or multiple hfills. Now it is
|
|||
|
|
"label" for left justified, "\hfill label\hfill" for center, and
|
|||
|
|
"\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
|
|||
|
|
should be changed accordingly.
|
|||
|
|
|
|||
|
|
2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxtext.h: change SetLayout() to take a
|
|||
|
|
LyXTextClass::size_type instead of a char (when there is more than
|
|||
|
|
127 layouts in a class); also change type of copylayouttype.
|
|||
|
|
* src/text2.C (SetLayout): ditto.
|
|||
|
|
* src/LyXView.C (updateLayoutChoice): ditto.
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (scanLogFile): errors where the line number was not
|
|||
|
|
given just after the '!'-line were ignored (from Dekel Tsur).
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: fix description of \date_insert_format
|
|||
|
|
|
|||
|
|
* lib/layouts/llncs.layout: new layout, contributed by Martin
|
|||
|
|
Vermeer.
|
|||
|
|
|
|||
|
|
2000-02-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
|
|||
|
|
2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
|
|||
|
|
cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
|
|||
|
|
insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
|
|||
|
|
BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
|
|||
|
|
paragraph.C, text.C, text2.C)
|
|||
|
|
|
|||
|
|
2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.C (LocalDispatch): remove extra break
|
|||
|
|
statement.
|
|||
|
|
|
|||
|
|
* src/insets/insetert.[Ch] (Clone): change return value to Inset*
|
|||
|
|
* src/insets/insettext.[Ch] (Clone): change return value to Inset*
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
|
|||
|
|
* src/insets/insettext.[Ch] (GetCursorPos): ditto
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.h: move InsetBibkey::Holder and
|
|||
|
|
InsetCitation::Holder in public space.
|
|||
|
|
|
|||
|
|
2000-02-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insettext.h: small change to get the new files from
|
|||
|
|
Juergen to compile (use "string", not "class string").
|
|||
|
|
|
|||
|
|
* src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
|
|||
|
|
const & as parameter to LocalDispatch, use LyXFont const & as
|
|||
|
|
paramter to some other func. This also had impacto on lyxinsets.h
|
|||
|
|
and the two mathed insets.
|
|||
|
|
|
|||
|
|
2000-02-24 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/buffer.C:
|
|||
|
|
* src/commandtags.h:
|
|||
|
|
* src/LyXAction.C:
|
|||
|
|
* src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
|
|||
|
|
|
|||
|
|
* src/BufferView.h
|
|||
|
|
* src/BufferView.C
|
|||
|
|
* src/BufferView2.C: added/updated code for various inset-functions
|
|||
|
|
|
|||
|
|
* src/insets/insetert.[Ch]: added implementation of InsetERT
|
|||
|
|
|
|||
|
|
* src/insets/insettext.[Ch]: added implementation of InsetText
|
|||
|
|
|
|||
|
|
* src/insets/inset.C (Edit): added "unsigned int button" parameter
|
|||
|
|
(draw): added preliminary code for inset scrolling not finshed yet
|
|||
|
|
|
|||
|
|
* src/insets/inset.C (LocalDispatch): changed arg parameter to string
|
|||
|
|
as it is in lyxfunc.C now
|
|||
|
|
|
|||
|
|
* src/insets/lyxinset.h: Added functions for text-insets
|
|||
|
|
|
|||
|
|
2000-02-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
|
|||
|
|
BufferView and reimplement the list as a queue put inside its own
|
|||
|
|
class.
|
|||
|
|
|
|||
|
|
* src/bufferlist.[Ch] (updateInset): remove func, not needed.
|
|||
|
|
|
|||
|
|
* several files: use the new interface to the "updateinsetlist"
|
|||
|
|
|
|||
|
|
* src/WorkArea.C (work_area_handler): call BufferView::doubleClick
|
|||
|
|
on doubleclick.
|
|||
|
|
(work_area_handler): call BufferView::trippleClick on trippleclick.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (doubleClick): new function, selects word on
|
|||
|
|
doubleclick.
|
|||
|
|
(trippleClick): new function, selects line on trippleclick.
|
|||
|
|
|
|||
|
|
2000-02-22 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/bind/xemacs.bind: buffer-previous not supported
|
|||
|
|
|
|||
|
|
2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
|
|||
|
|
as const.
|
|||
|
|
|
|||
|
|
2000-02-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/bufferlist.C: get rid of current_view from this file
|
|||
|
|
|
|||
|
|
* src/spellchecker.C: get rid of current_view from this file
|
|||
|
|
|
|||
|
|
* src/vspace.C: get rid of current_view from this file
|
|||
|
|
(inPixels): added BufferView parameter for this func
|
|||
|
|
(asLatexCommand): added a BufferParams for this func
|
|||
|
|
|
|||
|
|
* src/text.C src/text2.C: get rid of current_view from these
|
|||
|
|
files.
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (getFontDirection): move this function here from
|
|||
|
|
text.C
|
|||
|
|
|
|||
|
|
* src/bufferparams.C (getDocumentDirection): move this function
|
|||
|
|
here from text.C
|
|||
|
|
|
|||
|
|
* src/paragraph.C (getParDirection): move this function here from
|
|||
|
|
text.C
|
|||
|
|
(getLetterDirection): ditto
|
|||
|
|
|
|||
|
|
2000-02-18 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* WorkArea, Painter, LyXScreen: Fixed the crash that occured on
|
|||
|
|
resize due to wrong pixmap beeing used. Also took the opurtunity
|
|||
|
|
to make the LyXScreen stateless on regard to WorkArea and some
|
|||
|
|
general cleanup in the same files.
|
|||
|
|
|
|||
|
|
2000-02-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/Makefile.am: add missing direction.h
|
|||
|
|
|
|||
|
|
* src/PainterBase.h: made the width functions const.
|
|||
|
|
|
|||
|
|
* lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
|
|||
|
|
missing ones.
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.C (draw): draw Editable as buttons.
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (draw): make the accents draw
|
|||
|
|
better, at present this will only work well with iso8859-1.
|
|||
|
|
|
|||
|
|
* several files: remove the old drawing code, now we use the new
|
|||
|
|
painter only.
|
|||
|
|
|
|||
|
|
* several files: remove support for mono_video, reverse_video and
|
|||
|
|
fast selection.
|
|||
|
|
|
|||
|
|
2000-02-17 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
|
|||
|
|
int ** as we have to return the pointer, otherwise we have only
|
|||
|
|
NULL pointers in the returning function.
|
|||
|
|
|
|||
|
|
2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (operator()): quote file name when running latex.
|
|||
|
|
|
|||
|
|
2000-02-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/toolbar.C (set): use fl_set_object_helper for the tooltop
|
|||
|
|
(bubble tip), this removes our special handling of this.
|
|||
|
|
|
|||
|
|
* Remove all code that is unused now that we have the new
|
|||
|
|
workarea. (Code that are not active when NEW_WA is defined.)
|
|||
|
|
|
|||
|
|
* Make the uses of XSync not conditionalized on define USE_XSYNC.
|
|||
|
|
|
|||
|
|
2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
|
|||
|
|
nonexisting layout; correctly redirect obsoleted layouts.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: document \view_dvi_paper_option
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
|
|||
|
|
variable.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (RunScript): handle $$FName for command names.
|
|||
|
|
(PreviewDVI): handle the view_dvi_paper_option variable.
|
|||
|
|
[Both from Roland Krause]
|
|||
|
|
|
|||
|
|
2000-02-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
|
|||
|
|
char const *, int, LyXFont)
|
|||
|
|
(text(int, int, string, LyXFont)): ditto
|
|||
|
|
|
|||
|
|
* src/text.C (InsertCharInTable): attempt to fix the double-space
|
|||
|
|
feature in tables too.
|
|||
|
|
(BackspaceInTable): ditto.
|
|||
|
|
(GetVisibleRow): make bottom pagebreak line be a onoff line.
|
|||
|
|
|
|||
|
|
2000-02-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (owner): only complain if owner_ is set and bv != 0
|
|||
|
|
|
|||
|
|
* src/BufferView.C (resizeCurrentBuffer): set the owner of the
|
|||
|
|
newly found text in textcache to this.
|
|||
|
|
(buffer): set the owner of the text put into the textcache to 0
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (draw): fixed the drawing of figures with
|
|||
|
|
the new Painter.
|
|||
|
|
|
|||
|
|
* src/text.C src/mathed/math_cursor.C: nailed and fixed the
|
|||
|
|
drawing of mathframe, hfills, protected space, table lines. I have
|
|||
|
|
now no outstanding drawing problems with the new Painter code.
|
|||
|
|
|
|||
|
|
2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/PainterBase.C (ellipse, circle): do not specify the default
|
|||
|
|
arguments.
|
|||
|
|
|
|||
|
|
* src/LColor.h: add using directive.
|
|||
|
|
|
|||
|
|
* src/Painter.[Ch]: change return type of methods from Painter& to
|
|||
|
|
PainterBase&. Add a using directive.
|
|||
|
|
|
|||
|
|
* src/WorkArea.C: wrap xforms callbacks in C functions
|
|||
|
|
C_WorkArea_xxx.
|
|||
|
|
|
|||
|
|
* lib/layouts/foils.layout: font fix and simplifications from Carl
|
|||
|
|
Ollivier-Gooch.
|
|||
|
|
|
|||
|
|
2000-02-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* a lot of files: The Painter, LColor and WorkArea from the old
|
|||
|
|
devel branch has been ported to lyx-devel. Some new files and a
|
|||
|
|
lot of #ifdeffed code. The new workarea is enabled by default, but
|
|||
|
|
if you want to test the new Painter and LColor you have to compile
|
|||
|
|
with USE_PAINTER defined (do this in config.h f.ex.) There are
|
|||
|
|
still some rought edges, and I'd like some help to clear those
|
|||
|
|
out. It looks stable (loads and displays the Userguide very well).
|
|||
|
|
|
|||
|
|
|
|||
|
|
2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (pop_tag): revert to the previous implementation
|
|||
|
|
(use a global variable for both loops).
|
|||
|
|
|
|||
|
|
* lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (LyXRC): change slightly default date format.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXOnePar): Generate a correct latex file when
|
|||
|
|
there is an English text with a footnote that starts with a Hebrew
|
|||
|
|
paragraph, or vice versa.
|
|||
|
|
(TeXFootnote): ditto.
|
|||
|
|
|
|||
|
|
* src/text.C (LeftMargin): allow for negative values for
|
|||
|
|
parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
|
|||
|
|
this out.
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): add iso88595 as a possible choice
|
|||
|
|
for input encoding (cyrillic)
|
|||
|
|
|
|||
|
|
2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyx_gui.C (create_forms): make combo box taller (from Dekel
|
|||
|
|
Tsur).
|
|||
|
|
|
|||
|
|
* src/toolbar.C (set): ditto
|
|||
|
|
* src/insets/insetbib.C (create_form_citation_form): ditto
|
|||
|
|
|
|||
|
|
* lib/CREDITS: added Dekel Tsur.
|
|||
|
|
|
|||
|
|
* lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
|
|||
|
|
lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
|
|||
|
|
hebrew supports files from Dekel Tsur.
|
|||
|
|
|
|||
|
|
* lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
|
|||
|
|
<tzafrir@technion.ac.il>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C: put \date_insert_format at the right place.
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): fix the handling of
|
|||
|
|
BufferParams::sides when writing out latex files.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C: add a "using" directive.
|
|||
|
|
|
|||
|
|
* src/support/lyxsum.C (sum): when we use lyxstring,
|
|||
|
|
ostringstream::str needs an additional .c_str().
|
|||
|
|
|
|||
|
|
2000-02-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (ChangeExtension): patch from Etienne
|
|||
|
|
applied.
|
|||
|
|
|
|||
|
|
* src/TextCache.C (show): remove const_cast and make second
|
|||
|
|
parameter non-const LyXText *.
|
|||
|
|
|
|||
|
|
* src/TextCache.h: use non const LyXText in show.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
|
|||
|
|
with hebrew.
|
|||
|
|
|
|||
|
|
2000-02-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxsum.C: rework to be more flexible.
|
|||
|
|
|
|||
|
|
* several places: don't check if a pointer is 0 if you are going
|
|||
|
|
to delete it.
|
|||
|
|
|
|||
|
|
* src/text.C: remove some dead code.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: remove some dead code
|
|||
|
|
|
|||
|
|
* src/buffer.C: move the BufferView funcs to BufferView2.C
|
|||
|
|
remove all support for insetlatexdel
|
|||
|
|
remove support for oldpapersize stuff
|
|||
|
|
made some member funcs const
|
|||
|
|
|
|||
|
|
* src/kbmap.C: use a std::list to store the bindings in.
|
|||
|
|
|
|||
|
|
* src/BufferView2.C: new file
|
|||
|
|
|
|||
|
|
* src/kbsequence.[Ch]: new files
|
|||
|
|
|
|||
|
|
* src/LyXAction.C + others: remove all trace of buffer-previous
|
|||
|
|
|
|||
|
|
* src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
|
|||
|
|
only have one copy in the binary of this table.
|
|||
|
|
|
|||
|
|
* hebrew patch: moved some functions from LyXText to more
|
|||
|
|
appropriate places. (LyXParagraph, BufferParams, LyXFont)
|
|||
|
|
|
|||
|
|
* several files: remove support for XForms older than 0.88
|
|||
|
|
whitespace changes.
|
|||
|
|
remove some #if 0 #endif code
|
|||
|
|
|
|||
|
|
* src/TextCache.[Ch]: new file. Holds the textcache.
|
|||
|
|
|
|||
|
|
* src/BufferView.C: changes to use the new TextCache interface.
|
|||
|
|
(waitForX): remove the now unused code.
|
|||
|
|
|
|||
|
|
* src/BackStack.h: remove some commented code
|
|||
|
|
|
|||
|
|
* lib/bind/emacs.bind: remove binding for buffer-previous
|
|||
|
|
|
|||
|
|
2000-02-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* applied the hebrew patch.
|
|||
|
|
|
|||
|
|
* src/lyxrow.h: make sure that all Row variables are initialized.
|
|||
|
|
|
|||
|
|
* src/text2.C (TextHandleUndo): comment out a delete, this might
|
|||
|
|
introduce a memory leak, but should also help us to not try to
|
|||
|
|
read freed memory. We need to look at this one.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
|
|||
|
|
(LyXParagraph): initalize footnotekind.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
|
|||
|
|
forgot this when applying the patch. Please heed the warnings.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (buffer): a fix for the buffer-reload problem
|
|||
|
|
(aka. reformat problem)
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (exists): made const, and use const_iterator
|
|||
|
|
(isLoaded): new func.
|
|||
|
|
(release): use std::find to find the correct buffer.
|
|||
|
|
|
|||
|
|
* src/bufferlist.h: made getState a const func.
|
|||
|
|
made empty a const func.
|
|||
|
|
made exists a const func.
|
|||
|
|
new func: isLoaded
|
|||
|
|
|
|||
|
|
2000-02-01 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
|
|||
|
|
|
|||
|
|
* po/it.po: updated a bit the italian po file and also changed the
|
|||
|
|
'file nuovo' for newfile to 'filenuovo' without a space, this did
|
|||
|
|
annoy me a lot :)
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (LyXRC): added support for a default insert_date_format
|
|||
|
|
for the new insert_date command.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): added support for a insert_date function
|
|||
|
|
from jdblair, to insert a date into the current text conforming to
|
|||
|
|
a strftime format (for now only considering the locale-set and not
|
|||
|
|
the document-language).
|
|||
|
|
|
|||
|
|
2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (textWidth): hopefully better fix for the Array
|
|||
|
|
Bounds Read error seen by purify. The problem was that islower is
|
|||
|
|
a macros which takes an unsigned char and uses it as an index for
|
|||
|
|
in array of characters properties (and is thus subject to the
|
|||
|
|
above error).
|
|||
|
|
(drawText): ditto.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
|
|||
|
|
correctly the paper sides radio buttons.
|
|||
|
|
(UpdateDocumentButtons): ditto.
|
|||
|
|
|
|||
|
|
2000-01-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/kbmap.C (getsym + others): change to return unsigned int,
|
|||
|
|
returning a long can give problems on 64 bit systems. (I assume
|
|||
|
|
that int is 32bit on 64bit systems)
|
|||
|
|
|
|||
|
|
2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
|
|||
|
|
LyXLookupString to be zero-terminated. Really fixes problems seen
|
|||
|
|
by purify, I think.
|
|||
|
|
|
|||
|
|
2000-01-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
|
|||
|
|
write a (char*)0 to the lyxerr stream.
|
|||
|
|
|
|||
|
|
* src/lastfiles.C: move algorithm before the using statemets.
|
|||
|
|
|
|||
|
|
2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lastfiles.C: move using directives in global scope (egcs 1.x
|
|||
|
|
complains otherwise).
|
|||
|
|
* src/table.C: ditto
|
|||
|
|
|
|||
|
|
* lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
|
|||
|
|
directory.
|
|||
|
|
|
|||
|
|
* lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
|
|||
|
|
that I removed earlier... It is really needed.
|
|||
|
|
|
|||
|
|
* lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
|
|||
|
|
|
|||
|
|
2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* INSTALL: update xforms home page URL.
|
|||
|
|
|
|||
|
|
* lib/configure.m4: fix a bug with unreadable layout files.
|
|||
|
|
|
|||
|
|
* src/table.C (calculate_width_of_column): add "using std::max"
|
|||
|
|
directive.
|
|||
|
|
|
|||
|
|
2000-01-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* several files: marked several lines with "DEL LINE", this is
|
|||
|
|
lines that can be deleted without changing anything.
|
|||
|
|
if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
|
|||
|
|
checks this anyway */
|
|||
|
|
delete <ptr>
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
|
|||
|
|
|
|||
|
|
* src/DepTable.C (update): add a "+" at the end when the checksum
|
|||
|
|
is different. (debugging string only)
|
|||
|
|
|
|||
|
|
* src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
|
|||
|
|
the next inset to not be displayed. This should also fix the list
|
|||
|
|
of labels in the "Insert Crossreference" dialog.
|
|||
|
|
|
|||
|
|
2000-01-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/LSubstring.C (LSubstring): set pos to string::npos
|
|||
|
|
when regex was not found.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (lowercase): use handcoded transform always.
|
|||
|
|
(uppercase): ditto
|
|||
|
|
|
|||
|
|
* src/text.C (Delete): fixed the crash. cursor.par->prev and
|
|||
|
|
old_cursor.par->prev could be 0.
|
|||
|
|
|
|||
|
|
* several files: changed post inc/dec to pre inc/dec
|
|||
|
|
|
|||
|
|
* src/lastfiles.C (writeFile): use ostream_iterator and copy to
|
|||
|
|
write the lastfiles to file.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (buffer): only show TextCache info when debugging
|
|||
|
|
(buffer): ditto
|
|||
|
|
(resizeCurrentBuffer): ditto
|
|||
|
|
(workAreaExpose): ditto
|
|||
|
|
|
|||
|
|
* lib/kbd/iso8859-7.cdef: changed to new quoting scheme
|
|||
|
|
|
|||
|
|
* lib/kbd/iso8859-2.cdef: changed to new quoting scheme
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
|
|||
|
|
a bit better by removing the special case for \i and \j.
|
|||
|
|
|
|||
|
|
2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (easyParse): remove test for bad comand line
|
|||
|
|
options, since this broke all xforms-related parsing.
|
|||
|
|
|
|||
|
|
* src/kbmap.C (getsym): set return type to unsigned long, as
|
|||
|
|
declared in header. On an alpha, long is _not_ the same as int.
|
|||
|
|
|
|||
|
|
* src/support/LOstream.h: add a "using std::flush;"
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: ditto.
|
|||
|
|
|
|||
|
|
2000-01-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (write): use blinding fast file copy instead of
|
|||
|
|
"a char at a time", now we are doing it the C++ way.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: get rid of struct pidwaitpit, use a
|
|||
|
|
std::list<int> instead.
|
|||
|
|
(addpidwait): reflect move to std::list<int>
|
|||
|
|
(sigchldchecker): ditto
|
|||
|
|
|
|||
|
|
* src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
|
|||
|
|
version also.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (FirstPhysicalPar): remove assert and comment
|
|||
|
|
that obviously was wrong...
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (textWidth): have c as char c[2] instead of char
|
|||
|
|
c, this avoids warnings with purify and islower.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: rename struct queue to struct
|
|||
|
|
queue_element and rewrite to use a std::queue. gsqueue is now a
|
|||
|
|
std::queue<queue_element>
|
|||
|
|
(runqueue): reflect move to std::queue
|
|||
|
|
(addwait): ditto
|
|||
|
|
|
|||
|
|
* src/support/lstrings.h (tostr): specialize for bool, otherwise
|
|||
|
|
we would get "1" "0" instead of "true" "false. Also make the tostr
|
|||
|
|
functions inline.
|
|||
|
|
|
|||
|
|
2000-01-21 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFileAscii): Disabled code for special groff
|
|||
|
|
handling of tabulars till I fix this in table.C
|
|||
|
|
|
|||
|
|
2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/mkdir.C (mkdir): change second argument of mkdir to
|
|||
|
|
unsigned long int.
|
|||
|
|
* src/support/lyxlib.h: ditto.
|
|||
|
|
|
|||
|
|
2000-01-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
|
|||
|
|
and 'j' look better. This might fix the "macron" bug that has been
|
|||
|
|
observed.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.[Ch] (tostr): reimplement all the tostr
|
|||
|
|
functions as one template function. Delete the old versions.
|
|||
|
|
|
|||
|
|
* src/support/lyxsum.C: move using std::ifstream inside
|
|||
|
|
MODERN_STL_STREAMS
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
|
|||
|
|
and putenv.C
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C: delete #include "bufferlist.h" never used
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (InitFigures): use new instead of malloc
|
|||
|
|
to allocate memory for figures and bitmaps.
|
|||
|
|
(DoneFigures): use delete[] instead of free to deallocate memory
|
|||
|
|
for figures and bitmaps.
|
|||
|
|
(runqueue): use new to allocate
|
|||
|
|
(getfigdata): use new/delete[] instead of malloc/free
|
|||
|
|
(RegisterFigure): ditto
|
|||
|
|
|
|||
|
|
* some files: moved some declarations closer to first use, small
|
|||
|
|
whitespace changes use preincrement instead of postincrement where
|
|||
|
|
it does not make a difference.
|
|||
|
|
|
|||
|
|
* src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
|
|||
|
|
step on the way to use stl::containers for key maps.
|
|||
|
|
|
|||
|
|
* src/bufferlist.h: add a typedef for const_iterator and const
|
|||
|
|
versions of begin and end.
|
|||
|
|
|
|||
|
|
* src/bufferlist.[Ch]: change name of member variable _state to
|
|||
|
|
state_. (avoid reserved names)
|
|||
|
|
(makePup): removed
|
|||
|
|
(getFileNames): returns the filenames of the buffers in a vector.
|
|||
|
|
|
|||
|
|
* configure.in (ALL_LINGUAS): added ro
|
|||
|
|
|
|||
|
|
* src/support/putenv.C: new file
|
|||
|
|
|
|||
|
|
* src/support/mkdir.C: new file
|
|||
|
|
|
|||
|
|
2000-01-20 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/layouts/IEEEtran.layout: Added several theorem environments
|
|||
|
|
|
|||
|
|
* lib/templates/IEEEtran.lyx: Example theorem environments and a
|
|||
|
|
couple of minor additions.
|
|||
|
|
|
|||
|
|
* lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
|
|||
|
|
(except for those in footnotes of course)
|
|||
|
|
|
|||
|
|
2000-01-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
|
|||
|
|
|
|||
|
|
* src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
|
|||
|
|
std::sort and std::lower_bound instead of qsort and handwritten
|
|||
|
|
binarysearch.
|
|||
|
|
(struct compara): struct that holds the functors used by std::sort
|
|||
|
|
and std::lower_bound in MathedLookupBOP.
|
|||
|
|
|
|||
|
|
2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/LAssert.h: do not do partial specialization. We do
|
|||
|
|
not really need it.
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h: note that lyx::getUserName() and
|
|||
|
|
lyx::date() are not in use right now. Should these be suppressed?
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): we do not need the user name here.
|
|||
|
|
(makeLinuxDocFile): do not put date and user name in linuxdoc
|
|||
|
|
headers.
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h (kill): change first argument to long int,
|
|||
|
|
since that's what solaris uses.
|
|||
|
|
|
|||
|
|
* src/support/kill.C (kill): fix declaration to match prototype.
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
|
|||
|
|
actually check whether namespaces are supported. This is not what
|
|||
|
|
it used to do.
|
|||
|
|
|
|||
|
|
* src/support/lyxsum.C: add a using directive.
|
|||
|
|
|
|||
|
|
2000-01-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/kill.C: if we have namespace support we don't have
|
|||
|
|
to include lyxlib.h.
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h: use namespace lyx if supported.
|
|||
|
|
|
|||
|
|
2000-01-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/date.C: new file
|
|||
|
|
|
|||
|
|
* src/support/chdir.C: new file
|
|||
|
|
|
|||
|
|
* src/support/getUserName.C: new file
|
|||
|
|
|
|||
|
|
* src/support/getcwd.C: new file
|
|||
|
|
|
|||
|
|
* src/support/abort.C: new file
|
|||
|
|
|
|||
|
|
* src/support/kill.C: new file
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h: moved all the functions in this file
|
|||
|
|
insede struct lyx. Added also kill and abort to this struct. This
|
|||
|
|
is a way to avoid the "kill is not defined in <csignal>", we make
|
|||
|
|
C++ wrappers for functions that are not ANSI C or ANSI C++.
|
|||
|
|
|
|||
|
|
* src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
|
|||
|
|
instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
|
|||
|
|
lyx it has been renamed to sum.
|
|||
|
|
|
|||
|
|
2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/text.C: add using directives for std::min and std::max.
|
|||
|
|
|
|||
|
|
2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/texrow.C (getIdFromRow): actually return something useful in
|
|||
|
|
id and pos. Hopefully fixes the bug with positionning of errorbox
|
|||
|
|
insets.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (easyParse): output an error and exit if an
|
|||
|
|
incorrect command line option has been given.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (ispell_check_word): document a memory leak.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (write): fix mismatched allocation/deletion,
|
|||
|
|
where a "struct utimbuf" is allocated with "new" and deleted with
|
|||
|
|
"delete[]".
|
|||
|
|
|
|||
|
|
2000-01-13 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (CutSelection): don't delete double spaces.
|
|||
|
|
(PasteSelection): ditto
|
|||
|
|
(CopySelection): ditto
|
|||
|
|
|
|||
|
|
* src/text.C (Backspace): don't delete double spaces.
|
|||
|
|
|
|||
|
|
* src/lyxlex.C (next): fix a bug that were only present with
|
|||
|
|
conformant std::istream::get to read comment lines, use
|
|||
|
|
std::istream::getline instead. This seems to fix the problem.
|
|||
|
|
|
|||
|
|
2000-01-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
|
|||
|
|
allowed to insert space before space" editing problem. Please read
|
|||
|
|
commends at the beginning of the function. Comments about usage
|
|||
|
|
are very welcome.
|
|||
|
|
|
|||
|
|
* src/text.C (InsertChar): fix for the "not allowed to insert
|
|||
|
|
space before space" editing problem.
|
|||
|
|
|
|||
|
|
* src/text2.C (DeleteEmptyParagraphMechanism): when
|
|||
|
|
IsEmptyTableRow can only return false this last "else if" will
|
|||
|
|
always be a no-op. Commented out.
|
|||
|
|
|
|||
|
|
* src/text.C (RedoParagraph): As far as I can understand tmp
|
|||
|
|
cursor is not really needed.
|
|||
|
|
|
|||
|
|
* src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
|
|||
|
|
present it could only return false anyway.
|
|||
|
|
(several functions): Did something not so smart...added a const
|
|||
|
|
specifier on a lot of methods.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
|
|||
|
|
and add a tmp->text.resize. The LyXParagraph constructor does the
|
|||
|
|
resize for us.
|
|||
|
|
(BreakParagraphConservative): ditto
|
|||
|
|
|
|||
|
|
* src/support/path.h (Path): add a define so that the wrong usage
|
|||
|
|
"Path("/tmp") will be flagged as a compilation error:
|
|||
|
|
"`unnamed_Path' undeclared (first use this function)"
|
|||
|
|
|
|||
|
|
2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
|
|||
|
|
which was bogus for several reasons.
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (scanAux): fix the regular expression used to scan
|
|||
|
|
.aux files.
|
|||
|
|
(runBibTeX): ditto.
|
|||
|
|
|
|||
|
|
* autogen.sh: do not use "type -path" (what's that anyway?).
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (findtexfile): remove extraneous space
|
|||
|
|
which caused a kpsewhich warning (at least with kpathsea version
|
|||
|
|
3.0).
|
|||
|
|
|
|||
|
|
2000-01-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
|
|||
|
|
|
|||
|
|
2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/paragraph.C (BreakParagraph): do not reserve space on text
|
|||
|
|
if we don't need to (otherwise, if pos_end < pos, we end up
|
|||
|
|
reserving huge amounts of memory due to bad unsigned karma).
|
|||
|
|
(BreakParagraphConservative): ditto, although I have not seen
|
|||
|
|
evidence the bug can happen here.
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: add a using std::list.
|
|||
|
|
|
|||
|
|
2000-01-11 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/menus.C (MenuDocu): output an Alert if the documentation-file
|
|||
|
|
could not be found.
|
|||
|
|
|
|||
|
|
2000-01-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/vc-backend.C (doVCCommand): change to be static and take one
|
|||
|
|
more parameter: the path to chdir too be fore executing the command.
|
|||
|
|
(retrive): new function equiv to "co -r"
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (loadLyXFile): implement the missing parts if
|
|||
|
|
file_not_found_hook is true.
|
|||
|
|
|
|||
|
|
* src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (IsFileWriteable): use FileInfo to check
|
|||
|
|
if a file is readwrite,readonly...anything else.
|
|||
|
|
|
|||
|
|
2000-01-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
|
|||
|
|
(CreatePostscript): name change from MenuRunDVIPS (or something)
|
|||
|
|
(PreviewPostscript): name change from MenuPreviewPS
|
|||
|
|
(PreviewDVI): name change from MenuPreviewDVI
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
|
|||
|
|
\view_pdf_command., \pdf_to_ps_command
|
|||
|
|
|
|||
|
|
* lib/configure.m4: added search for PDF viewer, and search for
|
|||
|
|
PDF to PS converter.
|
|||
|
|
(lyxrc.defaults output): add \pdflatex_command,
|
|||
|
|
\view_pdf_command and \pdf_to_ps_command.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (write): we don't use blocksize for anything so
|
|||
|
|
I removed it.
|
|||
|
|
|
|||
|
|
2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/block.h: disable operator T* (), since it causes
|
|||
|
|
problems with both compilers I tried. See comments in the file.
|
|||
|
|
|
|||
|
|
* lib/reLyX/configure.in: do not define LYX_DIR. support flag
|
|||
|
|
--with-lyxname.
|
|||
|
|
|
|||
|
|
* lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
|
|||
|
|
variable LYX_DIR_10x to LYX_DIR_11x.
|
|||
|
|
|
|||
|
|
* src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
|
|||
|
|
|
|||
|
|
* INSTALL: document --with-lyxname.
|
|||
|
|
* NEWS: ditto.
|
|||
|
|
|
|||
|
|
* configure.in: new configure flag --with-lyxname which allows to
|
|||
|
|
choose the name under which lyx is installed. Default is "lyx", of
|
|||
|
|
course. It used to be possible to do this with --program-suffix,
|
|||
|
|
but the later has in fact a different meaning for autoconf.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.h (lstrchr): reformat a bit.
|
|||
|
|
|
|||
|
|
* src/lyxlex.h: include LIstream.h, for Sun CC this time.
|
|||
|
|
* src/mathed/math_defs.h: ditto.
|
|||
|
|
|
|||
|
|
2000-01-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
|
|||
|
|
true, decides if we create a backup file or not when saving. New
|
|||
|
|
tag and variable \pdf_mode, defaults to false. New tag and
|
|||
|
|
variable \pdflatex_command, defaults to pdflatex. New tag and
|
|||
|
|
variable \view_pdf_command, defaults to xpdf. New tag and variable
|
|||
|
|
\pdf_to_ps_command, defaults to pdf2ps.
|
|||
|
|
|
|||
|
|
2000-01-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (close): don't call insetUnlock if the buffer
|
|||
|
|
does not have a BufferView.
|
|||
|
|
(unlockInset): ditto + don't access the_locking_inset if the
|
|||
|
|
buffer does not have a BufferView.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
|
|||
|
|
certain circumstances so that we don't continue a keyboard
|
|||
|
|
operation long after the key was released. Try f.ex. to load a
|
|||
|
|
large document, press PageDown for some seconds and then release
|
|||
|
|
it. Before this change the document would contine to scroll for
|
|||
|
|
some time, with this change it stops imidiatly.
|
|||
|
|
|
|||
|
|
* src/support/block.h: don't allocate more space than needed. As
|
|||
|
|
long as we don't try to write to the arr[x] in a array_type arr[x]
|
|||
|
|
it is perfectly ok. (if you write to it you might segfault).
|
|||
|
|
added operator value_type*() so that is possible to pass the array
|
|||
|
|
to functions expecting a C-pointer.
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (dist-hook): don't fail completely if unable to
|
|||
|
|
cvs.
|
|||
|
|
|
|||
|
|
* intl/*: updated to gettext 0.10.35, tried to add our own
|
|||
|
|
required modifications. Please verify.
|
|||
|
|
|
|||
|
|
* po/*: updated to gettext 0.10.35, tried to add our own required
|
|||
|
|
modifications. Please verify.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (tostr): go at fixing the problem with
|
|||
|
|
cxx and stringstream. When stringstream is used return
|
|||
|
|
oss.str().c_str() so that problems with lyxstring and basic_string
|
|||
|
|
are avoided. Note that the best solution would be for cxx to use
|
|||
|
|
basic_string all the way, but it is not conformant yet. (it seems)
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C + other files: moved several global functions to
|
|||
|
|
class BufferView, some have been moved to BufferView.[Ch] others
|
|||
|
|
are still located in lyx_cb.C. Code changes because of this. (part
|
|||
|
|
of "get rid of current_view project".)
|
|||
|
|
|
|||
|
|
* src/buffer.C + other files: moved several Buffer functions to
|
|||
|
|
class BufferView, the functions are still present in buffer.C.
|
|||
|
|
Code changes because of this.
|
|||
|
|
|
|||
|
|
* config/lcmessage.m4: updated to most recent. used when creating
|
|||
|
|
acinclude.m4.
|
|||
|
|
|
|||
|
|
* config/progtest.m4: updated to most recent. used when creating
|
|||
|
|
acinclude.m4.
|
|||
|
|
|
|||
|
|
* config/gettext.m4: updated to most recent. applied patch for
|
|||
|
|
tmplinguas.
|
|||
|
|
|
|||
|
|
* config/gettext.m4.patch: new file that shows what changes we
|
|||
|
|
have done to the local copy of gettext.m4.
|
|||
|
|
|
|||
|
|
* config/libtool.m4: new file, used in creation of acinclude.m4
|
|||
|
|
|
|||
|
|
* config/lyxinclude.m4: new file, this is the lyx created m4
|
|||
|
|
macros, used in making acinclude.m4.
|
|||
|
|
|
|||
|
|
* autogen.sh: GNU m4 discovered as a separate task not as part of
|
|||
|
|
the lib/configure creation.
|
|||
|
|
Generate acinlucde from files in config. Actually cat
|
|||
|
|
lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
|
|||
|
|
easier to upgrade .m4 files that really are external.
|
|||
|
|
|
|||
|
|
* src/Spacing.h: moved using std::istringstream to right after
|
|||
|
|
<sstream>. This should fix the problem seen with some compilers.
|
|||
|
|
|
|||
|
|
2000-01-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C: began some work to remove the dependency a lot of
|
|||
|
|
functions have on BufferView::text, even if not really needed.
|
|||
|
|
(GetCurrentTextClass): removed this func, it only hid the
|
|||
|
|
current_view.
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
|
|||
|
|
forgot this in last commit.
|
|||
|
|
|
|||
|
|
* src/Bullet.C (bulletEntry): use static char const *[] for the
|
|||
|
|
tables, becuase of this the return arg had to change to string.
|
|||
|
|
(bulletSize): ditto
|
|||
|
|
(~Bullet): removed unneeded destructor
|
|||
|
|
|
|||
|
|
* src/BufferView.C (beforeChange): moved from lyx_cb.C
|
|||
|
|
(insetSleep): moved from Buffer
|
|||
|
|
(insetWakeup): moved from Buffer
|
|||
|
|
(insetUnlock): moved from Buffer
|
|||
|
|
|
|||
|
|
* buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
|
|||
|
|
from Buffer to BufferView.
|
|||
|
|
|
|||
|
|
* acinclude.m4: include libtool.m4 from libtool 1.3.4.
|
|||
|
|
|
|||
|
|
* config/ltmain.sh: updated to version 1.3.4 of libtool
|
|||
|
|
|
|||
|
|
* config/ltconfig: updated to version 1.3.4 of libtool
|
|||
|
|
|
|||
|
|
2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
|
|||
|
|
* src/buffer.C (pop_tag): fix a dubious for() loop initialization.
|
|||
|
|
Did I get that right?
|
|||
|
|
|
|||
|
|
* src/lyxlex.h: add a "using" directive or two.
|
|||
|
|
* src/Spacing.h: ditto.
|
|||
|
|
* src/insets/figinset.C: ditto.
|
|||
|
|
* src/support/filetools.C: ditto.
|
|||
|
|
* src/support/lstrings.C: ditto.
|
|||
|
|
* src/BufferView.C: ditto.
|
|||
|
|
* src/bufferlist.C: ditto.
|
|||
|
|
* src/lyx_cb.C: ditto.
|
|||
|
|
* src/lyxlex.C: ditto.
|
|||
|
|
|
|||
|
|
* NEWS: add some changes for 1.1.4.
|
|||
|
|
|
|||
|
|
2000-01-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/BufferView.C: first go at a TextCache to speed up switching
|
|||
|
|
between documents.
|
|||
|
|
|
|||
|
|
2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
|
|||
|
|
* lib/examples/nl_voorbeeld_ruw.lyx: ditto.
|
|||
|
|
* lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
|
|||
|
|
* lib/examples/nl_opsommingstekens.lyx: new translation from Tino
|
|||
|
|
Meinen.
|
|||
|
|
|
|||
|
|
* src/mathed/math_defs.h (MathedRowSt): make sure that all
|
|||
|
|
members of the struct are correctly initialized to 0 (detected by
|
|||
|
|
purify)
|
|||
|
|
* src/lyxrc.C (LyXRC): ditto for print_adapt_output.
|
|||
|
|
* src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (sigchldchecker): use "delete" to free a
|
|||
|
|
pidwait, since it was allocated with "new". This was potentially
|
|||
|
|
very bad. Thanks to Michael Schmitt for running purify for us.
|
|||
|
|
|
|||
|
|
|
|||
|
|
2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.h: add a 'using std::pair;' statement.
|
|||
|
|
|
|||
|
|
1999-12-30 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/templates/IEEEtran.lyx: minor change
|
|||
|
|
|
|||
|
|
* src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
|
|||
|
|
src/mathed/formula.C (LocalDispatch): askForText changes
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
|
|||
|
|
know when a user has cancelled input. Fixes annoying problems with
|
|||
|
|
inserting labels and version control.
|
|||
|
|
|
|||
|
|
1999-12-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (tostr): rewritten to use strstream and
|
|||
|
|
stringstream
|
|||
|
|
|
|||
|
|
1999-12-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (IsFileWriteable): use fstream to check
|
|||
|
|
(IsDirWriteable): use fileinfo to check
|
|||
|
|
|
|||
|
|
* src/support/filetools.h (FilePtr): whole class deleted
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h (readSimpleWholeFile): make arg istream
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
|
|||
|
|
|
|||
|
|
* src/bufferlist.C (write): use ifstream and ofstream instead of
|
|||
|
|
FILE*
|
|||
|
|
|
|||
|
|
* src/Spacing.h: use istrstream instead of sscanf
|
|||
|
|
|
|||
|
|
* src/mathed/math_defs.h: change first arg to istream from FILE*
|
|||
|
|
|
|||
|
|
* src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
|
|||
|
|
|
|||
|
|
* src/mathed/math_parser.C: have yyis to be an istream
|
|||
|
|
(LexGetArg): use istream (yyis)
|
|||
|
|
(yylex): ditto
|
|||
|
|
(mathed_parse): ditto
|
|||
|
|
(mathed_parser_file): first arg istream instead of FILE*, set yyis
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (Read): rewritten to use istream
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.C (Read): rewritten to use istream
|
|||
|
|
|
|||
|
|
* src/lyxlex.h (~LyXLex): deleted desturctor
|
|||
|
|
(getStream): new function, returns an istream
|
|||
|
|
(getFile): deleted funtion
|
|||
|
|
(IsOK): return is.good();
|
|||
|
|
|
|||
|
|
* src/lyxlex.C (LyXLex): delete file and owns_file
|
|||
|
|
(setFile): open an filebuf and assign that to a istream instead of
|
|||
|
|
using FILE*
|
|||
|
|
(setStream): new function, takes an istream as arg.
|
|||
|
|
(setFile): deleted function
|
|||
|
|
(EatLine): rewritten us use istream instead of FILE*
|
|||
|
|
(next): ditto
|
|||
|
|
(nextToken): ditto
|
|||
|
|
|
|||
|
|
* src/table.C (LyXTable): use istream instead of FILE*
|
|||
|
|
(Read): rewritten to take an istream instead of FILE*
|
|||
|
|
|
|||
|
|
1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (Dispatch): remove an extraneous break statement.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (QuoteName): change to do simple
|
|||
|
|
'quoting'. More work is necessary. Also changed to do nothing
|
|||
|
|
under emx (needs fix too).
|
|||
|
|
(Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
|
|||
|
|
|
|||
|
|
* acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
|
|||
|
|
config.h.in to the AC_DEFINE_UNQUOTED() call.
|
|||
|
|
(LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
|
|||
|
|
needs char * as argument (because Solaris 7 declares it like
|
|||
|
|
that).
|
|||
|
|
|
|||
|
|
* acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
|
|||
|
|
remove definition of BZERO.
|
|||
|
|
|
|||
|
|
1999-12-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
|
|||
|
|
defined, "lyxregex.h" if not.
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (noinst_LTLIBRARIES): changed from
|
|||
|
|
pkglib_ to noinst_
|
|||
|
|
(REGEX): new variable that is set to regex.c lyxregex.h when
|
|||
|
|
AM_CONDITIONAL USE_REGEX is set.
|
|||
|
|
(libsupport_la_SOURCES): add $(REGEX)
|
|||
|
|
|
|||
|
|
* src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
|
|||
|
|
pkglib_ to noinst_
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
|
|||
|
|
pkglib_ to noinst_
|
|||
|
|
|
|||
|
|
* configure.in: add call to LYX_REGEX
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_REGEX): checks if we need to use the included
|
|||
|
|
regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
|
|||
|
|
|
|||
|
|
1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/bind/fi_menus.bind: new file, from
|
|||
|
|
pauli.virtanen@saunalahti.fi.
|
|||
|
|
|
|||
|
|
* src/buffer.C (getBibkeyList): pass the parameter delim to
|
|||
|
|
InsetInclude::getKeys and InsetBibtex::getKeys.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
|
|||
|
|
is passed to Buffer::getBibkeyList
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
|
|||
|
|
instead of the hardcoded comma.
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (getKeys): make sure that there are not
|
|||
|
|
leading blanks in bibtex keys. Normal latex does not care, but
|
|||
|
|
harvard.sty seems to dislike blanks at the beginning of citation
|
|||
|
|
keys. In particular, the retturn value of the function is
|
|||
|
|
|
|||
|
|
* INSTALL: make it clear that libstdc++ is needed and that gcc
|
|||
|
|
2.7.x probably does not work.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (findtexfile): make debug message go to
|
|||
|
|
the LATEX channel
|
|||
|
|
* src/insets/insetbib.C (getKeys): ditto
|
|||
|
|
|
|||
|
|
* src/debug.C (showTags): make sure that the output is correctly
|
|||
|
|
aligned.
|
|||
|
|
|
|||
|
|
* configure.in: add a comment for TWO_COLOR_ICON define.
|
|||
|
|
|
|||
|
|
* acconfig.h: remove all the entries that already defined in
|
|||
|
|
configure.in or acinclude.m4.
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): headers of latex file also changed
|
|||
|
|
to avoid user name, date and copyright.
|
|||
|
|
|
|||
|
|
1999-12-21 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/table.C (Read): Now read bogus row format informations
|
|||
|
|
if the format is < 5 so that afterwards the table can
|
|||
|
|
be read by lyx but without any format-info. Fixed the
|
|||
|
|
crash we experienced when not doing this.
|
|||
|
|
|
|||
|
|
1999-12-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
|
|||
|
|
(RedoDrawingOfParagraph): ditto
|
|||
|
|
(RedoParagraphs): ditto
|
|||
|
|
(RemoveTableRow): ditto
|
|||
|
|
|
|||
|
|
* src/text.C (Fill): rename arg paperwidth -> paper_width
|
|||
|
|
|
|||
|
|
* src/buffer.C (insertLyXFile): rename var filename -> fname
|
|||
|
|
(writeFile): rename arg filename -> fname
|
|||
|
|
(writeFileAscii): ditto
|
|||
|
|
(makeLaTeXFile): ditto
|
|||
|
|
(makeLinuxDocFile): ditto
|
|||
|
|
(makeDocBookFile): ditto
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (runMakeIndex): change arg name from file -> f
|
|||
|
|
(runBibTeX): ditto
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
|
|||
|
|
|
|||
|
|
* src/bmtable.h: add extern "C" on this file when __cplusplus is
|
|||
|
|
defined.
|
|||
|
|
|
|||
|
|
* src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
|
|||
|
|
compiled by a C compiler not C++.
|
|||
|
|
|
|||
|
|
* src/layout.h (LyXTextClass): added typedef for const_iterator
|
|||
|
|
(LyXTextClassList): added typedef for const_iterator + member
|
|||
|
|
functions begin and end.
|
|||
|
|
|
|||
|
|
* src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
|
|||
|
|
iterators to fill the choice_class.
|
|||
|
|
(updateLayoutChoice): rewritten to use iterators to fill the
|
|||
|
|
layoutlist in the toolbar.
|
|||
|
|
|
|||
|
|
* src/BufferView.h (BufferView::work_area_width): removed unused
|
|||
|
|
variable.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
|
|||
|
|
|
|||
|
|
* src/buffer.C (sgmlOpenTag): drop the use of the static space array
|
|||
|
|
(sgmlCloseTag): ditto
|
|||
|
|
|
|||
|
|
* src/support/lstrings.h: return type of countChar changed to
|
|||
|
|
unsigned char.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
|
|||
|
|
what version of this func to use. Also made to return unsigned int.
|
|||
|
|
|
|||
|
|
* configure.in: call LYX_STD_COUNT
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
|
|||
|
|
conforming std::count.
|
|||
|
|
|
|||
|
|
1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
|
|||
|
|
and a subscript would give bad display (patch from Dekel Tsur
|
|||
|
|
<dekel@math.tau.ac.il>).
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (create_ispell_pipe): use a const_cast to
|
|||
|
|
please sun CC.
|
|||
|
|
|
|||
|
|
* src/chset.h: add a few 'using' directives
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
|
|||
|
|
triggered when no buffer is active
|
|||
|
|
|
|||
|
|
* src/layout.C: removed `break' after `return' in switch(), since
|
|||
|
|
it is unreachable.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init): make sure LyX can be ran in place even
|
|||
|
|
when libtool has done its magic with shared libraries. Fix the
|
|||
|
|
test for the case when the system directory has not been found.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
|
|||
|
|
name for the latex file.
|
|||
|
|
(MenuMakeHTML): ditto
|
|||
|
|
|
|||
|
|
* src/buffer.h: add an optional boolean argument, which is passed
|
|||
|
|
to ChangeExtension.
|
|||
|
|
|
|||
|
|
1999-12-20 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/templates/IEEEtran.lyx: small correction and update.
|
|||
|
|
|
|||
|
|
* configure.in: Attempted to use LYX_PATH_HEADER
|
|||
|
|
|
|||
|
|
* src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
|
|||
|
|
|
|||
|
|
* acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
|
|||
|
|
input from JMarc. Now use preprocessor to find the header.
|
|||
|
|
Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
|
|||
|
|
(LYX_PATH_HEADER): My, so far, failed attempt to generalize
|
|||
|
|
LYX_STL_STRING_FWD. See comments in file.
|
|||
|
|
|
|||
|
|
1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
|
|||
|
|
|
|||
|
|
* The global MiniBuffer * minibuffer variable is dead.
|
|||
|
|
|
|||
|
|
* The global FD_form_main * fd_form_main variable is dead.
|
|||
|
|
|
|||
|
|
1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/toolbar.C (set): condition #warning on WITH_WARNINGS
|
|||
|
|
|
|||
|
|
* src/table.h: add the LOstream.h header
|
|||
|
|
* src/debug.h: ditto
|
|||
|
|
|
|||
|
|
* src/LyXAction.h: change the explaination of the ReadOnly
|
|||
|
|
attribute: is indicates that the function _can_ be used.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): find-replace _can_ be used in read-only
|
|||
|
|
mode.
|
|||
|
|
|
|||
|
|
1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (ascent): Make sure that char is _always_ used as
|
|||
|
|
unsigned.
|
|||
|
|
(descent): ditto
|
|||
|
|
(lbearing): ditto
|
|||
|
|
(rbearing): ditto
|
|||
|
|
|
|||
|
|
* src/paragraph.C (GetWord): assert on pos>=0
|
|||
|
|
(GetChar): ditto
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: condition the use of an invariant on
|
|||
|
|
ENABLE_ASSERTIONS
|
|||
|
|
* src/support/lyxstring.h: ditto
|
|||
|
|
|
|||
|
|
* src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
|
|||
|
|
Use LAssert.h instead of plain assert().
|
|||
|
|
|
|||
|
|
* src/support/lstrings.h: add LAssert.h, in case it is needed.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: do not include LAssert.h, it is not used.
|
|||
|
|
* src/support/filetools.C: ditto
|
|||
|
|
|
|||
|
|
* src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
|
|||
|
|
is not defined.
|
|||
|
|
|
|||
|
|
* INSTALL: document the new configure flags
|
|||
|
|
|
|||
|
|
* configure.in: suppress --with-debug; add --enable-assertions
|
|||
|
|
|
|||
|
|
* acinclude.m4: various changes in alignment of help strings.
|
|||
|
|
|
|||
|
|
1999-12-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/kbmap.C: commented out the use of the hash map in kb_map,
|
|||
|
|
beginning of movement to a stl::container.
|
|||
|
|
|
|||
|
|
* several files: removed code that was not in effect when
|
|||
|
|
MOVE_TEXT was defined.
|
|||
|
|
|
|||
|
|
* lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
|
|||
|
|
for escaping should not be used. We can discuss if the string
|
|||
|
|
should be enclosed in f.ex. [] instead of "".
|
|||
|
|
|
|||
|
|
* src/trans_mgr.C (insert): use the new returned value from
|
|||
|
|
encodeString to get deadkeys and keymaps done correctly.
|
|||
|
|
|
|||
|
|
* src/chset.C (encodeString): changed to return a pair, to tell
|
|||
|
|
what to use if we know the string.
|
|||
|
|
|
|||
|
|
* src/lyxscreen.h (fillArc): new function.
|
|||
|
|
|
|||
|
|
* src/FontInfo.C (resize): rewritten to use more std::string like
|
|||
|
|
structore, especially string::replace.
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (Draw): use fillArc for the
|
|||
|
|
approp. accents.
|
|||
|
|
|
|||
|
|
* configure.in (chmod +x some scripts): remove config/gcc-hack
|
|||
|
|
|
|||
|
|
1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFile): change once again the top comment in a
|
|||
|
|
.lyx file to point to www.lyx.org and to use LYX_DOCVERSION
|
|||
|
|
instead of an hardcoded version number.
|
|||
|
|
(makeDocBookFile): ditto
|
|||
|
|
|
|||
|
|
* src/version.h: add new define LYX_DOCVERSION
|
|||
|
|
|
|||
|
|
* po/de.po: update from Pit S<>tterlin
|
|||
|
|
* lib/bind/de_menus.bind: ditto.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): call MenuExport()
|
|||
|
|
* src/buffer.C (Dispatch): ditto
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuMakeHTML): new function, moved from
|
|||
|
|
LyXFunc::Dispatch().
|
|||
|
|
(MenuExport): new function, moved from
|
|||
|
|
LyXFunc::Dispatch().
|
|||
|
|
|
|||
|
|
* src/trans_mgr.C (insert): small cleanup
|
|||
|
|
* src/chset.C (loadFile): ditto
|
|||
|
|
|
|||
|
|
* lib/kbd/iso8859-1.cdef: add missing backslashes
|
|||
|
|
|
|||
|
|
1999-12-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (Lbearing): new function, used to
|
|||
|
|
help with placing the manually drawn accents better.
|
|||
|
|
(Rbearing): ditto
|
|||
|
|
(Draw): x2 and hg changed to float to minimize rounding errors and
|
|||
|
|
help place the accents better.
|
|||
|
|
|
|||
|
|
* src/lyxfont.C (ascent): fixed faulty static_cast, casting from
|
|||
|
|
unsigned short to char is just wrong...cast the char to unsigned
|
|||
|
|
char instead so that the two values can compare sanely. This
|
|||
|
|
should also make the display of insetlatexaccents better and
|
|||
|
|
perhaps also some other insets.
|
|||
|
|
(descent): ditto
|
|||
|
|
(lbearing): new function
|
|||
|
|
(rbearing): ditto
|
|||
|
|
|
|||
|
|
1999-12-15 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
|
|||
|
|
header that provides a wrapper around the very annoying SGI STL header
|
|||
|
|
of the same name.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C, src/LString.h:
|
|||
|
|
removed old SGI-STL-compatability attempts.
|
|||
|
|
|
|||
|
|
* configure.in: Use LYX_STL_STRING_FWD.
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
|
|||
|
|
stl_string_fwd.h is around and try to determine it's location.
|
|||
|
|
Major improvement over previous SGI STL 3.2 compatability.
|
|||
|
|
Three small problems remain with this function due to my zero
|
|||
|
|
knowledge of autoconf. JMarc and lgb see the comments in the code.
|
|||
|
|
|
|||
|
|
1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/broken_const.h, config/hack-gcc, config/README: removed
|
|||
|
|
|
|||
|
|
* configure.in: remove --with-gcc-hack option; do not call
|
|||
|
|
LYX_CXX_STL_STACK
|
|||
|
|
|
|||
|
|
* INSTALL: remove documentation of --with-broken-const and
|
|||
|
|
--with-gcc-hack
|
|||
|
|
|
|||
|
|
* acconfig.h: remove all trace of BROKEN_CONST define
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeDocBookFile): update version number in output
|
|||
|
|
file.
|
|||
|
|
(SimpleDocBookOnePar): fix an assert when trying to a character
|
|||
|
|
access beyond string length
|
|||
|
|
[Patch from Jose']
|
|||
|
|
|
|||
|
|
1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* po/de.po: fix the Export menu
|
|||
|
|
|
|||
|
|
* lyx.man: update the description of -dbg
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
|
|||
|
|
(commandLineHelp): updated
|
|||
|
|
(easyParse): show list of available debug levels if -dbg is passed
|
|||
|
|
without argument.
|
|||
|
|
|
|||
|
|
* src/Makefile.am: add debug.C
|
|||
|
|
|
|||
|
|
* src/debug.h: moved some code to debug.C
|
|||
|
|
|
|||
|
|
* src/debug.C: new file. Contains code to set and show debug
|
|||
|
|
level.
|
|||
|
|
|
|||
|
|
* src/layout.C: remove 'break' after 'continue' in switch
|
|||
|
|
statements, since these cannot be reached.
|
|||
|
|
|
|||
|
|
1999-12-13 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
|
|||
|
|
(in_word_set): hash() -> math_hash()
|
|||
|
|
|
|||
|
|
* src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
|
|||
|
|
|
|||
|
|
* acconfig.h: Added a test for whether we are using exceptions in the
|
|||
|
|
current compilation run. If so USING_EXCEPTIONS is defined.
|
|||
|
|
|
|||
|
|
* config.in: Check for existance of stl_string_fwd.h
|
|||
|
|
* src/LString.h: If compiling --with-included-string and SGI's
|
|||
|
|
STL version 3.2 is present (see above test) we need to block their
|
|||
|
|
forward declaration of string and supply a __get_c_string().
|
|||
|
|
However, it turns out this is only necessary if compiling with
|
|||
|
|
exceptions enabled so I've a bit more to add yet.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.[Ch], src/insets/insetinclude.C,
|
|||
|
|
src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
|
|||
|
|
src/support/LRegex.h, src/undo.h:
|
|||
|
|
Shuffle the order of the included files a little to ensure that
|
|||
|
|
LString.h gets included before anything that includes stl_string_fwd.h
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: We need to #include LString.h instead of
|
|||
|
|
lyxstring.h to get the necessary definition of __get_c_string.
|
|||
|
|
(__get_c_string): New function. This is defined static just like SGI's
|
|||
|
|
although why they need to do this I'm not sure. Perhaps it should be
|
|||
|
|
in lstrings.C instead.
|
|||
|
|
|
|||
|
|
* lib/templates/IEEEtran.lyx: New template file.
|
|||
|
|
|
|||
|
|
1999-12-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
|
|||
|
|
* intl/Makefile.in (MKINSTALLDIRS): ditto
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (init): changed to hold the LFUN data in a
|
|||
|
|
automatic array in stead of in callso to newFunc, this speeds up
|
|||
|
|
compilation a lot. Also all the memory used by the array is
|
|||
|
|
returned when the init is completed.
|
|||
|
|
|
|||
|
|
* a lot of files: compiled with -Wold-style-cast, changed most of
|
|||
|
|
the reported offenders to C++ style casts. Did not change the
|
|||
|
|
offenders in C files.
|
|||
|
|
|
|||
|
|
* src/trans.h (Match): change argument type to unsigned int.
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.C: fix some types on the streambufs so
|
|||
|
|
that it works on a conforming implementation.
|
|||
|
|
|
|||
|
|
1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: remove the inline added earlier since
|
|||
|
|
they cause a bunch of unsatisfied symbols when linking with dec
|
|||
|
|
cxx. Cxx likes to have the body of inlines at the place where they
|
|||
|
|
are declared.
|
|||
|
|
|
|||
|
|
* src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
|
|||
|
|
accessing negative bounds in array. This fixes the crash when
|
|||
|
|
inserting accented characters.
|
|||
|
|
* src/trans.h (Match): ditto
|
|||
|
|
|
|||
|
|
* src/buffer.C (Dispatch): since this is a void, it should not try
|
|||
|
|
to return anything...
|
|||
|
|
|
|||
|
|
1999-12-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/buffer.h: removed the two friends from Buffer. Some changes
|
|||
|
|
because of this. Buffer::getFileName and Buffer::setFileName
|
|||
|
|
renamed to Buffer::fileName() and Buffer::fileName(...).
|
|||
|
|
|
|||
|
|
1999-12-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
|
|||
|
|
and Buffer::update(short) to BufferView. This move is currently
|
|||
|
|
controlled by a define MOVE_TEXT, this will be removed when all
|
|||
|
|
shows to be ok. This move paves the way for better separation
|
|||
|
|
between buffer contents and buffer view. One side effect is that
|
|||
|
|
the BufferView needs a rebreak when swiching buffers, if we want
|
|||
|
|
to avoid this we can add a cache that holds pointers to LyXText's
|
|||
|
|
that is not currently in use.
|
|||
|
|
|
|||
|
|
* buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
|
|||
|
|
Andr<64> P<>nitz.
|
|||
|
|
|
|||
|
|
1999-11-18 Andr<64> P<>nitz <poenitz@mathematik.tu-chemnitz.de>
|
|||
|
|
|
|||
|
|
* buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
|
|||
|
|
|
|||
|
|
* lyx_main.C: new command line option -x (or --execute) and
|
|||
|
|
-e (or --export). Now direct conversion from .lyx to .tex
|
|||
|
|
(.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
|
|||
|
|
Unfortunately, X is still needed and the GUI pops up during the
|
|||
|
|
process...
|
|||
|
|
|
|||
|
|
1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/Spacing.C: add a using directive to bring stream stuff into
|
|||
|
|
normal namespace.
|
|||
|
|
* src/paragraph.C: ditto
|
|||
|
|
* src/buffer.C: ditto
|
|||
|
|
|
|||
|
|
* NEWS: updated a bit the new features of 1.1.3 (took a few things
|
|||
|
|
from Lars' announcement).
|
|||
|
|
|
|||
|
|
* lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
|
|||
|
|
example files from Tino Meinen.
|
|||
|
|
|
|||
|
|
1999-12-06 Allan Rae <rae@lyx.org>
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
|
|||
|
|
|
|||
|
|
1999-12-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: added a lot of inline for no good
|
|||
|
|
reason
|
|||
|
|
|
|||
|
|
* src/lyxfont.[Ch]: removed latexWriteStartChanges, and
|
|||
|
|
latexWriteEndChanges, they were not used.
|
|||
|
|
|
|||
|
|
* src/layout.h (operator<<): output operator for PageSides
|
|||
|
|
|
|||
|
|
* src/mathed/math_iter.C (my_memcpy): slightly changed.
|
|||
|
|
|
|||
|
|
* some example files: loaded in LyX 1.0.4 and saved again to update
|
|||
|
|
certain constructs (table format)
|
|||
|
|
|
|||
|
|
* a lot of files: did the change to use fstream/iostream for all
|
|||
|
|
writing of files. Done with a close look at Andre Poenitz's patch.
|
|||
|
|
|
|||
|
|
* some files: whitespace changes.
|
|||
|
|
|
|||
|
|
1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/math_iter.C (my_memcpy): new function. Since the
|
|||
|
|
built-in memcpy() is broken on egcs and gcc 2.95 for alpha
|
|||
|
|
architecture, we provide our own. It is used unconditionnally, but
|
|||
|
|
I do not think this is a performance problem. Thanks to Angus
|
|||
|
|
Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
|
|||
|
|
Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
|
|||
|
|
first time).
|
|||
|
|
(GetInset): use my_memcpy.
|
|||
|
|
(Insert): ditto
|
|||
|
|
(Copy): ditto
|
|||
|
|
|
|||
|
|
* lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
|
|||
|
|
it is easier to understand, but it uses less TeX-only constructs now.
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
|
|||
|
|
elements contain spaces
|
|||
|
|
|
|||
|
|
* lib/configure: regenerated
|
|||
|
|
|
|||
|
|
* lib/configure.m4 (SEARCH_PROG): make it work when the PATH
|
|||
|
|
elements contain spaces; display the list of programs that are
|
|||
|
|
tried.
|
|||
|
|
|
|||
|
|
* autogen.sh: make sure lib/configure is executable
|
|||
|
|
|
|||
|
|
* lib/examples/*: rename the tutorial examples to begin with the
|
|||
|
|
two-letters language code.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): do not query current font if no
|
|||
|
|
buffer exists.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (RunScript): use QuoteName
|
|||
|
|
(MenuRunDvips): ditto
|
|||
|
|
(PrintApplyCB): ditto
|
|||
|
|
|
|||
|
|
* src/support/filetools.[Ch] (QuoteName): new function. Add quotes
|
|||
|
|
around argument, so that it works well with the current shell.
|
|||
|
|
Does not work properly with OS/2 shells currently.
|
|||
|
|
|
|||
|
|
* src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
|
|||
|
|
* src/LyXSendto.C (SendtoApplyCB): ditto
|
|||
|
|
* src/lyxfunc.C (Dispatch): ditto
|
|||
|
|
* src/buffer.C (runLaTeX): ditto
|
|||
|
|
(runLiterate): ditto
|
|||
|
|
(buildProgram): ditto
|
|||
|
|
(runChktex): ditto
|
|||
|
|
* src/lyx_cb.C (RunScript): ditto
|
|||
|
|
(MenuMakeLaTeX): ditto
|
|||
|
|
|
|||
|
|
* src/buffer.h (getLatexName): new method
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (MakeLatexName): renamed from SpaceLess
|
|||
|
|
|
|||
|
|
1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
|
|||
|
|
* src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
|
|||
|
|
(create_math_panel): ditto
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): re-activate the code which gets
|
|||
|
|
current font and cursor; add test for export to html.
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (read): remove unreachable break statements; add a
|
|||
|
|
few "using".
|
|||
|
|
|
|||
|
|
* src/bmtable.C (fl_set_bmtable_data): add a const_cast.
|
|||
|
|
|
|||
|
|
1999-12-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C (LocalDispatch): fix small whitspace bug
|
|||
|
|
introduced by faulty regex.
|
|||
|
|
* src/buffer.C: ditto
|
|||
|
|
* src/lastfiles.C: ditto
|
|||
|
|
* src/paragraph.C: ditto
|
|||
|
|
* src/table.C: ditto
|
|||
|
|
* src/vspace.C: ditto
|
|||
|
|
* src/insets/figinset.C: ditto
|
|||
|
|
Note: most of these is absolutely harmless, except the one in
|
|||
|
|
src/mathed formula.C.
|
|||
|
|
|
|||
|
|
1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
|
|||
|
|
|
|||
|
|
* src/ImportNoweb.C (documentclass): fixed bounds for substr
|
|||
|
|
operation, yielding correct results for the reLyX command.
|
|||
|
|
|
|||
|
|
1999-12-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (ExpandPath): removed an over eager
|
|||
|
|
Assert.
|
|||
|
|
(ReplaceEnvironmentPath): ditto
|
|||
|
|
|
|||
|
|
* src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
|
|||
|
|
shows that we are doing something fishy in our code...
|
|||
|
|
(BubblePost): ditto
|
|||
|
|
(ToolbarCB): ditto
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (read): use a double switch trick to get more help
|
|||
|
|
from the compiler. (the same trick is used in layout.C)
|
|||
|
|
(write): new function. opens a ofstream and pass that to output
|
|||
|
|
(output): new function, takes a ostream and writes the lyxrc
|
|||
|
|
elemts to it. uses a dummy switch to make sure no elements are
|
|||
|
|
forgotten.
|
|||
|
|
|
|||
|
|
* src/lyxlex.h: added a struct pushpophelper for use in functions
|
|||
|
|
with more than one exit point.
|
|||
|
|
|
|||
|
|
* src/lyxlex.[Ch] (GetInteger): made it const
|
|||
|
|
(GetFloat): ditto
|
|||
|
|
(GetBool): ditto
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
|
|||
|
|
|
|||
|
|
* src/layout.[hC] : LayoutTags splitted into several enums, new
|
|||
|
|
methods created, better error handling cleaner use of lyxlex. Read
|
|||
|
|
the diff.
|
|||
|
|
|
|||
|
|
* src/bmtable.[Ch]: change some member prototypes because of the
|
|||
|
|
image const changes.
|
|||
|
|
|
|||
|
|
* commandtags.h, src/LyXAction.C (init): new function:
|
|||
|
|
"preferences-save", saves the lyxrc entries into .lyx/preferences.
|
|||
|
|
This file is not read automatically but you can add \input
|
|||
|
|
preferences to your lyxrc if you want to. We need to discuss how
|
|||
|
|
to handle this.
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (runBibTeX): use regex to match for the needed lines
|
|||
|
|
in .aux, also remove .bib and .bst files from dependencies when
|
|||
|
|
running bibtex.
|
|||
|
|
|
|||
|
|
* src/BufferView.C, src/LyXView.C: add const_cast several places
|
|||
|
|
because of changes to images.
|
|||
|
|
|
|||
|
|
* lib/images/*: same change as for images/*
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Default for accept_compound is false not no.
|
|||
|
|
|
|||
|
|
* images/*: changed to be const, however I have som misgivings
|
|||
|
|
about this change so it might be changed back.
|
|||
|
|
|
|||
|
|
1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/configure, po/POTFILES.in: regenerated
|
|||
|
|
|
|||
|
|
* autogen.sh: autogenerate lib/configure from lib/configure.m4
|
|||
|
|
|
|||
|
|
* config/lib_configure.m4: removed
|
|||
|
|
|
|||
|
|
* lib/configure.m4: new file (was config/lib_configure.m4)
|
|||
|
|
|
|||
|
|
* configure.in: do not test for rtti, since we do not use it.
|
|||
|
|
|
|||
|
|
1999-11-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (lyxstring::Srep): Changed to use a
|
|||
|
|
doubling of allocated space scheme. This makes it faster for large
|
|||
|
|
strings end to use less memory for small strings. xtra rememoved.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (waitalarm): commented out.
|
|||
|
|
(GhostscriptMsg): use static_cast
|
|||
|
|
(GhostscriptMsg): use new instead of malloc to allocate memory for
|
|||
|
|
cmap. also delete the memory after use.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
|
|||
|
|
for changes in bibtex database or style.
|
|||
|
|
(runBibTeX): remove all .bib and .bst files from dep before we
|
|||
|
|
begin.
|
|||
|
|
(run): use scanAuc in when dep file already exist.
|
|||
|
|
|
|||
|
|
* src/DepTable.C (remove_files_with_extension): new method
|
|||
|
|
(exist): new method
|
|||
|
|
|
|||
|
|
* src/DepTable.[Ch]: made many of the methods const.
|
|||
|
|
|
|||
|
|
1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/bufferparams.C: make sure that the default textclass is
|
|||
|
|
"article". It used to be the first one by description order, but
|
|||
|
|
now the first one is "docbook".
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (setDebuggingLevel): change type of argument to
|
|||
|
|
string; call Debug::value.
|
|||
|
|
(easyParse): pass complete argument to setDebuggingLevel().
|
|||
|
|
|
|||
|
|
* src/debug.h (value): fix the code that parses debug levels.
|
|||
|
|
|
|||
|
|
* src/debug.h: add new debug type ACTION, reserved for LyXAction
|
|||
|
|
class.
|
|||
|
|
|
|||
|
|
* src/LyXAction.C: use Debug::ACTION as debug channel.
|
|||
|
|
|
|||
|
|
* src/lyxlookup.C: make the debug statements go to Debug::KEY.
|
|||
|
|
|
|||
|
|
* NEWS: updated for the future 1.1.3 release.
|
|||
|
|
|
|||
|
|
* src/mathed/symbol_def.h: swap the definitions of \varepsilon and
|
|||
|
|
\epsilon. Now \epsilon shows as red text, and \varepsilon shows as
|
|||
|
|
it should. This is of course a controversial change (since many
|
|||
|
|
people will find that their lyx workscreen is suddenly full of
|
|||
|
|
red), but done for the sake of correctness.
|
|||
|
|
|
|||
|
|
* src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
|
|||
|
|
src/mathed/math_root.[Ch] (Clone): return a MathedInset*
|
|||
|
|
|
|||
|
|
* src/insets/inseterror.h, src/insets/inseturl.h,
|
|||
|
|
src/insets/insetinfo.h, src/insets/figinset.h,
|
|||
|
|
src/mathed/formulamacro.h, src/mathed/math_macro.h
|
|||
|
|
(EditMessage): add a missing const and add _() to make sure that
|
|||
|
|
translation happens
|
|||
|
|
|
|||
|
|
* src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
|
|||
|
|
src/insets/insetbib.C, src/support/filetools.C: add `using'
|
|||
|
|
directives for cxx.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): make sure nothing bad happens when
|
|||
|
|
doing 'Insert index of last word' at the beginning of a paragraph.
|
|||
|
|
|
|||
|
|
1999-11-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* several files: white-space changes.
|
|||
|
|
|
|||
|
|
* src/mathed/formula.C: removed IsAlpha and IsDigit
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (getKeys): use findtexfile to look for the
|
|||
|
|
.bib file. use a ifstream instead of FilePtr when parsing the .bib
|
|||
|
|
file for keys.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (GetPSSizes): don't break when
|
|||
|
|
"EndComments" is seen. But break when a boundingbox is read.
|
|||
|
|
|
|||
|
|
* all classes inherited from Inset: return value of Clone
|
|||
|
|
changed back to Inset *.
|
|||
|
|
|
|||
|
|
* all classes inherited form MathInset: return value of Clone
|
|||
|
|
changed back to MathedInset *.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (runqueue): use a ofstream to output the
|
|||
|
|
gs/ps file. Might need some setpresicion or setw. However I can
|
|||
|
|
see no problem with the current code.
|
|||
|
|
(runqueue): use sleep instead of the alarm/signal code. I just
|
|||
|
|
can't see the difference.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (LyXParagraph): reserve space in the new
|
|||
|
|
paragraph and resize the inserted paragraph to just fit.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.h (operator|=): added operator for func_status.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
|
|||
|
|
check for readable file.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
|
|||
|
|
check for readable file.
|
|||
|
|
(MenuMakeLinuxDoc): ditto
|
|||
|
|
(MenuMakeDocBook): ditto
|
|||
|
|
(MenuMakeAscii): ditto
|
|||
|
|
(InsertAsciiFile): split the test for openable and readable
|
|||
|
|
|
|||
|
|
* src/bmtable.C (draw_bitmaptable): use
|
|||
|
|
fl_state[fl_get_vclass()].depth instead of DefualtScreen.
|
|||
|
|
|
|||
|
|
* src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
|
|||
|
|
findtexfile from LaTeX to filetools.
|
|||
|
|
|
|||
|
|
* src/ImportNoweb.C (documentclass): rewrote to use ifstream
|
|||
|
|
instead of FilePtr. Needs to be verified by a literate user.
|
|||
|
|
|
|||
|
|
1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
|
|||
|
|
(EditMessage): likewise.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
|
|||
|
|
respectively as \textasciitilde and \textasciicircum.
|
|||
|
|
|
|||
|
|
1999-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h: made the methods that take iterators
|
|||
|
|
use const_iterator.
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
|
|||
|
|
(regexMatch): made is use the real regex class.
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am: changed to use libtool
|
|||
|
|
|
|||
|
|
* src/support/.cvsignore: added *.lo, .libs and libsupport.la
|
|||
|
|
|
|||
|
|
* src/mathed/math_defs.h: made the mathaligns be in a enum instead
|
|||
|
|
of defines.
|
|||
|
|
(MathIsInset ++): changed several macros to be inline functions
|
|||
|
|
instead.
|
|||
|
|
|
|||
|
|
* src/mathed/Makefile.am: changed to use libtool
|
|||
|
|
|
|||
|
|
* src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
|
|||
|
|
|
|||
|
|
* src/insets/inset* : Clone changed to const and return type is
|
|||
|
|
the true insettype not just Inset*.
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am: changed to use libtool
|
|||
|
|
|
|||
|
|
* src/insets/.cvsignore: added *.lo, .libs and libinsets.la
|
|||
|
|
|
|||
|
|
* src/undo.[Ch] : added empty() and changed some of the method
|
|||
|
|
names.
|
|||
|
|
|
|||
|
|
* src/texrow.[Ch]: rewrote to store texrow's in a std::list.
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h: use id() and id(...) instead of getID and
|
|||
|
|
setID use block<> for the bullets array, added const several places.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (getStatus): new function
|
|||
|
|
|
|||
|
|
* src/lyxfunc.[Ch] : small changes to take advantage of the new
|
|||
|
|
LyXAction, added const to several funtions.
|
|||
|
|
|
|||
|
|
* src/filedlg.[Ch]: rewrote to store userchache and groupchache in
|
|||
|
|
a std::map, and to store the dir items in a vector.
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
|
|||
|
|
as dependencies.
|
|||
|
|
|
|||
|
|
* src/LyXView.[Ch] + other files : changed currentView to view.
|
|||
|
|
|
|||
|
|
* src/LyXAction.[Ch] : ported from the old devel branch.
|
|||
|
|
|
|||
|
|
* src/.cvsignore: added .libs and a.out
|
|||
|
|
|
|||
|
|
* configure.in : changes to use libtool.
|
|||
|
|
|
|||
|
|
* acinclude.m4 : inserted libtool.m4
|
|||
|
|
|
|||
|
|
* .cvsignore: added libtool
|
|||
|
|
|
|||
|
|
1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
|
|||
|
|
file name in insets and mathed directories (otherwise the
|
|||
|
|
dependency is not taken in account under cygwin).
|
|||
|
|
|
|||
|
|
* src/text2.C (InsertString[AB]): make sure that we do not try to
|
|||
|
|
read characters past the string length.
|
|||
|
|
|
|||
|
|
1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/doc/LaTeXConfig.lyx.in,
|
|||
|
|
lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFile): Do not add a comment on top of .lyx
|
|||
|
|
file saying who created them and when this heppened; this is
|
|||
|
|
useless and annoys tools like cvs.
|
|||
|
|
|
|||
|
|
* lib/layouts/g-brief-{en,de}.layout,
|
|||
|
|
lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
|
|||
|
|
from Thomas Hartkens <thomas@hartkens.de>.
|
|||
|
|
|
|||
|
|
* src/{insets,mathed}/Makefile.am: do not declare an empty
|
|||
|
|
LDFLAGS, so that it can be set at configure time (useful on Irix
|
|||
|
|
for -n32 flag).
|
|||
|
|
|
|||
|
|
* lib/reLyX/configure.in: make sure that the prefix is set
|
|||
|
|
correctly in LYX_DIR.
|
|||
|
|
|
|||
|
|
1999-11-18 Andr<64> P<>nitz <poenitz@mathematik.tu-chemnitz.de>
|
|||
|
|
|
|||
|
|
* src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
|
|||
|
|
be used by 'command-sequence' this allows to bind a key to a
|
|||
|
|
sequence of LyX-commands
|
|||
|
|
(Example: 'command-sequence math-insert alpha; math-insert beta;")
|
|||
|
|
|
|||
|
|
* src/LyXAction.C: add "command-sequence"
|
|||
|
|
|
|||
|
|
* src/LyXFunction.C: handling of "command-sequence"
|
|||
|
|
|
|||
|
|
* src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
|
|||
|
|
&cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
|
|||
|
|
|
|||
|
|
* src/lyxserver.C, src/minibuffer.C: Use this new interface
|
|||
|
|
|
|||
|
|
1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/buffer.C (writeFile): Do not output a comment giving user
|
|||
|
|
and date at the beginning of a .lyx file. This is useless and
|
|||
|
|
annoys cvs anyway; update version number to 1.1.
|
|||
|
|
|
|||
|
|
* src/Makefile.am (LYX_DIR): add this definition, so that a
|
|||
|
|
default path is hardcoded in LyX.
|
|||
|
|
|
|||
|
|
* configure.in: Use LYX_GNU_GETTEXT.
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
|
|||
|
|
AM_GNU_GETTEXT with a bug fixed.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
|
|||
|
|
|
|||
|
|
* src/chset.C: add "using std::ifstream;" to please dec cxx.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init), INSTALL.OS2: the environment variable
|
|||
|
|
which is used to point to LyX data is now LYX_DIR_11x.
|
|||
|
|
|
|||
|
|
* lyx.man: convert to a unix text file; small updates.
|
|||
|
|
|
|||
|
|
1999-11-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/LSubstring.[Ch]: made the second arg of most of the
|
|||
|
|
constructors be a const reference.
|
|||
|
|
|
|||
|
|
* src/mathed/math_parser.C (LexInitCodes): small bug introduced by
|
|||
|
|
me fixed.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.[Ch] (swap): added missing member function
|
|||
|
|
and specialization of swap(str, str);
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowBufferMenu): to use the new BufferStorage
|
|||
|
|
|
|||
|
|
* src/bufferlist.[Ch]: use the new BufferStorage class and remove all
|
|||
|
|
trace of the old one.
|
|||
|
|
|
|||
|
|
* src/undo.[Ch]: made the undostack use std::list to store undo's in
|
|||
|
|
put the member definitions in undo.C.
|
|||
|
|
|
|||
|
|
* src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
|
|||
|
|
NEW_TEXT and have now only code that was included when this was
|
|||
|
|
defined.
|
|||
|
|
|
|||
|
|
* src/intl.C (LCombo): use static_cast
|
|||
|
|
(LCombo2): ditto
|
|||
|
|
(DispatchCallback): ditto
|
|||
|
|
|
|||
|
|
* src/definitions.h: removed whole file
|
|||
|
|
|
|||
|
|
* src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
|
|||
|
|
|
|||
|
|
* src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
|
|||
|
|
parsing and stores in a std:map. a regex defines the file format.
|
|||
|
|
removed unneeded members.
|
|||
|
|
|
|||
|
|
* src/bufferparams.h: added several enums from definitions.h here.
|
|||
|
|
Removed unsused destructor. Changed some types to use proper enum
|
|||
|
|
types. use block to have the temp_bullets and user_defined_bullets
|
|||
|
|
and to make the whole class assignable.
|
|||
|
|
|
|||
|
|
* src/bufferparams.C (Copy): removed this functions, use a default
|
|||
|
|
assignment instead.
|
|||
|
|
|
|||
|
|
* src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
|
|||
|
|
isLiterate const.
|
|||
|
|
|
|||
|
|
* src/buffer.C (readLyXformat2): commend out all that have with
|
|||
|
|
oldpapersize to do. also comment out all that hve to do with
|
|||
|
|
insetlatex and insetlatexdel.
|
|||
|
|
(setOldPaperStuff): commented out
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
|
|||
|
|
|
|||
|
|
* src/LyXAction.C: remove use of inset-latex-insert
|
|||
|
|
|
|||
|
|
* src/mathed/math_panel.C (button_cb): use static_cast
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am (insets_o_SOURCES): removed
|
|||
|
|
insetlatex.[Ch]
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (helper): use the unsigned long
|
|||
|
|
specifier, UL, instead of a static_cast.
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_a_SOURCES): added block.h
|
|||
|
|
|
|||
|
|
* src/support/block.h: new file. to be used as a c-style array in
|
|||
|
|
classes, so that the class can be assignable.
|
|||
|
|
|
|||
|
|
1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C (askForText): when fl_show_input() returns
|
|||
|
|
NULL, make sure to return an empty string (it is not possible to
|
|||
|
|
set a string to NULL).
|
|||
|
|
|
|||
|
|
1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (helper): fix bogus cast in assertion.
|
|||
|
|
|
|||
|
|
* src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
|
|||
|
|
link line, so that Irix users (for example) can set it explicitely to
|
|||
|
|
"-n32".
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
|
|||
|
|
it can be overidden at make time (static or dynamic link, for
|
|||
|
|
example).
|
|||
|
|
|
|||
|
|
* src/vc-backend.C, src/LaTeXFeatures.h,
|
|||
|
|
src/support/LRegex.C, src/support/LRegex.h: add a few "using"
|
|||
|
|
statements to bring templates to global namespace.
|
|||
|
|
|
|||
|
|
1999-11-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (operator[] const): make it standard
|
|||
|
|
conforming.
|
|||
|
|
|
|||
|
|
* src/minibuffer.C (Init): changed to reflect that more
|
|||
|
|
information is given from the lyxvc and need not be provided here.
|
|||
|
|
|
|||
|
|
* src/lyxvc.[Ch]: rewrote to use the vc-backend.
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
|
|||
|
|
|
|||
|
|
* src/LyXView.C (UpdateTimerCB): use static_cast
|
|||
|
|
(KeyPressMask_raw_callback): ditto
|
|||
|
|
|
|||
|
|
* src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
|
|||
|
|
buffer_, a lot of changes because of this. currentBuffer() ->
|
|||
|
|
buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
|
|||
|
|
also changes to other files because of this.
|
|||
|
|
|
|||
|
|
1999-11-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/vc-backend.[Ch]: new files. The backends for vc handling,
|
|||
|
|
have no support for RCS and partial support for CVS, will be
|
|||
|
|
improved later.
|
|||
|
|
|
|||
|
|
* src/insets/ several files: changes because of function name
|
|||
|
|
changes in Bufferview and LyXView.
|
|||
|
|
|
|||
|
|
* src/mathed/math_symbols.C (math_insert_symbol): use static_cast
|
|||
|
|
|
|||
|
|
* src/support/LSubstring.[Ch]: new files. These implement a
|
|||
|
|
Substring that can be very convenient to use. i.e. is this
|
|||
|
|
possible:
|
|||
|
|
string a = "Mary had a little sheep";
|
|||
|
|
Substring(a, "sheep") = "lamb";
|
|||
|
|
a is now "Mary has a little lamb".
|
|||
|
|
|
|||
|
|
* src/support/LRegex.[Ch]: a regex class that can be used to pick
|
|||
|
|
out patterns and subpatterns of strings. It is used by LSubstring
|
|||
|
|
and also by vc-backend.C
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: went over all the assertions used and
|
|||
|
|
tried to correct the wrong ones and flag which of them is required
|
|||
|
|
by the standard. some bugs found because of this. Also removed a
|
|||
|
|
couple of assertions.
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_a_SOURCES): added
|
|||
|
|
LSubstring.[Ch] and LRegex.[Ch]
|
|||
|
|
|
|||
|
|
* src/support/FileInfo.h: have struct stat buf as an object and
|
|||
|
|
not a pointer to one, some changes because of this.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.C (getTClassPreamble): also use the
|
|||
|
|
information in layout when adding the layouts preamble to the
|
|||
|
|
textclass preamble.
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.h: use a vector<bool> to store the layout
|
|||
|
|
usage in.
|
|||
|
|
|
|||
|
|
* configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
|
|||
|
|
because of bug in OS/2.
|
|||
|
|
|
|||
|
|
1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/layouts/lyxmacros.inc (lyxcode): set the font with
|
|||
|
|
\verbatim@font instead of \ttfamily, so that it can be redefined.
|
|||
|
|
|
|||
|
|
* src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
|
|||
|
|
src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
|
|||
|
|
src/layout.h, src/text2.C: add 'using' directive to bring the
|
|||
|
|
STL templates we need from the std:: namespace to the global one.
|
|||
|
|
Needed by DEC cxx in strict ansi mode.
|
|||
|
|
|
|||
|
|
* src/support/LIstream.h,src/support/LOstream.h,
|
|||
|
|
src/support/lyxstring.h,src/table.h,
|
|||
|
|
src/lyxlookup.h: do not include <config.h> in header
|
|||
|
|
files. This should be done in the .C files only.
|
|||
|
|
|
|||
|
|
* development/lyx.spec.in: WHATSNEW has been renamed to NEWS
|
|||
|
|
(from Kayvan).
|
|||
|
|
|
|||
|
|
|
|||
|
|
1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
|
|||
|
|
from Kayvan to fix the tth invokation.
|
|||
|
|
|
|||
|
|
* development/lyx.spec.in: updates from Kayvan to reflect the
|
|||
|
|
changes of file names.
|
|||
|
|
|
|||
|
|
1999-11-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (InsertStringB): use std::copy
|
|||
|
|
(InsertStringA): use std::copy
|
|||
|
|
|
|||
|
|
* src/bufferlist.C: use a vector to store the buffers in. This is
|
|||
|
|
an internal change and should not affect any other thing.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (waitForX): use XSync instead of the lengthy
|
|||
|
|
stuff in waitForX.
|
|||
|
|
|
|||
|
|
* src/text.C (Fill): fix potential bug, one off bug.
|
|||
|
|
|
|||
|
|
1999-11-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_main.o): add more files it depends on.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: use size_t for the reference count,
|
|||
|
|
size, reserved memory and xtra.
|
|||
|
|
(internal_compare): new private member function. Now the compare
|
|||
|
|
functions should work for std::strings that have embedded '\0'
|
|||
|
|
characters.
|
|||
|
|
(compare): all compare functions rewritten to use
|
|||
|
|
internal_compare.
|
|||
|
|
|
|||
|
|
1999-11-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (compare): pass c_str()
|
|||
|
|
(compare): pass c_str
|
|||
|
|
(compare): pass c_str
|
|||
|
|
|
|||
|
|
1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.C: <config.h> was not included correctly.
|
|||
|
|
|
|||
|
|
* lib/configure: forgot to re-generate it :( I'll make this file
|
|||
|
|
auto generated soon.
|
|||
|
|
|
|||
|
|
1999-11-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
|
|||
|
|
is used.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: some changes from length() to rep->sz.
|
|||
|
|
avoids a function call.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (SpaceLess): yet another version of the
|
|||
|
|
algorithm...now per Jean-Marc's suggestions.
|
|||
|
|
|
|||
|
|
1999-11-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/layout.C (less_textclass_desc): functor for use in sorting
|
|||
|
|
of textclasses.
|
|||
|
|
(LyXTextClass::Read): sort the textclasses after reading.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (SpaceLess): new version of the
|
|||
|
|
SpaceLess functions. What problems does this one give? Please
|
|||
|
|
report.
|
|||
|
|
|
|||
|
|
* images/banner_bw.xbm: made the arrays unsigned char *
|
|||
|
|
|
|||
|
|
1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (find): remove bogus assertion in the
|
|||
|
|
two versions of find where this has not been done yet.
|
|||
|
|
|
|||
|
|
* src/support/lyxlib.h: add missing int return type to
|
|||
|
|
lyx::chdir().
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowFileMenu): disable exporting to html if no
|
|||
|
|
html export command is present.
|
|||
|
|
|
|||
|
|
* config/lib_configure.m4: add a test for an HTML converter. The
|
|||
|
|
programs checked for are, in this order: tth, latex2html and
|
|||
|
|
hevea.
|
|||
|
|
|
|||
|
|
* lib/configure: generated from config/lib_configure.m4.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): update and improve the execution of an
|
|||
|
|
html converter. The parameters are now passed through $$FName and
|
|||
|
|
$$OutName, instead of standard input/output.
|
|||
|
|
|
|||
|
|
* src/lyxrc.{C,h}: rename \tth_command to \html_command.
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: update description of \html_command.
|
|||
|
|
add "quotes" around \screen_font_xxx font setting examples to help
|
|||
|
|
people who use fonts with spaces in their names.
|
|||
|
|
|
|||
|
|
1999-11-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* Distribution files: updates for v1.1.2
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (find): remove bogus assert and return
|
|||
|
|
npos for the same condition.
|
|||
|
|
|
|||
|
|
1999-11-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* added patch for OS/2 from SMiyata.
|
|||
|
|
|
|||
|
|
1999-10-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/text2.C (CutSelection): make space_wrapped a bool
|
|||
|
|
(CutSelection): dont declare int i until we have to.
|
|||
|
|
(alphaCounter): return a char const *.
|
|||
|
|
|
|||
|
|
1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/syscall.C (Systemcalls::kill):
|
|||
|
|
src/support/filetools.C (PutEnv, PutEnvPath):
|
|||
|
|
src/lyx_cb.C (addNewlineAndDepth):
|
|||
|
|
src/FontInfo.C (FontInfo::resize): condition some #warning
|
|||
|
|
directives with WITH_WARNINGS.
|
|||
|
|
|
|||
|
|
|
|||
|
|
1999-10-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/layout.[Ch] + several files: access to class variables
|
|||
|
|
limited and made accessor functions instead a lot of code changed
|
|||
|
|
becuase of this. Also instead of returning pointers often a const
|
|||
|
|
reference is returned instead.
|
|||
|
|
|
|||
|
|
* src/form1.C (create_form_Figure): added a couple fo "no-c-format"
|
|||
|
|
|
|||
|
|
* src/Makefile.am (dist-hook): added used to remove the CVS from
|
|||
|
|
cheaders upon creating a dist
|
|||
|
|
(EXTRA_DIST): added cheaders
|
|||
|
|
|
|||
|
|
* src/support/lstrings.C (tostr(char)): fix it to handle param as
|
|||
|
|
a character not as a small integer.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (find): removed Assert and added i >=
|
|||
|
|
rep->sz to the first if.
|
|||
|
|
|
|||
|
|
1999-10-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
|
|||
|
|
src/LyXView.C src/buffer.C src/bufferparams.C
|
|||
|
|
src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
|
|||
|
|
src/text2.C src/insets/insetinclude.C:
|
|||
|
|
lyxlayout renamed to textclasslist.
|
|||
|
|
|
|||
|
|
* src/layout.C: some lyxerr changes.
|
|||
|
|
|
|||
|
|
* src/layout.[Ch] (LyXLayout::Read): changed second paramter to
|
|||
|
|
LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
|
|||
|
|
(LyXLayoutList): removed all traces of this class.
|
|||
|
|
(LyXTextClass::Read): rewrote LT_STYLE
|
|||
|
|
(LyXTextClass::hasLayout): new function
|
|||
|
|
(LyXTextClass::GetLayout): rewritten to return an iterator + has
|
|||
|
|
both const and nonconst version.
|
|||
|
|
(LyXTextClass::delete_layout): new function.
|
|||
|
|
(LyXTextClassList::Style): bug fix. do the right thing if layout
|
|||
|
|
is to big.
|
|||
|
|
(LyXTextClassList::NumberOfLayout): new acces to layoutlist.
|
|||
|
|
(LyXTextClassList::NameOfLayout): ditto
|
|||
|
|
(LyXTextClassList::Load): ditto
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): new access to layoutlist
|
|||
|
|
|
|||
|
|
* src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
|
|||
|
|
|
|||
|
|
* src/LyXAction.C (LookupFunc): added a workaround for sun
|
|||
|
|
compiler, on the other hand...we don't know if the current code
|
|||
|
|
compiles on sun at all...
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (CleanupPath): subst fix
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (delDatabase): subst fix, this looks
|
|||
|
|
_really_ weird.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (PutEnvPath): subst fix, how come nobody
|
|||
|
|
complained about this one?
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (Latex): subst fix
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (getKeys): subst fix
|
|||
|
|
|
|||
|
|
* src/LyXSendto.C (SendtoApplyCB): subst fix
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init): subst fix
|
|||
|
|
|
|||
|
|
* src/layout.C (Read): subst fix
|
|||
|
|
|
|||
|
|
* src/lyx_sendfax_main.C (button_send): subst fix
|
|||
|
|
|
|||
|
|
* src/buffer.C (RoffAsciiTable): subst fix
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuFax): subst fix
|
|||
|
|
(PrintApplyCB): subst fix
|
|||
|
|
|
|||
|
|
1999-10-26 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
|
|||
|
|
|
|||
|
|
(Read): Cleaned up this code so now we read only format vestion >= 5
|
|||
|
|
|
|||
|
|
1999-10-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (PutEnvPath): subst fix for EMX, how
|
|||
|
|
come nobody has complained about this one?
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (Latex): subst fix
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (getKeys): subst fix
|
|||
|
|
|
|||
|
|
* src/lyx_main.C (init): subst fix
|
|||
|
|
|
|||
|
|
* src/layout.C (Read): subst fix
|
|||
|
|
|
|||
|
|
* src/buffer.C (RoffAsciiTable): subst fix
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuFax): subst fix.
|
|||
|
|
|
|||
|
|
* src/layout.[hC] + some other files: rewrote to use
|
|||
|
|
std::container to store textclasses and layouts in.
|
|||
|
|
Simplified, removed a lot of code. Make all classes
|
|||
|
|
assignable. Further simplifications and review of type
|
|||
|
|
use still to be one.
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
|
|||
|
|
lastfiles to create the lastfiles partr of the menu.
|
|||
|
|
|
|||
|
|
* src/lastfiles.[Ch]: rewritten to use deque to store the
|
|||
|
|
lastfiles in. Uses fstream for reading and writing. Simplifies
|
|||
|
|
code.
|
|||
|
|
|
|||
|
|
* src/support/syscall.C: remove explicit cast.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (CursorToggleCB): removed code snippets that
|
|||
|
|
were commented out.
|
|||
|
|
use explicat C++ style casts instead of C style casts. also use
|
|||
|
|
u_vdata instea of passing pointers in longs.
|
|||
|
|
|
|||
|
|
* src/PaperLayout.C: removed code snippets that were commented out.
|
|||
|
|
|
|||
|
|
* src/lyx_gui_misc.C: removed code snippets that were commented out.
|
|||
|
|
|
|||
|
|
* src/lyx_main.C: removed code snippets that wer commented out.
|
|||
|
|
|
|||
|
|
* src/paragraph.C: removed code snippets that were commented out.
|
|||
|
|
|
|||
|
|
* src/lyxvc.C (logClose): use static_cast
|
|||
|
|
(logUpdate): ditto
|
|||
|
|
(viewLog): remove explicit cast to void*
|
|||
|
|
(showLog): removed old commented code
|
|||
|
|
|
|||
|
|
* src/menus.C: use static_cast instead of C style casts. use
|
|||
|
|
u_vdata instead of u_ldata. remove explicit cast to (long) for
|
|||
|
|
pointers. Removed old code that was commented out.
|
|||
|
|
|
|||
|
|
* src/insets/inset.C: removed old commented func
|
|||
|
|
|
|||
|
|
* src/insets/insetref.C (InsetRef): removed old code that had been
|
|||
|
|
commented out for a long time.
|
|||
|
|
(Edit): ditto
|
|||
|
|
(escape): removed C style cast
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (Draw): removed old commented code
|
|||
|
|
|
|||
|
|
* src/insets/insetlatex.C (Draw): removed old commented code
|
|||
|
|
(Read): rewritten to use string
|
|||
|
|
|
|||
|
|
* src/insets/insetlabel.C (escape): removed C style cast
|
|||
|
|
|
|||
|
|
* src/insets/insetindex.h: removed vdata and ldata from FD_index_form
|
|||
|
|
|
|||
|
|
* src/insets/insetindex.C: use static_cast and u_vdata, removed
|
|||
|
|
old commented code.
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.h: removed a couple of stupid bools
|
|||
|
|
|
|||
|
|
* src/insets/insetinclude.C (include_cb): use static_cast and u_data.
|
|||
|
|
(Clone): remove C style cast
|
|||
|
|
(getKeys): changed list to lst because of std::list
|
|||
|
|
|
|||
|
|
* src/insets/inseterror.C (Draw): removed som old commented code.
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.C (Draw): removed some old commented code.
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (bibitem_cb): removed code that has been
|
|||
|
|
commented out forever.
|
|||
|
|
(bibitem_cb): use static_cast instead of C style cast
|
|||
|
|
use of vdata changed to u_vdata.
|
|||
|
|
|
|||
|
|
* src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
|
|||
|
|
parameter.
|
|||
|
|
(CloseUrlCB): use static_cast instead of C style cast.
|
|||
|
|
(CloseUrlCB): added a fl_free form...it seemed to be missing.
|
|||
|
|
|
|||
|
|
* src/insets/insetinfo.C (Edit): pass object in u_vdata instead
|
|||
|
|
(C_InsetInfo_CloseInfoCB): forward the ob parameter
|
|||
|
|
(CloseInfoCB): static_cast from ob->u_vdata instead.
|
|||
|
|
(Edit): removed bogus arg from fl_set_object_shortcut, set to 1
|
|||
|
|
instead.
|
|||
|
|
|
|||
|
|
* src/insets/inseterror.C (Edit): pass object in u_vdata instead
|
|||
|
|
(C_InsetError_CloseErrorCB): forward the ob parameter
|
|||
|
|
(CloseErrorCB): static_cast from ob->u_vdata instead.
|
|||
|
|
|
|||
|
|
* src/vspace.h: include LString.h since we use string in this class.
|
|||
|
|
|
|||
|
|
* src/vspace.C (lyx_advance): changed name from advance because of
|
|||
|
|
nameclash with stl. And since we cannot use namespaces yet...I
|
|||
|
|
used a lyx_ prefix instead. Expect this to change when we begin
|
|||
|
|
using namespaces.
|
|||
|
|
|
|||
|
|
* src/BufferView.[Ch] (BufferView::~BufferView): removed
|
|||
|
|
|
|||
|
|
* src/BackStack.h: rewrote to use std::stack. made BackStackItem
|
|||
|
|
and removed now defunct constructor and deconstructor.
|
|||
|
|
|
|||
|
|
* src/BufferView.h: have backstack as a object not as a pointer.
|
|||
|
|
removed initialization from constructor. added include for BackStack
|
|||
|
|
|
|||
|
|
* development/lyx.spec.in (%build): add CFLAGS also.
|
|||
|
|
|
|||
|
|
* src/screen.C (drawFrame): removed another warning.
|
|||
|
|
|
|||
|
|
1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
|
|||
|
|
OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
|
|||
|
|
README and ANNOUNCE a bit for the next release. More work is
|
|||
|
|
needed, of course.
|
|||
|
|
|
|||
|
|
* src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
|
|||
|
|
unbreakable if we are in freespacing mode (LyX-Code), but not in
|
|||
|
|
latex mode.
|
|||
|
|
|
|||
|
|
1999-10-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/BackStack.h: fixed initialization order in constructor
|
|||
|
|
|
|||
|
|
* Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
|
|||
|
|
|
|||
|
|
* acinclude.m4 (VERSION): new rules for when a version is
|
|||
|
|
development, added also a variable for prerelease.
|
|||
|
|
(warnings): we set with_warnings=yes for prereleases
|
|||
|
|
(lyx_opt): prereleases compile with same optimization as development
|
|||
|
|
(CXXFLAGS): only use pedantic if we are a development version
|
|||
|
|
|
|||
|
|
* src/BufferView.C (restorePosition): don't do anything if the
|
|||
|
|
backstack is empty.
|
|||
|
|
|
|||
|
|
* src/BackStack.h: added member empty, use this to test if there
|
|||
|
|
is anything to pop...
|
|||
|
|
|
|||
|
|
1999-10-25 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* forms/form1.fd +
|
|||
|
|
* forms/layout_forms.fd +
|
|||
|
|
* forms/latexoptions.fd +
|
|||
|
|
* lyx.fd: changed for various form resize issues
|
|||
|
|
|
|||
|
|
* src/mathed/math_panel.C +
|
|||
|
|
* src/insets/inseterror.C +
|
|||
|
|
* src/insets/insetinfo.C +
|
|||
|
|
* src/insets/inseturl.C +
|
|||
|
|
* src/insets/inseturl.h +
|
|||
|
|
* src/LaTeXLog.C +
|
|||
|
|
* src/LyXSendto.C +
|
|||
|
|
* src/PaperLayout.C +
|
|||
|
|
* src/ParagraphExtra.C +
|
|||
|
|
* src/TableLayout.C +
|
|||
|
|
* src/form1.C +
|
|||
|
|
* src/layout_forms.C +
|
|||
|
|
* src/lyx.C +
|
|||
|
|
* src/lyx_cb.C +
|
|||
|
|
* src/lyx_gui.C +
|
|||
|
|
* src/lyxfr0.C +
|
|||
|
|
* src/lyxfunc.C +
|
|||
|
|
* src/lyxvc.C +
|
|||
|
|
* src/menus.C: fixed various resize issues. So now forms can be
|
|||
|
|
resized savely or not be resized at all.
|
|||
|
|
|
|||
|
|
* forms/form_url.fd +
|
|||
|
|
* src/insets/form_url.[Ch]: added because it's cleaner and easier
|
|||
|
|
to modify IMO.
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am: added files form_url.[Ch]
|
|||
|
|
|
|||
|
|
1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* INSTALL: it is now possible to compile LyX with digital C++ 6.1
|
|||
|
|
(and presumably 6.2).
|
|||
|
|
|
|||
|
|
* src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
|
|||
|
|
menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
|
|||
|
|
remaining static member callbacks.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
|
|||
|
|
messages.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h: declare struct Srep as friend of
|
|||
|
|
lyxstring, since DEC cxx complains otherwise.
|
|||
|
|
|
|||
|
|
1999-10-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
1999-10-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (run): made run_bibtex also depend on files with
|
|||
|
|
extension ".bst"
|
|||
|
|
(runBibTeX): added scans for "\\bibstyle", now also ".bst" files
|
|||
|
|
are put into the dependency file.
|
|||
|
|
|
|||
|
|
* src/spellchecker.C (create_ispell_pipe): removed old #warning,
|
|||
|
|
the code has shown itself to work
|
|||
|
|
(create_ispell_pipe): removed another warning, added a comment
|
|||
|
|
instead.
|
|||
|
|
|
|||
|
|
* src/minibuffer.C (ExecutingCB): removed code that has been
|
|||
|
|
commented out a long time
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent): removed some very old commented
|
|||
|
|
out code + a warning.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h: comment out the three private
|
|||
|
|
operators, when compiling with string ansi conforming compilers
|
|||
|
|
they make problems.
|
|||
|
|
|
|||
|
|
* src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
|
|||
|
|
unsigned char *.
|
|||
|
|
(pixmapFromBitmapData): change type of bdata to be unsigned char *
|
|||
|
|
(pixmapFromBitmapData): add a reinterpret_cast in the call to
|
|||
|
|
XCreateImage
|
|||
|
|
|
|||
|
|
* src/mathed/math_panel.h: change 6th arg to AddBitmap to be
|
|||
|
|
unsigned char *
|
|||
|
|
|
|||
|
|
* src/mathed/math_panel.C (create_math_panel): remove explicit
|
|||
|
|
casts
|
|||
|
|
|
|||
|
|
* src/bmtable.h: change last paramter to fl_set_bmtable_data to be
|
|||
|
|
unsigned char *.
|
|||
|
|
|
|||
|
|
* src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
|
|||
|
|
(draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
|
|||
|
|
to XCreatePixmapFromBitmapData
|
|||
|
|
(fl_set_bmtable_data): change the last argument to be unsigned
|
|||
|
|
char *
|
|||
|
|
(fl_set_bmtable_file): change bdata to unsinged char *, change bw
|
|||
|
|
and bh to be unsigned int, remove explicit casts in call to
|
|||
|
|
XReadBitmapFileData.
|
|||
|
|
|
|||
|
|
* images/arrows.xbm: made the arrays unsigned char *
|
|||
|
|
* images/varsz.xbm: ditto
|
|||
|
|
* images/misc.xbm: ditto
|
|||
|
|
* images/greek.xbm: ditto
|
|||
|
|
* images/dots.xbm: ditto
|
|||
|
|
* images/brel.xbm: ditto
|
|||
|
|
* images/bop.xbm: ditto
|
|||
|
|
|
|||
|
|
* Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
|
|||
|
|
(LYX_PROG_CXX): added -pedantic to g++ compile options when
|
|||
|
|
with-warnings, removed the __STRING_ANSI__ hack, seems to not be
|
|||
|
|
needed.
|
|||
|
|
(LYX_CXX_CHEADERS): added <clocale> to the test.
|
|||
|
|
|
|||
|
|
1999-10-23 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (append): fixed something that must be a
|
|||
|
|
bug, rep->assign was used instead of rep->append.
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
|
|||
|
|
and LOstream.h
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent): removed faulty line that made
|
|||
|
|
lyx insert double chars. Fix spotted by Kayvan.
|
|||
|
|
|
|||
|
|
1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
|
|||
|
|
|
|||
|
|
* Fixed the tth support. I messed up with the Emacs patch apply feature
|
|||
|
|
and omitted the changes in lyxrc.C.
|
|||
|
|
|
|||
|
|
1999-10-22 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuInsertRef) +
|
|||
|
|
* src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
|
|||
|
|
the form cannot be resized under it limits (fixes a segfault)
|
|||
|
|
|
|||
|
|
* src/lyx.C (create_form_form_ref) +
|
|||
|
|
* forms/lyx.fd: Changed Gravity on name input field so that it is
|
|||
|
|
resized correctly.
|
|||
|
|
|
|||
|
|
1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
|
|||
|
|
<ostream> and <istream>.
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
|
|||
|
|
whether <fstream> provides the latest standard features, or if we
|
|||
|
|
have an oldstyle library (like in egcs).
|
|||
|
|
(LYX_CXX_STL_STRING): fix the test.
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
|
|||
|
|
code on MODERN_STL_STREAM.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h: use L{I,O}stream.h.
|
|||
|
|
|
|||
|
|
* src/support/L{I,O}stream.h: new files, designed to setup
|
|||
|
|
correctly streams for our use
|
|||
|
|
- includes the right header depending on STL capabilities
|
|||
|
|
- puts std::ostream and std::endl (for LOStream.h) or
|
|||
|
|
std::istream (LIStream.h) in toplevel namespace.
|
|||
|
|
|
|||
|
|
1999-10-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (run): added a check in 0 sumchange so that if it
|
|||
|
|
was a bib file that had been changed we ensure that bibtex is run.
|
|||
|
|
(runBibTeX): enhanced to extract the names of the bib files and
|
|||
|
|
getting their absolute path and enter them into the dep file.
|
|||
|
|
(findtexfile): static func that is used to look for tex-files,
|
|||
|
|
checks for absolute patchs and tries also with kpsewhich.
|
|||
|
|
Alternative ways of finding the correct files are wanted. Will
|
|||
|
|
probably be moved.
|
|||
|
|
(do_popen): function that runs a command using popen and returns
|
|||
|
|
the whole output of that command in a string. Should be moved to
|
|||
|
|
somewhere else.
|
|||
|
|
|
|||
|
|
* src/DepTable.[Ch] (extchanged): new function that returns true if a
|
|||
|
|
file with extension ext has changed.
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: added ifdef guards around the fl_free
|
|||
|
|
code that jug commented out. Now it is commented out when
|
|||
|
|
compiling with XForms == 0.89.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: moved the definition of lyxstring::Srep
|
|||
|
|
to lyxstring.C, and only keep a forward declaration in
|
|||
|
|
lyxstring.h. Simplifies the header file a bit and should help a
|
|||
|
|
bit on compile time too. Also changes to Srep will not mandate a
|
|||
|
|
recompile of code just using string.
|
|||
|
|
(~lyxstring): definition moved here since it uses srep.
|
|||
|
|
(size): definition moved here since it uses srep.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h: removed a couple of "inline" that should
|
|||
|
|
not be there.
|
|||
|
|
|
|||
|
|
1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
|
|||
|
|
the 'ob' argument.
|
|||
|
|
|
|||
|
|
1999-10-21 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/table.C (SetPWidth): Just a small fix so the alignment is not
|
|||
|
|
set to left if I just remove the width entry (or it is empty).
|
|||
|
|
|
|||
|
|
* src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
|
|||
|
|
paragraph when having dummy paragraphs.
|
|||
|
|
|
|||
|
|
1999-10-20 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/insets/figinset.C: just commented some fl_free_form calls
|
|||
|
|
and added warnings so that this calls should be activated later
|
|||
|
|
again. This avoids for now a segfault, but we have a memory leak!
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (processKeyEvent) (Dispatch): changed
|
|||
|
|
'const char * argument' to 'string argument', this should
|
|||
|
|
fix some Asserts() in lyxstring.C.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.h: Removed the function argAsString(const char *)
|
|||
|
|
as it is not used anymore.
|
|||
|
|
|
|||
|
|
1999-10-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (getline): reads now _all_ chars. uses
|
|||
|
|
get instead of >>
|
|||
|
|
|
|||
|
|
* src/Literate.h: some funcs moved from public to private to make
|
|||
|
|
interface clearer. Unneeded args removed.
|
|||
|
|
|
|||
|
|
* src/Literate.C (scanLiterateLogFile): rewritten to use iostream
|
|||
|
|
instead of lyxlex.
|
|||
|
|
(scanBuildLogFile): ditto
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
|
|||
|
|
normal TeX Error. Still room for improvement.
|
|||
|
|
|
|||
|
|
* src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
|
|||
|
|
|
|||
|
|
* src/buffer.C (insertErrors): changes to make the error
|
|||
|
|
desctription show properly.
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
|
|||
|
|
could never happen
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (helper): changed to use
|
|||
|
|
sizeof(object->rep->ref).
|
|||
|
|
(operator>>): changed to use a pointer instead.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h: changed const reference & to value_type
|
|||
|
|
const & lets see if that helps.
|
|||
|
|
|
|||
|
|
1999-10-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* Makefile.am (rpmdist): fixed to have non static package and
|
|||
|
|
verison.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: removed the compilation guards
|
|||
|
|
|
|||
|
|
* src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
|
|||
|
|
a bit clearer.
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
|
|||
|
|
conditional compile of lyxstring.Ch
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
|
|||
|
|
stupid check, but it is a lot better than the bastring hack.
|
|||
|
|
(LYX_CXX_STL_STRING): bruker n<> AM_CONDITIONAL(USE_LYXSTRING
|
|||
|
|
|
|||
|
|
* several files: changed string::erase into string::clear. Not
|
|||
|
|
really needed.
|
|||
|
|
|
|||
|
|
* src/chset.C (encodeString): use a char temporary instead
|
|||
|
|
|
|||
|
|
* src/table.C (TexEndOfCell): added tostr around
|
|||
|
|
column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
|
|||
|
|
(TexEndOfCell): ditto
|
|||
|
|
(TexEndOfCell): ditto
|
|||
|
|
(TexEndOfCell): ditto
|
|||
|
|
(DocBookEndOfCell): ditto
|
|||
|
|
(DocBookEndOfCell): ditto
|
|||
|
|
(DocBookEndOfCell): ditto
|
|||
|
|
(DocBookEndOfCell): ditto
|
|||
|
|
|
|||
|
|
* src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
|
|||
|
|
|
|||
|
|
* src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
|
|||
|
|
(MenuBuildProg): added tostr around ret
|
|||
|
|
(MenuRunChktex): added tostr around ret
|
|||
|
|
(DocumentApplyCB): added tostr around ret
|
|||
|
|
|
|||
|
|
* src/chset.C (encodeString): added tostr around t->ic
|
|||
|
|
|
|||
|
|
* src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
|
|||
|
|
(makeLaTeXFile): added tostr around tocdepth
|
|||
|
|
(makeLaTeXFile): added tostr around ftcound - 1
|
|||
|
|
|
|||
|
|
* src/insets/insetbib.C (setCounter): added tostr around counter.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h: added an operator+=(int) to catch more
|
|||
|
|
mistakes.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
|
|||
|
|
(lyxstring): We DON'T allow NULL pointers.
|
|||
|
|
|
|||
|
|
1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/mathed/math_macro.C (MathMacroArgument::Write,
|
|||
|
|
MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
|
|||
|
|
when writing them out.
|
|||
|
|
|
|||
|
|
* src/LString.C: remove, since it is not used anymore.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C: condition the content to
|
|||
|
|
USE_INCLUDED_STRING macro.
|
|||
|
|
|
|||
|
|
* src/mathed/math_symbols.C, src/support/lstrings.C,
|
|||
|
|
src/support/lyxstring.C: add `using' directive to specify what
|
|||
|
|
we need in <algorithm>. I do not think that we need to
|
|||
|
|
conditionalize this, but any thought is appreciated.
|
|||
|
|
|
|||
|
|
* many files: change all callback functions to "C" linkage
|
|||
|
|
functions to please strict C++ compilers like DEC cxx 6.1 in mode
|
|||
|
|
strict_ansi. Those who were static are now global.
|
|||
|
|
The case of callbacks which are static class members is
|
|||
|
|
trickier, since we have to make C wrappers around them (see
|
|||
|
|
InsetError, InsetInfo and InsetUrl). The same holds for friends. I
|
|||
|
|
did not finish this yet, since it defeats the purpose of
|
|||
|
|
encapsulation, and I am not sure what the best route is.
|
|||
|
|
|
|||
|
|
1999-10-19 Juergen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (lyxstring): we permit to have a null
|
|||
|
|
pointer as assignment value and just don't assign it.
|
|||
|
|
|
|||
|
|
* src/vspace.C (nextToken): corrected this function substituting
|
|||
|
|
find_first(_not)_of with find_last_of.
|
|||
|
|
|
|||
|
|
* src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
|
|||
|
|
(TableOptCloseCB) (TableSpeCloseCB):
|
|||
|
|
inserted fl_set_focus call for problem with fl_hide_form() in
|
|||
|
|
xforms-0.89.
|
|||
|
|
|
|||
|
|
1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
|
|||
|
|
string.
|
|||
|
|
|
|||
|
|
1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
|
|||
|
|
LyXLex::next() and not eatline() to get its argument.
|
|||
|
|
|
|||
|
|
1999-10-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/DepTable.[Ch]: rewritten to store the dependencies in a map
|
|||
|
|
instead, use fstreams for io of the depfile, removed unneeded
|
|||
|
|
functions and variables.
|
|||
|
|
|
|||
|
|
* src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
|
|||
|
|
vector instead, removed all functions and variables that is not in
|
|||
|
|
use.
|
|||
|
|
|
|||
|
|
1999-10-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/buffer.C (insertErrors): use new interface to TeXError
|
|||
|
|
|
|||
|
|
* Makefile.am (rpmdist): added a rpmdist target
|
|||
|
|
|
|||
|
|
* lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
|
|||
|
|
per Kayvan's instructions.
|
|||
|
|
|
|||
|
|
1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/Makefile.am: add a definition for localedir, so that locales
|
|||
|
|
are found after installation (Kayvan)
|
|||
|
|
|
|||
|
|
1999-10-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* development/.cvsignore: new file.
|
|||
|
|
|
|||
|
|
1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
|
|||
|
|
C++ compiler provides wrappers for C headers and use our alternate
|
|||
|
|
version otherwise.
|
|||
|
|
|
|||
|
|
* configure.in: use LYX_CXX_CHEADERS.
|
|||
|
|
|
|||
|
|
* src/cheader/: new directory, populated with cname headers from
|
|||
|
|
libstdc++-2.8.1. They are a bit old, but probably good enough for
|
|||
|
|
what we want (support compilers who lack them).
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
|
|||
|
|
from includes. It turns out is was stupid.
|
|||
|
|
|
|||
|
|
1999-10-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (install-data-local): forgot a ';'
|
|||
|
|
(install-data-local): forgot a '\'
|
|||
|
|
(libinstalldirs): needed after all. reintroduced.
|
|||
|
|
|
|||
|
|
1999-10-13 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* configure.in (AC_OUTPUT): added lyx.spec
|
|||
|
|
|
|||
|
|
* development/lyx.spec: removed file
|
|||
|
|
|
|||
|
|
* development/lyx.spec.in: new file
|
|||
|
|
|
|||
|
|
* po/*.po: merged with lyx.pot becuase of make distcheck
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (dist-hook): added dist-hook so that
|
|||
|
|
documentation files will be included when doing a make
|
|||
|
|
dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
|
|||
|
|
(pkgdata_SCRIPTS): added configure.cmd for now, we can use som
|
|||
|
|
conditional later.
|
|||
|
|
more: tried to make install do the right thing, exclude CVS dirs
|
|||
|
|
etc.
|
|||
|
|
|
|||
|
|
* src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
|
|||
|
|
Path would fit in more nicely.
|
|||
|
|
|
|||
|
|
* all files that used to use pathstack: uses now Path instead.
|
|||
|
|
This change was a lot easier than expected.
|
|||
|
|
|
|||
|
|
* src/support/path.h: new file
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am (libsupport_a_SOURCES): added path.h
|
|||
|
|
|
|||
|
|
* src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (getline): Default arg was given for
|
|||
|
|
para 3. removed.
|
|||
|
|
|
|||
|
|
* Configure.cmd: removed file
|
|||
|
|
|
|||
|
|
1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.[Ch]: remove the explicit std:: before
|
|||
|
|
streams classes and types, add the proper 'using' statements when
|
|||
|
|
MODERN_STL is defined.
|
|||
|
|
|
|||
|
|
* src/debug.h: move the << operator definition after the inclusion
|
|||
|
|
of DebugStream.h
|
|||
|
|
|
|||
|
|
* src/support/filetools.C: include "LAssert.h", which is needed
|
|||
|
|
later.
|
|||
|
|
|
|||
|
|
* src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
|
|||
|
|
to includes.
|
|||
|
|
|
|||
|
|
* src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
|
|||
|
|
include "debug.h" to define a proper ostream.
|
|||
|
|
|
|||
|
|
1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
|
|||
|
|
|
|||
|
|
* src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
|
|||
|
|
method to the SystemCall class which can kill a process, but it's
|
|||
|
|
not fully implemented yet.
|
|||
|
|
|
|||
|
|
* src/*.C: Changed Systemcalls::Startscript() to startscript()
|
|||
|
|
|
|||
|
|
* src/support/FileInfo.h: Better documentation
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C: Added support for buffer-export html
|
|||
|
|
|
|||
|
|
* src/menus.C: Added Export->As HTML...
|
|||
|
|
|
|||
|
|
* lib/bind/*.bind: Added short-cut for buffer-export html
|
|||
|
|
|
|||
|
|
* src/lyxrc.*: Added support for new \tth_command
|
|||
|
|
|
|||
|
|
* lib/lyxrc.example: Added stuff for new \tth_command
|
|||
|
|
|
|||
|
|
1999-10-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* lib/Makefile.am (IMAGES): removed images/README
|
|||
|
|
(pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
|
|||
|
|
installes in correct place. Check permisions is installed
|
|||
|
|
correctly.
|
|||
|
|
|
|||
|
|
* src/LaTeX.C: some no-op changes moved declaration of some
|
|||
|
|
variables around.
|
|||
|
|
|
|||
|
|
* src/LaTeX.h (LATEX_H): changed include guard name
|
|||
|
|
|
|||
|
|
1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* lib/reLyX/Makefile.am: install noweb2lyx.
|
|||
|
|
|
|||
|
|
* lib/Makefile.am: install configure.
|
|||
|
|
|
|||
|
|
* lib/reLyX/configure.in: declare a config aux dir; set package
|
|||
|
|
name to lyx (not sure what the best solution is); generate noweb2lyx.
|
|||
|
|
|
|||
|
|
* lib/layouts/egs.layout: fix the bibliography layout.
|
|||
|
|
|
|||
|
|
1999-10-08 J<>rgen Vigna <jug@sad.it>
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (FileOpenSearch): Fixed a bug where
|
|||
|
|
when in the PATH was something like /usr/bin;;/bin (note: the ;;)
|
|||
|
|
it returned without continuing to search the path.
|
|||
|
|
|
|||
|
|
1999-10-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/insets/insetquotes.C (Draw): Simplified a gread deal. This
|
|||
|
|
also fixes a bug. It is not allowed to do tricks with std::strings
|
|||
|
|
like: string a("hei"); &a[e]; this will not give what you
|
|||
|
|
think... Any reason for the complexity in this func?
|
|||
|
|
|
|||
|
|
1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
|
|||
|
|
|
|||
|
|
* Updated README and INSTALL a bit, mostly to check that my
|
|||
|
|
CVS rights are correctly set up.
|
|||
|
|
|
|||
|
|
1999-10-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.C (helper): removed bogus Assert. strlen
|
|||
|
|
does not allow '\0' chars but lyxstring and std::string does.
|
|||
|
|
|
|||
|
|
1999-10-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* autogen.sh (AUTOCONF): let the autogen script create the
|
|||
|
|
POTFILES.in file too. POTFILES.in should perhaps now not be
|
|||
|
|
included in the cvs module.
|
|||
|
|
|
|||
|
|
* some more files changed to use C++ includes instead of C ones.
|
|||
|
|
|
|||
|
|
* src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
|
|||
|
|
not assigned.
|
|||
|
|
(Reread): added tostr to nlink. buggy output otherwise.
|
|||
|
|
(Reread): added a string() around szMode when assigning to Buffer,
|
|||
|
|
without this I got a log of garbled info strings.
|
|||
|
|
|
|||
|
|
* acconfig.h: commented out the PTR_AS_INT macros. They should not
|
|||
|
|
be needed.
|
|||
|
|
|
|||
|
|
* I have added several ostream & operator<<(ostream &, some_type)
|
|||
|
|
functions. This has been done to avoid casting and warnings when
|
|||
|
|
outputting enums to lyxerr. This as thus eliminated a lot of
|
|||
|
|
explicit casts and has made the code clearer. Among the enums
|
|||
|
|
affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
|
|||
|
|
mathed enums, some font enum the Debug::type enum.
|
|||
|
|
|
|||
|
|
* src/support/lyxstring.h (clear): missing method. equivalent of
|
|||
|
|
erase(0, npos).
|
|||
|
|
|
|||
|
|
* all files that contained "stderr": rewrote constructs that used
|
|||
|
|
stderr to use lyxerr instead. (except bmtable)
|
|||
|
|
|
|||
|
|
* src/support/DebugStream.h (level): and the passed t with
|
|||
|
|
Debug::ANY to avoid spurious bits set.
|
|||
|
|
|
|||
|
|
* src/debug.h (Debug::type value): made it accept strings of the
|
|||
|
|
type INFO,INIT,KEY.
|
|||
|
|
|
|||
|
|
* configure.in (Check for programs): Added a check for kpsewhich,
|
|||
|
|
the latex generation will use this later to better the dicovery of
|
|||
|
|
all used files.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (create_view): we don't need to cast this to
|
|||
|
|
(void*) that is done automatically.
|
|||
|
|
(WorkAreaButtonPress): removed some dead code.
|
|||
|
|
|
|||
|
|
1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
|
|||
|
|
is not overwritten when translated (David Sua'rez de Lis).
|
|||
|
|
|
|||
|
|
* lib/CREDITS: Added David Sua'rez de Lis
|
|||
|
|
|
|||
|
|
* lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
|
|||
|
|
|
|||
|
|
* src/bufferparams.C (BufferParams): default input encoding is now
|
|||
|
|
"latin1"
|
|||
|
|
|
|||
|
|
* acinclude.m4 (cross_compiling): comment out macro
|
|||
|
|
LYX_GXX_STRENGTH_REDUCE.
|
|||
|
|
|
|||
|
|
* acconfig.h: make sure that const is not defined (to empty) when
|
|||
|
|
we are compiling C++. Remove commented out code using SIZEOF_xx
|
|||
|
|
macros.
|
|||
|
|
|
|||
|
|
* configure.in : move the test for const and inline as late as
|
|||
|
|
possible so that these C tests do not interefere with C++ ones.
|
|||
|
|
Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
|
|||
|
|
has not been proven.
|
|||
|
|
|
|||
|
|
1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
|
|||
|
|
|
|||
|
|
* src/table.C (getDocBookAlign): remove bad default value for
|
|||
|
|
isColumn parameter.
|
|||
|
|
|
|||
|
|
* src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
|
|||
|
|
shortcut.
|
|||
|
|
(ShowFileMenu2): ditto.
|
|||
|
|
|
|||
|
|
* lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
|
|||
|
|
of files to ignore.
|
|||
|
|
|
|||
|
|
1999-10-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* Most files: finished the change from the old error code to use
|
|||
|
|
DebugStream for all lyxerr debugging. Only minor changes remain
|
|||
|
|
(e.g. the setting of debug levels using strings instead of number)
|
|||
|
|
|
|||
|
|
1999-10-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/layout.C (Add): Changed to use compare_no_case instead of
|
|||
|
|
strcasecmp.
|
|||
|
|
|
|||
|
|
* src/FontInfo.C: changed loop variable type too string::size_type.
|
|||
|
|
|
|||
|
|
1999-10-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
|
|||
|
|
set ETAGS_ARGS to --c++
|
|||
|
|
|
|||
|
|
1999-09-30 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/table.C (DocBookEndOfCell): commented out two unused variables
|
|||
|
|
|
|||
|
|
* src/paragraph.C: commented out four unused variables.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
|
|||
|
|
insed a if clause with type string::size_type.
|
|||
|
|
|
|||
|
|
* src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
|
|||
|
|
string::size_type.
|
|||
|
|
|
|||
|
|
* src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
|
|||
|
|
|
|||
|
|
* src/lyx_cb.C (ReplaceWord): use string::size_type as loop
|
|||
|
|
variable, also changed loop to go from 0 to lenght + 1, instead of
|
|||
|
|
-1 to length. This should be correct.
|
|||
|
|
|
|||
|
|
* src/LaTeX.C (scanError): use string::size_type as loop variable
|
|||
|
|
type.
|
|||
|
|
|
|||
|
|
* src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
|
|||
|
|
(l.896) since y_tmp and row was not used anyway.
|
|||
|
|
|
|||
|
|
* src/insets/insetref.C (escape): use string::size_type as loop
|
|||
|
|
variable type.
|
|||
|
|
|
|||
|
|
* src/insets/insetquotes.C (Width): use string::size_type as loop
|
|||
|
|
variable type.
|
|||
|
|
(Draw): use string::size_type as loop variable type.
|
|||
|
|
|
|||
|
|
* src/insets/insetlatexaccent.C (checkContents): use
|
|||
|
|
string::size_type as loop variable type.
|
|||
|
|
|
|||
|
|
* src/insets/insetlabel.C (escape): use string::size_type as loop
|
|||
|
|
variable type.
|
|||
|
|
|
|||
|
|
* src/insets/insetinfo.C: added an extern for current_view.
|
|||
|
|
|
|||
|
|
* src/insets/insetcommand.C (scanCommand): use string::size_type
|
|||
|
|
as loop variable type.
|
|||
|
|
|
|||
|
|
* most files: removed the RCS tags. With them we had to recompile
|
|||
|
|
a lot of files after a simple cvs commit. Also we have never used
|
|||
|
|
them for anything meaningful.
|
|||
|
|
|
|||
|
|
* most files: tags-query-replace NULL 0. As adviced several plases
|
|||
|
|
we now use "0" instead of "NULL" in our code.
|
|||
|
|
|
|||
|
|
* src/support/filetools.C (SpaceLess): use string::size_type as
|
|||
|
|
loop variable type.
|
|||
|
|
|
|||
|
|
1999-09-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/paragraph.C: fixed up some more string stuff.
|
|||
|
|
|
|||
|
|
1999-09-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* src/support/filetools.h: make modestr a std::string.
|
|||
|
|
|
|||
|
|
* src/filetools.C (GetEnv): made ch really const.
|
|||
|
|
|
|||
|
|
* src/lyxlib.h: removed the Maximum and Minimum inline functions,
|
|||
|
|
made code that used these use max/min from <algorithm> instead.
|
|||
|
|
|
|||
|
|
* changed several c library include files to their equivalent c++
|
|||
|
|
library include files. All is not changed yet.
|
|||
|
|
|
|||
|
|
* created a support subdir in src, put lyxstring and lstrings
|
|||
|
|
there + the extra files atexit, fileblock, strerror. Created
|
|||
|
|
Makefile.am. edited configure.in and src/Makefile.am to use this
|
|||
|
|
new subdir. More files moved to support.
|
|||
|
|
|
|||
|
|
* imported som of the functions from repository lyx, filetools
|
|||
|
|
|
|||
|
|
* ran tags-query-replace on LString -> string, corrected the bogus
|
|||
|
|
cases. Tried to make use of lstrings.[hC], debugged a lot. There
|
|||
|
|
is still some errors in there. This is errors where too much or
|
|||
|
|
too litle get deleted from strings (string::erase, string::substr,
|
|||
|
|
string::replace), there can also be some off by one errors, or
|
|||
|
|
just plain wrong use of functions from lstrings. Viewing of quotes
|
|||
|
|
is wrong.
|
|||
|
|
|
|||
|
|
* LyX is now running fairly well with string, but there are
|
|||
|
|
certainly some bugs yet (see above) also string is quite different
|
|||
|
|
from LString among others in that it does not allow null pointers
|
|||
|
|
passed in and will abort if it gets any.
|
|||
|
|
|
|||
|
|
* Added the revtex4 files I forgot when setting up the repository.
|
|||
|
|
|
|||
|
|
1999-09-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* All over: Tried to clean everything up so that only the files
|
|||
|
|
that we really need are included in the cvs repository.
|
|||
|
|
* Switched to use automake.
|
|||
|
|
* Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
|
|||
|
|
* Install has not been checked.
|
|||
|
|
|
|||
|
|
1999-09-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
|
|||
|
|
|
|||
|
|
* po/pt.po: Three errors:
|
|||
|
|
l.533 and l.538 format specification error
|
|||
|
|
l. 402 duplicate entry, I just deleted it.
|