diff --git a/ChangeLog b/ChangeLog index c5137413f6..c0108b9ed6 100644 --- a/ChangeLog +++ b/ChangeLog @@ -1,13357 +1,5 @@ -2001-01-11 Jean-Marc Lasgouttes +2001-01-12 Lars Gullik Bjønnes - * src/buffer.C (getTocList): make the method const, so that - InsetTOC::Ascii compiles. - - * src/insets/insettoc.C (Ascii): return 0 - -2001-01-11 Dekel Tsur - - * src/insets/insettoc.C (Ascii): New method. - - * src/lyx_main.C (init) Set first_start to false when running - without a GUI. - -2000-12-19 Dekel Tsur - - * src/paragraph.C (TeXOnePar,SimpleTeXOnePar) Fix problem with - aligned paragraphs. - -2001-01-11 Lars Gullik Bjønnes - - * src/buffer.C (writeFile): add missing ' ' after lyxformat. - - * src/buffer.h: change format to int, and change name to file_format - - * src/buffer.C: change LYX_FORMAT to int, and bump version number - to 218. - (readLyXformat2): handle it - handle it - (readFile): handle it - (writeFile): handle it - -2001-01-10 Dekel Tsur - - * src/insets/insettext.C (LocalDispatch): Add handling of - LFUN_BREAKPARAGRAPHKEEPLAYOUT. - -2001-01-10 Lars Gullik Bjønnes - - * src/tabular.C (Write): write lowercase identifiers - (Read): read lowercase identifiers - -2001-01-10 Jean-Marc Lasgouttes - - * src/support/lyxstring.C (rfind): better fix (from Dekel). - - * src/tabular.h: add a couple std:: qualifiers. - -2001-01-10 Lars Gullik Bjønnes - - * src/support/lyxstring.C (rfind): also test the first char in the - string and be sure that t >= 0. - -2001-01-09 Lars Gullik Bjønnes - - * src/tabular.C (ReadNew): new method - (Read): changed to call ReadNew or ReadOld depending on the - tabular version found. - - * src/tabular-old.C: new file with the support functions and the - ReadOld method. - (ReadOld): new method - - * src/frontends/xforms/FormDocument.C (CheckChoiceClass): make tc - unsigned to remove a signed/usigned warning. - - * src/tabular.C (tostr): new spesializations, replaces type2string - (Write): use the new spesializations - -2001-01-09 Juergen Vigna - - * src/tabular.C (OldFormatRead): convert the footer/header information - to the right row. - (getTokenValue): chaned this functions again. - (string2type): added a bunch of this functions per type. - (Write): use type2string and write columns first. - (type2string): added a bunch of this functions per type. - (TeXBottomHLine): - (TeXTopHLine): check row parameter. - -2001-01-08 Dekel Tsur - - * src/tabular.C (getTokenValue): Fix crash with malformed files. - (Read): Read the rotate attribute. - -2001-01-09 Jean-Marc Lasgouttes - - * src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix - class switching; do not do anything if class has not been changed. - -2001-01-07 Dekel Tsur - - * lib/build-listerrors: Exit if literate-article doesn't appear in - textclass.lst - -2001-01-09 Jean-Marc Lasgouttes - - * src/combox.h (getline): small fix for sun CC 6.0 - * src/combox.C (input_cb): ditto. - * src/spellchecker.C (sigchldhandler): ditto. - - * src/lyx_main.C (init): do not query for creation of user - directory when running without a GUI. - -2001-01-08 Dekel Tsur - - * src/mathed/formula.C (LocalDispatch): Toggle font properties. - -2001-01-07 Dekel Tsur - - * BufferView2.C (open_new_inset): Added 2nd argument. - (getParentText, getParentLanguage): New methods. - - * src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and - LFUN_INSET_TABULAR for RTL text. - - * src/tabular.C (Latex): Put \R{} around RTL cells. - - * src/text2.C (InsertInset): Change cursor position for highly - editable insets. - - * src/frontends/xforms/FormTabularCreate.C (apply): Create the - tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...) - - * src/insets/insettabular.C (LocalDispatch): When dispatching - LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was - locked, then the insettext of the new cell will be locked. - (moveLeft, moveRight): Fixed for RTL tabulars. - (moveNextCell, movePrevCell): Ditto. - (isRightToLeft): New method. - - * src/insets/insettext.C (LocalDispatch): Fixed handling of - non-dispatched function in the locking inset. - (Edit): If the inset is empty set the language of the current font - to the language to the surronding text (this code was moved from - LocalDispatch to allow the user to change the languaeg before - inserting text). - (moveRight, moveLeft): Fixed for RTL text. - (checkAndActivateInset): Fixed. - - * src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font. - -2001-01-08 Jean-Marc Lasgouttes - - * src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate - the tooltip. - (set): ditto. - - * src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL - around some ispell code. - - * src/lyxcursor.[Ch]: add proper constructor, to avoid tons of - Unitialized Memory Read in purify. - - * lib/examples/nl_splash.lyx: update from Tino Meinen. - -2001-01-04 Dekel Tsur - - * src/frontends/xforms/FormDocument.C (FormDocument::build): - Disable class_->choice_doc_class and language_->choice_language to - allow using the class/language combox with keyboard. - -2001-01-08 Lars Gullik Bjønnes - - * src/support/snprintf.c (va_copy): only define va_copy if undefined - -2001-01-06 Lars Gullik Bjønnes - - * src/lyxvc.C (showLog): give the tempfile a mask - - * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed - branch on !rename - - * src/support/filetools.C (IsDirWriteable): give the tempfile a - mask and unlink the tempfile after use. - -2001-01-04 Juergen Vigna - - * src/insets/insettabular.C (resetPos): an extra scroll, but we - really should redo all this scrolling code! - (TabularFeatures): unlock the_locking_inset before add/del rows/colums. - - * src/text.C (GetVisibleRow): check that y/h values are good otherwise - change them. - - * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION. - (pasteSelection): pay attention to multicolumn cells. - (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc. - -2001-01-03 Jean-Marc Lasgouttes - - * src/mathed/math_panel.C (deco_cb): check the decoration index is - valid. - - * src/frontends/xforms/FormPreferences.C (feedback): apply - formatting to the translated string, not to the original one. - (printWarning): ditto. - - * src/gettext.C (_): translate empty string with empty string. - - * src/frontends/xforms/FormCopyright.C (build): use _() instead of - N_(). - - * NEWS: small update - - * UPGRADING: mention that tabular format has been changed. - -2001-01-03 Juergen Vigna - - * src/insets/insettabular.C (InsetButtonPress): look for button==2 - and do Clipboard Paste! - - * src/insets/insettext.C (SetText): added function. - - * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and - new LFUN_PASTESELECTION. - - * src/insets/insettext.C (draw): don't clear if top_x changes. - - * src/insets/insettabular.C (draw): clear only if the inset didn't - change in the draw routine. - - * src/insets/insettext.C (width): make the width dependant on the - textWidth too. - - * src/text.C (draw): comment out the UpdateInset call. - - * src/screen.C (DrawOneRow): - (DrawFromTo): check for bv->text->status not text->status. - - * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate - dimensions of ascent-descent for the whole row. - - * src/insets/insettext.C (draw): check also for need_update == INIT. - -2001-01-03 Jean-Marc Lasgouttes - - * Makefile.am (EXTRA_DIST): add autogen.sh - -2001-01-03 Miyata Shigeru - - * development/OS2/quick_fix.patch: - * lib/configure.cmd: update OS/2 support files. - -2001-01-02 Juergen Vigna - - * src/insets/insettabular.C (pasteSelection): rewritten correctly. - - * src/tabular.C (TeXTopHLine): - (TeXBottomHLine): fixed Lars new code. - - * src/insets/insettext.C (LocalDispatch): added support for math_greek. - - * src/mathed/math_symbols.C (math_insert_greek): removed current_view - from this function and added a BufferView * parameter. - - * src/mathed/math_symbols.C (math_insert_symbol): ditto - -2000-12-31 Lars Gullik Bjønnes - - * src/version.h: set to pre3 - -2000-12-31 Lars Gullik Bjønnes - - * src/Makefile.am (lyx_SOURCES): added Floating.C - - * src/Floating.h: moved all the inlines to Floating.C - - * src/Floating.C: new file - -2000-12-29 Jean-Marc Lasgouttes - - * src/frontends/xforms/FormPreferences.C (feedback): fix - description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG. - -2000-12-29 Lars Gullik Bjønnes - - * src/support/FileInfo.h: move unistd.h to after sys/types.h and - sys/stat.h. - - * src/support/FileInfo.C: don't include sys/types. and sys/stat.h - - * src/mathed/math_inset.h: move LString.h to be included first - - * src/insets/insetfloat.C: adjust for change in private variable names - - * src/frontends/xforms/xform_helpers.h : don't include config.h - - * src/frontends/xforms/xform_helpers.C: adjust the order of - includes, some whitespace changes. - - * src/trans.C (Load): constify filename and res - - * src/text2.C (SetCounter): call Floating::name() - - * src/screen.C: change to not use owner from WorkArea, but from - text instead. - - * src/lyxfunc.C: adjust because of changes in Intl. - - * src/intl.h: make trans a object instead of pointer, inlucd - trans_mgr.h in this file. - (getTrans): return a reference to TransManager - - * src/intl.C: don't include trans_mgr.h here - modify calls to trans to work on object instead of on pointer - - * src/WorkArea.h: add using for Signal1 - comment out forward decl of BufferView. - add signal scrollCB - remove class variable owner_ and getter method for this. - - * src/WorkArea.C: don't include BufferView.h - (WorkArea): change to not take a BufferView.h, use signals - instead. - (scroll_cb): emit signal - - * src/LaTeXFeatures.C: include Floatlist.h - (getPackages): only load float.sty when needed - (getMacros): prepare for outputting the correct code to preamble. - - * src/Floating.h: make all variables private + rename to var_. - (Floating): default ctor - (Floating): complex ctor to set a complete Floating - (type): getter - (placement): getter - (name): getter - (builtin): getter - - * src/FloatList.C (FloatList): use Floating's constructor - (begin): new method - (end): ditto - (newFloat): call type() - (defaultPlacement): call placement() - (operator): new operator - - * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea - (scrollUp): call pimpl's scrollCB - (scrollDown): ditto - (pasteClipboard): constify clip - - * src/BufferView2.C (insertLyXFile): constify fname, fi and c. - (insertErrors): constify desctext, errortext, msgtxt and errorrow - (open_new_inset): delete some commented code. - - * src/BufferView.[Ch] (enterView): comment out - (leaveView): ditto - (scrollCB): ditto - (workAreaMotionNotify): ditto - (workAreaButtonPress): ditto - (doubleClick): ditto - (tripleClick): ditto - (workAreaButtonRelease): ditto - (workAreaExpose): ditto - - * config/lyxinclude.m4 (cross_compiling): small stuff to be able - to compile with cvs gcc (2.97). - -2000-12-28 Dekel Tsur - - * lib/ui/default.ui: menu structure cleanup. - - * lib/languages: add description of entries. - -2000-12-27 Jean-Marc Lasgouttes - - * src/insets/ExternalTemplate.C (readTemplates): change debug - messages a bit. - (readTemplate): use lyxlex.printError to report read errors. - (readFormat): ditto. - - * src/insets/insetexternal.C (Read): suppress debug message when - not needed. - -2000-12-21 Dekel Tsur - - * src/insets/insetinclude.C (Ascii): New method. Currently - supports only verbatim input. - -2000-12-27 Jean-Marc Lasgouttes - - * lib/bind/fi_menus.bind: update from Pauli Virtanen. - -2000-12-22 Juergen Vigna - - * src/insets/insettabular.C (InsetButtonPress): do nothing if we - have a selection and button == 3. - (UpdateLocal): if what == INIT clear selection if existent! - (InsetButtonPress): don't activate the cell inset on button==3 - (Edit): ditto - (LocalDispatch): move curor up/down if exiting an inset which this - keys. - -2000-12-20 Juergen Vigna - - * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when - calling for the math-panel (do not unlock the math-inset if locked)! - - * src/text.C (GetVisibleRow): fixed drawing of depth lines inside - text-insets (with x-offset). - - * src/tabular.C (TeXCellPreamble): fixed wrong output of special - alignment of multicolumn-cells. - -2000-12-19 Juergen Vigna - - * src/lyxfunc.C (Dispatch): - * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions - for insettext. - -2000-12-19 Lars Gullik Bjønnes - - * src/WorkArea.C (work_area_handler): simplify the key/keysym - handling for XForms 0.89, this might have rendered some cases - unusable. I have at least deadkeys, accent-xxx and KP_x working. - Please report proplems. - - * src/lyxfunc.C (processKeySym): make the self-insert handling - work as it should - -2000-12-18 Baruch Even - - * src/LaTeX.C (deplog): fix spelling errors - * src/text2.C (CutSelection): ditto - * src/lyxfunc.C (Dispatch): ditto - -2000-12-18 Lars Gullik Bjønnes - - * lib/layouts/stdlayouts.inc: only allow align Center for Caption - - * src/mathed/math_inset.C (MathMatrixInset): initialize v_align - and h_align in default init. - adjust calls to MathedRowSt - - * src/mathed/math_iter.C: adjust calls to MathedRowSt - * src/mathed/math_iter.h (getAD): ditto - - * src/mathed/math_defs.h (class MathedRowSt): remove friends, add - methods setBaseline, ascent, descent - (class MathMatrixInset): remove method GetAlign, change h_align - from char* to string - - * src/lyxfunc.C (processKeySym): discover the correct argument if - the action is LFUN_SELFINSERT - -2000-12-18 Dekel Tsur - - * src/mathed/math_cursor.C (Interpret) Suppress a debug message - in normal run. - -2000-12-17 Lars Gullik Bjønnes - - * src/support/copy.C: don't include filetools.h - - * lib/images: revert to old banner, drop the cucumber. - -2000-12-12 Dekel Tsur - - * src/converter.C (Formats::View): Change the current directory to - the directory of the file. - -2000-12-17 Lars Gullik Bjønnes - - * src/kbsequence.C (addkey): also clear sequence and modifiers if - length == 0 - - * src/BufferView2.C (theLockingInset): return 0 if text is 0 - -2000-12-17 Dekel Tsur - - * Many files: Fix RTL support for insettext. - -2000-12-11 John Levon - - * README: add mention of broken ghostscript versions, remove - reference to non-existent BUGS file - -2000-12-13 Angus Leeming - - * src/support/lstrings.C (compare_no_case): small fix. When passed - length, should use it in the size comparison. - -2000-12-11 Jean-Marc Lasgouttes - - * src/insets/insetexternal.C (getScreenLabel): Return a default - value if the template label is empty. - - * src/lyxlookup.C: do not condition on FL_REVISION. - - * forms/sp_form.fd: - * src/sp_form.C: fix the font size of some text entries - - * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator - after TOC when there is no TOC. - - * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main - bind file if it has not been done yet. - (read): remove local bindFile variable. Try to fix the handling of - RC_BIND and RC_BINDFILE. - - * src/lyx_main.C (init): use readBindFileIfNeeded(). - - * lib/languages: Change description of german to "German (new - spelling)". - -2000-12-07 Angus Leeming - - * src/frontends/xforms/FormInset.C (createInset): activate "Ok", - "Apply" buttons if arg is non-zero. - - * src/lyxfunc.C (Dispatch): enable citation to be inserted without - launching the popup if sufficient info is passed to - LFUN_CITATION_CREATE. - -2000-11-23 Dekel Tsur - - * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new - labels (disabled in 1.1.6). - - * src/lyxrc.[Ch]: New variable label_init_length - - * mathed/formula.C (LocalDispatch): Preserve the label when - changing from display math to eqnarray (however, the label - do not appear at the first line, as one might expects, but at the - second line). - (LocalDispatch): When inserting a label to a formula which already - have a label, the old label is used as default value. - Also, if the label is changed, then all references to the label - are changed. - - * src/mathed/math_iter.C (setLabel): Allow to set the label - even if it is empty. This is needed to allow deletion of a label - in an eqnarray. - - * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the - refernces only if the old label appears once in the document. - -2000-12-07 Angus Leeming - - * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert - - - * src/frontends/xforms/FormBase.C: comment out debug.h - - * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse - code in xform_helpers instead. - (d-tor): comment out "delete dialog;" and so prevent a crash on exit. - - * src/frontends/xforms/FormPreferences.C: use AddName() in more places. - Use N_(), rather than _() when creating strings to pass to browseFile() - because browseFile calls gettext() itself now. - - * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and - display the filename correctly. - -2000-12-09 Dekel Tsur - - * src/converter.C (Move): New method. Used to move file or files - from temp dir to the output dir. (this fixes the bug that - exporting linuxdoc/docbook document to html would not move all - html file from temp directory). - - * src/support/filetools.C (DirList): Fixed. - - * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??). - -2000-12-08 Dekel Tsur - - * src/converter.C (Add): Remove $$i when setting latex_command. - - * src/text.C (IsBoundary): Return false when pos = 0. - -2000-12-08 Dekel Tsur - - * lib/kbd/hebrew.kmap: Add Hebrew points (nikud). - -2000-12-07 Angus Leeming - - * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't - need to empty the fields to turn off use of the geometry package! - -2000-12-07 Angus Leeming - - * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a - (Buffer const &), not a (BufferParams const &) and so fix a crash - caused by using current_view before it had been initialised. Not - the best way to do this, but much easier than changing - Inset::Clone(Buffer const &) to Inset::Clone(). - - * src/CutAndPaste.C: - * src/tabular.C: changed call to CopyIntoMinibuffer(). - -2000-12-07 Jean-Marc Lasgouttes - - * lib/ui/default.ui: put TOC at the beginning of the TOC menu. - - * src/lyxfunc.C (getStatus): disable insertion of floats in a - tabular. - -2000-12-06 Angus Leeming - - * src/frontends/xforms/FormPreferences.C (ScreenFonts::build): - changed filter for screen fonts input filter from int to float - - * src/frontends/xforms/input_validators.c: removed. - * src/frontends/xforms/input_validators.C: new file. Can now call C++ - functions from within the filter functions. - - * src/frontends/xforms/input_validators.[Ch] - (fl_unsigned_float_filter): new filter function. - - * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get - confused now! And if you think I'm going to do this in - ./forms/fdfix.sh with its "sed -e" declarations, then think again! - -2000-12-06 Lars Gullik Bjønnes - - * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon - - * src/WorkArea.C (work_area_handler): don't handle button requests - if xbutton.button == 0 - -2000-12-06 Jean-Marc Lasgouttes - - * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode. - It creates a lot of interesting problems. - -2000-12-06 Jean-Marc Lasgouttes - - * src/frontends/xforms/Menubar_pimpl.C (openByName): check that - the menu exists in the current menubar before opening it. - - * src/MenuBackend.C (hasSubmenu): new method. - - * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus - action value by offsetting actions by a large constant (so that - bogs choice result will be less than this constant). - - * lib/bind/fi_menus.bind: more cleanup to menus. - * lib/bind/sciword.bind: ditto. - * lib/bind/xemacs.bind: ditto. - * lib/bind/emacs.bind: ditto. - * lib/bind/pt_menus.bind: ditto. - * lib/bind/hu_menus.bind: ditto. - - * src/gettext.h (locale_init): set locale LC_NUMERIC to "C". - - * INSTALL: update PROBLEMS section. - - * src/lyxlookup.h: remove condition on xforms version, since we - should not include it if not appropriate. - -2000-12-05 John Levon - - * src/LColor.C: "latex text" -> "latex inset" (from - Angus Leeming) - - * src/lyxrc.C: "it's" -> "its" (from Angus Leeming) - - * src/frontends/kde/FormTabularCreate.C: - * src/frontends/kde/citationdlg.C: - * src/frontends/kde/copyrightdlg.C: - * src/frontends/kde/paradlg.C: - * src/frontends/kde/paraextradlg.C: - * src/frontends/kde/parageneraldlg.C: - * src/frontends/kde/printdlg.C: - * src/frontends/kde/refdlg.C: - * src/frontends/kde/tabcreatedlg.C: - * src/frontends/kde/tocdlg.C: - * src/frontends/kde/urldlg.C: add necessary headers - (from Angus Leeming) - - * src/frontends/kde/dlg/emptytable.C: - * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have - default parameters (from Angus Leeming) - - * src/frontends/kde/dlg/moc/.cvsignore: - * src/frontends/kde/dlg/.cvsignore: - * src/frontends/kde/moc/.cvsignore: fix the library name - (from Angus Leeming) - - * src/frontends/kde/paradlg.C: - * src/frontends/kde/parageneraldlg.C: - * src/frontends/kde/dlg/para.dlg: - * src/frontends/kde/dlg/paradlgdata.C: added accelerators - - * src/frontends/kde/dlg/README: clarified qtarch version - - * src/frontends/kde/dlg/Makefile.am: removed the - dlg rules as they created spontaneous rebuilds - (not a good idea as it requires qtarch) - -2000-12-05 Jean-Marc Lasgouttes - - * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the - fixlevel along with xforms version. - - * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when - xforms version is strictly less than 0.89.5. - * src/lyx_gui.C (LyXGUI): ditto. - * src/LyXView.C (show): ditto. - -2000-12-02 Dekel Tsur - - * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse - movement in inset in RTL text. - (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text. - (workAreaButtonRelease): Do not open a float when there is a selection. - - * src/insets/insettext.C (cx): Fixed for insets in RTL text. - - * src/spellchecker.C (RunSpellChecker): Open all floats before - spellchecking. - - * src/text.C (InsertChar): Consider "," as a part of a number - (for LTR numbers in RTL text code). - (IsBoundary): Fixed (and simplified). - (InsertChar): Recalculate cursor boundary. - (Backspace): Ditto. - -2000-12-04 John Levon - - * src/spellchecker.C: fix figures with pspell enabled - - * src/insets/figinset.C: workaround for gs hang xforms bug - -2000-12-05 Jean-Marc Lasgouttes - - * lib/bind/??_menus.bind: comment out the entries corresponding to - real menus. They should be eventually removed, but I'll let the - language maintainers do that. - -2000-12-04 John Levon - - * src/frontends/kde/parageneraldlg.C: - * src/frontends/kde/parageneraldlg.h: don't use - a derived class for SpaceAbove/Below - - * src/frontends/kde/dlg/README: add some info - - * src/frontends/kde/dlg/*: update data files, update - dialog files. - - * src/frontends/kde/dlg/moc/Makefile.am: add - ${FRONTEND_INCLUDES} - -2000-12-04 John Levon - - * configure.in: add new KDE Makefiles - * src/vspace.h: return GlueLength not a normal one - * src/support/lstrings.h: - * src/support/lstrings.C: add isStrUnsignedInt(), - strToUnsignedInt() - - * src/frontends/kde/*: big reorganisation, update - FormParagraph, add FormTabCreate - -2000-12-04 Angus Leeming - - * lib/ui/default.ui: small grammatical change. - - * src/frontends/xforms/xform_macros.h: removed. - - * src/frontends/xforms/FormBase.C: - * src/frontends/xforms/FormPreferences.C: - * src/frontends/xforms/Makefile.am: changes associated with removing - xform_macros.h. Should make Lars' debugging a little easier. - - * src/frontends/xforms/FormPreferences.C: - * src/frontends/xforms/FormPreferences.h: - * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no - longer use X11 color name database. HSV and RGB dials/sliders. - Please let this be the end of this! - -2000-11-30 Dekel Tsur - - * Several files: Allow compilation when the compiler doesn't - support namespaces. - -2000-11-30 Angus Leeming - - * lyx.man: - * src/lyx_main.C (commandLineHelp, easyParse): documented remaining - command line options. - -2000-11-17 Jean-Marc Lasgouttes - - * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use - FL_MENU_BUTTON for items in menu bar. Not sure what difference it - makes, anyway. - -2000-11-29 Angus Leeming - - * src/frontends/xforms/FormRef.C (updateBrowser): - * src/frontends/xforms/forms/form_ref.fd: try clicking on - different insets with the sort key active. Now apply this patch! - -2000-11-29 John Levon - - * src/frontends/xforms/FormPrint.C: set to valid() - when we update from the passed parameters. - -2000-11-29 Angus Leeming - - * src/LColor.C (getFromGUIName): internationalise the comparison. - - * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a - FormPreferences choice. - - * src/frontends/xforms/FormPreferences.C: some additional Color safety. - Should be redundant. - -2000-11-29 John Levon - - * src/lyxrc.C: more detail for the printer program config - dialog. - - * src/LColor.C: ert->latex text. LColor needs a big revamp - but will have to wait till after 1.1.6 - - * src/buffer.C: bring up a dialog if we load a document - with an un-installed text class, rather than just complain - on the console. - -2000-11-29 Angus Leeming - - * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing - the browser form for a combox in a tabbed folder. Bug fix courtesy of - Steve Lamont . - - * src/frontends/xforms/FormDocument.C (build): - * src/frontends/xforms/FormPreferences.C (Language::build): - pass tabfolders to Combox::add() in order to use this work around. - - * src/frontends/xforms/FormCitation.C (connect): remove max size - limitation. - (update): sort list of bibliography keys. - - * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser, - setSize): removed. - No max size limitation. Same popup for new and existing insets. Fixes - bugs reported by Rob Lahaye. - - * src/frontends/xforms/FormCitation.C (c-tor): - * src/frontends/xforms/FormCopyright.C (c-tor): - * src/frontends/xforms/FormError.C (c-tor): - * src/frontends/xforms/FormGraphics.C (c-tor): - * src/frontends/xforms/FormIndex.C (c-tor): - * src/frontends/xforms/FormRef.C (c-tor): - * src/frontends/xforms/FormToc.C (c-tor): - * src/frontends/xforms/FormUrl.C (c-tor): - use correct policy for ButtonController. - - * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more. - - * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr - call a little. - - * src/frontends/xforms/forms/form_citation.fd: some resizing changes. - - * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons. - Some resizing changes. - -2000-11-28 Lars Gullik Bjønnes - - * configure.in: fix typo - - * lib/languages: add ukraninian and change no to no_NO - - * src/lyxfont.[Ch] (setGUISize): comment out setGUISize - - * src/bufferview_funcs.C (FontSize): use setLyXSize - -2000-11-24 Kayvan A. Sylvan - - * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests - to check for systems where mkstemp() is available but not declared - in headers. The new autoconf macro lyx_CHECK_DECL can be used - to check for declarations in headers. - -2000-11-23 Angus Leeming - - * forms/bibforms.fd: tiny fix to get it to run with fdesign. - - * forms/makefile: added bibforms.fd, include_form.fd. - Removed lyx_sendfax.fd. - - * src/LaTeXLog.C (ShowLatexLog): - * src/LyXAction.C (init): - * src/bufferparams.C (readLanguage): altered messages as suggested by - John Levon. - - * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to - Dialogs::redrawGUI. - - * src/credits.C: made fd_form_credits non-static, so that it can be - redrawn should the xforms colors be re-mapped. - * src/spellchecker.C ditto fd_form_spell_options. - - * src/filedlg.[Ch] (redraw): - * src/intl.[Ch] (redraw): - * src/lyxfr0.[Ch] (redraw): - * src/insets/figinset.[Ch] (redraw): - * src/insets/insetexternal.[Ch] (redraw): - new methods, connected to Dialogs::redrawGUI. - - * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function - to be connected to Dialogs::redrawGUI. - - * src/frontends/xforms/FormCitation.C (build): - * src/frontends/xforms/FormCopyright.C (build): - * src/frontends/xforms/FormError.C (build): - * src/frontends/xforms/FormGraphics.C (build): - * src/frontends/xforms/FormIndex.C (build): - * src/frontends/xforms/FormTabularCreate.[Ch] (update): - * src/frontends/xforms/FormToc.C (build): - * src/frontends/xforms/FormUrl.C (build): - use the ButtonController correctly. - - * src/frontends/xforms/FormCopyright.C (build): - * src/frontends/xforms/forms/form_copyright.fd: moved the text out of - the .fd file and into build(). - - * src/frontends/xforms/FormPreferences.C: tiny clean-up. - - * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input(). - - * src/frontends/xforms/forms/form_citation.fd: - * src/frontends/xforms/forms/form_copyright.fd: - * src/frontends/xforms/forms/form_error.fd: - * src/frontends/xforms/forms/form_graphics.fd: - * src/frontends/xforms/forms/form_index.fd: - * src/frontends/xforms/forms/form_toc.fd: - * src/frontends/xforms/forms/form_url.fd: - renamed some of the objects. Named others explicitly for the first time. - Added Restore and Apply buttons where appropriate. - - * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not - used. - -2000-11-22 Lars Gullik Bjønnes - - * src/version.h: try the pre2 again - -2000-11-22 Angus Leeming - - * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI. - - * src/frontends/kde/FormParagraph.C: added using directive. - - * src/frontends/kde/paradlg.C: added config.h and using directive. - - * src/frontends/kde/paradlg.h: added std::qualifier. - - * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD. - -2000-11-22 Lars Gullik Bjønnes - - * configure.in (AC_OUTPUT): don't output src/xtl/Makefile - - * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files - -2000-11-22 Lars Gullik Bjønnes - - * src/version.h: set back to 1.1.6cvs - -2000-11-22 Lars Gullik Bjønnes - - * src/version.h: set to 1.1.6pre2 - -2000-11-20 Marko Vendelin - - * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI - - * src/frontends/gnome/Makefile.am: updated list of XForms object files - -2000-11-21 Angus Leeming - - * src/LColor.C (init): - * src/lyxrc.C (getDescription): changed some comments as suggested by - John Levon. - - * src/frontends/xforms/FormBase.[Ch]: modified to connect and - disconnect the redrawGUI signal in best-practice fashion. - - * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as - long_opts_tab to reflect the change in name of this tabfolder, as - suggested by John Levon. - (connect, disconnect): new methods. Don't do much at present other than - ensuring that we can't resize the dialog. This just makes xforms go - crazy. - (lots of methods in Colors): made void rather than bool. The idea is - to have an isOk() function that keeps track of whether any input is - genuinely invalid and should therefore block Save, Apply. - Easier to manipulate the counters rapidly. - (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's - compiler will like this code. Much cleaner way of doing things. - - * src/frontends/xforms/forms/fdfix.sh: a little speed up fix. - - * src/frontends/xforms/forms/form_preferences.fd: used normal counters - rather than simple counters, following suggestion by John Levon. - - * src/frontends/xforms/forms/form_print.fd: used labelframe rather - than engraved frame + text. - - * src/frontends/xforms/forms/makefile: removed spurious command. - -2000-11-17 Angus Leeming - - * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry - array. - * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib - ReadOnly|NoBuffer. - - * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix. - - * src/frontends/xforms/FormPreferences.C: re-formatted so that I can - see what Lars has changed and what is just white space! - Now used X directly to ascertain the RGB color associated with the - color name. - Replaced the RGB sliders with HSV equivalent. Should be more intuitive - to use. - Added some sort capability. - The X11 color name database input is only displayed if the database - isn't found in the standard place. - Got rid of struct compare_converter; it wasn't used. - Probably some other stuff that I've forgotten. - - * src/frontends/xforms/FormPreferences.h: changed the names of some - methods in the Colors struct. Added a couple of structs to help sort - colors by name and by RGBColor. - - * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc - functions into a new class RWInfo. - - * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts. - The dialog is now almost navigable using the keyboard. Unfortunately, - the cursor has to be inside a browser for it to be activated. There is - no visual feedback for the key shortcuts to the arrow keys (use - Alt-appropriate arrow key, Alt-x). - - * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab - around a lot. - - * src/support/filetools.[Ch]: moved out ReadableFile etc and into - xform_helpers.[Ch]. See above. - -2000-11-17 Lars Gullik Bjønnes - - * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody - - * src/screen.C (setCursorColor): new method. Sets the color of the - cursor. - (ShowManualCursor): call it. - Constify some local variables. - - * src/LColor.[Ch] (LColor): add entry for cursor - * lib/configure(.m4) (word_to_latex_command): add quotes, removes - a warning. - -2000-11-19 Juergen Vigna - - * src/insets/insettabular.C (draw): fixed text border redraw problem. - (calculate_dimensions_of_cells): try to boost up when inserting chars. - -2000-11-15 Rob Lahaye - - * lib/ui/default.ui: OptItem used for Fax entry - -2000-11-17 Matej Cepl - - * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard. - -2000-11-15 John Levon - - * src/vspace.C (nextToken): fix so it can handle length phrases like - "10mm+-20mm", "40inplus16mmminus10cm" etc. - -2000-11-17 Lars Gullik Bjønnes - - * src/frontends/xforms/FormPreferences.C: constify several variables - (BrowserLyX): rewrite to not need the choice variable - (Modify): rewrite to not need the choide variable - (compare_converter): make operator const - - * src/lyxrc.C (output): be a bit nicer og os usage, and try to - correct the writing of \set_color - (getDescription): return a const string - - * src/kbsequence.[Ch] (addkey): remove dead code - - * src/Painter.C (text): remove some commented code - -2000-11-15 Angus Leeming - - * src/ColorHandler.[Ch]: removed some header files from .h file. - Included LColor.h in .C file. - - * src/LColor.[Ch]: made class copyable so that I could create a - system_lcolor instance. - - * src/Painter.h: removed LColor.h. - - * src/lyx_gui.C (create_forms): used AddName. - - * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading - of user preferences/lyxrc file. - - * src/lyxrc.C (output): output changes to lcolor. - - * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct, - NamedColor. - Moved class xformColor to files xform_helpers.[Ch]. These files, - Color.[Ch], could now be moved into src if they would be useful to - other GUIs. - - * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here. - Also moved FormPreferences::browseFile here as it can be used by any - xform dialog with a "Browse" button. FormGraphics is a perfect example. - - * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile, - ReadableFile): changed the FormPreferences methods a little and moved - them here as they'll be useful elsewhere also. - - * src/frontends/xforms/FormPreferences.h: a bit more cleaning up. - Removed some header files and used forward declarations instead. - Better commenting. - Removed some methods as they'll be useful elsewhere (see above). - - * src/frontends/xforms/FormPreferences.C: a bit more cleaning up. - Can also now modify the LyX LColors. However, for reasons that I don't - yet understand, it appears that we can use - LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer - present. The problem appears to lie in ColorHandler, because I can - change the color using LColor.SetColor(). Similarly, when reading in a - preferences file with some set_color instances, I'll get a warning - like: Color sea green is undefined or may not be redefined - Bad lyxrc set_color for sea green - - Once the buffer is loaded, however, I can happily change to this color. - - Finally, it appears that I have to set the color of "inset frame" - explicitly, or it oscillates from "black" to "indian red" with each - successive "Apply". - -2000-11-15 Angus Leeming - - * ANNOUNCE: corrected a spelling mistake. - - * src/tabular.C (OldFormatRead): variable "h" was set but never used. - Removed. - -2000-11-15 Lars Gullik Bjønnes - - * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch. - - * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from - distdir. - - * src/support/lyxfunctional.h: make back_insert_fun_iterator(s) - match the requirements from the standard better. This is required - to work with gnu libstdc++-v3 - - * src/frontends/xforms/FormPreferences.C: add explict pair - arguments to browse calls. include support/lyxmanip.h remvoe - extern fmt. whitespace changes. reorder variables in - FormPreferences.h, to match initalizaton order. - - * several files: constify more local variables. - - * src/buffer.C: remove some commented functions. - - * src/DepTable.C (remove_files_with_extension): temporary - work around for gcc 2.97 - * src/filedlg.C (find): ditto - * src/Variables.C (set): ditto - * src/LyXAction.C (searchActionArg): ditto - (retrieveActionArg): ditto - - * configure.in: check for mktemp too - - * UPGRADING: prepare for 1.1.6 - - * Makefile.am (lgbtags): add backup tags for when etags are - different than usual. - - * ANNOUNCE: prepare for 1.1.6 - - * src/support/tempname.C (make_tempfile): new function, wrapper - around mkstemp and mktemp. Only mkstemp has been tested. - (tempName): call it. - -2000-11-14 Rob Lahaye - - * default.ui: capitalized some menu items to improve shortcuts. - -2000-11-14 Jean-Marc Lasgouttes - - * src/frontends/xforms/FormPreferences.C (ok): use AddName(). - - * src/frontends/xforms/Dialogs.C: add "using" directive. - -2000-11-13 Angus Leeming - - * src/filedlg.C (Select): highlight suggested file in browser, if - it is present. - - * src/frontends/xforms/FormPreferences.[Ch]: re-written so that - each tab folder is encapsulated in its own class. - The Language keymaps are now chosen using a text input and a - browser button, rather than a Combox. - All the browser buttons are now functional, although LyXFileDlg - still needs to be modified to make it straighhtforward to return a - directory if that is what is desired. - - * src/frontends/xforms/forms/form_preferences.fd: use text input - and browse button to input the Language keymaps. Add a few - callbacks for the browse buttons. - -2000-11-14 Lars Gullik Bjønnes - - * src/support/tempname.C (tempName): small changes to make it - safer. remove the '.' before XXXXXX - - * src/support/filetools.C (TmpFileName): remove func - (GetCWD): ditto - - * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp - * src/frontends/xforms/FormUrl.C (FormUrl): ditto - * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto - * src/frontends/xforms/FormTabular.C (FormTabular): ditto - - * src/frontends/xforms/FormInset.h (FormInset): remove default for bp - (FormCommand): ditto - - * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit - call the bp - - * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy - for bp (this fixes a reproducible hard crash) - - * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit - call the bp - - * src/frontends/xforms/FormBase.h: make bp_ private - (FormBaseBI): remove default for bp - (FormBaseBD): ditto - - * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it - is safe enough. - - * src/frontends/xforms/Color.C (RGBColor): made several vars - const, changed initialization of j to allow it to be const - (HSVColor): similar - - * several files: added const to local variables. - - * src/lyx_cb.C: removed several function prototypes and moved them - to lyx_cb.h - (MenuWrite): - (MenuWriteAs): - (UpdateLayoutPreamble): - (MenuLayoutSave): - (MenuInsertLabel): add BufferView as arguemnt - (LayoutsCB): make tmp const - - * src/layout_forms.h: regenerated - - * src/debug.C: add Debug::FILES - (showLevel) (showTags): translate the desc - - * src/debug.h: add FILES as debug target - - * src/bufferlist.C: use current_view as an interim measure becuase - of added arguments to MenuWrite and MenuWriteAs - - * forms/layout_forms.h.patch: make the patch more correct and more appalyable - - * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve - string. - (LYX_PROG_CXX): change 2.97 rules to include the -f.. that - libstdc++ is compiled with. - -2000-11-13 José Abílio Matos - - * lib/layouts/docbook-book.layout - * lib/layouts/docbook.layout - * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now - those paragraphs are expresse as SGML comments . - - * src/LaTeXFeatures.h - * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as - parameter, this allows to express all the include files as relative - paths to the master buffer. The verbatim insert works as the other - include file modes. - - * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname - is a SGML comment. - (MakeLinuxdocFile) (MakeDocBookFile): included files are relative - to master path. - (MakeDocBookFile): top_element is always written. Some clean up, as - sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case. - - * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix. - (DocBook) added close tag to inlinegraphics trick for verbatim. Now - a reference is written instead of the name. - (Validate): use the relative path for the filename. - - * src/insets/insetlabel.C (DocBook): write end tag, for XML - compatibility. - - * src/support/filetools.h - * src/support/filetools.C (IsSGMLFilename): added. - (BasePath): added. - -2000-11-13 Miyata Shigeru - - * development/OS2/quick_fix.patch: - * lib/configure.cmd: - * README.OS2: quick update to the OS/2 port. - -2000-11-13 Jean-Marc Lasgouttes - - * src/converter.C: add "using" directive. - - * src/frontends/xforms/FormPreferences.C: add "using" directive. - (compare_converter): add "int" as return type. - - * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here - too. - -2000-11-11 Angus Leeming - - * src/lyx_gui.C (create_forms): map the xform colours, should a - mapping exist. Ie, call XformColor::read(). - - * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor - and struct HSV as HSVColor. - (XformColor::read, XformColor::write) : new methods that - input/output any changes to the cform GUI colors. - - * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer - included. - - * src/frontends/xforms/FormPreferences.C Lots of little changes - associated with the changed name of the RGB and HSV structs. Can - now save changes to xforms GUI to file. Commented out - FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't - used currently anyway. - -2000-11-11 Dekel Tsur - - * src/converter.C: A lot of changes: - - It is no longer possible to choose between two or more ways to - export to some format (the new code uses only the shortest path). - However, it is still possible to choose between pdflatex/ps2pdf - for creating a PDF file, by defining two PDF formats: pdf & pdf2. - - Added several methods that makes the FormPreferences code simpler. - - Changed the tokens $$FName and $$OutName to $$i and $$o. - - * src/exporter.C (Export): lyxrc.use_pdf is set before - makeLaTeXFile is called. This works but not very nice. - - * src/frontends/xforms/FormPreferences.C: The formats/converters - tabs are now fully functional. - - * src/buffer.C (getTocList): Add numbers to the captions. - - * lib/lyxrc.example: Removed fax section - - * src/support/rename.C (rename): Delete the old file if lyx::copy - is called. - -2000-11-13 Rob Lahaye - - * lib/ui/default.ui: minor polishing. - -2000-11-10 Jean-Marc Lasgouttes - - * src/frontends/xforms/Color.C: include and - headers. - - * lib/Makefile.am (DOCINST): do not install everything in the - documentation directory. - -2000-11-10 John Levon - - * src/bufferlist.C (newFile): set the filename to the constructed - newfileXX.lyx - - * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the - constructed "newfileXX.lyx" name to the dialog - - * src/frontends/DialogBase.h: make update() non-abstract so - KDE doesn't need to implement two update methods for every form - - * src/frontends/kde/Makefile.am: add missing xforms objects - to compile again - - * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog - -2000-11-09 Angus Leeming - - * src/frontends/xforms/Color.[Ch]: new files, defining the color - structs RGB and HSV. May not be the best place for these files. - Perhaps move them into src ? - - * src/frontends/xforms/Makefile.am: added new files. - - * src/frontends/xforms/forms/form_preferences.fd: - * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and - replaced all instances of "colour" with "color"! - - * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab - slightly yet again. - - * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors - tab. Can now alter the colors of the xform's GUI on the fly. With - the aid of a single static Signal (see below), can "Apply" these - changes to all currently open dialogs. (Well, to all of the NEW - dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL - subsequently opened dialogs will, of course, also have the new - color scheme. Cannot yet save (or load) the choices to file, so - they are lost when exiting LyX. - - * src/frontends/Dialogs.h: - * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal. - Used to trigger a redraw of any dialogs connected to it because, - for example, the GUI colours have been re-mapped. - - * src/frontends/xforms/FormBase.[Ch]: - * src/frontends/xforms/FormDocument.[Ch]: - * src/frontends/xforms/FormParagraph.[Ch]: - * src/frontends/xforms/FormPreferences.[Ch]: - * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual - method, to be connected to Dialogs::redrawGUI. Method must be - virtual, because dialogs with tabbed folders need to redraw the - forms of each tab folder. - - * src/LyXView.C (d-tor): - * src/frontends/xforms/FormBase.C (d-tor): connected - Dialogs::redrawGUI signal to redraw(). - - * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD): - removed Assert, because it is identical to that in FormBase. - -2000-11-10 Rob Lahaye - - * lib/ui/default.ui: minor polishing. - -2000-11-10 Juergen Vigna - - * src/insets/insettext.C (resizeLyXText): check !cache[bv] - (deleteLyXText): ditto - - * src/insets/insettabular.C (InsetButtonPress): don't clear the - selection on mouse-button-3. - - * src/insets/insettabular.h: new function clearSelection(), use this - functions inside insettabular.C. - - * src/insets/insettabular.C (TabularFeatures): clear the selection - on remove_row/column. - - * src/insets/inset.C (scroll): fixed some scroll stuff. - - * src/insets/insettabular.C (draw): fixed another minor draw problem. - -2000-11-10 Jean-Marc Lasgouttes - - * lib/CREDITS: add Yves Bastide - -2000-11-03 Yves Bastide - - * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to - check whether C library functions are in the global namespace. - - * configure.in: calls it. - - * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of - #ifndef __GLIBCPP__. - -2000-11-08 Dekel Tsur - - * src/frontends/xforms/FormPreferences.C (updateLanguage): Check - iterators to prevent crash. - -2000-11-08 Angus Leeming - - * src/converter.h (getprettyname, getFromToPrettyname): new methods. - - * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro - shortcut for xforms CB to the preemptive or post-handler function. - - * src/frontends/xforms/forms/form_preferences.fd (form_preferences): - removed the HIDDEN_TIMER as it's no longer used. - Various other small changes. - - * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a - preemptive handler to obtain feedback, rather than the post-handler. - (ColoursLoadBrowser): find "black" and "white" based on RGB values - rather than name. - Formats tab is now complete. Converters tab is nearly so. - -2000-11-09 Juergen Vigna - - * src/insets/insettext.C (~InsetText): - (clear): - (Read): - (SetParagraphData): set cache.second to 0 after deleting it! - (getLyXText): check if cache.second is not 0 if finding it. - -2000-11-08 Jean-Marc Lasgouttes - - * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use - lyxlex to parse the rgb.txt file. - - * src/lyxlex.[Ch]: - * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to - replace the default '#' comment character. - - * src/support/tempname.C: add "using" directive - * src/frontends/ButtonPolicies.C: ditto. - - * src/support/filetools.C (DirList): add an explicit cast to avoid - a compile error (probably not the right fix) - -2000-11-08 Lars Gullik Bjønnes - - * src/support/filetools.C (DirList): implement using system functions - - * src/support/tempname.C: new file - - * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C - - * src/insets/insetexternal.C (InsetExternal): use lyx::tempName - - * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use - lyx::tempName - - * src/frontends/xforms/ButtonController.C: new file - - * src/os2_defines.h: remove getcwd define - - * src/lyxvc.C: include support/lyxlib.h - (showLog): use lyx::tempName - - * src/lyx_cb.C: comment out includes that we don't need - (AutoSave): use lyx::tempName - - * src/filedlg.C: include support/lyxlib.h - (Reread): use lyx::getcwd - - * src/converter.C: include support/filetools.h - (add_options): change to static inline, make tail const - (Add): make old_viewer const - (GetAllFormats): make it a const method, use const_iterator - (enable): make static inline - (SplitFormat): make using_format const - - * src/LaTeX.C (run): use lyx::getcwd - - * configure.in: check for mkstemp as well - -2000-11-07 Angus Leeming - - * src/converter.[Ch] (GetAllCommands): new method. - - * src/support/filetools.[Ch] (DirList): new method. - - * src/frontends/xforms/FormPreferences.C: started (just!) adding - functionality to the converters tab. - The formats tab is now nearly complete. - The kbmap choices in Languages tab now display the contents of - system_lyxdir/kbd/*.kmap in readable form. - - * src/frontends/xforms/FormPreferences.h: made struct RGB private. - Moved some variables into the class. - - * src/frontends/xforms/forms/form_preferences.fd: Revert colour of - inactive tab folder to FL_COL1. Haven't yet worked out how to change - colour of active folder to lighter grey instead. Any takers? - (form_colours): added an "Apply" button. - (form_converters): added a "Flags" input field. - (form_formats): added a "Shortcut" input field. Note that we can't use - names such as "input_shortcut" as this buggers up the sed script stuff. - -2000-11-07 Angus Leeming - - * src/LaTeXLog.C: - * src/LyXSendto.C: - * src/credits.C: - * src/filedlg.C: - * src/intl.C: - * src/lyx_cb.C: - * src/lyx_sendfax_main.C: - * src/lyxfr0.C: - * src/lyxvc.C: - * src/spellchecker.C: - * src/insets/figinset.C: - * src/insets/insetbib.C: - * src/insets/insetexternal.C: - * src/insets/insetinclude.C: - * src/insets/insetinfo.C: - * src/mathed/math_panel.C: - use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so - all "daughter" dialogs now have identical "feel". - -2000-11-07 Angus Leeming - - * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer - used (and was only used in one place prior to this patch. Incorrectly!) - - * src/frontends/xforms/FormDocument.C: changed some instances of - FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more - sense. Also added fl_set_input_return() for class_->input_doc_extra and - for options_->input_float_placement. This fixes a bug reported by - Rob Lahaye. - - * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed - functionality into d-tor. - - * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow - input of numerals also. - - * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in - fl_set_form_atclose(). Can now close dialog from window manager, - fixing a bug reported by Rob Lahaye. - -2000-11-06 Angus Leeming - - * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders - are no longer dark. Haven't yet worked out how to lighten the colour of - the active tabfolder. Any ideas anybody? - Adjusted Colours tab a little. - Added Shortcut field to converters tab. Note that we can't create an - fdesign label like "input_shortcut" as this buggers up the sed-script - stuff. - - * src/frontends/xforms/FormPreferences.[Ch]: - (feedback): fixed crash due to to ob=0. - (LanguagesXXX): the kbmap choices now contain the files - sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually - be replaced by an input with a file browse button, but since the browse - buttons don'y yet work, this'll do for the moment. - (FormatsXXX): think that this is now nearly fully functional. - Some points/questions though: - 1. Does "Apply" remove formats if no longer present? - 2. I think that the browser should list the GUI names rather than the - format names. - 3. Must ensure that we can't delete Formats used by an existing - Converter. - - * src/support/filetools.[Ch] (DirList): new function. Not at all sure - if this is the best way to do this. - -2000-11-07 Jean-Marc Lasgouttes - - * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message. - - * lib/configure.m4 (latex_to_html_command): avoid spaces around = - for variable assignment. - -2000-11-07 Rob Lahaye - - * src/lib/ui/default.ui: added sub/superscripts to menu as - Insert->Special characters and cleaned-up the file a bit - -2000-11-07 Allan Rae - - * src/frontends/xforms/FormPreferences.C (feedback): make sure - ob isn't 0 before using it. See comments in function. - - * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix. - - * src/frontends/xforms/form_*.C: regenerated - -2000-11-07 Lars Gullik Bjønnes - - * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty) - - * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when - compiling with gcc-2.96 - -2000-11-06 Jean-Marc Lasgouttes - - * src/support/lyxstring.C: add a couple "using" directives. - - * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add - a .c_str() here too for good measure. - * src/Spacing.C (set): ditto. - * src/lyxfunc.C (Dispatch): ditto. - - * src/insets/insettabular.C (copySelection): change .str() to - .str().c_str() to fix problems with lyxstring. - * src/support/filetools.C (GetFileContents): ditto. - * src/buffer.C (asciiParagraph): ditto. - * src/paragraph.C (String): ditto. - - * lib/bind/fi_menus.bind: change symbol-insert to math-insert. - * lib/bind/sciword.bind: ditto. - - * src/LyXAction.C (init): remove "symbol-insert" function, which - shared LFUN_INSERT_MATH with "math-insert". - - * lib/configure.m4: == is not a valid operator for command test. - - * src/lyxrc.C: add using directive. - - * src/converter.h: add std:: qualifier. - -2000-11-03 Dekel Tsur - - * src/converter.[Ch] and other files: Change the Format class to a - real class, and create two instances: formats and system_format. - - * src/lyxrc.C (output): Output the difference between formats and - system_formats. - - * src/frontends/xforms/FormPreferences.C (input): Simplify. - (buildFormats): Insert formats into browser. - (inputFormats): Made the browser and add button functional. - (applyFormats): Update formats from format_vec. - - * src/converter.C: Changed all (*it). to it-> - (Format::dummy): New method. - (Format::importer): New format flag. - (Formats::GetAllFormats): New method. - (Formats::Add): Delete format from the map if prettyname is empty. - (Converter::Convert): Print an error message if moving the file fails. - (Converter::GetReachableTo): New method - - * src/MenuBackend.[Ch]: Add support for importformats tag. - - * src/support/rename.C (rename): Call to lyx::copy if ::rename fails. - - * lib/configure.m4: Add word->tex and ps->fax converters. - - * lib/ui/default.ui: Use ImportFormats on file->import menu. - Return fax to file menu. - - * NEWS: Updated. - -2000-11-04 Lars Gullik Bjønnes - - * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB - (operator!): ditto - - * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify - the use of FileInfo - - * src/lyxfunc.C (processKeyEvent): removed - - * src/bufferlist.C (emergencyWrite): removed the out commented - emergency write code. - - * src/Makefile.am (lyx_main.o): add dep for commandtags.h - - * src/LyXView.[Ch]: remove the outcommented raw_callback code - - * many files: change formatting to be a bit more uniform for - if,while,for,switch statements, remove some parantesis not needed. - - -2000-11-03 John Levon - - * config/kde.m4: make config more robust when KDEDIR is set - -2000-11-03 Jean-Marc Lasgouttes - - * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has - not returned a pixmap for "math-insert". - - * src/LyXAction.C (init): sort the entries a bit. - -2000-11-03 Juergen Vigna - - * src/insets/insettabular.h: added fixed number to update codes so - that update is only in one direction. - - * src/insets/insettabular.C (UpdateLocal): modified a bit don't think - it matters. - - * src/insets/insettext.C (InsetButtonPress): set the_locking_inset - before call to edit because of redraw. - - * src/insets/insetcollapsable.C (draw): fixed clearing too much. - -2000-11-03 Jean-Marc Lasgouttes - - * lib/ui/default.ui: Populate "edit_float" menu - - * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE. - - * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name - "floats-operate". The name is ugly (and the func also), but this - is just a band-aid until we switch to new insets. - -2000-11-03 Rob Lahaye - - * lib/ui/default.ui: update again the menu layout (fix some - shortcuts). - -2000-11-03 Jean-Marc Lasgouttes - - * src/MenuBackend.h (fulllabel): new method. - - * src/MenuBackend.C (checkShortcuts): new method. Checks whether - the menu shortcuts of a menu are unique and whether they - correspond to a letter of the label. - (expand): call checkShortcuts when debugging. - -2000-11-03 Andre Poenitz - - * src/insets/insettext.C (InsetButtonPress): shut off warning. - -2000-11-02 Lior Silberman - - * lib/examples/*.lyx : '\language default' => '\language english' - - * lib/examples/it_splash.lyx : except where it should be italian - - * lib/templates/*.lyx : the same - - * doc/*.lyx* : the same - -2000-11-03 Jean-Marc Lasgouttes - - * lib/bind/menus.bind: remove the Layout menu entries, which I - somehow forgot earlier. - -2000-11-03 Rob Lahaye - - * lib/ui/old-default.ui: keep the old one here for reference (to - be deleted later). - - * lib/ui/default.ui: update the menu layout - -2000-11-02 Angus Leeming - - * src/frontends/xforms/FormCitation.C: made use of ButtonController. - Can now Apply to different insets without closing the dialog. - - * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs. - Can't actually DO anything with them yet, but I'd like a little - feedback. - - * src/frontends/xforms/input_validators.[ch] - (fl_lowercase_filter): new. - -2000-10-27 Dekel Tsur - - * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead - of MATH_CODE. This fixes a bug with math-macros in RTL text. - - * src/text.C (PrepareToPrint): Show math-macros block aligned. - -2000-11-02 Juergen Vigna - - * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE - on char insertion as it has already be updated by bv->updateInset(). - - * src/insets/insettabular.C (UpdateInsetInInset): update the inset - if an inset inside was updated. - - * lib/configure.cmd: commented out fax-search code - -2000-11-01 Yves Bastide - - * src/tabular.C (OldFormatRead): set tabular language to the - document's one. - -2000-11-02 Jean-Marc Lasgouttes - - * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of - class names with non-letter characters (from Yves Bastide). - - * lib/ui/default.ui: change Item to OptItem in import menu. - Comment out fax stuff. - - * lib/configure.m4: comment out fax-related stuff. - -2000-10-31 Angus Leeming - - * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for - useful xforms helper functions. At present contains only formatted(). - Input a string and it returns it with line breaks so that in fits - inside the label. - - * src/frontends/xforms/Makefile.am: add new files. - - * src/lyxrc.[Ch] (getDescription): new name for getFeedback. - * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected - punctuation. - - * src/frontends/xforms/FormPreferences.[Ch]: - * src/frontends/xforms/forms/form_preferences.fd: No new functionality - but lots of little clean ups. Removed enum State. Make use of - formatted(). Constify lots of methods. Perhaps best of all: removed - requirement for that horrible reinterpret_cast from pointer to long in - feedbackPost(). - -2000-11-02 Lars Gullik Bjønnes - - * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION, - conditionalize build on xforms < 0.89 - - * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89 - - * src/lyxfunc.C (getStatus): commenout LFUN_FAX - - * src/LyXAction.C (init): comment out fax - - * src/lyxrc.h: comment out the fax enums - comment out the fax variables - - * src/commandtags.h: comment out LFUN_FAX - - * src/lyxrc.C: disable fax variables. - (read): disable parsing of fax variables - (output): disable writing of fax variables - (getFeedback): now description for fax variables - - * src/lyxfunc.C: comment out MenuFax - (Dispatch): disable LFUN_FAX - - * src/lyx_cb.C (MenuFax): comment out - - * src/WorkArea.C: add - (work_area_handler): better key handling, should be ok now. - for accented chars + etc - - * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C - lyx_sendfax.h and lyx_sendfax_man.C - - * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89 - (show): don't call InitLyXLookup when using xforms 0.89 - -2000-11-01 Lars Gullik Bjønnes - - * src/trans.C (AddDeadkey): better fix, the other one could crash... - - * src/support/filetools.C (GetFileContents): close to dummy change - -2000-10-31 Lars Gullik Bjønnes - - * src/trans.C (AddDeadkey): workaround stupid compilers. - -2000-10-31 Jean-Marc Lasgouttes - - * src/frontends/xforms/FormDocument.C (class_update): fix setting - of two-sided document. - -2000-10-31 Juergen Vigna - - * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines. - - * src/insets/insettabular.C (ActivateCellInset): passed the wrong - xposition to the Edit call. - -2000-10-31 Lars Gullik Bjønnes - - * src/trans.C (AddDeadkey): cast explicitly to char. - -2000-10-30 Lars Gullik Bjønnes - - * src/tabular.C (AsciiBottomHLine): simplify? - (AsciiTopHLine): simplify? - (print_n_chars): simplify - (DocBook): remove most of the << endl; we should flush the stream - as seldom as possible. - (Latex): ditto - (TeXBottomHLine): ditto - (TeXTopHLine): ditto - (Write): formatting - (write_attribute): try a templified version. - (set_row_column_number_info): lesson scope of variables - - * src/support/lstrings.h (tostr): new specialization of tostr - - * src/trans.C (AddDeadkey): slightly cleaner fix. - -2000-10-28 Dekel Tsur - - * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by - '%%' in Toc menu labels. - (add_toc2): ditto - - * src/insets/insetlatexaccent.C (draw): Correct rendering when - font_norm is iso10646-1. - - * src/font.C (ascent): Fixed for 16bit fonts - (descent,lbearing,rbearing): ditto - -2000-10-30 Angus Leeming - - * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file. - (getFeedback): new static method. - - * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs. - Now use combox rather than choice to display languages. - Feedback is now output using a new timer callback mechanism, identical - to that in Toolbar_pimpl. Individual messages obtained from lyxrc. - -2000-10-30 Jean-Marc Lasgouttes - - * src/minibuffer.C: fix for older compilers - -2000-10-30 Juergen Vigna - - * src/insets/insettext.C (InsertInset): fixed this as the cursor - has to be Left of the inset otherwise LyXText won't find it! - - * src/BufferView2.C (open_new_inset): delete the inset if it can - not be inserted. - -2000-10-30 Rob Lahaye - - * lyx.man: fix typo. - -2000-10-29 Marko Vendelin - * src/frontends/gnome/FormCitation.C - * src/frontends/gnome/FormCitation.h - * src/frontends/gnome/FormCopyright.C - * src/frontends/gnome/FormCopyright.h - * src/frontends/gnome/FormError.C - * src/frontends/gnome/FormError.h - * src/frontends/gnome/FormIndex.C - * src/frontends/gnome/FormIndex.h - * src/frontends/gnome/FormPrint.C - * src/frontends/gnome/FormPrint.h - * src/frontends/gnome/FormRef.C - * src/frontends/gnome/FormRef.h - * src/frontends/gnome/FormToc.C - * src/frontends/gnome/FormToc.h - * src/frontends/gnome/FormUrl.C - * src/frontends/gnome/FormUrl.h - * src/frontends/gnome/Menubar_pimpl.C - * src/frontends/gnome/mainapp.C - * src/frontends/gnome/mainapp.h - * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and - changing update() to updateSlot() where appropriate - -2000-10-27 Angus Leeming - - * src/frontends/xforms/FormPreferences.[Ch]: - * src/frontends/xforms/forms/form_preferences.fd: added a Languagues - tab. - -2000-10-28 Juergen Vigna - - * src/insets/insettabular.C (draw): fixed drawing bug. - - * src/insets/insettext.C (clear): - (Read): - (SetParagraphData): clearing the TEXT buffers when deleting the - paragraphs used by it. - - * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem. - - * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array. - -2000-10-27 Juergen Vigna - - * src/tabular.C (~LyXTabular): removed not needed anymore. - - * src/tabular.h: changed rowofcell and columnofcell to vector - (from Andre). - -2000-10-27 Angus Leeming - - * src/frontends/Dialogs.h: remove hideTabular signal as it is no - longer used. - - * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min - size. - - * src/frontends/xforms/FormPreferences.[Ch]: - * src/frontends/xforms/forms/form_preferences.fd: lots and lots! - Reorganised as modules based on tabs. Much easier to follow the - flow and to add new tabs. Added warning and feedback messages. - Added new tabs. - -2000-10-27 Jean-Marc Lasgouttes - - * src/tabular.h (DocBook): add std:: qualifier. - -2000-10-26 José Abílio Matos - - * src/buffer.h (SimpleDocBookOnePar): becomes public and const. - * src/buffer.C (SimpleDocBookOnePar): this method goes const. - - * insettabular.h - * insettabular.C (DocBook): uses the tabular methods to export - docbook - - * src/insets/insettext.h - * src/insets/insettext.C (DocBook): Implemented export for docbooc. - -2000-10-26 Lars Gullik Bjønnes - - * src/frontends/ButtonPolicies.h (operator<<): reinsert for State - and SMInput - - * src/lyxfunc.C (MenuNew): lessen the scope of fname - moved misplaced AllowInput two lines up. - - * src/buffer.C (readFile): compare float with float, not with int - -2000-10-26 Jean-Marc Lasgouttes - - * src/minibuffer.C: add "using SigC::slot" statement. - -2000-10-25 Angus Leeming - - * src/frontends/xforms/forms/README: updated section about make. - - * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts. - Tidied some forms up, made two of form_tabular's tabs more - self-consistent, fixed Jean-Marc's size problem in form_preferences, - fixed translation problem with "Column". - -2000-10-25 Lars Gullik Bjønnes - - * src/minibuffer.h: use Timeout instead of the xforms timer - object. - (setTimer) rewrite for the Timeout, change to unsigned arg - (set): change to unsigned timer arg - (TimerCB): remove - - * src/minibuffer.C (TimerCB): removed func - (C_MiniBuffer_TimerCB): removed func - (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB - (peek_event): use a switch statement - (add): don't use fl_add_timer. - (Set): rewrite to use the Timeout - (Init): ditto - - * src/Timeout.[Ch] (setType): return a Timeout & - (setTimeout): ditto, change to unsigned arg for timeout - -2000-10-25 Dekel Tsur - - * src/mathed/formula.C (mathed_string_width): Use string instead - of a constant size char array. - -2000-10-25 Lars Gullik Bjønnes - - * src/frontends/ButtonPolicies.h: remove the LOstream and remove - the two recently added operator<< for SMInput and State. - - * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast - SMI_TOTAL to int. - (OkCancelPolicy): ditto - (OkCancelReadOnlyPolicy): ditto - (NoRepeatedApplyReadOnlyPolicy): ditto - (OkApplyCancelReadOnlyPolicy): ditto - (OkApplyCancelPolicy): ditto - (NoRepeatedApplyPolicy): ditto - -2000-10-25 Jean-Marc Lasgouttes - - * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and - add the usual std:: qualifiers. - -2000-10-25 Juergen Vigna - - * src/screen.C (ShowManualCursor): fixed another uint -> int problem. - -2000-10-25 Lars Gullik Bjønnes - - * src/support/filetools.C (MakeRelPath): change some types to - string::size_type - - * src/frontends/ButtonPolicies.h (operator<<): new operator for - ButtonPolicy::SMInput and ButtonPolicy::State. - - * src/FontLoader.C (reset): small cleanup - (unload): small cleanup - - * src/FontInfo.C (getFontname): initialize error to 10000.0 - -2000-10-24 Angus Leeming - - * src/frontends/xforms/FormPreferences.[Ch]: - * src/frontends/xforms/forms/form_preferences.fd: added spell checker, - TeX encoding and default paper size sections. - -2000-10-24 Lars Gullik Bjønnes - - * src/frontends/xforms/FormTabularCreate.C: add missing #pragma - implementation - - * src/frontends/xforms/FormError.C (disconnect): use erase() to - make the message_ empty. - (FormError): don't initialize message_ in initializer list. - -2000-10-24 Angus Leeming - - * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot. - -2000-10-24 Jean-Marc Lasgouttes - - * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi) - -2000-10-24 John Levon - - * src/frontends/kde/*data.[Ch]: _("") is not - allowed - -2000-10-24 Angus Leeming - - * src/buffer.C: removed redundant using directive. - - * src/frontends/DialogBase.h: revert to original definition of - update(). - - * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular - stuff into two classes, one for each dialog, requires a new - element in the dialogs vector, FormTabularCreate. - - * src/frontends/xforms/FormXXX.[Ch] (update): revert to original - definition. - - * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new - method. Continues Allan's idea, but means that derived classes - don't need to worry about "update or hide?". - - * src/frontends/xforms/FormError.C (showInset): add connection - again ;-) - - * src/frontends/xforms/FormTabular.[Ch]: split into two classes, - one for each dialog. FormTabular now contains main tabular dialog - only. - - * src/frontends/xforms/FormTabularCreate.[Ch]: - * src/frontends/xforms/forms/form_tabular_create.fd: the create - dialog. - - * src/frontends/xforms/FormGraphics.[Ch]: - * src/frontends/xforms/forms/form_graphics.fd - * src/frontends/xforms/FormTabular.[Ch]: - * src/frontends/xforms/forms/form_tabular.fd: made daughter - classes of FormInset. - - * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create - class names properly. Eg, form_my_new_dialog -> FormMyNewDialog. - - * src/frontends/xforms/Makefile.am: - * src/frontends/xforms/forms/makefile: added new files. - - * src/insets/insettabular.[Ch]: removed (Dialogs *) member - variable. added Signal0 hide signal, in keeping with other GUI-I - insets. - - * src/support/lstrings.h: removed redundant std:: qualifier as - it's already declared in Lsstream.h. - -2000-10-23 Jean-Marc Lasgouttes - - * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to - open a new display. - (runqueue): ditto. - -2000-10-24 Lars Gullik Bjønnes - - * src/tabular.C (Ascii): minimize scope of cell. - - * src/BufferView2.C (nextWord): return string() instead of 0; - -2000-10-23 Jean-Marc Lasgouttes - - * src/converter.h: add a std:: qualifier - -2000-10-21 Dekel Tsur - - * src/importer.[Ch]: New files. Used for importing files into LyX. - - * src/lyxfunc.C (doImport): Use the new Importer class. - - * src/converter.h: Add shortcut member to the Format class. - Used for holding the menu shortcut. - - * src/converter.C and other files: Made a distinction between - format name and format extension. New formats can be defined using - the \format lyxrc tag. - Added two new converter flags: latex and disable. - -2000-10-20 Jean-Marc Lasgouttes - - * src/support/lyxlib.h: unify namespace/struct implementation. - Remove extra declarations. - - * src/support/chdir.C (chdir): remove version taking char const * - argument. - * src/support/rename.C: ditto. - * src/support/lyxsum.C: ditto. - -2000-10-19 Angus Leeming - - * src/frontends/xforms/FormBase.[Ch]: - * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter: - read the xforms manual to discover that fl_set_form_minsize()/maxsize() - work only for the next call to fl_show_form(). The correct place to set - them, therefore is in connect() immediately BEFORE fl_show_form(). Now - done. FormBase also stores minw_, minh_ itself. All dialogs derived - from FormBase have the minimum size set; no more stupid crashes with - tabbed folders etc. - -2000-10-20 Jean-Marc Lasgouttes - - * lib/ui/default.ui: fix shortcut for Insert->Include File. - -2000-10-19 Jean-Marc Lasgouttes - - * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch - - * src/support/lyxlib.h: changed second argument of mkdir to - unsigned long int (unsigned int would probably have been enough, - but...). Removed header. - * src/support/mkdir.C (mkdir): ditto. - - * NEWS: update. - -2000-10-19 Juergen Vigna - - * src/lyxfunc.C (MenuNew): small fix (form John) - - * src/screen.C (Update): removed unneeded code. - - * src/tabular.C (Ascii): refixed int != uint bug! - - * src/support/lyxlib.h: added sys/types.h include for now permits - compiling, but I don't like this! - -2000-10-18 Juergen Vigna - - * src/text2.C (ClearSelection): if we clear the selection we need - more refresh so set the status apropriately - - * src/insets/insettext.C (draw): hopefully finally fixed draw - problems! - -2000-10-12 Juergen Vigna - - * src/insets/insettext.C (draw): another small fix and make a block - so that variables are localized. - -2000-10-18 Angus Leeming - - * src/support/lstrings.C (lowercase, uppercase): - use explicit casts to remove compiler warnings. - - * src/support/LRegex.C (Impl): - * src/support/StrPool.C (add): - * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath) - (AddPath, MakeDisplayPath): - * src/support/lstrings.C (prefixIs, subst): - use correct type to remove compiler warnings. - - * src/support/lstrings.[Ch] (countChar): returns string::size_type. - - * src/support/lyxlib.h: - * src/support/mkdir.C (mkdir): change parameter to mode_t for - portability and to remove compiler warning with DEC cxx. - - * src/support/FileInfo.[Ch] (flagRWX): ditto. - -2000-10-18 Jean-Marc Lasgouttes - - * src/minibuffer.C (peek_event): retun 1 when there has been a - mouseclick in the minibuffer. - - * NEWS: updated. - -2000-10-17 John Levon - - * src/frontends/xforms/FormParagraph.C: more space above/below - fixes - -2000-10-17 Dekel Tsur - - * src/lyxfunc.C (Dispatch): Call to showState() after insertion of - a char only if real_current_font was changed. - -2000-10-17 Jean-Marc Lasgouttes - - * NEWS: update somewhat for 1.1.6 - - * lib/ui/default.ui: clean up. - -2000-10-17 Angus Leeming - - * lib/CREDITS: clean up - -2000-10-16 Angus Leeming - - * src/combox.[Ch] (select): changed argument back to int - * src/combox.C (peek_event): removed num_bytes as it is declared but - never referenced. - - * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply): - modified calls to Combox::select() to remove warnings about type - conversion. - - * src/insets/insetbutton.C (width): explicit cast to remove warning - about type conversion. - - * src/insets/insetcite.C (getScreenLabel): use string::size_type not - size_t. - - * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and - sel_pos_end, refering to cursor position are changed to - LyXParagraph::size_type. - - * src/insets/insettext.h (cpos): returns LyXParagraph::size_type, - consistent with LyXCursor::pos(). - (inset_pos): changed to LyXParagraph::size_type for same reason. - - * src/insets/insettext.C (resizeLyXText): changed some temporary - variables refing to cursor position to LyXParagraph::size_type. - -2000-10-16 John Levon - - * src/frontends/kde/: The Great Renaming, - add FormParagraph - -2000-10-17 Jean-Marc Lasgouttes - - * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix. - -2000-10-16 Jean-Marc Lasgouttes - - * src/mathed/math_macro.C (MathMacroTemplate): initialize args to - 0 when there are no arguments. - -2000-10-16 Angus Leeming - - * src/insets/insetbib.C: re-introduce current_view as a temporary fix - to segfaults when pressing Ok in InsetBibtex dialog. - -2000-10-16 Angus Leeming - - * forms/layout_forms.fd: - * src/layout_forms.C (create_form_form_character): small change to use - labelframe rather than engraved frame + text - - * src/lyx_gui.C (create_forms): initialise choice_language with some - arbitrary value to prevent segfault when dialog is shown. - -2000-10-16 Baruch Even - - * src/converter.C (runLaTeX, scanLog): Added a warning when there - is no resulting file. This pertains only to LaTeX output. - -2000-10-14 Dekel Tsur - - * src/text.C (Backspace): Make sure that the row of the cursor is - rebreaked. - - * src/lyxfunc.C (Dispatch): Call to showState() after insertion of - a char. - - * src/lyx_gui.C (init): Prevent a crash when only one font from - menu/popup fonts is not found. - - * lib/lyxrc.example: Add an example for binding a key for language - switching. - -2000-10-15 Dekel Tsur - - * src/converter.C (GetReachable): Changed the returned type to - vector - (IsReachable): New method - - * src/MenuBackend.C (expand): Handle formats that appear more - than once - -2000-10-16 Jean-Marc Lasgouttes - - * src/frontends/support/Makefile.am - (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and - not in SOURCES. - - * lib/CREDITS: add Garst Reese. - - * src/support/snprintf.h: add extern "C" {} around the definitions. - - * src/cheaders/cstdarg: new header file, taken from GNU libstdc++. - -2000-10-13 Angus Leeming - - * src/combox.[Ch]: - * src/frontends/xforms/FormDocument.C: - * src/frontends/xforms/Menubar_pimpl.C: small changes so that they - compile without "conversion to integral type of smaller size" - warnings. - -2000-10-13 Dekel Tsur - - * src/text.C (GetColumnNearX): Fixed disabled code. - -2000-10-13 Lars Gullik Bjønnes - - * configure.in (CPPFLAGS): add snprintf and vsnprintf to - AC_CHECK_FUNCS - - * src/support/snprintf.[ch]: new files - -2000-10-13 John Levon - - * src/frontends/kde/formprintdialog.C: add - file browser for selecting postscript output - - * src/frontends/kde/formprintdialogdata.C: - * src/frontends/kde/formprintdialogdata.h: re-generate - correctly - -2000-10-13 John Levon - - * src/frontends/gnome/Makefile.am: - * src/frontends/kde/Makefile.am: FormCommand.C - disappeared from xforms - - * src/frontends/kde/FormCitation.C: - * src/frontends/kde/FormIndex.C: read-only - correctness - -2000-10-13 Jean-Marc Lasgouttes - - * src/support/lyxfunctional.h (void_class_fun_t): fix name of - constructor. - - * src/bufferlist.C: add using directive. - -2000-10-13 Lars Gullik Bjønnes - - * src/support/lyxfunctional.h: version of class_fun for void - returns added, const versions of back_inseter_fun and compare_fun - added. - -2000-10-13 Angus Leeming - - * src/frontends/xforms/FormInset.C (showInset): fix typo. - -2000-10-13 Jean-Marc Lasgouttes - - * ChangeLog: cleanup. - - * lib/CREDITS: update to add all the contributors we've forgotten. - I have obviously missed some, so tell me whether there were - errors. - -2000-10-13 Marko Vendelin - - * src/frontends/gnome/FormCitation.C - * src/frontends/gnome/FormCitation.h - * src/frontends/gnome/FormError.C - * src/frontends/gnome/FormIndex.C - * src/frontends/gnome/FormRef.C - * src/frontends/gnome/FormRef.h - * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal - - * src/frontends/gnome/FormCitation.C - * src/frontends/gnome/FormCopyright.C - * src/frontends/gnome/FormError.C - * src/frontends/gnome/FormIndex.C - * src/frontends/gnome/FormRef.C - * src/frontends/gnome/FormToc.C - * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where - appropriate. - - * src/frontends/gnome/Menubar_pimpl.C - * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to - fill the menus. - -2000-10-11 Baruch Even - - * src/minibuffer.h: - * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand - to convey its real action. - - * src/minibuffer.C (peek_event): Added action when mouse clicks to - clear the minibuffer and prepare to enter a command. - - * src/mathed/formula.C (LocalDispatch): Changed to conform with - the rename from ExecCommand to PrepareForCommand. - * src/lyxfunc.C (Dispatch): ditto. - -2000-10-11 Baruch Even - - * src/buffer.C (writeFile): Added test for errors on writing, this - catches all errors and not only file system full errors as intended. - -2000-10-13 Dekel Tsur - - * src/lyx_gui.C (create_forms): better fix for crash with - translated interface. - -2000-10-12 John Levon - - * src/frontends/kde/Makefile.am: - * src/frontends/kde/FormCopyright.C: - * src/frontends/kde/formcopyrightdialog.C: - * src/frontends/kde/formcopyrightdialog.h: - * src/frontends/kde/formcopyrightdialogdata.C: - * src/frontends/kde/formcopyrightdialogdata.h: - * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: - * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert - copyright to use qtarch - -2000-10-12 Dekel Tsur - - * src/encoding.C (read): Fixed bug that caused an error message at - the end of the file. - - * po/Makefile.in.in: Fixed rule for ext_l10n.h - - * lib/lyxrc.example: Fixed hebrew example. - -2000-10-13 Allan Rae - - * src/frontends/xforms/FormPreferences.C (input): reworking the - checking - (build, update, apply): New inputs in various tabfolders - - * src/frontends/xforms/FormToc.C: use new button policy. - * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for - dialogs that either can't use any existing policy or where it just - doesn't care. - - * src/frontends/xforms/FormTabular.h: removed copyright notice that - said it was mine. - - * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs): - added a bool parameter which is ignored. - - * src/buffer.C (setReadonly): - * src/BufferView_pimpl.C (buffer): - * src/frontends/kde/FormCopyright.h (update): - * src/frontends/kde/FormCitation.[Ch] (update): - * src/frontends/kde/FormIndex.[Ch] (update): - * src/frontends/kde/FormPrint.[Ch] (update): - * src/frontends/kde/FormRef.[Ch] (update): - * src/frontends/kde/FormToc.[Ch] (update): - * src/frontends/kde/FormUrl.[Ch] (update): - * src/frontends/gnome/FormCopyright.h (update): - * src/frontends/gnome/FormCitation.[Ch] (update): - * src/frontends/gnome/FormError.[Ch] (update): - * src/frontends/gnome/FormIndex.[Ch] (update): - * src/frontends/gnome/FormPrint.[Ch] (update): - * src/frontends/gnome/FormRef.h (update): - * src/frontends/gnome/FormToc.[Ch] (update): - * src/frontends/gnome/FormUrl.[Ch] (update): - * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes - to updateBufferDependent and DialogBase - - * src/frontends/xforms/FormCitation.[hC]: - * src/frontends/xforms/FormDocument.[hC]: also removed restore() - * src/frontends/xforms/FormError.[Ch]: - * src/frontends/xforms/FormGraphics.[Ch]: - * src/frontends/xforms/FormIndex.[Ch]: - * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s - and fixed readOnly handling. - * src/frontends/xforms/FormPrint.[Ch]: - * src/frontends/xforms/FormRef.[Ch]: - * src/frontends/xforms/FormTabular.[Ch]: - * src/frontends/xforms/FormToc.[Ch]: - * src/frontends/xforms/FormUrl.[Ch]: - * src/frontends/xforms/FormInset.[Ch]: - * src/frontends/xforms/FormBase.[hC]: modifications to use the new - form of updateBufferDependent. - - * src/frontends/xforms/FormBase.C (hide): only call disconnect() - if form()->visible just in case someone does stuff to the form in a - derived class. - - * src/frontends/DialogBase.h (enum): removed enum since we can now use - the buttoncontroller for everything the enum used to be used for. - (update) It would seem we need to force all dialogs to use a bool - parameter or have two update functions. I chose to go with one. - I did try removing update() from here and FormBase and defining the - appropriate update signatures in FormBaseB[DI] but then ran into the - problem of the update() call in FormBase::show(). Whatever I did - to get around that would require another function and that just - got more confusing. Hence the decision to make everyone have an - update(bool). An alternative might have been to override show() in - FormBaseB[DI] and that would allow the different and appropriate - update signatures. - - * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool. - true == buffer change occurred. I decided against using a default - template parameter since not all compilers support that at present. - -2000-10-11 Angus Leeming - - * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss - army knife" by removing functionality. - (clearStore): removed. All such housekeeping on hide()ing the dialog - is to be carried out by overloaded disconnect() methods. - (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but - superceded by Baruch's neat test (FormGraphics) to update an existing - dialog if a new signal is recieved rather than block all new signals - until it is closed. - (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant - only to Inset dialogs. - (FormBaseBI, FormBaseBD): new classes derived from FormBase for - "Buffer Independent" and "Buffer Dependent" dialogs respectively. - - * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch] - - * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined - as a base class to all inset dialogs. Used solely to connect/disconnect - the Inset::hide signal and to define what action to take on receipt of - a UpdateBufferDependent signal. - (FormCommand): now derived from FormInset. - - * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as - disconnect(). - - * src/frontends/xforms/FormCopyright.[Ch]: - * src/frontends/xforms/FormPreferences.[Ch]: - now derived from FormBaseBI. - - * src/frontends/xforms/FormDocument.[Ch]: - * src/frontends/xforms/FormParagraph.[Ch]: - * src/frontends/xforms/FormPrint.[Ch]: - now derived from FormBaseBD. - - * src/frontends/xforms/FormError.[Ch]: now derived from FormInset. - - * src/frontends/xforms/FormCitation.[Ch]: - * src/frontends/xforms/FormError.[Ch]: - * src/frontends/xforms/FormRef.[Ch]: - * src/frontends/xforms/FormToc.[Ch]: - (clearStore): reworked as disconnect(). - - * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding - FormInset.[Ch]. - -2000-10-12 Jean-Marc Lasgouttes - - * src/converter.C (runLaTeX): constify buffer argument - (scanLog): ditto. - - * src/frontends/support/Makefile.am (INCLUDES): fix. - - * src/buffer.h: add std:: qualifier - * src/insets/figinset.C (addpidwait): ditto - * src/MenuBackend.C: ditto - * src/buffer.C: ditto - * src/bufferlist.C: ditto - * src/layout.C: ditto - * src/lyxfunc.C: ditto - -2000-10-11 Jean-Marc Lasgouttes - - * src/lyxtext.h (bidi_level): change return type to - LyXParagraph::size_type. - - * src/lyxparagraph.h: change size_type to - TextContainer::difference_type. This should really be - TextContainer::size_type, but we need currently to support signed - values. - -2000-10-11 Marko Vendelin - * src/frontends/gnome/FormError.h - * src/frontends/gnome/FormRef.C - * src/frontends/gnome/FormRef.h - * src/frontends/gnome/FormError.C - * src/frontends/gnome/Makefile.am - * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported - to Gnome frontend. Both dialogs use "action" area. - -2000-10-12 Baruch Even - - * src/graphics/GraphicsCacheItem_pimpl.C: - * src/graphics/Renderer.C: - * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts. - It now compiles. - -2000-10-12 Juergen Vigna - - * src/insets/insettext.C (draw): fixed drawing bug (specifically - visible when selecting). - - * development/Code_rules/Rules: fixed some typos. - -2000-10-09 Baruch Even - - * src/filedlg.C (GroupCache::find): de-inlined the function, makes - compiling on egcs 1.1.2 possible. - - * src/filedlg.C (comp_direntry::operator() ): ditto. - -2000-08-31 Baruch Even - - * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the - Buffer parameter. - - * src/frontends/xforms/FormGraphics.C: Changed the dialog to be - transient it now only gets freed when the object is destructed. - -2000-08-24 Baruch Even - - * src/frontends/FormGraphics.h: - * src/frontends/FormGraphics.C: Changed to use ButtonController and - ButtonPolicies. - -2000-08-20 Baruch Even - - * src/insets/insetgraphics.C: - (draw): Added messages to the drawn rectangle to report status. - (updateInset): Disabled the use of the inline graphics, - (draw): ditto. - -2000-08-17 Baruch Even - - * src/frontends/support: Directory added for the support of GUII LyX. - - * src/frontends/support/LyXImage.h: - * src/frontends/support/LyXImage.C: Base class for GUII holding of - images. - - * src/frontends/support/LyXImage_X.h: - * src/frontends/support/LyXImage_X.C: Implementation of the Xlib - version of LyXImage, this uses the Xlib Pixmap. - - * src/PainterBase.h: - * src/PainterBase.C: - * src/Painter.h: - * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII - replacement to Pixmap. - - * src/insets/insetgraphics.h: - * src/insets/insetgraphics.C: - * src/graphics/GraphicsCacheItem.h: - * src/graphics/GraphicsCacheItem.C: - * src/graphics/GraphicsCacheItem_pimpl.h: - * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage - instead of Pixmap. - - * src/graphics/GraphicsCacheItem.h: - * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create - another copy of the object. - - * src/insets/insetgraphics.C (Clone): Changed to create a second copy - of cacheHandle, this fixed a bug that sent LyX crashing. - - * src/graphics/XPM_Renderer.h: - * src/graphics/XPM_Renderer.C: - * src/graphics/EPS_Renderer.h: - * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF. - -2000-10-12 Lars Gullik Bjønnes - - * src/lyxfunc.C (processKeySym): only handle the - lockinginset/inset stuff if we have a buffer and text loaded... - - * lib/Makefile.am (EXTRA_DIST): add encodings and languages - -2000-10-12 Lars Gullik Bjønnes - - * src/support/lyxfunctional.h: add operator= that takes a reference - - * src/lyxserver.C (mkfifo): make first arg const - - * src/layout.h: renamed name(...) to setName(...) to work around - bugs in egcs. - - * src/buffer.C (setFileName): had to change name of function to - work around bugs in egcs. (renamed from fileName) - -2000-10-11 Lars Gullik Bjønnes - - * src/support/translator.h: move helper template classes to - lyxfunctional.h, include "support/lyxfunctional.h" - - * src/support/lyxmanip.h: add delaration of fmt - - * src/support/lyxfunctional.h: new file - (class_fun_t): new template class - (class_fun): helper template function - (back_insert_fun_iterator): new template class - (back_inserter_fun): helper template function - (compare_memfun_t): new template class - (compare_memfun): helper template function - (equal_1st_in_pair): moved here from translator - (equal_2nd_in_pair): moved here from translator - - * src/support/fmt.C: new file - (fmt): new func, can be used for a printf substitute when still - using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl; - - * src/support/StrPool.C: add some comments - - * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and - lyxfunctional.h - - * src/insets/figinset.C (addpidwait): use std::copy with - ostream_iterator to fill the pidwaitlist - - * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay - - * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove - c_str() - - * src/frontends/xforms/Menubar_pimpl.C: make several file scope - variables static - - * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi - - * src/frontends/xforms/FormDocument.C (build): remove c_str() - (class_update): ditto - (BulletPanel): ditto - (CheckChoiceClass): move initialization of tc and tct - - * src/tabular.C: remove current_view - (OldFormatRead): similar to right below [istream::ignore] - - * src/lyxlex_pimpl.C (next): add code for faster skipping of - chars, unfortunately this is buggy on gcc 2.95.2, so currently - unused [istream::ignore] - - * src/lyxfunc.C: include "support/lyxfunctional.h" - (getInsetByCode): use std::find_if and compare_memfun - - * src/lyxfont.C (stateText): remove c_str() - - * src/lyx_main.C (setDebuggingLevel): make static - (commandLineHelp): make static - - * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get - Screen* together with fl_get_display() and fl_screen - - * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen* - togheter with fl_get_display() and fl_screen - (create_forms): remove c_str() - - * src/layout.C: include "support/lyxfunctional.h" - (hasLayout): use std::find_if and compare_memfun - (GetLayout): use std::find_if and comapre_memfun - (delete_layout): use std::remove_if and compare_memfun - (NumberOfClass): use std:.find_if and compare_memfun - - * src/gettext.h: change for the new functions - - * src/gettext.C: new file, make _(char const * str) and _(string - const & str) real functions. - - * src/font.C (width): rewrite slightly to avoid one extra variable - - * src/debug.C: initialize Debug::ANY here - - * src/commandtags.h: update number comments - - * src/combox.h (get): make const func - (empty): make const - (getline): make const - - * src/combox.C (input_cb): handle case where fl_get_input can - return NULL - - * src/bufferlist.C: add , "support/lyxmanip.h", - "support/lyxfunctional.h", remove current_view variable. - (resize): use std::for_each with std::mem_fun - (getFileNames): use std::copy with back_inserter_fun - (getBuffer): change arg type to unsigned int - (emergencyWriteAll): call emergencyWrite with std::for_each and - class_fun. - (emergencyWrite): new method, the for loop in emergencyWriteAll - has been unrolled. - (exists): use std::find_if with compare_memfun - (getBuffer): use std::find_if and compare_memfun - - * src/buffer.h: add typedefs for iterator_category, value_type - difference_type, pointer and reference for inset_iterator - add postfix ++ for inset_iterator - make inset_iterator::getPos() const - - * src/buffer.C: added support/lyxmanip.h - (readFile): use lyxerr << fmt instead of printf - (makeLaTeXFile): use std::copy to write out encodings - - * src/Painter.C (text): rewrite slightly to avoid extra font variable - - * src/MenuBackend.C (read): remove c_str(), as well as strdup and - free and the char * temp. - (hasMenu): use std::find_if and compare_memfun - (getMenu): ditto - - * src/Makefile.am (lyx_SOURCES): added gettext.C - - * src/LyXAction.C (retrieveActionArg): clear the arg, use - string::insert small change to avoid temporary - - * src/LColor.C (getGUIName): remove c_str() - - * several files: change all occurrences of fl_display to - fl_get_display() - - * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so - that -pedantic is not used for gcc 2.97 (cvs gcc) - - * boost/Makefile.am: begin slowly to prepare for a real boost lib - -2000-10-11 Allan Rae - - * src/frontends/xforms/FormPreferences.C (input): template path must be - a readable directory. It doesn't need to be writeable. - (build, delete, update, apply): New inputs in the various tabfolders - - * src/frontends/xforms/forms/form_preferences.fd: - * src/frontends/xforms/FormPreferences.h: New tabfolder and added - several new entries to existing folders. Shuffled some existing stuff - around. - - * src/frontends/xforms/forms/form_print.fd: - * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated. - Should probably rework PrinterParams as well. Note that the switch to - collated is effectively the same as !unsorted so changing PrinterParams - will require a lot of fiddly changes to reverse the existing logic. - - * src/lyx_cb.C (TimerCB): cleaned up Angus's patch. - -2000-10-10 Angus Leeming - - * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist. - -2000-10-10 Allan Rae - - * src/lyxrc.[Ch]: - * src/lyxfunc.C (Dispatch): - * src/lyx_gui.C: - * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a - member of LyXRC - - * src/lyxrc.C (output): Only write the differences between system lyxrc - and the users settings. - - * src/lyx_main.C: - * src/lyxrc.[Ch]: commented out noncopyable so I can keep a - system_lyxrc. - I'll rewrite this later, after 1.1.6 probably, to keep a single - LyXRC but two instances of a LyXRCStruct. - -2000-10-10 Jean-Marc Lasgouttes - - * lib/Makefile.am (pkgdata_DATA): add encoding and languages - - * src/tabular.h: add a few std:: qualifiers. - - * src/encoding.C: add using directive. - * src/language.C: ditto. - - * src/insets/insetquotes.C (Validate): use languages->lang() - instead of only language. - -2000-10-07 Dekel Tsur - - * lib/languages: New file. - - * lib/encodings: New file. - - * src/language.C (Languages): New class. - (read): New method. Reads the languages from the 'languages' file. - - * src/encoding.C (Encodings): New class. - (read): New method. Reads the encodings from the 'encodings' file. - - * src/lyx_main.C (init): Call to LyXSetStyle() after languages - initialization. - - * src/bufferparams.h and a lot of files: Deleted the member language, - and renamed language_info to language - - * src/buffer.C (makeLaTeXFile): Use babel() instead of lang() - * src/lyxfont.C (latexWriteStartChanges): ditto. - * src/paragraph.C (validate,TeXOnePar): ditto. - - * src/lyxfont.C (update): Restored deleted code. - - * src/frontends/xforms/FormDocument.C (build): Made the combox taller - -2000-10-10 Angus Leeming - - * src/BufferView_pimpl.C (buffer): cleaned up a little. - - * src/insets/figinset.[Ch]: - * src/insets/insetinclude.[Ch]: - * src/insets/insetinclude.[Ch]: - * src/insets/insetparent.[Ch]: - * src/insets/insetref.[Ch]: - * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &. - - * src/insets/*.[Ch]: - * src/mathed/formula.[Ch]: - * src/mathed/formulamacro.C (Clone): passed Buffer const &. - - * src/buffer.C (parseSingleLyXformat2Token, readInset): - * src/lyx_cb.C (FigureApplyCB): - * src/lyxfunc.C (getStatus, Dispatch): - * src/frontends/xforms/FormTabular.C: use modified c-tors to some - insets. - - * src/lyxfunc.C (Dispatch): string "ref" not used. Removed. - - * src/converter.[Ch] (Formats::View): - * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter. - - * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed - *current_view->buffer(). This will change later, but this patch is way - big enough already! - -2000-10-09 Juergen Vigna - - * src/text.C (GetRow): small fix. - - * src/BufferView_pimpl.C (cursorPrevious): - (cursorNext): added LyXText parameter to function. - - * src/insets/insettabular.C (LocalDispatch): activate cell inset on - keypress depending on cursor position. - -2000-10-06 Juergen Vigna - - * src/insets/insettabular.C (Ascii): finally call right ascii-function. - (copySelection): redone this function and also copy ascii representa- - tion to clipboard. - - * src/tabular.C (Ascii): - (AsciiPrintCell): - (AsciiBottomHLine): - (AsciiTopHLine): - (print_n_chars): new functions to realize the ascii export of tabulars. - -2000-10-05 Juergen Vigna - - * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix - if we don't have a buffer. - -2000-10-10 Allan Rae - - * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem - with closing dialog. It seems that nested tabfolders require hiding - of inner tabfolders before hiding the dialog itself. Actually all I - did was hide the active outer folder. - - * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent - unless there really is a buffer. hideBufferDependent is called - instead. - - * po/Makefile.in.in (POTFILES.in): one little tweak to ensure - POTFILES.in stays in $(srcdir). - -2000-10-09 Dekel Tsur - - * lib/lyxrc.example: Few changes. - -2000-10-05 Angus Leeming - - * src/BufferView_pimpl.C (buffer): only need one the - updateBufferDependent signal to be emitted once! Moved to the end of - the method to allow bv_->text to be updated first. - - * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_ - and hSignal_ with Dialogs * and BufferDependency variables. - New Buffer * parent_, initialised when the dialog is launched. Used to - check whether to update() or hide() dialog in the new, private - updateOrHide() method that is connected to the updateBufferDependent - signal. Daughter classes dictate what to do using the - ChangedBufferAction enum, passed to the c-tor. - - * src/frontends/xforms/FormCitation.C: - * src/frontends/xforms/FormCommand.C: - * src/frontends/xforms/FormCopyright.C: - * src/frontends/xforms/FormDocument.C: - * src/frontends/xforms/FormError.C: - * src/frontends/xforms/FormIndex.C: - * src/frontends/xforms/FormPreferences.C: - * src/frontends/xforms/FormPrint.C: - * src/frontends/xforms/FormRef.C: - * src/frontends/xforms/FormToc.C: - * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase - c-tor. - - * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a - ChangedBufferAction enum. - - * src/frontends/xforms/FormParagraph.[Ch] - * src/frontends/xforms/forms/form_paragraph.fd: now derived from - FormBase. - -2000-10-06 Jean-Marc Lasgouttes - - * lib/bind/cua.bind: fix a bit. - * lib/bind/emacs.bind: ditto. - - * lib/bind/menus.bind: remove real menu entries from there. - - * src/spellchecker.C: make sure we only include strings.h when - _AIX is defined. - -2000-10-05 Dekel Tsur - - * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New - function. It enlarges the maximum number of pup when needed. - (add_toc2): Open a new menu if maximum number of items per menu has - reached. - -2000-10-05 John Levon - - * src/frontends/kde/FormPrint.C: fix error reporting - - * src/frontends/xforms/FormDocument.C: fix compiler - warnings - - * lib/.cvsignore: add Literate.nw - -2000-10-05 Dekel Tsur - - * buffer.C - * bufferview_funcs.[Ch] - * lyxfont.[Ch] - * text.C - * text2.C: Add support for numbers in RTL text. - -2000-10-06 Allan Rae - - * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed - to be gettext.m4 friendly again. ext_l10n.h is now - generated into $top_srcdir instead of $top_builddir - so that lyx.pot will be built correctly -- without - duplicate parsing of ext_l10n.h. - -2000-10-04 John Levon - - * src/frontends/kde/FormCitation.C: make the dialog - behave more sensibly - -2000-10-03 John Levon - - * config/kde.m4: fix consecutive ./configure runs, - look for qtarch, fix library order - - * src/frontends/kde/Makefile.am: tidy up, - add Print dialog, add .dlg dependencies - - * src/frontends/kde/FormPrint.C: - * src/frontends/kde/FormPrint.h: - * src/frontends/kde/formprintdialog.C: - * src/frontends/kde/formprintdialog.h: - * src/frontends/kde/formprintdialogdata.C: - * src/frontends/kde/formprintdialogdata.h: - * src/frontends/kde/dlg/formprintdialog.dlg: add - print dialog - - * src/frontends/kde/dlg/README: Added explanatory readme - - * src/frontends/kde/dlg/checkinitorder.pl: small perl - script to double-check qtarch's output - - * src/frontends/kde/formindexdialog.C: - * src/frontends/kde/formindexdialogdata.C: - * src/frontends/kde/formindexdialogdata.h: - * src/frontends/kde/dlg/formindexdialog.dlg: update - for qtarch, minor fixes - -2000-10-05 Allan Rae - - * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent - dialogs when switching buffers update them instead. It's up to each - dialog to decide if it should still be visible or not. - update() should return a bool to control visiblity within show(). - Or perhaps better to set a member variable and use that to control - visibility. - - * lib/build-listerrors: create an empty "listerrors" file just to stop - make trying to regenerate it all the time if you don't have noweb - installed. - - * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-* - - * po/Makefile.in.in (ext_l10n.h): added a rule to build - $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/ - is built before src/ and ext_l10n.h isn't actually needed to build lyx. - (POTFILES.in): added a rule to build POTFILES.in. It is also now safe - to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/. - - * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make. - -2000-10-04 Angus Leeming - - * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when - deleting buffer. Closes all buffer-dependent dialogs. - - * src/frontends/xforms/FormBase.[Ch] (input): modified to pass - FL_OBJECT * also. - * src/frontends/xforms/FormCitation.[Ch]: - * src/frontends/xforms/FormPreferences.[Ch]: - * src/frontends/xforms/FormPrint.[Ch]: - * src/frontends/xforms/FormRef.[Ch]: - * src/frontends/xforms/FormUrl.[Ch]: ditto - - * src/frontends/xforms/FormDocument.[Ch]: - * src/frontends/xforms/forms/form_document.C.patch: - * src/frontends/xforms/forms/form_document.fd: all input callbacks now - pass through a single input() function. - -2000-10-04 John Levon - - * lib/build-listerrors: return status as OK - -2000-10-04 Dekel Tsur - - * lib/lyxrc.example: Updated to new export code - -2000-10-04 Jean-Marc Lasgouttes - - * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to - LexAlpha. - - * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR - character. - - * lib/layouts/amsart.layout: include lyxmacros.inc, so that - LyX-Code is defined. - * lib/layouts/amsbook.layout: ditto. - - * boost/Makefile.am: fix typo. - - * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use - Menu::expand. - (add_lastfiles): removed. - (add_documents): removed. - (add_formats): removed. - - * src/frontends/Menubar.C: remove useless "using" directive. - - * src/MenuBackend.h: add a new MenuItem constructor. - - * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the - xforms frontend. - -2000-10-04 Allan Rae - - * lib/Makefile.am (listerrors): - * lib/build-listerrors: make $builddir != $srcdir compiles work again. - I haven't got notangle installed so Kayvan please test. The output - should end up in $builddir. This also allows people who don't have - noweb installed to complete the make process without error. - - * src/frontends/xforms/FormCommand.[Ch] (showInset): - * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found - by JMarc's picky compiler. - -2000-10-03 Lars Gullik Bjønnes - - - * src/insets/insettabular.C (setPos): change for loop to not use - sequencing operator. Please check this Jürgen. - - * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c" - instead of 'c' - * src/insets/insetcite.C (getScreenLabel): ditto - * src/support/filetools.C (QuoteName): ditto - (ChangeExtension): ditto - - * src/BufferView_pimpl.C (scrollCB): make heigt int - - * src/BufferView2.C (insertInset): comment out unused arg - - * boost/Makefile.am (EXTRADIST): new variable - -2000-10-03 Dekel Tsur - - * src/exporter.C (IsExportable): Fixed - - * lib/configure.m4: Small fix - -2000-10-03 Dekel Tsur - - * src/insets/insetbutton.C (width): Changed to work with no GUI. - * src/insets/insetbib.C (bibitemWidest): ditto. - * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto. - -2000-10-03 Juergen Vigna - - * src/BufferView2.C (theLockingInset): removed const because of - Agnus's compile problems. - - * src/insets/insettext.C (LocalDispatch): set the language of the - surronding paragraph on inserting the first character. - - * various files: changed use of BufferView::the_locking_inset. - - * src/BufferView2.C (theLockingInset): - (theLockingInset): new functions. - - * src/BufferView.h: removed the_locking_inset. - - * src/lyxtext.h: added the_locking_inset - - * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int. - - * src/insets/lyxinset.h: added bool to ShowInsetCursor definition. - -2000-10-02 Angus Leeming - - * src/mathed/formula.C (IsMacro): declared but not referenced; removed. - * src/mathed/math_cursor.C (IsAlpha): ditto. - * src/mathed/math_inset.C (strnew): ditto. - * src/mathed/math_iter.C: SizeFont declared but not referenced;removed. - (IMetrics): cxp set but never used; removed. - * src/insets/figinset.C (InitFigures): removed redundant for loop, now - that the variable in question has been removed also! - - - * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by - using the Buffer * passed to Latex(), using the BufferView * passed to - bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys() - - * src/insets/insetinclude.C: use the Buffer * passed to Latex(), - Linuxdoc() and DocBook() rather than the stored Buffer * master. - - * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor - * src/buffer.C (readInset): used new InsetBibtex c-tor - * (getBibkeyList): used new InsetBibtex::getKeys - -2000-10-01 Dekel Tsur - - * lib/configure.m4 - * lib/build-listerrors - * src/converter.C - * src/exporter.C: Add literate programming support to the export code - - * src/buffer.C - * src/lyx_cb.C: Remove old literate code. - - * src/lyxrc.[Ch]: Remove many obsolete (due to new export code) - variables. - - * src/lyxfunc.C (getStatus): Use Exporter::IsExportable - * src/converter.C (View, Convert): Use QuoteName. - - * src/insets/figinset.C (Preview): Use Formats::View. - - * lib/configure.m4: Add sgml->dvi converter to lyxrc.default - -2000-10-02 Jean-Marc Lasgouttes - - * src/lyxfunc.C (Dispatch): move declaration of text variable at - the top of the function, because compaq cxx complains that the - "goto exit_with_message" when the function is disabled bypasses - its initialization. - (MenuNew): try a better fix for the generation of new file names. - This time, I used AddName() instead of AddPath(), hoping Juergen - will be happier :) - -2000-10-03 Allan Rae - - * src/frontends/xforms/forms/form_preferences.fd: - * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using - nested tabfolders has begun. The old "Miscellaneous" was renamed as - "Look and Feel"->"General" but will need to be split up further into - general output and general input tabs. Current plan is for four outer - tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI - stuff; "Inputs" for input and import configuration; "Outputs" for - output and export configuration; and one more whatever is left over - called "General". The leftovers at present look like being which - viewers to use, spellchecker, language support and might be better - named "Support". I've put "Paths" in "Inputs" for the moment as this - seems reasonable for now at least. - One problem remains: X error kills LyX when you close Preferences. - -2000-10-02 Angus Leeming - - * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const. - qualifier from form() - * src/frontends/xforms/FormCitation.[Ch]: - * src/frontends/xforms/FormCopyright.[Ch]: - * src/frontends/xforms/FormDocument.[Ch]: - * src/frontends/xforms/FormError.[Ch]: - * src/frontends/xforms/FormIndex.[Ch]: - * src/frontends/xforms/FormPreferences.[Ch]: - * src/frontends/xforms/FormPrint.[Ch]: - * src/frontends/xforms/FormRef.[Ch]: - * src/frontends/xforms/FormToc.[Ch]: - * src/frontends/xforms/FormUrl.[Ch]: ditto. - - * src/frontends/xforms/FormCitation.[Ch]: - * src/frontends/xforms/FormIndex.[Ch]: - * src/frontends/xforms/FormRef.[Ch]: - * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent - with Allan's naming policy - - * src/frontends/xforms/FormCitation.C: some static casts to remove - compiler warnings. - -2000-10-02 Juergen Vigna - - * src/insets/insettabular.C (LocalDispatch): fixed selection code, - now you can type or do stuff inside the table-cell also when in dummy - position, fixed visible cursor. - - * src/insets/insettext.C (Edit): fixing cursor-view position. - - * src/lyxfunc.C (Dispatch): use * text variable so that it can - be used for equal functions in lyxfunc and insettext. - - * src/text.C (GetVisibleRow): fixed a small clear_area bug. - -2000-10-02 John Levon - - * src/frontends/gnome/FormCitation.h: - * src/frontends/gnome/FormCopyright.h: - * src/frontends/gnome/FormIndex.h: - * src/frontends/gnome/FormPrint.h: - * src/frontends/gnome/FormToc.h: - * src/frontends/gnome/FormUrl.h: - * src/frontends/kde/FormCitation.h: - * src/frontends/kde/FormCopyright.h: - * src/frontends/kde/FormIndex.h: - * src/frontends/kde/FormRef.h: - * src/frontends/kde/FormToc.h: - * src/frontends/kde/FormUrl.h: fix remaining users of - support/utility.hpp - -2000-10-02 Jean-Marc Lasgouttes - - * src/buffer.C (linuxDocHandleFootnote): remove const modifier - from depth argument. - (DocBookHandleCaption): ditto. - (DocBookHandleFootnote): ditto. - (SimpleDocBookOnePar): ditto. - - * src/frontends/xforms/FormDocument.h (form): remove extra - FormDocument:: qualifier. - - * sigc++/macros/basic_signal.h.m4: remove erroneous virtual - destructor. - * sigc++/handle.h: ditto. - - * src/lyx_gui_misc.C: add "using" directive. - - * src/cheaders/cstddef: new file, needed by the boost library (for - compaq cxx). - -2000-10-02 Juergen Vigna - - * src/insets/insettext.C (SetFont): better support. - - * src/insets/insettabular.C (draw): fixed drawing of single cell. - - * src/screen.C (DrawOneRow): some uint refixes! - -2000-10-02 Allan Rae - - * boost/.cvsignore: ignore Makefile as well - - * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for - LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:. - - * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh. - Left this one out by accident. - - * src/frontends/xforms/FormBase.h (restore): default to calling - update() since that will restore the original/currently-applied values. - Any input() triggered error messages will require the derived classes - to redefine restore(). - - * src/frontends/xforms/FormDocument.C: initialize a few variables to - avoid a segfault. combo_doc_class is the main concern. - -2000-10-01 Kayvan A. Sylvan - - * Simplify build-listerrors in view of GUI-less export ability! - -2000-10-01 Dekel Tsur - - * src/lyx_main.C (easyParse): Disable gui when exporting - - * src/insets/figinset.C: - * src/LaTeX.C - * src/converter.C - * src/lyx_gui_misc.C - * src/tabular.C: Changes to allow no-gui. - -2000-10-02 Lars Gullik Bjønnes - - * src/support/utility.hpp: removed file - * src/support/block.h: removed file - - * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h - and utility.hpp - - * src/mathed/formula.C: add support/lyxlib.h - * src/mathed/formulamacro.C: ditto - - * src/bufferparams.h: use boost/array.hpp instead of support/block.h - * src/lyxparagraph.h: ditto - - * src/Makefile.am (BOOST_INCLUDES): the boost include dir - * src/frontends/Makefile.am (INCLUDES): ditto - * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto - * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto - * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto - * src/graphics/Makefile.am (BOOST_INCLUDES): ditto - * src/insets/Makefile.am (BOOST_INCLUDES): ditto - * src/mathed/Makefile.am (BOOST_INCLUDES): ditto - - * src/BufferView.h: use boost/utility.hpp - * src/LColor.h: ditto - * src/LaTeX.h: ditto - * src/LyXAction.h: ditto - * src/LyXView.h: ditto - * src/bufferlist.h: ditto - * src/lastfiles.h: ditto - * src/layout.h: ditto - * src/lyx_gui.h: ditto - * src/lyx_main.h: ditto - * src/lyxlex.h: ditto - * src/lyxrc.h: ditto - * src/frontends/ButtonPolicies.h: ditto - * src/frontends/Dialogs.h: ditto - * src/frontends/xforms/FormBase.h: ditto - * src/frontends/xforms/FormGraphics.h: ditto - * src/frontends/xforms/FormParagraph.h: ditto - * src/frontends/xforms/FormTabular.h: ditto - * src/graphics/GraphicsCache.h: ditto - * src/graphics/Renderer.h: ditto - * src/insets/ExternalTemplate.h: ditto - * src/insets/insetcommand.h: ditto - * src/support/path.h: ditto - - * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96 - and introduce clause for 2.97. - - * boost/libs/README: new file - - * boost/boost/utility.hpp: new file - - * boost/boost/config.hpp: new file - - * boost/boost/array.hpp: new file - - * boost/Makefile.am: new file - - * boost/.cvsignore: new file - - * configure.in (AC_OUTPUT): add boost/Makefile - - * Makefile.am (SUBDIRS): add boost - -2000-10-01 Dekel Tsur - - * src/support/lstrings.C (suffixIs): Fixed. - -2000-10-01 Allan Rae - - * src/PrinterParams.h: moved things around to avoid the "can't - inline call" warning. - - * src/frontends/xforms/RadioButtonGroup.h: turned a comment - into doc++ documentation. - - * src/frontends/xforms/FormCommand.[Ch]: support button policy - - * src/frontends/xforms/FormRef.C: make use of button controller - * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase - cleaned up button controller usage. - * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase - * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and - use the button controller - - * src/frontends/xforms/forms/*.fd: and associated generated files - updated to reflect changes to FormBase. Some other FormXxxx files - also got minor updates to reflect changes to FormBase. - - * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new - (hide): made virtual. - (input): return a bool. true == valid input - (RestoreCB, restore): new - (CancelCB, OKCB): renamed from HideCB and ApplyHideCB. - Changes to allow derived dialogs to use a ButtonController and - make sense when doing so: OK button calls ok() and so on. - - * src/frontends/xforms/ButtonController.h (class ButtonController): - Switch from template implementation to taking Policy parameter. - Allows FormBase to provide a ButtonController for any dialog. - - * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time - Probably should rename connect and disconnect. - (apply): use the radio button groups - (form): needed by FormBase - (build): setup the radio button groups - -2000-09-29 Lars Gullik Bjønnes - - * several files: type changes to reduce the number of warnings and - to unify type hangling a bit. Still much to do. - -2000-09-29 Jean-Marc Lasgouttes - - * lib/images/*: rename a bunch of icons to match Dekel converter - changes. - - * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to - last parameter. - - * src/frontends/xforms/FormBase.C (disconnect): remove bogus test. - - * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a - virtual destructor - * sigc++/handle.h: ditto for class Handle. - -2000-09-27 John Levon - - * config/kde.m4: make Qt fail immediately if Qt2 is picked up - -2000-09-28 Dekel Tsur - - * src/intl.C (InitKeyMapper): Correct the value of n due to the - removal of the "default" language. - - * src/combox.h (getline): Check that sel > 0 - -2000-09-29 José Abílio Matos - - * lib/examples/docbook_example.lyx - * lib/examples/docbook_article.lyx: file renamed to avoid confusion. - - * lib/layouts/docbook-book.layout: new docbook book layout. - - * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy. - - * lib/layouts/manpage.layout: Same as above. Style SubSection removed. - - * src/insets/figinset.C (DocBook):fixed small typo. - - * src/insets/insetinclude.C (DocBook): new export for verbatim type. - - * src/insets/insetinclude.h: string include_label doesn't need to be - mutable. - -2000-09-29 Allan Rae - - * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new. - Allow derived type to control connection and disconnection from signals - of its choice if desired. - -2000-09-28 Juergen Vigna - - * src/insets/insettabular.C (update): fixed cursor setting when - the_locking_inset changed. - (draw): made this a bit cleaner. - (InsetButtonPress): fixed! - - * various files: added LyXText Parameter to fitCursor call. - - * src/BufferView.C (fitCursor): added LyXText parameter. - - * src/insets/insettabular.C (draw): small draw fix. - - * src/tabular.C: right setting of left/right celllines. - - * src/tabular.[Ch]: fixed various types in funcions and structures. - * src/insets/insettabular.C: ditto - * src/frontends/xforms/FormTabular.C: ditto - -2000-09-28 Allan Rae - - * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was - that the #ifdef's had been applied to part of what should have been - a complete condition. It's possible there are other tests that - were specific to tables that are also wrong now that InsetTabular is - being used. Now we need to fix the output of '\n' after a table in a - float for the same reason as the original condition: - "don't insert this if we would be adding it before or after a table - in a float. This little trick is needed in order to allow use of - tables in \subfigures or \subtables." - Juergen can you check this? - -2000-09-27 Lars Gullik Bjønnes - - * src/insets/insettext.C (Ascii): return numer of '\n' in the text - output to the ostream. - - * several files: fixed types based on warnings from cxx - -2000-09-26 John Levon - - * src/frontends/kde/Makefile.am: fix rule for - formindexdialogdata_moc.C - - * src/.cvsignore: add ext_l10n.h to ignore - - * acconfig.h: stop messing with __STRICT_ANSI__ - * config/gnome.m4: remove option to set -ansi - * config/kde.m4: remove option to set -ansi - * config/lyxinclude.m4: don't set -ansi - -2000-09-27 Juergen Vigna - - * various files: remove "default" language check. - - * src/insets/insetquotes.C: removed use of current_view. - - * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but - the one should have red ears by now! - - * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts - in more then one paragraph. Fixed cursor-movement/selection. - - * src/frontends/xforms/FormParagraph.C: disable pagebreaks for - paragraphs inside a text inset. - - * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the - text-inset if this owner is an inset. - -2000-09-27 Lars Gullik Bjønnes - - * src/Bullet.h: changed type of font, character and size to int - - * src/buffer.C (asciiParagraph): remove actcell and fname1. - - * src/insets/inseturl.[Ch]: - * src/insets/insetref.[Ch]: - * src/insets/insetlabel.[Ch]: add linelen to Ascii - -2000-09-26 Angus Leeming - - * src/buffer.C (readFile): block-if statement rearranged to minimise - bloat. Patch does not reverse Jean-Marc's change ;-) - - * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks. - Class rewritten to store pointers to hide/update signals directly, - rather than Dialogs *. Also defined an enum to ease use. All xforms - forms can now be derived from this class. - - * src/frontends/xforms/FormCommand.[Ch] - * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase. - - * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h - out of header file. - - * src/frontends/xforms/forms/form_citation.fd - * src/frontends/xforms/forms/form_copyright.fd - * src/frontends/xforms/forms/form_error.fd - * src/frontends/xforms/forms/form_index.fd - * src/frontends/xforms/forms/form_ref.fd - * src/frontends/xforms/forms/form_toc.fd - * src/frontends/xforms/forms/form_url.fd: remamed callbacks - - * src/frontends/xforms/forms/makefile: small change to work with DEC sh. - - * src/insets/insetfoot.C: removed redundent using directive. - -2000-09-26 Jean-Marc Lasgouttes - - * lib/layouts/siamltex.layout: new textclass for SIAM journals, - from Kornelia Pietsch - - * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now - created in the constructors in different groups. Then set() just - have to show the groups as needed. This fixes the redraw problems - (and is how the old menu code worked). - - * src/support/lyxlib.h: declare the methods as static when we do - not have namespaces. - -2000-09-26 Juergen Vigna - - * src/buffer.C (asciiParagraph): new function. - (writeFileAscii): new function with parameter ostream. - (writeFileAscii): use now asciiParagraph. - - * various inset files: added the linelen parameter to the Ascii-func. - - * src/tabular.C (Write): fixed error in writing file introduced by - the last changes from Lars. - - * lib/bind/menus.bind: removed not supported functions. - - * src/insets/insettext.C (Ascii): implemented this function. - - * src/insets/lyxinset.h (Ascii): added linelen parameter. - - * src/tabular.C (write_attribute[int,string,bool]): new functions. - (Write): use of the write_attribute functions. - - * src/bufferlist.C (close): fixed reasking question! - -2000-09-26 Lars Gullik Bjønnes - - * src/support/unlink.C src/support/remove.C src/support/mkdir.C: - new files use the everwhere possible. - - * several files: - * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h - src/log_form.C src/lyx.C: - regenerated - - * src/buffer.C (runLaTeX): remove func - - * src/PaperLayout.C: removed file - * src/ParagraphExtra.C: likewise - * src/bullet_forms.C: likewise - * src/bullet_forms.h: likewise - * src/bullet_forms_cb.C: likewise - - * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C, - ParagraphExtra.C, bullet_forms.C, bullet_forms.h and - bullet_forms_cb.C - - * several files: remove all traces of the old fd_form_paragraph, - and functions belonging to that. - - * several files: remove all traces of the old fd_form_document, - and functions belonging to that. - - * several files: constify local variables were possible. - - * several files: remove all code that was dead when NEW_EXPORT was - defined - - * several files: removed string::c_str in as many places as - possible. - - * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C] - (e): be a bit more outspoken when patching - (updatesrc): only move files if changed. - - * forms/layout_forms.h.patch: regenerated - - * forms/layout_forms.fd: remove form_document and form_paragraph - and form_quotes and form_paper and form_table_options and - form_paragraph_extra - - * forms/form1.fd: remove form_table - - * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and - the fdui->... rewrite. Update some comments to xforms 0.88 - - * forms/bullet_forms.C.patch: removed file - * forms/bullet_forms.fd: likewise - * forms/bullet_forms.h.patch: likewise - - * development/Code_rules/Rules: added a section on switch - statements. Updated some comment to xforms 0.88. - -2000-09-26 Jean-Marc Lasgouttes - - * src/buffer.C (readFile): make sure that the whole version number - is read after \lyxformat (even when it contains a comma) - - * lib/ui/default.ui: change shortcut of math menu to M-a. - -2000-09-25 Jean-Marc Lasgouttes - - * src/vspace.C (nextToken): use isStrDbl() to check for proper - double values. - - * src/LyXView.C (updateWindowTitle): show the full files name in - window title, limited to 30 characters. - - * src/support/lyxstring.C (lyxstring): fix it correctly this time. - When a number of characters has been given, we should not assume - that the string is 0-terminated. - - * src/intl.C (InitKeyMapper): remove a bunch of string::c_str() - calls (fixes some memory leaks) - - * src/intl.[Ch]: add a destructor for Intl, in order to delete the - trans member on exit. - -2000-09-22 Jean-Marc Lasgouttes - - * src/converter.C (GetReachable): fix typo. - - * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and - understand ',' instead of '.'. - (GetInteger): rewrite to use strToInt(). - -2000-09-26 Juergen Vigna - - * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields, - better visibility and error-message on wrong VSpace input. - - * src/language.C (initL): added english again. - -2000-09-25 Juergen Vigna - - * src/frontends/kde/Dialogs.C (Dialogs): - * src/frontends/gnome/Dialogs.C (Dialogs): - * src/frontends/kde/Makefile.am: - * src/frontends/gnome/Makefile.am: added FormParagraph from xforms. - - * src/frontends/xforms/forms/makefile: added form_paragraph.fd. - - * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph. - - * src/frontends/xforms/Makefile.am: added files for FormParagraph. - - * src/frontends/xforms/FormParagraph.C: - * src/frontends/xforms/FormParagraph.h: - * src/frontends/xforms/form_paragraph.C: - * src/frontends/xforms/form_paragraph.h: - * src/frontends/xforms/forms/form_paragraph.fd: new files for the new - paragraph layout. - - * src/lyxfunc.C (Dispatch): call the new layout paragraph. - - * src/tabular.C (OldFormatRead): forgot to delete the temporary - Paragraph-Data after use. - - * src/insets/insettext.C (LocalDispatch): don't set the layout on - non breakable paragraphs. - -2000-09-25 Garst R. Reese - - * src/language.C (initL): added missing language_country codes. - -2000-09-25 Juergen Vigna - - * src/insets/insettext.C (InsetText): - (deleteLyXText): remove the not released LyXText structure! - -2000-09-24 Marko Vendelin - - * src/frontends/gnome/mainapp.C - * src/frontends/gnome/mainapp.h: added support for keyboard - accelerators - - * src/frontends/gnome/FormCitation.C - * src/frontends/gnome/FormCitation.h - * src/frontends/gnome/Makefile.am - * src/frontends/gnome/pixbutton.h: completed the rewrite of - FormCitation to use "action area" in mainapp window - - * src/frontends/gnome/Menubar_pimpl.C - * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle - large TOC. - -2000-09-23 Dekel Tsur - - * src/mathed/formula.C (MathFuncInset::Metrics): Use default - width/descent/ascent values if name is empty. - (mathed_string_height): Use std::max. - -2000-09-25 Allan Rae - - * src/frontends/xforms/forms/form_preferences.fd: resize to stop - segfault. This will be completely redesigned soon. - - * sigc++: updated libsigc++. Fixes struct timespec bug. - - * development/tools/makeLyXsigc.sh: .cvsignore addition - -2000-09-23 Lars Gullik Bjønnes - - * several files: removed almost all traces of the old table - (tabular) code. - - * src/TableLayout.C: removed file - -2000-09-22 Juergen Vigna - - * src/frontends/kde/Dialogs.C: added credits forms. - - * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms. - - * src/frontends/gnome/Dialogs.C: added some forms. - - * src/spellchecker.C (init_spell_checker): set language in pspell code - (RunSpellChecker): some modifications for setting language string. - - * src/language.[Ch]: added language_country code. - -2000-09-21 Angus Leeming - - * src/frontends/Dialogs.h: added new signal showError. - Rearranged existing signals in some sort of alphabetical order. - - * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch], - FormError.[Ch], form_error.[Ch] - * src/frontends/xforms/forms/makefile: added new file form_error.fd - * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError. - - * src/frontends/xforms/FormBase.[Ch]: new base class for xforms - dialogs. I think that this can be used as the base to all these - dialogs. - - * src/frontends/xforms/FormError.[Ch] - * src/frontends/xforms/forms/form_error.fd: new files. Xforms - implementation of InsetError dialog. - - * src/insets/inseterror.[Ch]: rendered GUI-independent. - - * src/frontends/kde/Dialogs.C: added new xforms dialog FormError. - * src/frontends/kde/Makefile.am: ditto - -2000-09-21 Dekel Tsur - - * src/mathed/math_cursor.[Ch]: Removed class members macroln and - macrobf. This fixes a bug of invisible text. - -2000-09-22 Jean-Marc Lasgouttes - - * lib/doc/LaTeXConfig.lyx.in: updated. - - * src/language.C (initL): remove language "francais" and change a - bit the names of the two other french variations. - - * src/support/lyxstring.C (lyxstring): do not apply strlen() on a - string that may not be 0-terminated. - -2000-09-20 Lars Gullik Bjønnes - - * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h - -2000-09-20 Marko Vendelin - - * src/frontends/gnome/FormCitation.C - * src/frontends/gnome/FormIndex.C - * src/frontends/gnome/FormToc.C - * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering - the variable initialization to shut up the warnings - -2000-09-20 Lars Gullik Bjønnes - - * src/table.[Ch]: deleted files - - * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch - second arg. - -2000-09-18 Juergen Vigna - - * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete - problems with selection. Inserted new LFUN_PASTESELECTION. - (InsetButtonPress): inserted handling of middle mouse-button paste. - - * src/spellchecker.C: changed word to word.c_str(). - -2000-09-16 Kayvan A. Sylvan - - * src/Makefile.am: Add sources to lyx_SOURCES so they will be - included in the ``make dist'' tarball. - -2000-09-15 Juergen Vigna - - * src/CutAndPaste.C (cutSelection): small fix return the right - end position after cut inside one paragraph only. - - * src/insets/insettext.C (resizeLyXText): only reset the cursor if - we are locked as otherwise we don't have a valid cursor position! - - * src/insets/figinset.C (draw): small bugfix but why is this needed??? - -2000-09-19 Angus Leeming - - * src/frontends/kde/FormRef.C: added using directive. - * src/frontends/kde/FormToc.C: ditto - - * src/frontends/kde/formtocdialog.h: changed endl to std::endl. - - * src/frontends/kde/FormRef.h: removed trailing comma from enums. - -2000-09-19 Marko Vendelin - - * src/frontends/gnome/Menubar_pimpl.C - * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now - Toc, ViewFormats, UpdateFormats, and ExportFormats. - - * src/frontends/gnome/mainapp.C - * src/frontends/gnome/mainapp.h: support for menu update used - by Toc menu. - - * src/frontends/gnome/mainapp.C - * src/frontends/gnome/mainapp.h: support for "action" area in the - main window. This area is used by small simple dialogs, such as - FormUrl. - - * src/frontends/gnome/FormIndex.C - * src/frontends/gnome/FormIndex.h - * src/frontends/gnome/FormUrl.C - * src/frontends/gnome/FormUrl.h: rewrite to use main window action - area - - * src/frontends/gnome/FormCitation.C - * src/frontends/gnome/FormCitation.h: rewrite to use main window - action area. Only "Insert new citation" is implemented. - -2000-09-19 Lars Gullik Bjønnes - - * src/buffer.C (Dispatch): fix call to Dispatch - * src/insets/insetref.C (Edit): likewise - * src/insets/insetparent.C (Edit): likewise - * src/insets/insetinclude.C (include_cb): likewise - * src/frontends/xforms/FormUrl.C (apply): likewise - * src/frontends/xforms/FormToc.C (apply): likewise - * src/frontends/xforms/FormRef.C (apply): likewise - * src/frontends/xforms/FormIndex.C (apply): likewise - * src/frontends/xforms/FormCitation.C (apply): likewise - * src/lyxserver.C (callback): likewise - * src/lyxfunc.C (processKeySym): likewise - (Dispatch): likewise - (Dispatch): likewise - * src/lyx_cb.C (LayoutsCB): likewise - - * Makefile.am (sourcedoc): small change - -2000-09-18 Lars Gullik Bjønnes - - * src/main.C (main): Don't make an empty GUIRunTime object. all - methods are static. constify a bit remove unneded using + headers. - - * src/tabular.C: some more const to local vars move some loop vars - - * src/spellchecker.C: added some c_str after some word for pspell - - * src/frontends/GUIRunTime.h: add new static method setDefaults - * src/frontends/xforms/GUIRunTime.C (setDefaults): - * src/frontends/kde/GUIRunTime.C (setDefaults): - * src/frontends/gnome/GUIRunTime.C (setDefaults): new method - - * src/mathed/math_cursor.C (MacroModeClose): don't call SetName - with strnew in arg, use correct emptystring when calling SetName. - - * several files: remove all commented code with relation to - HAVE_SSTREAM beeing false. We now only support stringstream and - not strstream. - -2000-09-15 Jean-Marc Lasgouttes - - * src/lyxfunc.C: construct correctly the automatic new file - names. - - * src/text2.C (IsStringInText): change type of variable i to shut - off a warning. - - * src/support/sstream.h: do not use namespaces if the compiler - does not support them. - -2000-09-15 Marko Vendelin - * src/frontends/gnome/FormCitation.C - * src/frontends/gnome/FormCitation.h - * src/frontends/gnome/diainsertcitation_interface.c - * src/frontends/gnome/dialogs/diainsertcitation.glade: adds - regexp support to FormCitation [Gnome]. - -2000-09-15 John Levon - - * acconfig.h - * configure.in: remove unused KDE/GTKGUI define - - * src/frontends/kde/FormRef.C - * src/frontends/kde/FormRef.h - * src/frontends/kde/formrefdialog.C - * src/frontends/kde/formrefdialog.h: double click will - go to reference, now it is possible to change a cross-ref - after the fact - - * src/frontends/kde/FormToc.C - * src/frontends/kde/FormToc.h - * src/frontends/kde/formtocdialog.C - * src/frontends/kde/formtocdialog.h: add a depth - slider - - * src/frontends/kde/Makefile.am: add QtLyXView.h - to the sources list - -2000-09-15 Angus Leeming - - * src/frontends/kde/FormCitation.h: added some using directives. - - * src/frontends/kde/FormToc.h: corrected definition of doTree. - - * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not - cerr. - - * src/mathed/math_defs.h: redefine SetAlign to use string rather - than char *. - -2000-09-15 Jean-Marc Lasgouttes - - * src/buffer.C (pop_tag): revert for the second time a change by - Lars, who seems to really hate having non-local loop variables :) - - * src/Lsstream.h: add "using" statements. - - * src/support/copy.C (copy): add a bunch of std:: qualifiers - * src/buffer.C (writeFile): ditto - -2000-09-14 Lars Gullik Bjønnes - - * src/buffer.C (writeFile): try to fix the locale modified format - number to always be as we want it. - - * src/WorkArea.C (work_area_handler): try to workaround the bugs - in XForms 0.89. C-space is now working again. - - * src/Lsstream.h src/support/sstream.h: new files. - - * also commented out all cases where strstream were used. - - * src/Bullet.h (c_str): remove method. - - * remove all stuff that is irrelevant when NEW_MENUBAR is defined - - * a lot of files: get rid of "char const *" and "char *" is as - many places as possible. We only want to use them in interaction - with system of other libraries, not inside lyx. - - * a lot of files: return const object is not of pod type. This - helps ensure that temporary objects is not modified. And fits well - with "programming by contract". - - * configure.in: check for the locale header too - - * Makefile.am (sourcedoc): new tag for generation of doc++ - documentation - -2000-09-14 Juergen Vigna - - * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the - callback to check which combo called it and do the right action. - - * src/combox.C (combo_cb): added combo * to the callbacks. - (Hide): moved call of callback after Ungrab of the pointer. - - * src/intl.h: removed LCombo2 function. - - * src/intl.C (LCombo): added Combox * to call and removed LCombo2 - function as this can now be handled in one function. - - * src/combox.h: added Combox * to callback prototype. - - * src/frontends/xforms/Toolbar_pimpl.C: - * src/lyx_cb.C (LayoutsCB): added Combox * to function call. - -2000-09-14 Garst Reese - - * lib/tex/hollywood.cls changed length of parenthicals to 1.5in - moved usepackage{xxx}'s to beginning of file. Changed left margin - to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed - underlining from title. Thanks to John Culleton for useful suggestions. - -2000-09-13 Jean-Marc Lasgouttes - - * src/lyxlex_pimpl.C (setFile): change error message to debug - message. - -2000-09-13 Juergen Vigna - - * src/frontends/xforms/FormDocument.C: implemented choice_class - as combox and give callback to combo_language so OK/Apply is activated - on change. - - * src/bufferlist.C (newFile): small fix so already named files - (via an open call) are not requested to be named again on the - first save! - -2000-09-13 John Levon - - * src/frontends/kde/Makefile.am - * src/frontends/kde/FormRef.C - * src/frontends/kde/FormRef.h - * src/frontends/kde/formrefdialog.C - * src/frontends/kde/formrefdialog.h: implement - cross-ref dialog - -2000-09-13 John Levon - - * src/frontends/kde/formtocdialog.C - * src/frontends/kde/formtocdialog.h - * src/frontends/kde/FormToc.C - * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly - -2000-09-11 John Levon - - * src/frontends/kde/FormCitation.C: fix thinko - where we didn't always display the reference text - properly - - * src/frontends/kde/formurldialog.C - * src/frontends/kde/formurldialog.h - * src/frontends/kde/FormUrl.C - * src/frontends/kde/FormUrl.h: minor cleanups - - * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling - - * src/frontends/kde/Makefile.am - * src/frontends/kde/FormToc.C - * src/frontends/kde/FormToc.h - * src/frontends/kde/FormCitation.C - * src/frontends/kde/FormCitation.h - * src/frontends/kde/FormIndex.C - * src/frontends/kde/FormIndex.h - * src/frontends/kde/formtocdialog.C - * src/frontends/kde/formtocdialog.h - * src/frontends/kde/formcitationdialog.C - * src/frontends/kde/formcitationdialog.h - * src/frontends/kde/formindexdialog.C - * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs - -2000-09-12 Juergen Vigna - - * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version - static strings. - -2000-09-11 Jean-Marc Lasgouttes - - * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr, - not cerr. - -2000-09-09 Dekel Tsur - - * src/converter.C (Add, Convert): Added support for converter flags: - needaux, resultdir, resultfile. - (Convert): Added new parameter view_file. - (dvips_options): Fixed letter paper option. - - * src/exporter.C (Export, BufferExtension): Added support for Docbook. - (Export, GetExportableFormats, GetViewableFormats): Added support - for Ascii. - - * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary - directory! - (easyParse): Fixed to work with new export code. - - * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete - directories. - - * lyx-devel-export/lib/configure.m4: Changed flags of tth. - - * lib/bind/*.bind: Replaced - buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by - buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps - -2000-09-11 Juergen Vigna - - * src/lyx_gui.C (runTime): uses global guiruntime variable. - - * src/main.C (main): now GUII defines global guiruntime! - - * src/frontends/gnome/GUIRunTime.C (initApplication): - * src/frontends/kde/GUIRunTime.C (initApplication): - * src/frontends/xforms/GUIRunTime.C (initApplication): - * src/frontends/GUIRunTime.h: added new function initApplication. - - * src/spellchecker.C (sc_accept_word): change to add_to_session. - - * src/vspace.C (nextToken): fixed error with number 0cm as unvalid. - -2000-09-08 Juergen Vigna - - * src/lyx_gui.C (create_forms): don't display the "default" entry as - we have already "Reset". - - * src/language.C (initL): inserted "default" language and made this - THE default language (and not american!) - - * src/paragraph.C: inserted handling of "default" language! - - * src/lyxfont.C: ditto - - * src/text.C: ditto - - * src/paragraph.C: output the \\par only if we have a following - paragraph otherwise it's not needed. - -2000-09-05 Juergen Vigna - - * config/pspell.m4: added entry to lyx-flags - - * src/spellchecker.C: modified version from Kevin for using pspell - -2000-09-01 Marko Vendelin - * src/frontends/gnome/Makefile.am - * src/frontends/gnome/FormCitation.C - * src/frontends/gnome/FormCitation.h - * src/frontends/gnome/diainsertcitation_callbacks.c - * src/frontends/gnome/diainsertcitation_callbacks.h - * src/frontends/gnome/diainsertcitation_interface.c - * src/frontends/gnome/diainsertcitation_interface.h - * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation - dialog for Gnome frontend - - * src/main.C: Gnome libraries require keeping application name - and its version as strings - - * src/frontends/gnome/mainapp.C: Change the name of the main window - from GnomeLyX to PACKAGE - -2000-09-05 Jean-Marc Lasgouttes - - * src/frontends/Liason.C: add "using: declaration. - -2000-08-31 Dekel Tsur - - * src/mathed/math_macro.C (Metrics): Set the size of the template - - * src/mathed/formulamacro.C (Latex): Fixed the returned value - -2000-09-04 Dekel Tsur - - * src/converter.C (add_options): New function. - (SetViewer): Change $$FName into '$$FName'. - (View): Add options when running xdvi - (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName. - (Convert): The 3rd parameter is now the desired filename. Converts - calls to lyx::rename if necessary. - Add options when running dvips. - (dvi_papersize,dvips_options): New methods. - - * src/exporter.C (Export): Use getLatexName() instead of fileName(). - - * src/frontends/Liason.C (printBuffer): Removed duplicate code by - using a call to Converter::dvips_options. - Fixed to work with nex export code. - - * src/support/copy.C - * src/support/rename.C: New files - - * src/support/syscall.h - * src/support/syscall.C: Added Starttype SystemDontWait. - - * lib/ui/default.ui: Changed to work with new export code - - * lib/configure.m4: Changed to work with new export code - - * src/encoding.C: Changed latex name for iso8859_7 encoding. - -2000-09-04 Angus Leeming + - - * src/frontends/xforms/Menubar_pimpl.C: added two using directives - so that code compiles with DEC cxx. - - * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn - to work correctly! Also now supports the additional elements - neeeded by natbib. - -2000-09-01 Allan Rae - - * src/frontends/ButtonPolicies.C: renamed all the references to - PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy. - - * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS - since it's a const not a type. - - * src/frontends/xforms/ButtonController.h: cleanup before Lars does. - -2000-08-31 Juergen Vigna - - * src/insets/figinset.C: Various changes to look if the filename has - an extension and if not add it for inline previewing. - -2000-08-31 Lars Gullik Bjønnes - - * src/frontends/ButtonPolicies.h: add a Button AllButtons. - make buttonStatus and isReadOnly be const methods. (also reflect - this in derived classes.) - - * src/frontends/ButtonPolicies.C: remove sum_ and bogus_ - (nextState): change to be static inline, pass the StateMachine as - a const reference - (PreferencesPolicy): remove casts - (OkCancelPolicy): remvoe casts - (OkCancelReadOnlyPolicy): remove casts - (NoRepeatedApplyReadOnlyPolicy): remove casts - (OkApplyCancelReadOnlyPolicy): remove casts - (OkApplyCancelPolicy): remove casts - (NoRepeatedApplyPolicy): remove casts - -2000-08-31 Angus Leeming - - * src/converter.C: added some using directives - - * src/frontends/ButtonPolicies.C: changes to overcome - "need lvalue" error with DEC c++ - - * src/frontends/xforms/FormDocument.C (c-tor): use C callback - to WMHideCB for DEC c++ - - * src/frontends/xforms/Menubar_pimpl.C: added using directive - - * src/frontends/xforms/forms/form_document.C.patch: use C callback - to BulletBMTableCB for DEC c++ - -2000-08-31 Allan Rae - - * src/lyx_gui.C (create_forms): build combo_language2 which is part of - character dialog separately from old document dialogs combo_language. - Stops a segfault. - -2000-08-30 Dekel Tsur - - * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH. - Removed LFUN_REF_CREATE. - - * src/MenuBackend.C: Added new tags: toc and references - - * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool - (add_lastfiles, add_documents, add_formats): Removed the unused smn - parameter. - (add_toc, add_references): New methods. - (create_submenu): Handle correctly the case when there is a - seperator after optional menu items. - - * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK. - (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT. - (dispatch): New code for LFUN_GOTO_PARAGRAPH. - - * src/frontends/xforms/FormToc.C (apply): Use Dispatch. - -2000-08-30 Dekel Tsur - - * src/converter.[Ch]: New file for converting between different - formats. - - * src/export.[Ch]: New file for exporting a LyX file to different - formats. - - * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined: - MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript, - PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX, - MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML, - MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc, - RunDocBook, MenuExport. - - * src/lyxfunc.C (Dispatch): Use the Exporter::Export and - Exporter::Preview methods if NEW_EXPORT is defined. - - * src/buffer.C (Dispatch): Use Exporter::Export. - - * src/lyxrc.C: Added new tags: \converter and \viewer. - - * src/commandtags.h - * src/LyXAction.C: Define new lyx-function: buffer-update. - Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps - when NEW_EXPORT is defined. - - * src/MenuBackend.C: Added new tags: updateformats and viewformats. - - * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method. - - * lib/ui/default.ui: Added submenus "view" and "update" to the - "file" menu. - - * src/filetools.C (GetExtension): New function. - - * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used. - -2000-08-29 Allan Rae - - * lib/bind/xemacs.bind: update a binding due to Juergen's recent work - - * src/frontends/xforms/FormDocument.C (checkReadOnly): new function - (EnableDocumentLayout): removed - (DisableDocumentLayout): removed - (build): make use of ButtonController's read-only handling to - de/activate various objects. Replaces both of the above functions. - - * src/frontends/xforms/ButtonController.h (readWrite): was read_write - (readOnly): was read_only - (refresh): fixed dumb mistakes with read_only_ handling - - * src/frontends/xforms/forms/form_document.fd: - * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the - tabbed dialogs so the tabs look more like tabs and so its easier to - work out which is the current tab. - - * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix - segfault with form_table - - * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL. - -2000-08-28 Juergen Vigna - - * acconfig.h: added USE_PSPELL. - - * src/config.h.in: added USE_PSPELL. - - * autogen.sh: added pspell.m4 - - * config/pspell.m4: new file. - - * src/spellchecker.C: implemented support for pspell libary. - -2000-08-25 Juergen Vigna - - * src/LyXAction.C (init): renamed LFUN_TABLE to - LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences. - - * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries. - - * src/lyxscreen.h: add force_clear variable and fuction to force - a clear area when redrawing in LyXText. - - * src/text.C (GetVisibleRow): look if the screen forces a redraw. - -2000-08-25 Lars Gullik Bjønnes - - * some whitespace and comment changes. - - * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones. - - * src/buffer.C: up te LYX_FORMAT to 2.17 - -2000-08-23 Juergen Vigna - - * src/BufferView_pimpl.C (tripleClick): disable this when in a - locking_inset. - - * src/insets/insettabular.C (pasteSelection): delete the insets - LyXText as it is not valid anymore. - (copySelection): new function. - (pasteSelection): new function. - (cutSelection): new function. - (LocalDispatch): implemented cut/copy/paste of cell selections. - - * src/insets/insettext.C (resizeLyXText): don't need resize if I still - don't have a LyXText. - - * src/LyXAction.C (init): a NEW_TABULAR define too much. - - * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing - NEW_TABULAR define. - -2000-08-22 Juergen Vigna - - * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): - ifdef form_table out if NEW_TABULAR. - -2000-08-21 Juergen Vigna - - * src/insets/insettabular.C (TabularFeatures): BoxType is enum now. - (draw): fixed draw position so that the cursor is positioned in the - right place. - (InsetMotionNotify): hide/show cursor so the position is updated. - (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell), - using cellstart() function where it should be used. - - * src/insets/insettext.C (draw): ditto. - - * src/tabular.C: fixed initialization of some missing variables and - made BoxType into an enum. - -2000-08-22 Marko Vendelin - * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome - stock menu item using action numerical value, not its string - representation. - - -2000-08-22 Lars Gullik Bjønnes - - * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add - GUIRunTime.C remove GUIRunTime_pimpl.[Ch] - - * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file - - * src/frontends/xforms/GUIRunTime.C: new file - - * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add - GUIRunTime.C and remove GUIRunTime_pimpl.[Ch] - - * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file - - * src/frontends/kde/GUIRunTime.C: new file - - * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add - GUIRunTime.C and remove GUIRunTime_pimpl.[Ch] - - * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file - - * src/frontends/gnome/GUIRunTime.C: new file - - * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed - GUIRunTime.C - - * src/frontends/GUIRunTime.h: removed constructor and destructor, - small change to documetentation. - - * src/frontends/GUIRunTime.C: removed file - - * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR - - * src/lyxparagraph.h: enable NEW_TABULAR as default - - * src/lyxfunc.C (processKeySym): remove some commented code - - * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add - NEW_TABULAR around the fd_form_table_options. - - * src/lyx_gui.C (runTime): call the static member function as - GUIRunTime::runTime(). - -2000-08-21 Allan Rae - - * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the - policy here also. - -2000-08-21 Dekel Tsur - - * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present - -2000-08-21 Allan Rae - - * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to - keep Garst happy ;-) - * src/frontends/xforms/FormPreferences.C (build): use setOK - * src/frontends/xforms/FormDocument.C (build): use setOK - (FormDocument): use the appropriate policy. - -2000-08-21 Allan Rae - - * src/frontends/xforms/ButtonController.h (class ButtonController): Allow - automatic [de]activation of arbitrary objects when in a read-only state. - - * src/frontends/ButtonPolicies.h: More documentation - (isReadOnly): added to support the above. - - * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save - -2000-08-18 Juergen Vigna - - * src/insets/insettabular.C (getStatus): changed to return func_status. - - * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always - display toggle menu entries if they are. - - * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the - new document layout now. - - * src/lyxfunc.C: ditto - - * src/lyx_gui_misc.C: ditto - - * src/lyx_gui.C: ditto - - * lib/ui/default.ui: removed paper and quotes layout as they are now - all in the document layout tabbed folder. - - * src/frontends/xforms/forms/form_document.fd: added Restore - button and callbacks for all inputs for Allan's ButtonPolicy. - - * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added. - (CheckChoiceClass): added missing params setting on class change. - (UpdateLayoutDocument): added for updating the layout on params. - (build): forgot to RETURN_ALWAYS input_doc_spacing. - (FormDocument): Implemented Allan's ButtonPolicy with the - PreferencesPolicy. - -2000-08-17 Allan Rae - - * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection - so we can at least see the credits again. - - * src/frontends/xforms/FormPreferences.C: Used the appropriate button - controller calls for the appropriate callbacks. Note that since Ok - calls apply followed by cancel, and apply isn't a valid input for the - APPLIED state, the bc_ calls have to be made in the static callback not - within each of the real callbacks. - - * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay() - (setOk): renamed from setOkay() - -2000-08-17 Juergen Vigna - - * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function - in the implementation part. - (composeUIInfo): don't show optional menu-items. - - * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset. - - * src/insets/insettext.C (UpdateLocal): call to LyXView::showState() - - * src/bufferview_funcs.C (CurrentState): fixed to show also the - text-state when in a text-inset. - - * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now. - -2000-08-17 Marko Vendelin - * src/frontends/gnome/FormIndex.C - * src/frontends/gnome/FormIndex.h - * src/frontends/gnome/FormToc.C - * src/frontends/gnome/FormToc.h - * src/frontends/gnome/dialogs - * src/frontends/gnome/diatoc_callbacks.c - * src/frontends/gnome/diatoc_callbacks.h - * src/frontends/gnome/diainsertindex_callbacks.h - * src/frontends/gnome/diainsertindex_callbacks.c - * src/frontends/gnome/diainsertindex_interface.c - * src/frontends/gnome/diainsertindex_interface.h - * src/frontends/gnome/diatoc_interface.h - * src/frontends/gnome/diatoc_interface.c - * src/frontends/gnome/Makefile.am: Table of Contents and - Insert Index dialogs implementation for Gnome frontend - - * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs - - * src/frontends/gnome/Menubar_pimpl.C: remove historical comments - - * src/frontends/gnome/diainserturl_interface.c: make the dialog - resizable - -2000-08-17 Lars Gullik Bjønnes - - * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and - destructor. Don't definde if you don't need it - (processEvents): made static, non-blocking events processing for - xforms. - (runTime): static method. event loop for xforms - * similar as above for kde and gnome. - - * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong - new Pimpl is correct - (runTime): new method calss the real frontends runtime func. - - * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime - -2000-08-16 Lars Gullik Bjønnes - - * src/lyx_gui.C (create_forms): fix the "No change" gettext missing - -2000-08-16 Juergen Vigna - - * src/lyx_gui.C (runTime): added GUII RunTime support. - - * src/frontends/Makefile.am: - * src/frontends/GUIRunTime.[Ch]: - * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: - * src/frontends/kde/GUIRunTime_pimpl.[Ch]: - * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support - - * src/LyXAction.C (init): added dummy LFUN_INSERT_URL. - - * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include - as this is already set in ${FRONTEND_INCLUDE} if needed. - - * configure.in (CPPFLAGS): setting the include dir for the frontend - directory and don't set FRONTEND=xforms for now as this is executed - always. - -2000-08-16 John Levon (moz@compsoc.man.ac.uk) - - * src/frontends/kde/Makefile.am: - * src/frontends/kde/FormUrl.C: - * src/frontends/kde/FormUrl.h: - * src/frontends/kde/formurldialog.h: - * src/frontends/kde/formurldialog.C: Add KDE URL dialog - -2000-08-15 Kayvan A. Sylvan - - * src/frontend/Makefile.am: Add gnome and kde to dist tar file. - -2000-08-16 Lars Gullik Bjønnes - - * src/BufferView_pimpl.C (workAreaKeyPress): enable the - processKeySym - -2000-08-15 Lars Gullik Bjønnes - - * src/WorkArea.C (work_area_handler): more work to get te - FL_KEYBOARD to work with xforms 0.88 too, please test. - - * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard. - -2000-08-15 Dekel Tsur - - * src/frontends/ButtonPolicies.C: make gcc happy when compiling with - -pedantic - -2000-08-14 Lars Gullik Bjønnes - - * src/Timeout.h: remove Qt::emit hack. - - * several files: changes to allo doc++ compilation - - * src/lyxfunc.C (processKeySym): new method - (processKeyEvent): comment out if FL_REVISION < 89 - - * src/WorkArea.C: change some debugging levels. - (WorkArea): set wantkey to FL_KEY_ALL - (work_area_handler): enable the FL_KEYBOARD clause, this enables - clearer code and the use of compose with XForms 0.89. Change to - use signals instead of calling methods in bufferview directly. - - * src/Painter.C: change some debugging levels. - - * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback - if FL_REVISION < 89 - - * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals. - (workAreaKeyPress): new method - -2000-08-14 Juergen Vigna - - * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs. - - * config/kde.m4: addes some features - - * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to - include missing xforms dialogs. - - * src/Timeout.h: a hack to be able to compile with qt/kde. - - * sigc++/.cvsignore: added acinclude.m4 - - * lib/.cvsignore: added listerros - - * src/frontends/Makefile.am: modified for now to ALWAYS compile the - xforms tree as objects are needed for other frontends. - - * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for - linking with not yet implemented xforms objects. - - * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument. - -2000-08-14 Baruch Even - - * src/frontends/xforms/FormGraphics.h: - * src/frontends/xforms/FormGraphics.C: - * src/frontends/xforms/RadioButtonGroup.h: - * src/frontends/xforms/RadioButtonGroup.C: - * src/insets/insetgraphics.h: - * src/insets/insetgraphics.C: - * src/insets/insetgraphicsParams.h: - * src/insets/insetgraphicsParams.C: Changed indentation to use tabs - instead of spaces, and various other indentation issues to make the - sources more consistent. - -2000-08-14 Marko Vendelin - - * src/frontends/gnome/dialogs/diaprint.glade - * src/frontends/gnome/FormPrint.C - * src/frontends/gnome/FormPrint.h - * src/frontends/gnome/diaprint_callbacks.c - * src/frontends/gnome/diaprint_callbacks.h - * src/frontends/gnome/diaprint_interface.c - * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome - implementation - - * src/frontends/gnome/dialogs/diainserturl.glade - * src/frontends/gnome/FormUrl.C - * src/frontends/gnome/FormUrl.h - * src/frontends/gnome/diainserturl_callbacks.c - * src/frontends/gnome/diainserturl_callbacks.h - * src/frontends/gnome/diainserturl_interface.c - * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog - Gnome implementation - - * src/frontends/gnome/Dialogs.C - * src/frontends/gnome/Makefile.am: added Print, Insert Url and - all other dialogs. Copy all unimplemented dialogs from Xforms - frontend - - * src/frontends/gnome/support.c - * src/frontends/gnome/support.h: support files generated by Glade - - * autogen.sh - * configure.in - * config/gnome.m4: Gnome configuration scripts - - * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in - configure --help message - - * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime() - only if there are no events pendling in Gnome/Gtk. This enhances - the performance of menus. - - -2000-08-14 Allan Rae - - * lib/Makefile.am: listerrors cleaning - - * lib/listerrors: removed -- generated file - * acinclude.m4: ditto - * sigc++/acinclude.m4: ditto - - * src/frontends/xforms/forms/form_citation.fd: - * src/frontends/xforms/FormCitation.C (setSize): Made the form a more - manageable size. - - * src/frontends/xforms/forms/makefile: I renamed the `install` target - `updatesrc` and now we have a `test` target that does what `updatesrc` - used to do. I didn't like having an install target that wasn't related - to the dist. - - * src/frontends/xforms/Form*.[hC]: Removed the free() member functions - on all except FormGraphics. This may yet happen. Followed by a major - cleanup including using FL_TRANSIENT for most of the dialogs. More - changes to come when the ButtonController below is introduced. - - * src/frontends/xforms/ButtonController.h: New file for managing up to - four buttons on a dialog according to an externally defined policy. - * src/frontends/xforms/Makefile.am: added above - - * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok, - Apply and Cancel/Close buttons and everything in between and beyond. - * src/frontends/Makefile.am: added above. - - * src/frontends/xforms/forms/form_preferences.fd: - * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController - and removed variable 'status' as a result. Fixed the set_minsize thing. - Use the new screen-font-update after checking screen fonts were changed - Added a "Restore" button to restore the original lyxrc values while - editing. This restores everything not just the last input changed. - That's still a tricky one. As is the "LyX: this shouldn't happen..." - - * src/LyXAction.C: screen-font-update added for updating buffers after - screen font settings have been changed. - * src/commandtags.h: ditto - * src/lyxfunc.C: ditto - - * forms/lyx.fd: removed screen fonts dialog. - * src/lyx_gui.C: ditto - * src/menus.[Ch]: ditto - * src/lyx.[Ch]: ditto - * src/lyx_cb.C: ditto + code from here moved to make - screen-font-update. And people wonder why progress on GUII is - slow. Look at how scattered this stuff was! It takes forever - just find it all. - - * forms/fdfix.sh: Fixup the spacing after commas. - * forms/makefile: Remove date from generated files. Fewer clashes now. - * forms/bullet_forms.C.patch: included someones handwritten changes - - * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN - once I've discovered why LyXRC was made noncopyable. - * src/lyx_main.C: ditto - -2000-08-14 Angus Leeming - - * src/frontends/xforms/forms/fdfix.sh: - * src/frontends/xforms/forms/fdfixh.sed: - * src/frontends/xforms/forms/fdfixc.sed: New file from Angus - * src/frontends/xforms/Form*.[hC]: - * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation - scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to - provide a destructor for the struct FD_form_xxxx. Another version of - the set_[max|min]size workaround and a few other cleanups. Actually, - Angus' patch from 20000809. - -2000-08-13 Baruch Even - - * src/insets/insetgraphics.C (Clone): Added several fields that needed - copying. - -2000-08-11 Juergen Vigna - - * src/insets/insetgraphics.C (InsetGraphics): changing init - order because of warnings. - - * src/frontends/xforms/forms/makefile: adding patching .C with - .C.patch files. - - * src/frontends/xforms/forms/fdfix.sh: changing patching file .c - from .C.patch to .c.patch - - * src/frontends/xforms/FormCommand.C (FormCommand): changing init - order because of warning. - - * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog - - * src/frontends/Liason.C (setMinibuffer): new helper function - - * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument - - * src/lyxfunc.C (Dispatch): calling new Document-Layout - - * lib/ui/default.ui: commented out PaperLayout entry - - * src/frontends/xforms/form_document.[Ch]: new added files - - * src/frontends/xforms/FormDocument.[Ch]: ditto - - * src/frontends/xforms/forms/form_document.fd: ditto - - * src/frontends/xforms/forms/form_document.C.patch: ditto - -2000-08-10 Juergen Vigna - - * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle. - (InsetGraphics): initialized cacheHandle to 0. - (draw): changed call to updateInset to status=CHANGE_IN_DRAW. - -2000-08-10 Baruch Even - - * src/graphics/GraphicsCache.h: - * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work - correctly as a cache. - - * src/graphics/GraphicsCacheItem.h: - * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow - reference counting. - - * src/graphics/GraphicsCacheItem_pimpl.h: - * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the - GraphicsCacheItem. - - * src/insets/insetgraphics.h: - * src/insets/insetgraphics.C: Changed from using a signal notification - to polling when image is not loaded. - -2000-08-10 Allan Rae - - * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note - that there are two functions that have to been taken out of line by - hand and aren't taken care of in the script. (Just a reminder note) - - * sigc++/macros/*.h.m4: Updated as above. - -2000-08-09 Juergen Vigna - - * src/insets/insettext.C (draw): small fix for clearing rectangle. - - * src/insets/insettabular.C: make drawing of single cell smarter. - -2000-08-09 Marko Vendelin - * src/frontends/gnome/Menubar_pimpl.C - * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar - implementation: new files - - * src/frontends/gnome/mainapp.C - * src/frontends/gnome/mainapp.h: Gnome main window (temporary - implementation) - - * src/main.C: create Gnome main window - - * src/frontends/xforms/Menubar_pimpl.h - * src/frontends/Menubar.C - * src/frontends/Menubar.h: added method Menubar::update that calls - Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one) - - * src/LyXView.C: calls Menubar::update to update the state - of menu items - - * src/frontends/gnome/Makefile.am: added new files - - * src/frontends/Makefile.am: added frontend compiler options - -2000-08-08 Juergen Vigna - - * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled! - - * src/bufferlist.C (close): - * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed() - documents if exiting without saving. - - * src/buffer.C (save): use removeAutosaveFile() - - * src/support/filetools.C (removeAutosaveFile): new function. - - * src/lyx_cb.C (MenuWrite): returns a bool now. - (MenuWriteAs): check if file could really be saved and revert to the - old name if not. - (MenuWriteAs): removing old autosavefile if existant. - - * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration - before Goto toggle declaration, because of compiler warning. - - * src/frontends/xforms/FormRef.C: forgot include of - - * src/lyxfunc.C (MenuNew): small fix. - - * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag. - - * src/bufferlist.C (newFile): - * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc. - - * src/lyxrc.C: added new_ask_filename tag - -2000-08-07 Angus Leeming - - * src/lyx.fd: removed code pertaining to form_ref - * src/lyx.[Ch]: ditto - * src/lyx_cb.C: ditto - * src/lyx_gui.C: ditto - * src/lyx_gui_misc.C: ditto - - * src/BufferView_pimpl.C (restorePosition): update buffer only - if file has changed - - * src/commandtags.h (LFUN_REFTOGGLE): removed - (LFUN_INSERT_REF): renamed LFUN_REF_INSERT - (LFUN_REFGOTO): renamed LFUN_REF_GOTO - (LFUN_REFBACK): renamed LFUN_REF_BACK - - * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE - * src/menus.C: ditto - * src/lyxfunc.C (Dispatch): ditto. - InsertRef dialog is now GUI-independent. - - * src/texrow.C: added using std::endl; - - * src/insets/insetref.[Ch]: strip out large amounts of code. - The inset is now a container and this functionality is now - managed by a new FormRef dialog - - * src/frontends/Dialogs.h (showRef, createRef): new signals - - * src/frontends/xforms/FormIndex.[Ch], - src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug - when setting dialog's min/max size - * src/frontends/xforms/FormIndex.[Ch]: ditto - - * src/frontends/xforms/FormRef.[Ch], - src/frontends/xforms/forms/form_ref.fd: new xforms - implementation of an InsetRef dialog - - * src/graphics/GraphicsCache.[Ch]: small changes to compile with - DEC cxx - - * src/graphics/XPM_Renderer.C (isImageFormatOK): - ios::nocreate is not part of the standard. Removed. - -2000-08-07 Baruch Even - - * src/graphics/Renderer.h: - * src/graphics/Renderer.C: Added base class for rendering of different - image formats into Pixmaps. - - * src/graphics/XPM_Renderer.h: - * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed - in a different class. - - * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to - easily add support for other formats. - - * src/insets/figinset.C: plugged a leak of an X resource. - -2000-08-07 Lars Gullik Bjønnes - - * src/CutAndPaste.[Ch]: make all metods static. - - * development/Code_rules/Rules: more work, added section on - Exceptions, and a References section. - - * a lot of header files: work to make doc++ able to generate the - source documentation, some workarounds of doc++ problems. Doc++ is - now able to generate the documentation. - -2000-08-07 Juergen Vigna - - * src/insets/insettabular.C (recomputeTextInsets): removed function - - * src/tabular.C (SetWidthOfMulticolCell): - (SetWidthOfCell): - (calculate_width_of_column_NMC): fixed return value so that it really - only returns true if the column-width has changed (there where - problems with muliticolumn-cells in this column). - -2000-08-04 Juergen Vigna - - * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks - also on the scrollstatus of the inset. - (workAreaMotionNotify): ditto. - - * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2. - -2000-08-01 Juergen Vigna - - * src/insets/insettabular.C (resetPos): scroll tabular automatically. - - * src/commandtags.h: - * src/LyXAction.C (init): - * src/insets/inset.C (LocalDispatch): added support for - LFUN_SCROLL_INSET. - - * src/insets/inset.C (scroll): new functions. - - * src/insets/insettext.C (removeNewlines): new function. - (SetAutoBreakRows): removes forced newlines in the text of the - paragraph if autoBreakRows is set to false. - - * src/tabular.C (Latex): generates a parbox around the cell contents - if needed. - - * src/frontends/xforms/FormTabular.C (local_update): removed - the radio_useparbox button. - - * src/tabular.C (UseParbox): new function - -2000-08-06 Baruch Even - - * src/graphics/GraphicsCache.h: - * src/graphics/GraphicsCache.C: - * src/graphics/GraphicsCacheItem.h: - * src/graphics/GraphicsCacheItem.C: Made them to actually do something - usefull. - - * src/insets/insetgraphics.h: - * src/insets/insetgraphics.C: Added the use of the GraphicsCache - and the drawing of the inline image. - - * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be - loaded into the wrong position. - - * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now - launched. - -2000-08-05 Lars Gullik Bjønnes - - * src/support/translator.h: move all typedefs to public section - - * src/support/filetools.C (MakeLatexName): return string const - (QuoteName): ditto - (TmpFileName): ditto - (FileOpenSearch): ditto - (FileSearch): ditto - (LibFileSearch): ditto - (i18nLibFileSearch): ditto - (GetEnv): ditto - (GetEnvPath): ditto - (CreateTmpDir): ditto - (CreateBufferTmpDir): ditto - (CreateLyXTmpDir): ditto - (GetCWD): ditto - (OnlyPath): ditto - (MakeAbsPath): ditto - (AddName): ditto - (OnlyFilename): ditto - (ExpandPath): ditto - (NormalizePath): ditto - (CleanupPath): ditto - (GetFileContents): ditto - (ReplaceEnvironmentPath): ditto - (MakeRelPath): ditto - (AddPath): ditto - (ChangeExtension): ditto - (MakeDisplayPath): ditto - (do_popen): return cmdret const - (findtexfile): return string const - - * src/support/DebugStream.h: add some /// to please doc++ - - * src/frontends/DialogBase.h (endif): add some /// to please doc++ - - * src/texrow.C (same_rownumber): functor to use with find_if - (getIdFromRow): rewritten to use find_if and to not update the - positions. return true if row is found - (increasePos): new method, use to update positions - - * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable - - * src/lyxlex_pimpl.C (verifyTable): new method - (pushTable): use it - (Pimpl): use it - (GetString): return string const - (pushTable): rewrite to use std::stack - (popTable): ditto - (setFile): better check - (setStream): ditto - - * src/lyxlex.h: make LyXLex noncopyable - - * src/lyxlex.C (text): return char const * const - (GetString): return string const - (getLongString): return string const - - * src/lyx_gui_misc.C (askForText): return pair<...> const - - * src/lastfiles.[Ch] (operator): return string const - - * src/buffer.C (parseSingleLyXformat2Token): pass string to - istringstream not char const *. - move token.end() out of loop. - (readFile): move initializaton of token - - * src/BufferView2.C (insertErrors): run texrow.increasePos if - getIdFromRow is successful. - - * lib/bind/emacs.bind: don't include menus bind - - * development/Code_rules/Rules: the beginnings of making this - better and covering more of the unwritten rules that we have. - - * development/Code_rules/Recommendations: a couple of wording - changes. - -2000-08-04 Jean-Marc Lasgouttes - - * src/support/strerror.c: remove C++ comment. - -2000-08-04 Angus Leeming - - * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to - LFUN_INDEX_INSERT_LAST - - * src/texrow.C (getIdFromRow): changed from const_iterator to - iterator, allowing code to compile with DEC cxx - - * src/frontends/xforms/FormCitation.[Ch]: made vector - stores part of the class, as suggested by Allan. Will allow - multiple LyXViews. - (apply): test to apply uses InsetCommandParams operator!= - - * src/frontends/xforms/FormIndex.C: moved set_minsize into build - (apply): test to apply uses InsetCommandParams operator!= - - * src/frontends/xforms/FormToc.[Ch]: made vector - stores part of the class. - (update): removed limits on min/max size. - - * src/frontends/xforms/FormUrl.C: moved set_minsize into build - (apply): test to apply uses InsetCommandParams operator!= - - * src/insets/insetcommand.[Ch] InsetCommand made noncopyable - (Read, Write, scanCommand, getCommand): moved functionality - into InsetCommandParams. - (Clone): removed - (getScreenLabel): made pure virtual - new InsetCommandParams operators== and != - - * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new - c-tors based on InsetCommandParams. Removed others. - * src/insets/insetinclude.[Ch]: ditto - * src/insets/insetlabel.[Ch]: ditto - * src/insets/insetparent.[Ch]: ditto - * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C - - * src/buffer.C (parseSingleLyXformat2Token, readInset): all - insets derived from InsetCommand created using similar c-tors - based on InsetCommandParams - * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto - * src/menus.C (ShowRefsMenu): ditto - * src/paragraph.C (Clone): ditto - * src/text2.C (SetCounter): ditto - * src/lyxfunc.C (Dispatch) ditto - Also recreated old InsetIndex behaviour exactly. Can now - index-insert at the start of a paragraph and index-insert-last - without launching the pop-up. - -2000-08-03 Lars Gullik Bjønnes - - * lib/lyxrc.example: mark te pdf options as non functional. - - * src/support/lstrings.C (strToInt): move initalization of tmpstr - (isStrDbl): move tmpstr.end() out of loop. - (strToDbl): move intialization of tmpstr - (lowercase): return string const and move tmp.end() out of loop. - (uppercase): return string const and move tmp.edn() out of loop. - (prefixIs): add assertion - (suffixIs): ditto - (contains): ditto - (contains): ditto - (contains): ditto - (containsOnly): ditto - (containsOnly): ditto - (containsOnly): ditto - (countChar): make last arg char not char const - (token): return string const - (subst): return string const, move tmp.end() out of loop. - (subst): return string const, add assertion - (strip): return string const - (frontStrip): return string const, add assertion - (frontStrip): return string const - (split): ditto - (split): ditto - (rsplit): ditto - - * src/support/lstrings.C: add inclde "LAssert.h" - (isStrInt): move tmpstr.end() out of loop. - - * src/frontends/xforms/Toolbar_pimpl.C (activate): move - toollist.end() out of loop. - (deactivate): move toollist.end() out of loop. - (update): move toollist.end() out of loop. - (updateLayoutList): move tc.end() out of loop. - (add): move toollist.end() out of loop. - - * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move - md.end() out of loop. - - * src/texrow.h: make getIdFromRow const, make rowlist mutable. - - * src/texrow.C (getIdFromRow): make const, more rowlist.end() out - of loop. - - * src/paragraph.C (Erase): move fontlist.end() out of loop. - (Erase): move insetlist.end() out of loop. - - * src/lyx_sendfax_main.C: make show_logfile static and to take a - ref to const string as first arg. Move initialization of some - variables, whitespace changes. - - * src/kbmap.C (defkey): move table.end() out of loop. - (kb_keymap): move table.end() out of loop. - (findbinding): move table.end() out of loop. - - * src/MenuBackend.C (hasMenu): move end() out of loop. - (getMenu): move end() out of loop. - (getMenu): move menulist_.end() out of loop. - - * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out. - - * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end() - out of loop. - - * src/LColor.C (getFromGUIName): move infotab.end() out of loop. - (getFromLyXName): move infotab.end() out of loop. - - * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add - -fvtable-thunks -ffunction-sections -fdata-sections - -2000-08-03 Dekel Tsur - - * src/frontends/xforms/RadioButtonGroup.h: Changed to - FORMS_H_LOCATION. - -2000-08-03 Angus Leeming - - * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed - - * src/frontends/xforms/FormCitation.[Ch], - src/frontends/xforms/FormIndex.[Ch], - src/frontends/xforms/FormToc.[Ch], - src/frontends/xforms/FormUrl.[Ch] (d-tors): call free() - -2000-08-03 Angus Leeming - - * src/commandtags.h: renamed, created some flags for citation - and index - - * src/lyx_gui_misc.C: stripped out old FD_index_form code - - * src/lyxfunc.C (dispatch): use signals to insert index entry - - * src/frontends/Dialogs.h: new signal createIndex - - * src/frontends/xforms/FormCommand.[Ch], - src/frontends/xforms/FormCitation.[Ch], - src/frontends/xforms/FormToc.[Ch], - src/frontends/xforms/FormUrl.[Ch]: clean up and comment better - - * src/insets/insetindex.[Ch]: GUI-independent - - * src/frontends/xforms/FormIndex.[Ch], - * src/frontends/xforms/forms/form_index.fd: xforms implementation - of the Index dialog - -2000-08-01 Dekel Tsur - - * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect - before \overbrace, \underbrace, \overleftarrow, or \overrightarrow. - -2000-08-02 Lars Gullik Bjønnes - - * src/insets/insetref.C (Latex): rewrite so that there is now - question that a initialization is requested. - - * src/insets/insetcommand.h: reenable the hide signal - -2000-08-01 Jean-Marc Lasgouttes - - * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to - fix handling of shortcuts (many bugs :) - (add_lastfiles): ditto. - - * lib/ui/default.ui: fix a few shortcuts. - -2000-07-27 Kayvan A. Sylvan - - * Makefile.am: Fix ``rpmdist'' target to return the exit - status of the ``rpm'' command, instead of the last command in - the chain (the ``rm lyx.xpm'' command, which always returns - success). - -2000-08-02 Allan Rae - - * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables. - * src/frontends/xforms/FormCitation.C (FormCitation): ditto - * src/frontends/xforms/FormToc.C (FormToc): ditto - - * src/frontends/xforms/Makefile.am: A few forgotten files - - * src/frontends/xforms/FormCommand.C (showInset): The rest of the - Signals-not-copyable-problem Lars' started commenting out. - - * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx. - -2000-08-01 Lars Gullik Bjønnes - - * src/insets/insetcommand.h: Signals is not copyable so anoter - scheme for automatic hiding of forms must be used. - - * src/frontends/xforms/FormCitation.h: don't inerit from - noncopyable, FormCommand already does that. - * src/frontends/xforms/FormToc.h: ditto - * src/frontends/xforms/FormUrl.h: ditto - - * src/frontends/xforms/FormCitation.C: add include - -2000-08-01 Angus Leeming - - * src/insets/insetcommand.h (hide): new SigC::Signal0 - (d-tor) new virtual destructor emits hide signal - - * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed - * src/insets/inseturl.[Ch] (hide, d-tor): ditto - - * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA, - LOF and LOT. Inset is now GUI-independent - - * src/insets/insetloa.[Ch]: redundant - * src/insets/insetlof.[Ch]: ditto - * src/insets/insetlot.[Ch]: ditto - - * src/frontends/xforms/forms/form_url.fd: tweaked! - * src/frontends/xforms/forms/form_citation.fd: ditto - - * src/frontends/xforms/FormCommand.[Ch]: new base class to those - dialogs dealing with InsetCommand insets - - * src/frontends/xforms/FormCitation.[Ch]: now makes use of - FormCommand base class - * src/frontends/xforms/FormUrl.[Ch]: ditto - - * src/frontends/xforms/forms/form_toc.fd: Xforms implementation - of the TOC dialog - * src/frontends/xforms/FormToc.[Ch]: ditto - - * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all - passed a generic InsetCommand pointer - * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc - - * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class - and modified InsetTOC class - * src/buffer.C: ditto - - * forms/lyx.fd: strip out old FD_form_toc code - * src/lyx_gui_misc.C: ditto - * src/lyx_gui.C: ditto - * src/lyx_cb.C: ditto - * src/lyx.[Ch]: ditto - -2000-08-01 Lars Gullik Bjønnes - - * src/support/utility.hpp: tr -d '\r' - -2000-08-01 Juergen Vigna - - * src/insets/insettabular.h: removed initFeatures() as it's not needed. - - * src/commandtags.h: - * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and - LFUN_TABULAR_FEATURES. - - * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and - LFUN_LAYOUT_TABULAR. - - * src/insets/insettabular.C (getStatus): implemented helper function. - - * lib/ui/default.ui: implemented edit-table-menu and layout-tabular. - -2000-07-31 Juergen Vigna - - * src/text.C (draw): fixed screen update problem for text-insets. - - * src/text2.C (SetParagrpah): call an update of the inset-owner when - something changed probably this has to be added in various other - functions too. - - * src/insets/insettext.C (cy): fixed to give back the right cursor.y(). - -2000-07-31 Baruch Even - - * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew - templates to satisfy compaq cxx. - - -2000-07-31 Lars Gullik Bjønnes - - * src/support/translator.h (equal_1st_in_pair::operator()): take - const ref pair_type as arg. - (equal_2nd_in_pair::operator()): ditto - (Translator::~Translator): remove empty d-tor. - - * src/graphics/GraphicsCache.C: move include config.h to top, also - put initialization of GraphicsCache::singleton here. - (~GraphicsCache): move here - (addFile): take const ref as arg - (removeFile): ditto - - * src/lyxlex_pimpl.C (setFile): comment in old behaviour - - * src/BufferView2.C (insertLyXFile): change te with/without header - check slightly. - -2000-07-31 Jean-Marc Lasgouttes - - * src/frontends/xforms/FormGraphics.C (apply): add some - static_cast. Not very nice, but required by compaq cxx. - - * src/frontends/xforms/RadioButtonGroup.h: include header - instead of - - * src/insets/insetgraphicsParams.C: add using directive. - (readResize): change return type to void. - (readOrigin): ditto. - - * src/lyxfunc.C (getStatus): add missing break for build-program - function; add test for Literate for export functions. - - * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid - entries in Options menu. - -2000-07-31 Baruch Even - - * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=): - protect against auto-allocation; release icon when needed. - -2000-07-31 Matej Cepl - - * lib/kbd/czech.kmap: new file. standard Czech keyboard as found - on usual typewriter. - - * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the - earlier czech.kmap), useful only for programming. - -2000-07-28 Jean-Marc Lasgouttes - - * src/frontends/xforms/FormCitation.h: fix conditioning around - #pragma. - -2000-07-31 Juergen Vigna - - * src/frontends/xforms/FormTabular.C (local_update): changed - radio_linebreaks to radio_useparbox and added radio_useminipage. - - * src/tabular.C: made support for using minipages/parboxes. - - * src/bufferlist.C (QwriteAll): small fix for asking for save. - - * src/insets/insetgraphics.C (draw): just draw the inset so that the - cursor is visible. - (descent): so the cursor is in the middle. - (width): bit smaller box. - - * src/insets/insetgraphics.h: added display() function. - -2000-07-31 Baruch Even - - * src/frontends/Dialogs.h: Added showGraphics signals. - - * src/frontends/xforms/forms/form_graphics.fd: Added file, the - xforms form definition of the graphics dialog. - - * src/frontends/xforms/FormGraphics.h: - * src/frontends/xforms/FormGraphics.C: Added files, the - GUIndependent code of InsetGraphics - - * src/insets/insetgraphics.h: - * src/insets/insetgraphics.C: Major writing to make it work. - - * src/insets/insetgraphicsParams.h: - * src/insets/insetgraphicsParams.C: Added files, parameter passing - struct between InsetGraphics and GUI. - - * src/LaTeXFeatures.h: - * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled - support for graphicx package. - - * src/buffer.C (parseSingleLyXformat2Token): Fixed read support - for the graphics inset. - - * src/support/translator.h: Added file, used in - InsetGraphicsParams. this is a template to translate between two - types. - - * src/frontends/xforms/RadioButtonGroup.h: - * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a - way to easily control a radio button group. - -2000-07-28 Juergen Vigna - - * src/insets/insettabular.C (LocalDispatch): - (TabularFeatures): added support for lyx-functions of tabular features. - (cellstart): refixed this function after someone wrongly changed it. - - * src/commandtags.h: - * src/LyXAction.C (init): added support for tabular-features - -2000-07-28 Allan Rae - - * src/frontends/xforms/FormPreferences.C (build): Setup input return - checking. NOTE: It seems that pressing ESC to cancel the dialog also - triggers the callback for input checking. As a result we sometimes get - "LyX: This shouldn't happen..." printed to cerr. - (input): Started using status variable since I only free() on - destruction. Some input checking for paths and font sizes. - - * src/frontends/xforms/FormPreferences.h: Use status to control - activation of Ok and Apply - - * src/frontends/xforms/forms/form_preferences.fd: Setup input return - callback. Also resized to stop segfaults with 0.88. The problem is - that xforms-0.88 requires the folder to be wide enough to fit all the - tabs. If it isn't it causes all sorts of problems. - - * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form... - - * src/frontends/xforms/forms/README: Reflect reality. - - * src/frontends/xforms/forms/fdfix.sh: Clean up comments - * src/frontends/xforms/forms/makefile: ditto. - - * src/commandtags.h: Get access to new Preferences dialog - * src/LyXAction.C: ditto - * src/lyxfunc.C: ditto - * lib/ui/default.ui: ditto - -2000-07-27 Jean-Marc Lasgouttes - - * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh. - - * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a - few files. - - * src/frontends/xforms/form_url.[Ch]: added. - -2000-07-27 Lars Gullik Bjønnes - - * src/insets/insetbib.h: fixed bug in previous commit - - * src/frontends/xforms/FormUrl.h: ditto - - * src/frontends/xforms/FormPrint.h: ditto - - * src/frontends/xforms/FormPreferences.h: ditto - - * src/frontends/xforms/FormCopyright.h: ditto - - * src/frontends/xforms/FormCitation.C: ditto - - * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove - private copyconstructor and private default contructor - - * src/support/Makefile.am: add utility.hpp - - * src/support/utility.hpp: new file from boost - - * src/insets/insetbib.h: set owner in clone - - * src/frontends/xforms/FormCitation.C: added missing include - algorithm - - * src/insets/form_url.[Ch]: removed - -2000-07-26 Kayvan A. Sylvan - - * development/lyx.spec.in - * Makefile.am: Fix buglet for LyX RPM generation resulting from - file/directory re-organization. - -2000-07-26 Angus Leeming - - * src/insets/insetcommand.[Ch]: moved the string data and - associated manipulation methods into a new stand-alone class - InsetCommandParams. This class has two additional methods - getAsString() and setFromString() allowing the contents to be - moved around as a single string. - (addContents) method removed. - (setContents) method no longer virtual. - - * src/buffer.C (readInset): made use of new InsetCitation, - InsetUrl constructors based on InsetCommandParams. - - * src/commandtags.h: add LFUN_INSERT_URL - - * src/lyxfunc.C (Dispatch): changed to accomadate GUI- - independent InsetUrl and use InsetCommandParams to extract - string info and create new Insets. - - * src/frontends/Dialogs.h: add signals showUrl, createUrl. - - * src/frontends/xforms/FormCitation.C (apply): uses - InsetCommandParams. - - * src/frontends/xforms/form_url.C - * src/frontends/xforms/form_url.h - * src/frontends/xforms/FormUrl.h - * src/frontends/xforms/FormUrl.C - * src/frontends/xforms/forms/form_url.fd: new files - - * src/insets/insetcite.[Ch]: removed unused constructors. - - * src/insets/insetinclude.[Ch]: no longer store filename - - * src/insets/inseturl.[Ch]: GUI-independent. - -2000-07-26 Juergen Vigna - * renamed frontend from gtk to gnome as it is that what is realized - and did the necessary changes in the files. - -2000-07-26 Marko Vendelin - * autogen.sh - * configure.in: cleaning up gnome configuration scripts - -2000-07-26 Jean-Marc Lasgouttes - - * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing - shortcuts syndrom by redrawing them explicitely (a better solution - would be appreciated). - - * src/lyxfunc.C (getStatus): fix crash when functions are disabled. - - * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of - the button. - - * src/lyx_cb.C (MenuExport): change html export to do the right - thing depending of the document type (instead of having - html-linuxdoc and html-docbook). - * src/lyxfunc.C (getStatus): update for html - * lib/ui/default.ui: simplify due to the above change. - * src/menus.C (ShowFileMenu): update too (in case we need it). - - * src/MenuBackend.C (read): if a menu is defined twice, add the - new entries to the exiting one. - -2000-07-26 Juergen Vigna - - * src/buffer.h: added functions setUnnamed(bool) and isUnnamed(). - - * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs - and return a bool if it did actual save the file. - (AutoSave): don't autosave a unnamed doc. - - * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll): - check if this is an UNNAMED new file and react to it. - (newFile): set buffer to unnamed and change to not mark a new - buffer dirty if I didn't do anything with it. - - * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new. - -2000-07-26 Lars Gullik Bjønnes - - * src/frontends/Menubar.h: make "struct Pimpl;" public + the - friend as per Angus's patch posted to lyx-devel. - - * src/ext_l10n.h: updated - - * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run - gettext on the style string right before inserting them into the - combox. - - * autogen.sh: add code to extract style strings form layout files, - not good enough yet. - - * src/frontends/gtk/.cvsignore: add MAKEFILE - - * src/MenuBackend.C (read): run the label strings through gettext - before storing them in the containers. - - * src/ext_l10n.h: new file - - * autogen.sh : generate the ext_l10n.h file here - -2000-07-25 Jean-Marc Lasgouttes - - * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color - arguments. - - * lib/ui/default.ui: fix a couple of typos. - - * config/gnome/gtk.m4: added (and added to the list of files in - autogen.sh). - - * src/insets/insetinclude.C (unique_id): fix when we are using - lyxstring instead of basic_string<>. - * src/insets/insettext.C (LocalDispatch): ditto. - * src/support/filetools.C: ditto. - - * lib/configure.m4: create the ui/ directory if necessary. - - * src/LyXView.[Ch] (updateToolbar): new method. - - * src/BufferView_pimpl.C (buffer): update the toolbar when - opening/closing buffer. - -2000-07-24 Jean-Marc Lasgouttes - - * src/LyXAction.C (getActionName): enhance to return also the name - and options of pseudo-actions. - (init): New lyxfunc LFUN_MATH_PANEL=="math-panel". - - * lib/ui/default.ui: use OptItem in the vc submenu (intented just - as an example of what is possible). Used in File->Build too (more - useful) and in the import/export menus (to mimick the complicated - handling of linuxdoc and friends). Try to update all the entries. - - * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle - optional entries. - - * src/MenuBackend.C (read): Parse the new OptItem tag. - - * src/MenuBackend.h: Add a new optional_ data member (used if the - entry should be omitted when the lyxfunc is disabled). - - * src/frontends/xforms/Menubar_pimpl.C (string_width): new - function, used as a shortcut. - (create_submenu): align correctly the shortcuts on the widest - entry. - - * src/MenuBackend.h: MenuItem.label() only returns the label of - the menu without shortcut; new method shortcut(). - -2000-07-14 Marko Vendelin - - * src/frontends/gtk/Dialogs.C: - * src/frontends/gtk/FormCopyright.C: - * src/frontends/gtk/FormCopyright.h: - * src/frontends/gtk/Makefile.am: added these source-files for the - Gtk/Gnome support of the Copyright-Dialog. - - * src/main.C: added Gnome::Main initialization if using - Gtk/Gnome frontend-GUI. - - * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome - frontend-GUI. - * config/gnome/aclocal-include.m4 - * config/gnome/compiler-flags.m4 - * config/gnome/curses.m4 - * config/gnome/gnome--.m4 - * config/gnome/gnome-bonobo-check.m4 - * config/gnome/gnome-common.m4 - * config/gnome/gnome-fileutils.m4 - * config/gnome/gnome-ghttp-check.m4 - * config/gnome/gnome-gnorba-check.m4 - * config/gnome/gnome-guile-checks.m4 - * config/gnome/gnome-libgtop-check.m4 - * config/gnome/gnome-objc-checks.m4 - * config/gnome/gnome-orbit-check.m4 - * config/gnome/gnome-print-check.m4 - * config/gnome/gnome-pthread-check.m4 - * config/gnome/gnome-support.m4 - * config/gnome/gnome-undelfs.m4 - * config/gnome/gnome-vfs.m4 - * config/gnome/gnome-x-checks.m4 - * config/gnome/gnome-xml-check.m4 - * config/gnome/gnome.m4 - * config/gnome/gperf-check.m4 - * config/gnome/gtk--.m4 - * config/gnome/linger.m4 - * config/gnome/need-declaration.m4: added configuration scripts - for Gtk/Gnome frontend-GUI - - * configure.in: added support for the --with-frontend=gtk option - - * autogen.sh: added config/gnome/* to list of config-files - - * acconfig.h: added define for GTKGUI-support - - * config/lyxinclude.m4: added --with-frontend[=value] option value - for Gtk/Gnome frontend-GUI support. - -2000-07-25 Lars Gullik Bjønnes - - * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring - can be used. - (suffixIs): ditto - - * src/paragraph.C (GetChar): remove non-const version - - * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96 - (search_kw): use it. - - * src/lyx_main.C (init): if "preferences" exist, read that instead - of "lyxrc". - (ReadRcFile): return bool if the file could be read ok. - (ReadUIFile): add a check to see if lex file is set ok. - - * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc - bastring can be used instead of lyxstring (still uses the old code - if std::string is good enough or if lyxstring is used.) - - * src/encoding.C: make the arrays static, move ininle functions - here - * src/encoding.h: from here. - - * src/buffer.C: have last_isnet_read as a file scope variable for now. - (parseSingleLyXformat2Token): move inset parsing to separate method - (readInset): new private method - - * src/Variables.h: remove virtual from get(). - - * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get - access to NEW_INSETS and NEW_TABULAR - - * src/MenuBackend.h: remove superfluous forward declaration of - MenuItem. Add documentations tags "///", remove empty MenuItem - destructor, remove private default contructor. - - * src/MenuBackend.C (MenuItem): remove unneeded copy contructor - (add): return *this - (read): more string mlabel and mname to where they are used - (read): remove unused variables mlabel and mname - (defaults): unconditional clear, make menusetup take advantage of - add returning Menu &. - - * src/LyXView.h: define NEW_MENUBAR as default - - * src/LyXAction.C: include lyxparagraph.h temporary to get access - to NEW_INSETS and NEW_TABULAR. - (init): commetn out some funcs that is obsolete when NEW_INSETS is - defined. Change some of the "xxxx-inset-insert" functions names to - "xxxx-insert". - - * several files: more enahncements to NEW_INSETS and the resulting - LyXParagraph code. - - * lib/lyxrc.example (\date_insert_format): move to misc section - - * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc - bastring and use AC_CACHE_CHECK. - (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of - the system have the newest methods. uses AC_CACHE_CHECK - (LYX_CXX_MUTABLE): use AC_CACHE_CHECK - (LYX_CXX_PARTIAL): use AC_CACHE_CHECK - (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK - - * configure.in: add LYX_CXX_GOOD_STD_STRING - - * acinclude.m4: recreated - -2000-07-24 Amir Karger - - * README: add Hebrew, Arabic kmaps - * ANNOUNCE: typo - -2000-07-24 Jean-Marc Lasgouttes - - * src/buffer.C (writeFileAscii): Define actcell as an int instead - of int*. - -2000-07-23 Jean-Marc Lasgouttes - - * Lot of files: add pragma interface/implementation. - - * src/lyx_main.C (ReadUFile): new method. Read the UI file. - - * lib/ui/default.ui: new file (ans new directory). Contains the - default menu and toolbar. - - * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to - global space. Toolbars are now read (as menus) in ui files. - - * src/debug.C: change Debug::TOOLBAR to Debug::GUI. - - * src/lyxfunc.C (getStatus): do not exit immediately if a command - is disabled because the document is read-only. We want to have the - toggle state of the function anyway. - (getStatus): add code for LFUN_VC* functions (mimicking what is - done in old-style menus) - - * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER, - LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN. - - * src/LyXView.[Ch]: add code for the NEW_MENUBAR define. - * src/BufferView_pimpl.C: ditto. - * src/lyxfunc.C: ditto. - - * src/LyXView.h: add a define NEW_MENUBAR (commented out by - default). This replaces old-style menus by new ones. - - * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and - MenuItem. Contain the data structure of a menu. - - * src/insets/insettext.C: use LyXView::setLayout instead of - accessing directly the toolbar combox. - * src/lyxfunc.C (Dispatch): ditto. - - * src/LyXView.C (setLayout): new method, which just calls - Toolbar::setLayout(). - (updateLayoutChoice): move part of this method in Toolbar. - - * src/toolbar.[Ch]: removed. - - * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms - implementation the toolbar. - - * src/frontend/Toolbar.[Ch]: new files. The abstract interface of - the toolbar. It might make sense to merge it with ToolbarDefaults - later. - (setLayout): new function. - (updateLayoutList): ditto. - (openLayoutList): ditto. - - * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the - xforms implementation of the toolbar. - (get_toolbar_func): comment out, since I do not - know what it is good for. - - * src/ToolbarDefaults.h: Add the ItemType enum. - - * src/support/StrPool.[Ch]: new class. Acts as a reference holder - for a list of allocated C strings. Used in Menubar xforms - implementation to avoid memory leaks. - - * src/support/lstrings.[Ch] (uppercase): new version taking and - returning a char. - (lowercase): ditto. - - * lib/bind/xemacs.bind: remove bogus binding for lyx-quit. - * lib/bind/emacs.bind: ditto. - -2000-07-21 Lars Gullik Bjønnes - - * src/toolbar.h: include commandtags.h instead of lyxfunc.h, - forward decl of LyXView. - - * src/toolbar.C (toolbarItem): moved from toolbar.h - (toolbarItem::clean): ditto - (toolbarItem::~toolbarItem): ditto - (toolbarItem::operator): ditto - - * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff - - * src/paragraph.h: control the NEW_TABULAR define from here - - * src/buffer.C: remove define USE_PARSE_FUNCTION, change - USE_TABULAR_INSETS to NEW_TABULAR - - * src/ToolbarDefaults.C: add include "lyxlex.h" - - * files using the old table/tabular: use NEW_TABULAR to control - compilation of old tabular stuff. - - * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef - to correct place. - - * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the - planemet in reading of old style floats, fix the \end_deeper - problem when reading old style floats. - -2000-07-20 Lars Gullik Bjønnes - - * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif - -2000-07-20 Serge Winitzki - - * lib/bind/sciword.bind: updated. - -2000-07-20 Lars Gullik Bjønnes - - * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the - layout write problem - -2000-07-20 Jean-Marc Lasgouttes - - * src/Makefile.am (INCLUDES): remove image directory from include - path. - - * src/bullet_forms.C (create_form_form_bullet): small cleanup. - * src/bullet_forms_cb.C (BulletPanelCB): ditto. - - * src/LyXView.C (create_form_form_main): read the application icon - from the disk. - - * lib/images/*.xpm: change the icons to use transparent color for - background. - - * src/toolbar.C (update): change the color of the button when it - is toggled on. - -2000-07-20 Jean-Marc Lasgouttes - - * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of - setting explicitely the minibuffer. - * src/BufferView_pimpl.C (workAreaButtonRelease): ditto. - - * src/LyXView.C (showState): new function. Shows font information - in minibuffer and update toolbar state. - (LyXView): call Toolbar::update after creating the - view. - - * src/toolbar.C: change toollist to be a vector instead of a - linked list. - (BubbleTimerCB): get help string directly from the callback - argument of the corresponding icon (which is the action) - (set): remove unnecessary ugliness. - (update): new function. update the icons (depressed, disabled) - depending of the status of the corresponding action. - - * src/toolbar.h: remove help in toolbarItem - -2000-07-19 Dekel Tsur - - * src/Painter.C (text): Added code for using symbol glyphs from - iso10646 fonts. Currently diabled. - - * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and - symbol_encoding. - - * src/language.C (initL): Fixed encodings for esperanto,lsorbian, - magyar,turkish and usorbian. - - * src/paragraph.C (isMultiLingual): Made more efficient. - - * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek - keyboard. - - * src/mathed/math_symbols.C (math_insert_greek): Changed to use - LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol(). - Also changed the prototype to "bool math_insert_greek(char)". - -2000-07-19 Lars Gullik Bjønnes - - * lots of files: apply the NEW_INSETS on all code that will not be - needed when we move to use the new insets. Enable the define in - lyxparagrah.h to try it. - - * src/insets/insettabular.C (cellstart): change to be a static - inline function - (InsetTabular): initialize buffer in the initializer list. - -2000-07-19 Angus Leeming - - * src/frontends/xforms/FormPrint.[Ch] : moved #include - form_print.h out of the header file. Replaced with forward - declarations of the relevant struct. - - * src/frontends/xforms/FormPreferences.[Ch] : ditto for - form_preferences.h. - - * src/commandtags.h: do not include "debug.h" which does not - belong there. #include it in some other places because of this - change. - -2000-07-19 Jean-Marc Lasgouttes - - * src/insets/insetcaption.C: add a couple "using" directives. - - * src/toolbar.C (add): get the help text directly from lyxaction. - (getPixmap): nuked. - (setPixmap): new function. Loads from disk and sets a pixmap on a - botton; the name of the pixmap file is derived from the command - name. - - * src/toolbar.h: remove members isBitmap and pixmap from - toobarItem struct. - - * lib/images/*.xbm *_bw.xpm: remove (not used any more). - * lib/images/: move many files from images/banner.xpm. - - * src/lyx_gui.C (create_forms): read banner pixmap from file. - - * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support. - * src/toolbar.C: ditto. - * configure.in: ditto. - * INSTALL: document. - - * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when - the spellchecker popup is closed from the WM. - -2000-07-19 Juergen Vigna - - * src/insets/insetfloat.C (Write): small fix because we use the - insetname for the type now! - -2000-07-18 Angus Leeming - - * src/frontends/xforms/forms/form_citation.fd: object sizes are - now set here - - * src/frontends/Dialogs.h: removed hideCitation signal - - * src/insets/insetcite.h: added hide signal - - * src/insets/insetcite.C (~InsetCitation): emits new signal - (getScreenLabel): "intelligent" label should now fit on the screen! - - * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed - - * src/frontends/xforms/FormCitation.C (showInset): connects - hide() to the inset's hide signal - (show): modified to use fl_set_object_position rather than - fl_set_object_geometry wherever possible - -2000-07-18 Lars Gullik Bjønnes - - * src/insets/lyxinset.h: add caption code - - * src/insets/insetfloat.C (type): new method - - * src/insets/insetcaption.C (Write): new method - (Read): new method - (LyxCode): new method - - * src/text2.C (SetCounter): revert Jürgens code, but use his idea - to get it right together with using the FloatList. - - * src/commandtags.h: add LFUN_INSET_CAPTION - * src/lyxfunc.C (Dispatch): handle it - - * src/buffer.C (parseSingleLyXformat2Token): add code to read a - caption inset. - - * src/Variables.[Ch]: make expand take a const reference, remove - the destructor, some whitespace changes. - - * src/LyXAction.C (init): add caption-inset-insert - - * src/FloatList.C (FloatList): update the default floats a bit. - -2000-07-17 Jean-Marc Lasgouttes - - * src/Variables.[Ch]: new files. Intended to be used for language - specific strings (like \chaptername) and filename substitution in - commands. - - * src/trans.C (AddDeadkey): replace keyword "all" with "native" in - kmap files. - * lib/kbd/american.kmap: update - - * src/trans_mgr.C (normalkey): do not test allowAccent anymore. - - * src/bufferparams.[Ch]: remove member allowAccents. - - * src/menus.C (ShowOptionsMenu): remove the LaTeX entry. - - * src/LaTeXLog.C: use the log_form.h header. - * src/lyx_gui.C: ditto. - * src/lyx_gui_misc.C: ditto. - * src/lyxvc.h: ditto. - - * forms/log_form.fd: new file, created from latexoptions.fd. I - kept the log popup and nuked the options form. - - * src/{la,}texoptions.[Ch]: removed. - * src/lyx_cb.C (LaTeXOptions): ditto - - * src/lyx_gui.C (create_forms): do not handle the - fd_latex_options form. - -2000-07-18 Juergen Vigna - - * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the - name of the inset so that it can be requested outside (text2.C). - - * src/text2.C (SetCounter): modified so it sees insetfloat for caption - labels. - -2000-07-17 Lars Gullik Bjønnes - - * src/mathed/formula.h (ConvertFont): constify - - * src/mathed/formula.C (Read): add warning if \end_inset is not - found on expected place. - - * src/insets/lyxinset.h (ConvertFont): consify - - * src/insets/insetquotes.C (ConvertFont): constify - * src/insets/insetquotes.h: ditto - - * src/insets/insetinfo.h: add labelfont - - * src/insets/insetinfo.C (InsetInfo): set the labelfont - (ascent): use labelfont - (descent): likewise - (width): likewise - (draw): likewise - (Write): make .lyx file a bit nicer - - * src/insets/insetfloat.C (Write): simplify somewhat... - (Read): add warning if arg is not found - - * src/insets/insetcollapsable.C: add using std::max - (Read): move string token and add warning in arg is not found - (draw): use std::max to get the right ty - (getMaxWidth): simplify by using std::max - - * src/insets/insetsection.h: new file - * src/insets/insetsection.C: new file - * src/insets/insetcaption.h: new file - * src/insets/insetcaption.C: new file - - * src/insets/inset.C (ConvertFont): constify signature - - * src/insets/Makefile.am (libinsets_la_SOURCES): add - insetcaption.[Ch] and insetsection.[Ch] - - * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all - uses to use LABEL_COUNTER_CHAPTER instead. - * src/text2.C (SetCounter): here - - * src/counters.h: new file - * src/counters.C: new file - * src/Sectioning.h: new file - * src/Sectioning.C: new file - - * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch] - -2000-07-17 Jean-Marc Lasgouttes - - * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir}, - not always in "."! - - * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of - the last argument. - -2000-07-17 Juergen Vigna - - * src/tabular.C (Validate): check if array-package is needed. - (SetVAlignment): added support for vertical alignment. - (SetLTFoot): better support for longtable header/footers - (Latex): modified to support added features. - - * src/LaTeXFeatures.[Ch]: added array-package. - -2000-07-17 R. Lahaye - - * src/lyx_gui.C (LyXGUI): make sure that the height is large - enough. - -2000-07-17 Kayvan Sylvan - - * configure.in: do not forget to put a space after -isystem. - -2000-07-10 Dekel Tsur - - * lib/kbd/arabic.kmap: a few fixes. - -2000-07-16 Lars Gullik Bjønnes - - * some whitespace chagnes to a number of files. - - * src/support/DebugStream.h: change to make it easier for - doc++ to parse correctly. - * src/support/lyxstring.h: ditto - - * src/mathed/math_utils.C (compara): change to have only one - operator() - (MathedLookupBOP): change because of the above. - - * src/mathed/math_delim.C (math_deco_compare): change to have only - one operator() - (search_deco): change becasue of the above. - - * src/insets/insettabular.C (DrawCellSelection): use std::swap - instead of manually coded one. - - * src/insets/insetquotes.C (Read): read the \end_inset too - - * src/insets/insetlatex.h: remove file - * src/insets/insetlatex.C: remove file - - * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default - constructor - (InsetPrintIndex): remove destructor - - * src/insets/insetinclude.h: remove default constructor - - * src/insets/insetfloat.C: work to make it work better - - * src/insets/inseterror.[Ch] (InsetError): remove default constructor - - * src/insets/insetcite.h (InsetCitation): remove default constructor - - * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor - - * src/text.C (GetColumnNearX): comment out some currently unused code. - - * src/paragraph.C (writeFile): move some initializations closer to - first use. - (CutIntoMinibuffer): small change to use new matchIT operator - (Erase): ditto - (Erase): ditto - (InsertChar): ditto - (InsertInset): ditto - (GetInset): ditto - (GetInset): ditto - (InsetIterator): ditto - (Erase): small change to use new matchFT operator - (InsertChar): ditto - (GetFontSettings): ditto - (HighestFontInRange): ditto - (SetFont): ditto - - * src/lyxparagraph.h: some chars changed to value_type - (matchIT): because of some stronger checking (perhaps too strong) - in SGI STL, the two operator() unified to one. - (matchFT): ditto - - * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved - - * src/buffer.C (parseSingleLyXformat2Token): static string to hold - the last inset read added - (parseSingleLyXformat2Token): some more (future) compability code added - (parseSingleLyXformat2Token): warning about solitary \end_inset added - (parseSingleLyXformat2Token): set last_inset_read - (parseSingleLyXformat2Token): more code to read new "Float" correctly - (parseSingleLyXformat2Token): don't double intializw string next_token - - * src/TextCache.C (text_fits::operator()): add const's to the signature - (has_buffer::operator()): ditto - - * src/Floating.h: add some comments on the class - - * src/FloatList.[Ch] (typeExist): new method - (getType): ditto - - * src/BackStack.h: added default constructor, wanted by Gcc. - -2000-07-14 Juergen Vigna - - * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts. - - * src/frontends/xforms/forms/form_tabular.fd: updated a bit. - - * src/insets/insettabular.C (resizeLyXText): need this to be able to - do a redraw when the window is resized! - (LocalDispatch): small fix so LFUN_TAB works only with locked_inset. - - * src/insets/insettext.C (resizeLyXText): added function to correctly - being able to resize the LyXWindow. - - * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr) - -2000-07-13 Angus Leeming - - * src/frontends/Dialogs.h (hideCitation) : new signal to prevent - crashes when closing dialog to a deleted inset. - - * src/insets/insetcite.[Ch] (Edit) : the return of this former - method! Now similar to other insets. - -2000-07-13 Juergen Vigna - - * src/text.C (GetVisibleRow): fixed clearing of rows with insets! - - * lib/examples/Literate.lyx: small patch! - - * src/insets/insetbib.C (Read): added this function because of wrong - Write (without [begin|end]_inset). - -2000-07-11 Juergen Vigna - - * src/BufferView2.C (open_new_inset): changed to a bool returnvalue - as the insertInset could not be good! - - * src/screen.C (ToggleSelection): fixed toggle selection bug as - the bool param should not be last. - -2000-07-10 Jean-Marc Lasgouttes - - * sigc++/configure.in: fix bug in threading-related code (Yes, I - did submit that to Karl). - - * configure.in: use -isystem instead of -I for X headers. This - fixes a problem on solaris with a recent gcc; - put the front-end code after the X detection code; - configure in sigc++ before lib/ - - * src/lyx_main.C (commandLineHelp): remove -display from command - line help. - -2000-07-09 Kayvan A. Sylvan - - * lib/Makefile.am: added lib/build-listerrors to DIST tarfile. - Also put in Makefile rules for building the ``listerrors'' - program for parsing errors from literate programs written in LyX. - - * lib/build-listerrors: Added small shell script as part of compile - process. This builds a working ``listerrors'' binary if noweb is - installed and either 1) the VNC X server is installed on the machine, - or 2) the user is compiling from within a GUI. The existence of a GUI - is necessary to use the ``lyx --export'' feature for now. This - hack can be removed once ``lyx --export'' no longer requires a GUI to - function. - -2000-07-09 Bernard Michael Hurley - - * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are - now passed back correctly from gcc and placed "under" error - buttons in a Literate LyX source. - -2000-07-08 Dekel Tsur - - * src/text.C (GetColumnNearX): Better behavior when a RTL - paragraph is ended by LTR text. - - * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern): - Ditto - -2000-07-08 Dekel Tsur - - * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to - true when clipboard is empty. - -2000-07-08 Dekel Tsur - - * text.C (Backspace): Prevent rebreaking of a row if it is the last - row of the paragraph. - (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false - to prevent calculation of bidi tables - -2000-07-07 Juergen Vigna - - * src/screen.C (ToggleSelection): added y_offset and x_offset - parameters. - - * src/insets/insettext.C (InsetMotionNotify): fixed selection with - mouse. - - * src/text.C (GetVisibleRow): fixed selection drawing in insets. - - * src/insets/insettext.C: fixed Layout-Display! - -2000-07-07 Jean-Marc Lasgouttes - - * configure.in: add check for strings.h header. - - * src/spellchecker.C: include in order to have a - definition for bzero(). - -2000-07-07 Juergen Vigna - - * src/insets/insettext.C (draw): set the status of the bv->text to - CHANGED_IN_DRAW if top_x changed and so a reinit is necessary. - - * src/screen.C (DrawOneRow): - (DrawFromTo): redraw the actual row if something has changed in it - while drawing. - - * src/text.C (draw): call an update of the toplevel-inset if something - has changed inside while drawing. - - * src/lyxtext.h: added CHANGED_IN_DRAW status. - -2000-07-06 Angus Leeming - - * src/insets/insetbib.[Ch] (callback) new method, moving callback - processing inside class. - - * src/insets/insetindex.[Ch] (callback) new method, moving callback - processing inside class. - - * src/insets/insetindex.h new struct Holder, consistent with other - insets. - - * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms - citation dialog from main code and placed it in src/frontends/xforms. - Dialog launched through signals instead of callbacks - -2000-07-06 R. Lahaye - - * lyx.man: update the options description. - -2000-07-05 R. Lahaye - - * src/lyx_gui.C src/lyx_main.C: improve the -geometry support, - handle neg values, set min width to 590, add doc about -display - -2000-07-05 Juergen Vigna - - * src/insets/lyxinset.h: changed Painter & in ascent(), descent() - calls to BufferView *. - - * src/insets/insettext.C (checkAndActivateInset): small fix non - HIGHLY_EDITABLE insets should not be entered by cursor-move-over! - - * src/insets/insetcommand.C (Read): Fixed as insets should read till - their \end_inset token! - -2000-07-04 edscott - - * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C, - lib/lyxrc.example: added option \wheel_jump - -2000-07-04 R. Lahaye - - * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and - remove support for -width,-height,-xpos and -ypos. - -2000-07-01 Dekel Tsur - - * src/encoding.[Ch]: New files. - - * src/painter.C (text(int,int,XChar2b const *,...)): New method. - (text): Call to the underline() method only when needed. - - * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods. - - * src/buffer.C (makeLaTeXFile): Compute automatically the input - encoding(s) for the document. - - * src/bufferparams.C (BufferParams): Changed default value of - inputenc to "auto". - - * src/language.C (newLang): Removed. - (items[]): Added encoding information for all defined languages. - - * src/lyx_gui.C (create_forms): Added "auto" option to the input - encoding choice button. - - * src/lyxrc.h (font_norm_type): New member variable. - (set_font_norm_type): New method. - - * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between - paragraphs with different encodings. - - * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C - (TransformChar): Changed to work correctly with Arabic points. - (draw): Added support for drawing Arabic points. - (draw): Removed code for drawing underbars (this is done by - the Painter!) - - * src/support/textutils.h (IsPrintableNonspace): New function. - - * src/BufferView_pimpl.h: Added "using SigC::Object". - * src/LyXView.h: ditto. - - * src/insets/insetinclude.h (include_label): Changed to mutable. - -2000-07-04 Lars Gullik Bjønnes - - * src/mathed/math_iter.h: remove empty destructor - - * src/mathed/math_cursor.h: remove empty destructor - - * src/insets/lyxinset.h: add THEOREM_CODE - - * src/insets/insettheorem.[Ch]: new files - - * src/insets/insetminipage.C: (InsertInset): remove - - * src/insets/insetmarginal.C: inherit from InsetFootLike instead - of InsetCollapsable - (InsertInset): remove - - * src/insets/insetlist.C: (InsertList): remove - - * src/insets/insetfootlike.[Ch]: new files - - * src/insets/insetfoot.C: inherit from InsetFootLike instead of - InsetCollapsable. - (Write): remove - (InsertInset): ditto - - * src/insets/insetert.C: remove include Painter.h, reindent - (InsertInset): move to header - - * src/insets/insetcollapsable.h: remove explicit from default - contructor, remove empty destructor, add InsertInset - - * src/insets/insetcollapsable.C (InsertInset): new func - - * src/insets/Makefile.am (libinsets_la_SOURCES): add new files - - * src/vspace.h: add explicit to constructor - - * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of - \textcompwordmark, please test this. - - * src/lyxrc.C: set ascii_linelen to 65 by default - - * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM - - * src/commandtags.h: add LFUN_INSET_THEOREM - - * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem - (makeLinuxDocFile): remove _some_ of the nice logic - (makeDocBookFile): ditto - - * src/Painter.[Ch]: (~Painter): removed - - * src/LyXAction.C (init): entry for insettheorem added - - * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES - enum - (deplog): code to detect files generated by LaTeX, needs testing - (deptex): removed - -2000-07-03 Lars Gullik Bjønnes - - * src/FloatList.[Ch]: moved inlines out of line to FloatList.C - -2000-07-02 Lars Gullik Bjønnes - - * src/LaTeX.C (deplog): Add a check for files that are going to be - created by the first latex run, part of the project to remove the - all_files array. - - * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of - contents to the extension list. - -2000-07-04 Juergen Vigna - - * src/text.C (NextBreakPoint): added support for needFullRow() - - * src/insets/lyxinset.h: added needFullRow() - - * src/insets/insetcollapsable.C: redone now this uses a text-inset - and isn't one. - - * src/insets/insettext.C: lots of changes for update! - -2000-07-03 Angus Leeming - - * src/LaTeXFeatures.h: add a missing std:: qualifier. - -2000-07-02 José Abílio Matos - - * src/insets/insetinclude.C (InsetInclude): fixed - initialization of include_label. - (unique_id): now returns a string. - -2000-07-01 José Abílio Matos - - * src/LaTeXFeatures.h: new member IncludedFiles, for - a map of key, included file name. - - * src/LaTeXFeatures.C (getIncludedFiles): returns a string - with the included files for inclusion in SGML preamble, - i. e., linuxdoc and docbook. - - * src/buffer.h: - * src/buffer.C (makeLinuxDocFile): takes two new arguments, - nice (is the generated linuxdoc code to be exported?), that - allows to remove column, and only_body that will be true for - slave documents. Insets are allowed inside SGML font type. - New handling of the SGML preamble for included files. - (makeDocBookFile): the same for docbook. - - * src/insets/insetinclude.h: - * src/insets/insetinclude.C (Validate): keeps a list of included files. - (Linuxdoc): - (DocBook): new export methods. - - * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile - and makeDocBookFile. - - * src/lyx_main.C (easyParse): accept linuxdoc and docbook as - formats to export with command line argument -x. - -2000-06-29 Juergen Vigna - - * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements - to return DISPATCHED_NOUPDATE so that a it does not redraw the inset! - - * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the - region could already been cleared by an inset! - -2000-06-28 Lars Gullik Bjønnes - - * src/BufferView_pimpl.h: remove member variables lyx_focus and - work_area_focus - - * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus - and lyx_focus - (cursorToggle): remove special handling of lyx focus. - -2000-06-28 Juergen Vigna - - * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight > - insetHeight. - -2000-06-28 Jean-Marc Lasgouttes - - * src/insets/insetindex.C (Edit): add a callback when popup is - closed by the WM. - - * src/insets/insettext.C (LocalDispatch): - * src/insets/insetmarginal.h: - * src/insets/insetlist.h: - * src/insets/insetfoot.h: - * src/insets/insetfloat.h: - * src/insets/insetert.h: add a missing std:: qualifier. - -2000-06-28 Lars Gullik Bjønnes - - * src/support/lyxsum.C (sum): '\0' teminate file read when using - strstream. - - * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE - - * src/insets/insettext.C (Read): remove tmptok unused variable - (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING - (InsertInset): change for new InsetInset code - - * src/insets/insettext.h: add TEXT inline method - - * src/insets/insettext.C: remove TEXT macro - - * src/insets/insetmarginal.C (Write): new method - (Latex): change output slightly - - * src/insets/insetfoot.C (Write): new method - (Latex): change output slightly (don't use endl when no need) - - * src/insets/insetert.C (Write): new method - - * src/insets/insetcollapsable.h: make button_length, button_top_y - and button_bottm_y protected. - - * src/insets/insetcollapsable.C (Write): simplify code by using - tostr. Also do not output the float name, the children class - should to that to get control over own arguments - - * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch] - src/insets/insetminipage.[Ch]: - new files - - * src/insets/Makefile.am (libinsets_la_SOURCES): add new files - - * src/lyxfunc.C (Dispatch): cases for new insets/commands - - * src/Makefile.am (lyx_SOURCES): add the new files - - * src/LyXAction.C (init): add LFUN_INSET_MARGINAL, - LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST - * src/commandtags.h: ditto - - * src/LaTeXFeatures.h: add a std::set of used floattypes - - * src/LaTeXFeatures.C (getPackages): add basic support for float.sty - - * src/FloatList.[Ch] src/Floating.h: new files - - * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to - InsertInset. - * src/lyx_cb.C (TableApplyCB): ditto - * src/text.C: ditto - * src/text2.C: ditto - * src/buffer.C (SimpleLinuxDocOnePar): ditto - (parseSingleLyXformat2Token): ditto + add code for - backwards compability for old float styles + add code for new insets - - * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new - method - (InsertInset(size_type, Inset *, LyXFont)): new method - (InsetChar(size_type, char)): changed to use the other InsetChar - with a LyXFont(ALL_INHERIT). - (InsetInset(size_type, Inset*)): changed to use InsetChar to - insert the META_INSET. - - * sigc++/thread.cc (Privete::operator int&): move definition - out of line. - * sigc++/thread.h (Threads): from here - - * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move - definition out of line - * sigc++/scope.h: from here - -2000-06-27 Jean-Marc Lasgouttes - - * src/lyxrc.C (read): make sure the .kmap files exist when a keymap - is specified (adapted from a patch from edscott ). - - * Makefile.am (bindist): new target. - - * INSTALL: add instructions for doing a binary distribution. - - * development/tools/README.bin.example: update a bit. - -2000-06-26 Lior Silberman - - * src/lyxrc.C: - * lib/lyxrc.example: new lyxrc tag \set_color. - - * src/lyxfunc.C (Dispatch): - * src/commandtags.h: - * src/LyXAction.C: new lyxfunc "set-color". - - * src/LColor.[Ch] (setColor): new method to set colors from a lyxname - and an x11name given as strings. - - * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC - cache when a color is changed. - -2000-06-26 Juergen Vigna - - * src/lyxrow.C (width): added this functions and variable. - - * src/insets/insetcite.C (create_form_citation_form): some Gravity - changes. - - * src/text.C (SetHeightOfRow): fixed calcualting of width. - -2000-06-26 Jean-Marc Lasgouttes - - * images/undo_bw.xpm: new icon. - * images/redo_bw.xpm: ditto. - - * configure.in (INSTALL_SCRIPT): change value to - ${INSTALL} to avoid failures of install-script target. - * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto - - * src/BufferView.h: add a magic "friend" declaration to please - compaq cxx. - -2000-06-23 Angus Leeming - - * forms/cite.fd: modified to allow resizing without messing - up the dialog. - - * src/insetcite.C: Uses code from cite.fd almost without - tweaking. ;-) - User can now resize dialog in the x-direction. - Resizing the dialog in the y-direction is prevented, as the - code does this intelligently already. - -2000-06-22 Jean-Marc Lasgouttes - - * INSTALL: remove obsolete entry in "problems" section. - - * lib/examples/sl_*.lyx: update of the slovenian examples. - - * src/support/FileInfo.[Ch] (getBlockSize): remove. - -2000-06-23 Juergen Vigna - - * src/lyxtext.h: added a 'cleared' flag to draw() function. - - * src/buffer.C (resize): delete the LyXText of textinsets. - - * src/paragraph.C (SetInsetOwner): set the owner in the insets too. - - * src/insets/lyxinset.h: added another parameter 'cleared' to - the draw() function. - - * src/lyxfunc.C (processKeyEvent): move cursor to the right of the - unlocking inset in inset. - -2000-06-22 Juergen Vigna - - * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings - of insets and moved first to LyXText. - - * src/mathed/formulamacro.[Ch]: - * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos - -2000-06-21 Juergen Vigna - - * src/text.C (GetVisibleRow): look if I should clear the area or not - using Inset::doClearArea() function. - - * src/insets/lyxinset.h: added doClearArea() function and - modified draw(Painter &, ...) to draw(BufferView *, ...) - - * src/text2.C (UpdateInset): return bool insted of int - -2000-06-20 Dekel Tsur - - * src/lyx_gui.C (create_forms): Add "Reset" option to the language - combox in the character popup - - * src/lyx_cb.C (UserFreeFont): Add argument to the method: - BufferParams const & params - -2000-06-20 Juergen Vigna - - * src/insets/insettext.C (SetParagraphData): set insetowner on - 2- paragraphs. - -2000-06-21 Lars Gullik Bjønnes - - * src/Timeout.[Ch]: Change to use signals instead of callbacks. - * src/LyXView.h (struct FD_form_main): remove, LyXView inherits - from SigC::Object - (form_main_): remove - - * src/LyXView.C (LyXView_AutosaveTimerCB): remove - (create_form_form_main): remove FD_form_main stuff, connect to - autosave_timeout signal - - * src/LyXView.[Ch] (getMainForm): remove - (UpdateTimerCB): remove - * src/BufferView_pimpl.h: inherit from SigC::Object - - * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with - signal instead of callback - - * src/BufferView.[Ch] (cursorToggleCB): remove - -2000-06-20 Lars Gullik Bjønnes - - * src/BufferView_pimpl.C: changes because of the one below - - * src/screen.[Ch]: Made the lyxscreen take LyXText as argument - instead of storing a pointer to a LyXText. - - * src/buffer.[Ch]: apply Baruch's remove isdviclean patch. - -2000-06-10 Dekel Tsur - - * src/lyxparagraph.h - - * src/paragraph.C: Changed fontlist to a sorted vector. - -2000-06-19 Juergen Vigna - - * src/BufferView.h: added screen() function. - - * src/insets/insettext.C (LocalDispatch): some selection code - fixed. - - * src/vspace.C (nextToken): use stringfunctions instead of sscanf. - - * src/insets/insettext.C (SetParagraphData): - (Read): - (InsetText): fixes for multiple paragraphs. - -2000-06-17 Kayvan A. Sylvan - - * development/lyx.spec.in: Call configure with ``--without-warnings'' - to work around a bug with the Makefiles when doing ``make lyxrpm''. - This should be fine, however, since we generally don't want to be - verbose when making an RPM. - -2000-06-16 Dekel Tsur - - * lib/scripts/fig2pstex.py: New file - -2000-06-16 Juergen Vigna - - * src/insets/insettabular.C (UpdateLocal): - * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem. - (LocalDispatch): Changed all functions to use LyXText. - -2000-06-15 Juergen Vigna - - * src/text.C (SetHeightOfRow): call inset::update before requesting - any width/height. - - * src/insets/insettext.C (update): - * src/insets/insettabular.C (update): added implementation - - * src/insets/lyxinset.h: added update function - -2000-06-15 Jean-Marc Lasgouttes - - * src/text.C (SelectNextWord): protect against null pointers with - old-style string streams. (fix from Paul Theo Gonciari - ) - - * src/cite.[Ch]: remove erroneous files. - - * lib/configure.m4: update the list of created directories. - - * src/lyxrow.C: include - * src/lyxcursor.C: ditto. - -2000-06-13 Jean-Marc Lasgouttes - - * lib/examples/decimal.lyx: new example file from Mike. - - * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch() - to find template definitions (from Dekel) - - * src/frontends/.cvsignore: add a few things. - - * src/frontends/xforms/input_validators.[ch]: remove C++ comments. - - * src/Timeout.C (TimeOut): remove default argument. - - * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have - "C" linkage. - - * src/insets/ExternalTemplate.C: add a "using" directive. - - * src/lyx_main.h: remove the act_ struct, which seems unused - anyway. - -2000-06-12 Lars Gullik Bjønnes - - * LyX Developers Meeting: All files changed, due to random C++ (by - coincidence) code generator script. - - - external inset (cool!) - - initial online editing of preferences - - insettabular breaks insettext(s contents) - - cleanup - - some DocBook fixes - - example files update - - other cool stuff, create a diff and look for yourself. - -2000-06-09 The Great LyX Application - - * src/insets/insettext.C (computeTextRows): if the maxWidth is - -1 this is a non-line-breaking textinset. - - * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1 - if there is no width set. - -2000-06-10 Lars Gullik Bjønnes - - * Lots of files: Merged the dialogbase branch. - -2000-06-09 Allan Rae - - * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and - and the Dispatch methods that used it. - - * src/frontends/Liason.[Ch]: replaced with a Liason namespace for - access to functions formerly kept in Dispatch. - -2000-05-19 Allan Rae - - * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C: - made to_page and count_copies integers again. from_page remains a - string however because I want to allow entry of a print range like - "1,4,22-25" using this field. - - * src/LyXAction.C: added action info and commands for buffer-print-xtl - and printer-params-get. These aren't useful from the minibuffer but - could be used by a script/LyXServer app provided it passes a suitable - auto_mem_buffer. I guess I should take a look at how the LyXServer - works and make it support xtl buffers. - - * sigc++/: updated to libsigc++-1.0.1 - - * src/xtl/: updated to xtl-1.3.pl.11 - - * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure - those changes done to the files in src/ are actually recreated when - they get regenerated. Please don't ever accept a patch that changes a - dialog unless that patch includes the changes to the corresponding *.fd - file. - - * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's - stringOnlyContains, renamed it and generalised it. - - * lots-of-files: Rolled the "rae" branch over into the "dialogbase" - branch. Removed the remaining old form_print code. - -2000-04-26 Allan Rae - - * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same - trap I was trying to fix with the ID: fields in src/xtl/ :-) - -2000-04-25 Allan Rae - - * src/xtl/: Updated to incorporate Angus's two patches as well as mine - against a base of xtl-1.3.pl.4 - - * development/tools/lxtl.sh: fixed a couple of silly typos and now - filter the Id: entries so they still show the xtl version number - they are based on. - - * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated - into the src/xtl code. Patch still pending with José (XTL) - -2000-04-24 Allan Rae - - * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is - both more generic and much safer. Use the new template functions. - * src/buffer.[Ch] (Dispatch): ditto. - - * src/frontends/xforms/FormPrint.C (update): Use new template functions - and mem buffer more intelligently. Also a little general cleanup. - (apply): ditto. - - * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot. - * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore - * src/xtl/Makefile.am: ditto. - * src/xtl/.cvsignore: ditto. - * src/Makefile.am: ditto. - - * src/PrinterParams.h: Removed the macros member functions. Added a - testInvariant member function. A bit of tidying up and commenting. - Included Angus's idea for fixing operation with egcs-1.1.2. - - * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really - cool expansion of XTL's mem_buffer to support automatic memory - management within the buffer itself. Removed the various macros and - replaced them with template functions that use either auto_mem_buffer - or mem_buffer depending on a #define. The mem_buffer support will - disappear as soon as the auto_mem_buffer is confirmed to be good on - other platforms/compilers. That is, it's there so you've got something - to compare against. - - * src/xtl/objio.h: Changes to support auto_mem_buffer. This has - effectively forked XTL. However I expect José will include my code - into the next major release. Also fixed a memory leak. - * src/xtl/text.h: ditto. - * src/xtl/xdr.h: ditto. - * src/xtl/giop.h: ditto. - -2000-04-16 Allan Rae - - * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated - by autogen.sh and removed by maintainer-clean anyway. - * .cvsignore, sigc++/.cvsignore: Support the above. - - * sigc++/.cvsignore: Forgot that retbind.h was generated. - - * src/buffer.C (Dispatch): Couldn't print a single page. Fixed. - - * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using - macros, renamed static callback-target member functions to suit new - scheme and made them public. - * src/frontends/xforms/forms/form_print.fd: ditto. - * src/frontends/xforms/forms/form_copyright.fd: ditto. - - * src/support/lxtl.h: small cleanup to use typedef instead of #define - for gui_format. - - * src/xtl/: New directory containing a minimal distribution of XTL. - This is XTL-1.3.pl.4. - - * development/tools/lxtl.sh: A script to generate the above mini-dist. - -2000-04-15 Allan Rae - - * development/tools/makeLyXsigc.sh: Remove the library version numbers - - * sigc++/: Updated to libsigc++-1.0.0 - -2000-04-14 Allan Rae - - * src/frontends/xforms/xform_macros.h: Remove specific macros and just - use the generic ones in future. I'll modify my conversion script. - - * src/frontends/xforms/FormCopyright.C: Reverse the earlier change. - - * src/lyx_gui_misc.[Ch]: Removed references to form_print. - (CloseAllBufferRelatedDialogs): Renamed. - (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog - - * src/frontends/xforms/FormCopyright.C: Use the specific macros instead - of the generic ones. These are the same ones my conversion script - generates. - - * src/PrinterParams.h: Allow you to print a range of odd or even pages. - * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup - * src/buffer.C (Dispatch): ditto - - * src/LyXView.C (LyXView): Use new signals instead of old hard coded - functions for updating and hiding buffer dependent dialogs. - * src/BufferView.C (buffer): ditto - * src/buffer.C (setReadonly): ditto - * src/lyxfunc.C (CloseBuffer): ditto - - * src/buffer.h: Take setReadonly() out of line so I don't have to include - Dialogs.h, and hence all the SigC stuff, into every file that includes - buffer.h. We also don't need to include lyx_gui_misc.h in everything. - - * src/BufferView2.C: reduce the number of headers included by buffer.h - -2000-04-11 Allan Rae - - * src/frontends/xforms/xform_macros.h: A small collection of macros - for building C callbacks. - - * src/frontends/xforms/Makefile.am: Added above file. - - * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback - scheme again. This time it should work for JMarc. If this is - successful I'll revise my conversion script to automate some of this. - The static member functions in the class also have to be public for - this scheme will work. If the scheme works (it's almost identical to - the way BufferView::cursorToggleCB is handled so it should work) then - FormCopyright and FormPrint will be ready for inclusion into the main - trunk immediately after 1.1.5 is released -- provided we're prepared - for complaints about lame compilers not handling XTL. - - * src/support/lxtl.h: Switched to XDR_format instead of raw_format. - -2000-04-07 Allan Rae - - * config/lyxinclude.m4: A bit more tidying up (Angus) - - * src/LString.h: JMarc's header fix - - * src/PrinterParams.h: Used string for most data to remove some - ugly code in the Print dialog and avoid even uglier code when - appending the ints to a string for output. - - * src/buffer.C (Dispatch): Added a couple of braces to fix an error - and moved "default:" back to the end of switch statement. Cleaned - up the printing so it uses the right function calls and so the - "print to file" option actually puts the file in the right directory. - - * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus). - - * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking - and Ok+Apply button control into a separate method: input (Angus). - (input) Cleaned it up and improved it to be very thorough now. - (All CB) static_cast used instead of C style cast (Angus). This will - probably change again once we've worked out how to keep gcc-2.8.1 happy - with real C callbacks. - (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to - ignore some of the bool settings and has random numbers instead. Needs - some more investigation. Added other input length checks and checking - of file and printer names. - - * src/frontends/xforms/FormPrint.h: Removed pragma statement so it - would link (Angus). Seems the old code doesn't compile with the pragma - statement either. Separated callback entries from internal methods. - - * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus). - -2000-03-17 Allan Rae - - * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really - need it? Maybe it could go in Dialogs instead? I could make it a - LFUN but you'd have to call Dispatch(int, int, char*) with dummy - values to get the bool return value. - (Dispatch): New overloaded method for xtl support. - - * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly - extern "C" callback instead of static member functions. Hopefully, - JMarc will be able to compile this. I haven't changed - forms/form_copyright.fd yet. Breaking one of my own rules already. - - * src/commandtags.h: New xtl-based LFUN's no description in LyXAction - because they aren't useful from the minibuffer. Maybe a LyXServer - might want a help message though? - - * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support. - - * config/lyxinclude.m4: Changes to g++ flags to suit compiling with - xtl which needs both rtti and exceptions. - - * src/support/Makefile.am: - * src/support/lxtl.h: New file. Some helper macros for using XTL. - - * src/frontends/xforms/input_validators.[ch]: input filters and - validators. These conrol what keys are valid in input boxes. - Use them and write some more. Much better idea than waiting till - after the user has pressed Ok to say that the input fields don't make - sense. - - * src/frontends/xforms/Makefile.am: - * src/frontends/xforms/forms/form_print.fd: - * src/frontends/xforms/forms/makefile: - * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to - new scheme. Still have to make sure I haven't missed anything from - the current implementation. - - * src/Makefile.am, src/PrinterParams.h: New data store. - - * other files: Added a couple of copyright notices. - -2000-03-06 Jean-Marc Lasgouttes - - * src/insets/insetbib.h: move Holder struct in public space. - - * src/frontends/include/DialogBase.h: use SigC:: only when - SIGC_CXX_NAMESPACES is defined. - * src/frontends/include/Dialogs.h: ditto. - - * sigc++/Makefile.am (%.h): use the autodected GNU m4. - - * src/frontends/xforms/FormCopyright.[Ch]: do not - mention SigC:: explicitely. - -2000-03-03 Jean-Marc Lasgouttes - - * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which - deals with testing KDE in main configure.in - * configure.in: ditto. - -2000-02-22 Allan Rae - - * Lots of files: Merged from HEAD - - * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible - with the etags shipped with SuSE-6.3 (fancier than gnu-etags). - - * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4 - - * sigc++/: new minidist. - -2000-02-14 Allan Rae - - * development/tools/makeLyXsigc.sh: Small fix for Makefile.am - -2000-02-08 Juergen Vigna - - * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data - file for the buildin GUI builder of KDevelop of the copyright-dialog. - - * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop - for this port and so it is much easier for other people to port - dialogs in a common development environment. - - * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for - the QT/KDE implementation. - - * src/frontends/kde/Dialogs.C: - * src/frontends/kde/FormCopyright.C: - * src/frontends/kde/FormCopyright.h: - * src/frontends/kde/Makefile.am: - * src/frontends/kde/formcopyrightdialog.C: - * src/frontends/kde/formcopyrightdialog.h: - * src/frontends/kde/formcopyrightdialogdata.C: added this source-files - for the kde support of the Copyright-Dialog. - - * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@ - subdir-substitution instead of hardcoded 'xforms' as we now have also - the kde subdir. - - * src/frontends/include/DialogBase.h (Object): just commented the - label after #endif (nasty warning and I don't like warnings ;) - - * src/main.C (main): added KApplication initialization if using - KDE frontend-GUI. - - * src/lyx_gui.C (runTime): added support for multiple toolkit support. - For now only the KDE event-loop is added if frontend==kde. - - * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support - - * configure.in: added support for the --with-frontend[=value] option - - * autogen.sh: added kde.m4 file to list of config-files - - * acconfig.h: added define for KDEGUI-support - - * config/kde.m4: added configuration functions for KDE-port - - * config/lyxinclude.m4: added --with-frontend[=value] option with - support for xforms and KDE. - -2000-02-08 Allan Rae - - * all Makefile.am: Fixed up so the make targets dist, distclean, - install and uninstall all work even if builddir != srcdir. Still - have a new sigc++ minidist update to come. - - * config/lyxinclude.m4: Some more builddir!=srcdir fixes. - -2000-02-01 Allan Rae - - * config/lyxinclude.m4, development/tools/makeLyXsigc.sh: - Many mods to get builddir != srcdir working. - - * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both - for building on NT and so we can do the builddir != srcdir stuff. - -2000-01-30 Allan Rae - - * sigc++/doc/*: Selected documentation for the libsigc++ mini dist. - This will stay in "rae" branch. We probably don't really need it in - the main trunk as anyone who wants to help programming it should get - a full library installed also. So they can check both included and - system supplied library compilation. - - * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4: - Added a 'mini' distribution of libsigc++. If you feel the urge to - change something in these directories - Resist it. If you can't - resist the urge then you should modify the following script and rebuild - the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it - all happen. Still uses a hacked version of libsigc++'s configure.in. - I'm quite happy with the results. I'm not sure the extra work to turn - the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is - worth the trouble and would probably lead to extra maintenance - headaches. - I haven't tested the following important make targets: install, dist. - Not ready for prime time but very close. Maybe 1.1.5. - - * development/tools/makeLyXsigc.sh: A shell script to automatically - generate our mini-dist of libsigc++. It can only be used with a CVS - checkout of libsigc++ not a tarball distribution. It's well commented. - This will end up as part of the libsigc++ distribution so other apps - can easily have an included mini-dist. If someone makes mods to the - sigc++ subpackage without modifying this script to generate those - changes I'll be very upset! - - * src/frontends/: Started the gui/system indep structure. - - * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s - to access the gui-indep dialogs are in this class. Much improved - design compared to previous revision. Lars, please refrain from - moving this header into src/ like you did with Popups.h last time. - - * src/frontends/include/DialogBase.h: Abstract base class for dialogs. - - * src/frontends/xforms/: Started the gui-indep system with a single - dialog: FormCopyright. Initial testing of use of libsigc++ was very - successful. - - * src/frontends/xforms/forms: Repository for the xforms .fd files. - Here you'll find a very useful makefile and automated fdfix.sh that - makes updating dailogs a no-brainer -- provided you follow the rules - set out in the README. I'm thinking about adding another script to - automatically generate skeleton code for a new dialog given just the - name of the dialog. - - * src/commandtags.h, src/lyxfunc.C, src/menus.C: - * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd: - Made FormCopyright gui-indep and added a lyxfunc to get to it. - -2000-06-09 Lars Gullik Bjønnes - - * src/support/LSubstring.C (operator): simplify - - * src/lyxtext.h: removed bparams, use buffer_->params instead - - * src/lyxrow.h: make Row a real class, move all variables to - private and use accessors. - - * src/lyxparagraph.h (getParLanguage): add BufferParamas as - arguament. - (isRightToLeftPar): ditto - (ChangeLanguage): ditto - (isMultiLingual): ditto - (String): ditto - (TeXOnePar): ditto - (SimpleTeXOnePar): ditto - (TeXEnvironment): ditto - (GetEndLabel): ditto - (SetLayout): ditto - (SetOnlyLayout): ditto - (BreakParagraph): ditto - (BreakParagraphConservative): ditto - (GetFontSettings): ditto - (getFont): ditto - (CopyIntoMinibuffer): ditto - (CutIntoMinibuffer): ditto - (PasteParagraph): ditto - (SetPExtraType): ditto - (UnsetPExtraType): ditto - (DocBookContTableRows): ditto - (SimpleDocBookOneTablePar): ditto - (TeXDeeper): ditto - (TeXFootnote): ditto - (SimpleTeXOneTablePar): ditto - (TeXContTableRows): ditto - (SimpleTeXSpecialChars): ditto - - - * src/lyxcursor.h: make LyXCursor a real class, move all variables - to private and use accessors. - - * src/lyx_cb.C: remove char updatetimer, and all code that uses - this, we did not use it anymore and has not been for ages. Just a - waste of cpu cycles. - - * src/language.h: make Language a real class, move all variables - to private and use accessors. - - * src/BufferView_pimpl.C (Pimpl): use new timer code. - (create_view): remove - (update): some changes for new timer - (cursorToggle): use new timer - (beforeChange): change for new timer - - * src/BufferView.h (cursorToggleCB): removed last paramter because - of new timer code. - - * src/BufferView.C (C_BufferView_CursorToggleCB): removed - (cursorToggleCB): change because of new timer code - - * lib/CREDITS: updated own mailaddress - -2000-06-08 Jean-Marc Lasgouttes - - * src/support/filetools.C (PutEnv): fix the code in case neither - putenv() nor setenv() have been found. - - * INSTALL: mention the install-strip Makefile target. - - * src/LyXAction.C (init): make LFUN_BUILDPROG available in - read-only documents. - -2000-06-07 Jean-Marc Lasgouttes - - * lib/reLyX/configure.in (VERSION): avoid using a previously - generated reLyX wrapper to find out $prefix. - - * lib/examples/eu_adibide_lyx-atua.lyx: - * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque - translation of the Tutorial (Dooteo) - -2000-06-06 Angus Leeming - - * forms/cite.fd: new citation dialog - - * src/insetcite.[Ch]: the new citation dialog is moved into - its own files. - - * src/insetbib.C: InsetBibtex::getKeys() uses STL containers - (Dekel). - - * src/insets/insetcommand.h: data members made private. - -2000-06-06 Lars Gullik Bjønnes - - * LyX 1.1.5 released - -2000-06-06 Lars Gullik Bjønnes - - * src/version.h (LYX_RELEASE): to 1.1.5 - - * src/spellchecker.C (RunSpellChecker): return false if the - spellchecker dies upon creation. - -2000-06-06 Jean-Marc Lasgouttes - - * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file - in \include{} (from Tomasz Motylewski ) - - * NEWS: update. - - * lib/CREDITS: update entry for Martin Vermeer. - -2000-06-06 Dekel Tsur - - * src/text.C (draw): Draw foreign language bars at the bottom of - the row instead of at the baseline. - - * lib/examples/Minipage.lyx: Use the new multi-lingual support. - -2000-06-06 Lars Gullik Bjønnes - - * lib/bind/de_menus.bind: updated - -2000-06-05 Dekel Tsur - - * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref - -2000-06-05 Dekel Tsur - - * src/menus.C (Limit_string_length): New function - (ShowTocMenu): Limit the number of items/length of items in the - LOT/LOF/LOA menus. - - * src/paragraph.C (String): Correct result for a paragraph inside - a footnote. - -2000-06-05 Lars Gullik Bjønnes - - * src/bufferlist.C (close): test of buf->getuser() == NULL - -2000-06-02 Dekel Tsur - - * src/BufferView2.C (removeAutoInsets): Fix a bug: - Do not call to SetCursor when the paragraph is a closed footnote! - -2000-06-01 Dekel Tsur - - * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a - label is changed. - - * src/text.C (SetCursor): Made the computation of cursor_vpos safer. - -2000-05-31 Dekel Tsur - - * forms/lyx.fd - * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert - reference popup, that activates the reference-back action - - * src/menus.C (ShowRefsMenu): Added "Go Back" menu item. - - * src/menus.C (Add_to_refs_menu): Limit the size of each item in - the menus. Also fixed a bug. - - * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close - the math panels when switching buffers (unless new buffer is readonly). - - * src/BufferView.C (NoSavedPositions) - * src/BufferView_pimpl.C (NoSavedPositions): New methods - -2000-06-01 Lars Gullik Bjønnes - - * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard - less of dvi dirty or not. - - * src/trans_mgr.[Ch] (insert): change first parameter to string - const &. - - * src/chset.[Ch] (encodeString): add const to first parameter - -2000-05-31 Lars Gullik Bjønnes - - * src/support/lyxstring.C (begin): fix a "shared" string bug. use - rep->get_own_copy() - (end): ditto - - * src/LaTeX.C (deplog): better searching for dependency files in - the latex log. Uses now regexps. - - * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil - instead of the box hack or \hfill. - -2000-05-31 Jean-Marc Lasgouttes - - * src/lyxfunc.C (doImportHelper): do not create the file before - doing the actual import. - (doImportASCIIasLines): create a new file before doing the insert. - (doImportASCIIasParagraphs): ditto. - - * lib/lyxrc.example: remove mention of non-existing commands - - * lyx.man: remove mention of color-related switches. - - * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR. - - * src/lyx_gui.C: remove all the color-related ressources, which - are not used anymore. - - * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file - name. - -2000-05-31 Dekel Tsur - - * src/lyxrc.C (read): Add a missing break in the switch - -2000-05-30 Dekel Tsur - - * src/text2.C (InsertStringA): Fix a bug with insertion into table - - * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the - text is Hebrew. - -2000-05-27 Dekel Tsur - - * src/text.C (draw): draw bars under foreign language words. - - * src/LColor.[Ch]: add LColor::language - -2000-05-27 Dekel Tsur - - * src/lyxcursor.h (boundary): New member variable - - * src/text.C (IsBoundary): New methods - - * src/text.C: Use the above for currect cursor movement when there - is both RTL & LTR text. - - * src/text2.C: ditto - - * src/bufferview_funcs.C (ToggleAndShow): ditto - -2000-05-30 Jean-Marc Lasgouttes - - * src/text.C (DeleteLineForward): set selection to true to avoid - that DeleteEmptyParagraphMechanism does some magic. This is how it - is done in all other functions, and seems reasonable. - (DeleteWordForward): do not jump over non-word stuff, since - CursorRightOneWord() already does it. - - Remove the CHECK tag from DeleteLineForward, DeleteWordForward and - DeleteWordBackward, since they seem safe to me (since selection is - set to "true") DeleteEmptyParagraphMechanism does nothing. - -2000-05-29 Jean-Marc Lasgouttes - - * src/lyx_main.C (easyParse): simplify the code by factoring the - part that removes parameters from the command line. - (LyX): check wether wrong command line options have been given. - -2000-05-29 Lior Silberman - - * src/lyx_main.C : add support for specifying user LyX - directory via command line option -userdir. - -2000-05-26 Dekel Tsur - - * src/menus.C (Add_to_toc_menu): Limit the number of popups, and - the number of items per popup. - (Add_to_refs_menu): Ditto. - -2000-05-26 Jean-Marc Lasgouttes - - * src/lyxparagraph.h: renamed ClearParagraph() to - StripLeadingSpaces() and moved it to paragraph.C. We pass the - textclass as parameter, and do nothing if free_spacing is - true. This fixes part of the line-delete-forward problems. - - * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces. - (pasteSelection): ditto. - (SwitchLayoutsBetweenClasses): more translatable strings. - - * src/text2.C (CutSelection): use StripLeadingSpaces. - (PasteSelection): ditto. - (DeleteEmptyParagraphMechanism): ditto. - -2000-05-26 Juergen Vigna - - * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this - is not needed in tabular insets. - - * src/insets/insettabular.C (TabularFeatures): added missing features. - - * src/tabular.C (DeleteColumn): - (AppendColumn): - (AppendRow): implemented this functions - (cellsturct::operator=): clone the inset too; - -2000-05-23 Juergen Vigna - - * src/insets/insettabular.C (LocalDispatch): better selection support - when having multicolumn-cells. - -2000-05-26 Jose Abilio Oliveira Matos - - * lib/layouts/linuxdoc.layout: fix indentation of paragraphs. - -2000-05-25 Jean-Marc Lasgouttes - - * src/ColorHandler.C (getGCForeground): put more test into _() - - * lib/examples/eu_splash.lyx: new file (Basque translation) from - Dooteo. - - * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to - get the version. - -2000-05-25 Dekel Tsur - - * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when - there are no labels, or when buffer is readonly. - - * src/menus.C (ShowRefsMenu) disable appropriate menu items when - there are no labels, buffer is SGML, or when buffer is readonly. - -2000-05-25 Lars Gullik Bjønnes - - * src/LColor.C (LColor): change a couple of grey40 to grey60 - (LColor): rewore initalization to make compiles go some magnitude - faster. - (getGUIName): don't use gettext until we need the string. - -2000-05-09 Dekel Tsur - - * src/Bullet.[Ch]: Fixed a small bug. - -2000-05-21 Dekel Tsur - - * src/paragraph.C (String): Several fixes/improvements - - * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method - -2000-05-22 Lars Gullik Bjønnes - - * src/paragraph.C (String): give more correct output. - -2000-05-20 Dekel Tsur - - * src/lyxfont.C (stateText) Do not output the language if it is - eqaul to the language of the document. - - * src/paragraph.C (TeXOnePar): Do not put language switch commands - between two paragraphs with the same language. - - * src/paragraph.C (getParLanguage) Return a correct answer for an - empty dummy paragraph. - - * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA - menus. - - * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the - layout menu. - - * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for - the menus/popup, if requested fonts are unavailable. - -2000-05-22 Juergen Vigna - - * src/insets/insettabular.C (LocalDispatch): added some more cursor - movement support (Up/Down/Tab/Shift-Tab). - (LocalDispatch): added also preliminari cursor-selection. - - * src/LyXAction.C (init): added SHIFT-Tab as tab-backward. - - * src/paragraph.C (PasteParagraph): Hopefully now right! - -2000-05-22 Garst R. Reese - - * layouts/hollywood.layout, broadway.layout : move Dialogue to top - of list, change all references to Environment to Command - * tex/hollywood.cls : rewrite environments as commands, add - \uppercase to interiorshot and exteriorshot to force uppecase. - * tex/broadway.cls : rewrite environments as commands. Tweak - whitespace. - -2000-05-22 Jean-Marc Lasgouttes - - * src/menus.C (Add_to_toc_menu): fix the code which limits the - size of items: use a constant intead of the hardcoded 40, and more - importantly do not remove the %m and %x tags added at the end. - (Add_to_refs_menu): use vector::size_type instead of - unsigned int as basic types for the variables. _Please_ do not - assume that size_t is equal to unsigned int. On an alpha, this is - unsigned long, which is _not_ the same. - - * src/language.C (initL): remove language "hungarian", since it - seems that "magyar" is better. - -2000-05-22 Juergen Vigna - - * src/CutAndPaste.C: hopefully fixed memory the problem defenitively! - - * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable - end markers! - - * src/paragraph.C (PasteParagraph): Possibly a memory leak as - next was deleted but not set to 0. - -2000-05-21 Lars Gullik Bjønnes - - * src/language.C (initL): change the initialization of languages - so that compiles goes _fast_. - - * src/menus.C (Add_to_toc_menu): limit the line length in TOC to - 40 chars. - - * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0. - -2000-05-21 Lars Gullik Bjønnes - - * release 1.1.5pre3 - -2000-05-20 Lars Gullik Bjønnes - - * src/WorkArea.C (request_clipboard_cb): give "C" linkage. - -2000-05-19 Dekel Tsur - - * src/commandtags.h - * src/LyXAction.C - * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW - and LFUN_LOAVIEW - - * src/insets/insetlo*.[Ch]: Made editable - -2000-05-20 Lars Gullik Bjønnes - - * src/text2.C (SetSelection): call BufferView::stuffClipboard with - the current selection. - - * src/BufferView_pimpl.C (stuffClipboard): new method - - * src/BufferView.C (stuffClipboard): new method - - * src/paragraph.C (String): new method - - * src/LColor.C (getFromLyXName): return LColor::inherit instead of - LColor::ignore when lyxname is not found. - - * src/BufferView.C (pasteSelection): new method - - * src/BufferView_pimpl.C (pasteSelection): new method - - * src/lyxfunc.C (Dispatch): use the new clipboard functions. - - * src/WorkArea.C (request_clipboard_cb): new static function - (getClipboard): new method - (putClipboard): new method - -2000-05-19 Lars Gullik Bjønnes - - * LyX 1.1.5pre2 released - -2000-05-19 Lars Gullik Bjønnes - - * src/vspace.C (operator=): removed - (operator=): removed - - * src/lyx_gui_misc.C (askForText): manually set the type in make_pair - - * src/layout.C (NumberOfClass): manually set the type in make_pair - (NumberOfLayout): ditto - - * src/language.C: use the Language constructor for ignore_lang - - * src/language.h: add constructors to struct Language - - * src/BufferView_pimpl.C (scrollDown): change to pair - - * src/text2.C (SetCursorIntern): comment out #warning - - * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast - - * src/mathed/math_iter.h: initialize sx and sw to 0 - -2000-05-10 Dekel Tsur - - * forms/lyx.fd: Redesign of form_ref - - * src/LaTeXFeatures.[Ch] - * src/buffer.C - * src/lyx_cb.C - * src/menus.C - * src/insets/insetref.[Ch]: Added support for varioref and prettyref. - - * src/buffer.h - * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator - and Buffer::inset_iterator. - - * src/menus.C: Added new menus: TOC and Refs. - - * src/insets/insetlabel.C (Edit) Made InsetLabel editable. - - * src/buffer.C (getTocList): New method. - - * src/BufferView2.C (ChangeRefs): New method. - - * src/buffer.C (getLabelList): New method. It replaces the old - getReferenceList. The return type is vector instead of - string. - - * src/insets/insetinclude.C (getLabelList): New method. Replaces - the old getLabel() and GetNumberOfLabels() methods. - * src/insets/insetlabel.C (getLabelList): ditto - * src/mathed/formula.C (getLabelList): ditto - - * src/paragraph.C (String): New method. - - * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten. - Uses the new getTocList() method. - TocSelectCB() now calls to TocUpdateCB() before moving the cursor, - which automatically updates the contents of the browser. - (RefUpdateCB): Use the new getLabelList method. - - * src/lyxfunc.C (Dispatch): Give an error if the label is not found. - - * src/BufferView2.C (gotoLabel) Use the new getLabelList method. - - * src/spellchecker.C: Added using std::reverse; - -2000-05-19 Juergen Vigna - - * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures. - - * src/insets/insettext.C (computeTextRows): small fix for display of - 1 character after a newline. - - * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard - to cont-rows! - -2000-05-18 Juergen Vigna - - * src/insets/insettabular.C (TabularFeatures): fixed update of display - when changing width of column. - - * src/tabular.C (set_row_column_number_info): setting of - autobreak rows if necessary. - -2000-05-17 Jean-Marc Lasgouttes - - * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat() - - * src/vc-backend.*: renamed stat() to status() and vcstat to - vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and - compilation broke. The new name seems more relevant, anyway. - -2000-05-17 Juergen Vigna - - * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets - which was wrong if the removing caused removing of rows! - - * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken. - (pushToken): new function. - - * src/text2.C (CutSelection): fix problem discovered with purify - -2000-05-17 Jean-Marc Lasgouttes - - * src/debug.C (showTags): enlarge the first column, now that we - have 6-digits debug codes. - - * lib/layouts/hollywood.layout: - * lib/tex/hollywood.cls: - * lib/tex/brodway.cls: - * lib/layouts/brodway.layout: more commands and fewer - environments. Preambles moved in the .cls files. Broadway now has - more options on scene numbering and less whitespace (from Garst) - - * src/insets/insetbib.C (getKeys): make sure that we are in the - document directory, in case the bib file is there. - - * src/insets/insetbib.C (Latex): revert bogus change. - -2000-05-16 Juergen Vigna - - * src/insets/insettabular.C (UnlockInsetInInset): Changes to update - the TabularLayout on cursor move. - - * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable - - * src/insets/insettabular.C (Clone): Clone the LyXTabular for - undo-handling. - (getCellXPos): - (draw): fixed cursor position and drawing so that the cursor is - visible when before the tabular-inset. - - * src/insets/insettext.C (init): drawLockedFrame was not initialized - when creating from old insettext. - - * src/tabular.C (Clone): added Clone of text-inset for undo-handling. - -2000-05-15 Jean-Marc Lasgouttes - - * lib/tex/hollywood.cls: better algorithm for page breaks (Garst) - * lib/tex/brodway.cls: ditto - - * lib/layouts/brodway.layout: change alignment of parenthical - layout (Garst) - -2000-05-12 Jean-Marc Lasgouttes - - * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only - versions 0.88 and 0.89 are supported. - -2000-05-15 Juergen Vigna - - * src/insets/insetcollapsable.C (draw): enhancements in drawing and - width calculating. - - * src/insets/insettext.C (computeTextRows): redone completely this - function in a much cleaner way, because of problems when having a - fixed maxWidth. - (draw): added a frame border when the inset is locked. - (SetDrawLockedFrame): this sets if we draw the border or not. - (SetFrameColor): this sets the frame color (default=insetframe). - - * src/insets/lyxinset.h: added x() and y() functions which return - the top_x and top_baseline values. Added a GetFirstLockingInsetOfType - function which is needed to see if we have a locking inset of some - type in this inset (needed for now in insettabular). - - * src/vspace.C (inPixels): the same function also without a BufferView - parameter as so it is easier to use it in some ocasions. - - * src/lyxfunc.C: changed all places where insertInset was used so - that now if it couldn't be inserted it is deleted! - - * src/TabularLayout.C: - * src/TableLayout.C: added support for new tabular-inset! - - * src/BufferView2.C (insertInset): this now returns a bool if the - inset was really inserted!!! - - * src/tabular.C (GetLastCellInRow): - (GetFirstCellInRow): new helper functions. - (Latex): implemented for new tabular class. - (TeXCellPostamble): - (TeXCellPreamble): - (TeXBottomHLine): - (TeXTopHLine): new Latex() helper functions. - -2000-05-12 Juergen Vigna - - * src/mathed/formulamacro.C (Read): - * src/mathed/formula.C (Read): read also the \end_inset here! - -2000-05-10 Dekel Tsur - - * src/mathed/math_write.C (MathParInset::Write): Fixed a bug: - crush when saving formulae with unbalanced parenthesis. - -20000-05-11 Dekel Tsur - - * src/layout.C: Add new keyword "endlabelstring" to layout file - - * src/text.C (GetVisibleRow): Draw endlabel string. - - * lib/layouts/broadway.layout - * lib/layouts/hollywood.layout: Added endlabel for the - Parenthetical layout. - - * lib/layouts/heb-article.layout: Do not use slanted font shape - for Theorem like environments. - - * src/buffer.C (makeLaTeXFile): Always add "american" to - the UsedLanguages list if document language is RTL. - -2000-05-11 Jean-Marc Lasgouttes - - * add addendum to README.OS2 and small patch (from SMiyata) - -2000-05-10 Jean-Marc Lasgouttes - - * many files: correct the calls to ChangeExtension(). - - * src/support/filetools.C (ChangeExtension): remove the no_path - argument, which does not belong there. Use OnlyFileName() instead. - - * src/insets/insetbib.C (Latex): use absolute paths for bibtex - files when LaTeXing a non-nice latex file. - - * src/lyxlookup.C (isDeadEvent): use a switch statement instead of - a chain of "if". Return false when deadkeys are not handled. - - * src/lyx_main.C (LyX): adapted the code for default bindings. - - * src/kbmap.C (defaultKeyBindings): new method. Performs the default - bindings for basic functionality (except deadkeys). - (deadKeyBindings): new method. Performs the bindings of deadkeys. - - * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C - several methods: handle override_x_deadkeys. - - * src/lyxrc.h: remove the "bindings" map, which did not make much - sense anyway. New variable override_x_deadkeys, defaulting to "true". - -2000-05-09 Jean-Marc Lasgouttes - - * src/lyxfont.C (stateText): use a saner method to determine - whether the font is "default". Seems to fix the crash with DEC - cxx. - - * src/Bullet.[Ch] (Bullet): remove const on parameters. - -2000-05-08 Juergen Vigna - - * src/insets/insettabular.C (InsetButtonRelease): Now opens the - TabularLayoutMenu with mouse-button-3 - (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout. - - * src/TabularLayout.C: added this file for having a Layout for - tabular-insets. - -2000-05-05 Juergen Vigna - - * src/insets/insettabular.C (UpdateLocal): resetCursorPos when - recalculating inset-widths. - (TabularFeatures): activated this function so that I can change - tabular-features via menu. - - * src/menus.C (ShowEditMenu): inserted support for insettabular so - that I can test some functions with the Table menu. - -2000-05-05 Lars Gullik Bjønnes - - * src/lyxfont.C (stateText): guard against stupid c++libs. - - * src/tabular.C: add using std::vector - some whitespace changes, + removed som autogenerated code. - - * src/buffer.C (parseSingleLyXformat2Token): stupid bug. - -2000-05-05 Juergen Vigna - - * src/tabular.[Ch]: now using std:vector instead of arrays for all the - row, columns and cellstructures. - -2000-05-05 Lars Gullik Bjønnes - - * lib/lyxrc.example: remove obsolete entries. - - * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix - reading of protected_separator for free_spacing. - -2000-05-05 Jean-Marc Lasgouttes - - * src/text.C (draw): do not display an exclamation mark in the - margin for margin notes. This is confusing, ugly and - uninformative. - - * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use - AMS math' is checked. - - * src/buffer.C (makeLaTeXFile): do not depend on the textclass - name to see whether including the amsmath package is needed. - -2000-05-05 Dekel Tsur - - * src/paragraph.C (validate): Compute UsedLanguages correctly - (don't insert the american language if it doesn't appear in the - document) - - * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars) - The argument of \thanks{} command is considered moving argument - - * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in - moving argument. - -2000-05-04 Dekel Tsur - - * src/text.C (GetVisibleRow): Improved drawing of vertical lines - for appendix/minipage/depth. The lines can be now both in the footnote - frame, and outside the frame. - - * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels - points ("nikud") - -2000-05-05 Juergen Vigna - - * src/table.[Ch]: removed the inset and buffer stuff as this is now - neede only in tabular.[Ch]. - -2000-05-05 Lars Gullik Bjønnes - - * src/insets/insetspecialchar.C (Read): allow command == '~' for - PROTECTED_SEPARATOR - (Write): write '~' for PROTECTED_SEPARATOR - -2000-05-04 Lars Gullik Bjønnes - - * src/lyxparagraph.h: add a friend struct matchIT after the struct - InsetTable. - - * src/mathed/formula.C (drawStr): rename size to siz. - - * src/insets/figinset.C (RestoreForm): rename pflags to piflags, - possibly fix a bug by not changing the pflags = flags to piflags = - flags. - -2000-05-05 Juergen Vigna - - * src/insets/insetbib.C: moved using directive - - * src/ImportNoweb.C: small fix for being able to compile (missing - include cstdlib) - -2000-05-04 Lars Gullik Bjønnes - - * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not - to use clear, since we don't depend on this in the code. Add test - for string::compare - -2000-05-04 Jean-Marc Lasgouttes - - * (various *.C files): add using std::foo directives to please dec - cxx. - - * replace calls to string::clear() to string::erase() (Angus) - - * src/cheaders/cmath: modified to provide std::abs. - -2000-05-04 Juergen Vigna - - * src/insets/insettext.C: Prepared all for inserting of multiple - paragraphs. Still display stuff to do (alignment and other things), - but I would like to use LyXText to do this when we cleaned out the - table-support stuff. - - * src/insets/insettabular.C: Changed lot of stuff and added lots - of functionality still a lot to do. - - * src/tabular.C: Various functions changed name and moved to be - const functions. Added new Read and Write functions and changed - lots of things so it works good with tabular-insets (also removed - some stuff which is not needed anymore * hacks *). - - * src/lyxcursor.h: added operators == and != which just look if - par and pos are (not) equal. - - * src/buffer.C (latexParagraphs): inserted this function to latex - all paragraphs form par to endpar as then I can use this too for - text-insets. - - * src/text2.C (SetLayout): Changed this to use a cursor this is needed - so that I can call this to from text insets with their own cursor. - - * src/buffer.C (makeLaTeXFile): added the output of one \n after the - output off all paragraphs (because of the fix below)! - - * src/paragraph.C (TeXOnePar): removed output of \n when we are in - the very last paragraph (this could be also the last paragraph of an - inset!) - - * src/texrow.h: added rows() call which returns the count-variable. - -2000-05-03 Jose Abilio Oliveira Matos - - * lib/lyxrc.example: fix examples for exporting SGML to HTML. - - * lib/configure.m4: better autodetection of DocBook tools. - -2000-04-28 Lars Gullik Bjønnes - - * src/lyx_main.C (easyParse): use lyxerr instead of cerr. - - * src/lyx_cb.C: add using std::reverse; - - * src/LaTeX.C (run): on error always run deleteFilesOnError before - returning. - - * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some - selected files. Should fix repeated errors from generated files. - -2000-04-27 Dekel Tsur - - * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs - - * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in - the spellchecker popup. - - * lib/lyxrc.example: Removed the \number_inset section - -2000-04-28 Jean-Marc Lasgouttes - - * src/insets/figinset.C (various): Use IsFileReadable() to make - sure that the file actually exist. Relying on ghostscripts errors - is a bad idea since they can lead to X server crashes. - -2000-04-27 Claus Hentschel - - * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to - open under CYGWIN - - * lib/lyxrc.example: smallish typo in description of - \view_dvi_paper_option - -2000-04-26 André Pönitz - - * src/lyxfunc.h: - * src/lyxfunc.C: doImportHelper to factor out common code of the - various import methods. New functions doImportASCIIasLines, - doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb, - doImportLinuxDoc for the format specific parts. - - * buffer.h: - * buffer.C: Dispatch returns now a bool to indicate success - - * lyx_gui.h: - * lyx_gui.C: Add getLyXView() for member access - - * lyx_main.C: Change logic for batch commands: First try - Buffer::Dispatch (possibly without GUI), if that fails, use - LyXFunc::Dispatch - - * lyx_main.C: Add support for --import command line switch. - Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded. - Available Formats: Everything accepted by 'buffer-import ' - -2000-04-27 Lars Gullik Bjønnes - - * src/lyx_gui.C (create_forms): small oneliner from Garst to have - unnumbered parts. - - * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the - documents will be reformatted upon reentry. - -2000-04-27 Juergen Vigna - - * src/CutAndPaste.C (pasteSelection): last paragraph was not returned - correctly only last pos this was a bug. - -2000-04-26 Lars Gullik Bjønnes - - * release of lyx-1.1.5pre1 - -2000-04-26 Jean-Marc Lasgouttes - - * src/insets/insettabular.[Ch]: fix the Clone() declaration. - - * src/menus.C: revert the change of naming (Figure->Graphic...) - from 2000-04-11. It was incomplete and bad. - - * src/LColor.[Ch]: add LColor::depthbar. - * src/text.C (GetVisibleRow): use it. - - * README: update the languages list. - -2000-04-25 Dekel Tsur - - * src/text.C (GetVisibleRow): show the depth of paragraphs using - vertical bars. - -2000-04-26 Lars Gullik Bjønnes - - * README: remove sections that were just wrong. - - * src/text2.C (GetRowNearY): remove currentrow code - - * src/text.C (GetRow): remove currentrow code - - * src/screen.C (Update): rewritten a bit. - (SmallUpdate): removed func - - * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never - used. - (FullRebreak): return bool - (currentrow): remove var - (currentrow_y): ditto - - * src/lyxscreen.h (Draw): change arg to unsigned long - (FitCursor): return bool - (FitManualCursor): ditto - (Smallpdate): remove func - (first): change to unsigned long - (DrawOneRow): change second arg to long (from long &) - (screen_refresh_y): remove var - (scree_refresh_row): ditto - - * src/lyxrow.h: change baseline to usigned int from unsigned - short, this brings some implicit/unsigned issues out in the open. - - * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change - accordingly. - (Dispatch): don't call updateScrollbar after fitCursor. Use update - instead of smallUpdate. - - * src/lyxcursor.h: change y to unsigned long - - * src/buffer.h: don't call updateScrollbar after fitcursor - - * src/buffer.C (parseSingleLyXformat2Token): move variables to - where they are used. Removed "\\direction", this was not present - in 1.1.4 and is already obsolete. Commented out some code that I - believe to never be called. - (runLiterate): don't call updateScrollbar after fitCursor - (runLaTeX): ditto - (buildProgram): ditto - (runChktex): ditto - - * src/WorkArea.h (workWidth): change return val to unsigned - (width): ditto - (height): ditto - (redraw): remove the button redraws - (setScrollbarValue): change for scrollbar - (getScrollbarValue): change for scrollbar - (getScrollbarBounds): change for scrollbar - - * src/WorkArea.C (C_WorkArea_up_cb): removed func - (C_WorkArea_down_cb): removed func - (WorkArea): use fl_add_scrollbar instead of two buttons and a slider. - (resize): change for scrollbar - (setScrollbar): ditto - (setScrollbarBounds): ditto - (setScrollbarIncrements): ditto - (up_cb): removed func - (down_cb): removed func - (scroll_cb): change for scrollbar - (work_area_handler): ditto - - * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar - when FitCursor did something. - (updateScrollbar): some unsigned changes - (downCB): removed func - (scrollUpOnePage): removed func - (scrollDownOnePage): remvoed func - (workAreaMotionNotify): don't call screen->FitCursor but use - fitCursor instead. and bool return val - (workAreaButtonPress): ditto - (workAreaButtonRelease): some unsigned changes - (checkInsetHit): ditto - (workAreaExpose): ditto - (update): parts rewritten, comments about the signed char arg added - (smallUpdate): removed func - (cursorPrevious): call needed updateScrollbar - (cursorNext): ditto - - * src/BufferView2.C (allFloats): don't call updateScrollbar after - fitCursor. - - * src/BufferView.[Ch] (upCB): removed func - (downCB): removed func - (smallUpdate): removed func - -2000-04-25 Lars Gullik Bjønnes - - * src/lyxtext.h src/text.C src/text2.C: removed support for the - currentrow, currentrow_y optimization. This did not help a lot and - if we want to do this kind of optimization we should rather use - cursor.row instead of the currentrow. - - * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in - buffer spacing and klyx spacing support. - -2000-04-25 Dekel Tsur - - * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by - a factor of 50! - -2000-04-26 Juergen Vigna - - * src/insets/figinset.C: fixes to Lars sstream changes! - -2000-04-23 Dekel Tsur - - * A lot of files: Added Ascii(ostream &) methods to all inset - classes. Used when exporting to ASCII. - - * src/buffer.C (writeFileAscii,RoffAsciiTable) - * src/paragraph.C (RoffContTableRows): Use the Ascii() methods - instead of Latex() - - * src/text2.C (ToggleFree): Disabled implicit word selection when - there is a change in the language - - * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug: - no output was generated for end-of-sentence inset. - - * src/insets/lyxinset.h - * src/buffer.C - * src/lyxfunc.C - * src/paragraph.C: Removed the insetnumber code - - * src/text.C (SelectWordWhenUnderCursor): Cleaned the code. - -2000-04-22 Lars Gullik Bjønnes - - * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1, - no_babel and no_epsfig completely from the file. - (parseSingleLyXformat2Token): add handling for per-paragraph - spacing as written by klyx. - - * src/insets/figinset.C: applied patch by Andre. Made it work with - ostringstream too. - -2000-04-20 Juergen Vigna - - * src/insets/insettext.C (cutSelection): - (copySelection): Fixed with selection from right to left. - (draw): now the rows are not recalculated at every draw. - (computeTextRows): for now reset the inset-owner here (this is - important for an undo or copy where the inset-owner is not set - automatically!) - - * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the - motion to the_locking_inset screen->first was forgotten, this was - not important till we got multiline insets. - -2000-04-19 Jean-Marc Lasgouttes - - * src/mathed/formulamacro.C (Latex): remove CHECK comment, since - code seems to be alright (it is code changed by Dekel, and the - intent is indeed that all macros should be defined \protect'ed) - - * NEWS: a bit of reorganisation of the new user-visible features. - -2000-04-19 Juergen Vigna - - * src/insets/insettext.C (init): using a LyXCursor now for cursor - position. Set the inset_owner of the used paragraph so that it knows - that it is inside an inset. Fixed cursor handling with mouse and - cursor keys. Fixed wrong timed inset redraws and lots of other changes - and cleanups to make TextInsets work better. - - * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call. - Changed parameters of various functions and added LockInsetInInset(). - - * src/insets/insettext.C: - - * src/insets/insetcollapsable.h: - * src/insets/insetcollapsable.C: - * src/insets/insetfoot.h: - * src/insets/insetfoot.C: - * src/insets/insetert.h: - * src/insets/insetert.C: cleaned up the code so that it works now - correctly with insettext. - - * src/insets/inset.C: - * src/insets/lyxinset.h: inserted inset_owner and some more changes so - that insets in insets are supported right. - - * src/table.h: - * src/table.C: lots of changes for use with inset tabular (and cleanup) - - * src/paragraph.C: some small fixes - - * src/debug.h: inserted INSETS debug info - - * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset - fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN). - - * src/commandtags.h: - * src/LyXAction.C: insert code for InsetTabular. - - * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if - not Button1MotionMask. - (workAreaButtonRelease): send always a InsetButtonRelease event to - the_locking_inset. - (checkInsetHit): some setCursor fixes (always with insets). - - * src/BufferView2.C (lockInset): returns a bool now and extended for - locking insets inside insets. - (showLockedInsetCursor): it is important to have the cursor always - before the locked inset. - (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset. - - * src/BufferView.h: made lockInset return a bool. - - * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...). - - * src/text2.C (SetCursor): This now has a version with a LyXCursor - that is used also internally but can be called as public to have back - a cursor pos which is not set internally. - (SetCursorIntern): Changed to use above function. - - * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass - -2000-04-19 Lars Gullik Bjønnes - - * ANNOUNCE: - * INSTALL: - * UPGRADING: - * NEWS: updated for prerelease of 1.1.5. Please comment and send - patches for things that should be in or should be changed. - - * src/* [insetfiles]: change "usigned char fragile" to bool - fragile. There was only one point that could that be questioned - and that is commented in formulamacro.C. Grep for "CHECK". - - * src/CutAndPaste.C (getBufferTextClass): unused func, removed. - (DeleteBuffer): take it out of CutAndPaste and make it static. - -2000-04-17 Lars Gullik Bjønnes - - * src/paragraph.C (TeXOnePar): use the new method in Spacing to - output the spacing envir commands. Also the new commands used in - the LaTeX output makes the result better. - - * src/Spacing.C (writeEnvirBegin): new method - (writeEnvirEnd): new method - -2000-04-18 Juergen Vigna - - * src/CutAndPaste.C: made textclass a static member of the class - as otherwise it is not accesed right!!! - -2000-04-17 Dekel Tsur - - * forms/layout_forms.fd - * src/layout_forms.h - * src/layout_forms.C (create_form_form_character) - * src/lyx_cb.C (UserFreeFont) - * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual - documents (in the layout->character popup). - -2000-04-17 Jean-Marc Lasgouttes - - * src/spellchecker.C (create_ispell_pipe): fix a bug where - \spell_command was in fact not honored (from Kevin Atkinson). - - * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when - quitting (Angus) - - * src/lyx_gui.h: make lyxViews private (Angus) - -2000-04-15 Dekel Tsur - - * src/mathed/math_write.C - (MathMatrixInset::Write) Put \protect before \begin{array} and - \end{array} if fragile - (MathParInset::Write): Put \protect before \\ if fragile - -2000-04-15 Lars Gullik Bjønnes - - * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The - initialization if the LyXColorHandler must be done after the - connections to the XServer has been established. - - * src/insets/figinset.C (runqueue): change the grabing a bit. Also - get the background pixel from the lyxColorhandler so that the - figures are rendered with the correct background color. - (NextToken): removed functions. - (GetPSSizes): use ifs >> string instead of NextToken. - - * src/Painter.[Ch]: the color cache moved out of this file. - - * src/ColorHandler.[Ch]: new files. Holds the gc cache for color - and lines. - -2000-04-14 Lars Gullik Bjønnes - - * src/WorkArea.C (work_area_handler): call BufferView::enterView - and Buffer::leaveView when FL_ENTER and FL_LEAVE. - - * src/BufferView.C (enterView): new func - (leaveView): new func - - * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor - when approp. - (leaveView): new func, undefines xterm cursor when approp. - - * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C - (AllowInput): delete the Workarea cursor handling from this func. - - * src/Painter.C (underline): draw a slimer underline in most cases. - - * src/lyx_main.C (error_handler): use extern "C" - -2000-04-12 Lars Gullik Bjønnes - - * src/insets/figinset.C (DocBook): small patch from Jose (jamatos) - sent directly to me. - - * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted - to the list by Dekel. - - * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with - strstream too. - - * src/bufferview_funcs.[Ch]: two new files, moved several of the - methods from lyx_cb.here. - - * src/lyx_cb.C: in addition to the above; removed input_prohibited - it was not used. - -2000-04-11 Lars Gullik Bjønnes - - * src/lyx_cb.[Ch]: made several functions take a BufferView* arg - instead of using current_view directly. - - * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation - - * src/LyXAction.C (init): add the paragraph-spacing command. - - * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING - - * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing - - * src/lyx_cb.C (CurrentState): output a string when the spacing is - different from the documents. - - * src/text.C (SetHeightOfRow): take paragraph spacing into - account, paragraph spacing takes precedence over buffer spacing - (GetVisibleRow): ditto - - * src/paragraph.C (writeFile): output the spacing parameter too. - (validate): set the correct features if spacing is used in the - paragraph. - (Clear): set spacing to default - (MakeSameLayout): spacing too - (HasSameLayout): spacing too - (SetLayout): spacing too - (TeXOnePar): output the spacing commands - - * src/lyxparagraph.h: added a spacing variable for use with - per-paragraph spacing. - - * src/Spacing.h: add a Default spacing and a method to check if - the current spacing is default. also added an operator== - - * src/text2.C (DeleteEmptyParagraphMechanism): added a - RedoParagraphs. - -2000-04-11 Jean-Marc Lasgouttes - - * src/lyxserver.C (callback): fix dispatch of functions - - * src/insets/insetlatexaccent.C (checkContents): turn bogus - printf() into lyxerr call. - - * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of - fonts. - - * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic", - "Table" to "Table Box", "Float" to "Floating Material"; deletes - the "Float" from each of the subitems. - (ShowHelpMenu): add entry for "FAQ" and "TOC". - - * src/support/DebugStream.h: add an #ifdef to work around a gcc - 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I - documented the change so that the workaround can be nuked later. - - * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from - LyX::init(). - - * src/lyxlex_pimpl.C (next): do not re-declare the default value - of arguments. - * src/buffer.C (getLatexName): ditto - (setReadonly): ditto - -2000-04-11 Lars Gullik Bjønnes - - * src/LaTeXFeatures.h: add a const reference to BufferParams, to - avoid some uses of current_view. Added also a bufferParams() - method to get at this. - - * src/lyxtext.h: changed params->buffer and paramters->bparams. - -2000-04-10 Lars Gullik Bjønnes - - * src/lyxparagraph.[Ch]: removed - operator<(LyXParagraph::InsetTable..., added a struct matchIT - with operators used by lower_bound and - upper_bound in InsetTable's - Make struct InsetTable private again. Used matchpos. - -2000-04-08 Dekel Tsur - - * src/lyx_cb.C (DocumentApplyCB): When changing the language of the - document, the language of existing text is changed (unless the - document is multi-lingual) - - * src/buffer.C (ChangeLanguage,isMultiLingual) New methods. - - * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods. - - * A lot of files: A rewrite of the Right-to-Left support. - -2000-04-10 Juergen Vigna - - * src/BufferView2.C (showLockedInsetCursor): small bugfix for - misplaced cursor when inset in inset is locked. - - * src/insets/insettext.C (LocalDispatch): small fix so that a - BREAKLINE is not inserted if we don't permit it with autBreakRows. - - * src/insets/insetfoot.C (GetDrawFont): implemented this as the - footnote font should be decreased in size twice when displaying. - - * src/insets/insettext.C (GetDrawFont): inserted this function as - the drawing-font may differ from the real paragraph font. - - * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking - insets (inset in inset!). - - * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below - function here because we don't want footnotes inside footnotes. - - * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for - Cloned insets. - (init): now set the inset_owner in paragraph.C - (LocalDispatch): added some resetPos() in the right position - (cutSelection): - (copySelection): - (pasteSelection): changed to use the new CutAndPaste-Class. - - * src/insets/lyxinset.h: inserted new function InsertInsetAllowed - which tells if it is allowed to insert another inset inside this one. - - * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for - SwitchLayoutsBetweenClasses. - - * src/text2.C (InsertInset): checking of the new paragraph-function - InsertInsetAllowed. - (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this - is not needed anymore here! - (CutSelection): - (CopySelection): - (PasteSelection): redone (also with #ifdef) so that now this uses - the CutAndPaste-Class. - (SwitchLayoutsBetweenClasses): removed here and implemented in the - CutAndPaste-Class. - - * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste - from/to text/insets. - - * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer - so that the paragraph knows if it is inside an (text)-inset. - (InsertFromMinibuffer): changed return-value to bool as now it - may happen that an inset is not inserted in the paragraph. - (InsertInsetAllowed): this checks if it is allowed to insert an - inset in this paragraph. - (PasteParagraph): - (BreakParagraphConservative): - (BreakParagraph) : small change for the above change of the return - value of InsertFromMinibuffer. - - * src/lyxparagraph.h: added inset_owner and the functions to handle - this (SetInsetOwner(), InInset() and InsertInsetAllowed()). - -2000-04-10 Lars Gullik Bjønnes - - * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more - functions from BufferView to BufferView::Pimpl to ease maintence. - - * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor - correctly. Also use SetCursorIntern instead of SetCursor. - - * src/insets/insetinfo.C (draw): draw InsetInfo notes with the - correct color. - -2000-04-08 Lars Gullik Bjønnes - - * src/WorkArea.C (belowMouse): manually implement below mouse. - - * src/*: Add "explicit" on several constructors, I added probably - some unneeded ones. A couple of changes to code because of this. - - * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the - implementation and private parts from the users of BufferView. Not - quite finished. - - * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the - implementation and private parts from the users of LyXLex. Not - quite finished. - - * src/BufferView_pimpl.[Ch]: new files - - * src/lyxlex_pimpl.[Ch]: new files - - * src/LyXView.[Ch]: some inline functions move out-of-line - -2000-04-04 Jean-Marc Lasgouttes - - * src/lyxparagraph.h: make struct InsetTable public. - - * src/support/lyxstring.h: change lyxstring::difference_type to be - ptrdiff_t. Add std:: modifiers to streams. - - * src/font.C: include the header, for islower() and - isupper(). - -2000-04-03 Lars Gullik Bjønnes - - * src/font.[Ch]: new files. Contains the metric functions for - fonts, takes a LyXFont as parameter. Better separation of concepts. - - * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several - changes because of this. - - * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead - - * src/*: compile with -Winline and move functions that don't - inline out of line. - - * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of - instead of strspn. - -2000-04-02 Lars Gullik Bjønnes - - * src/paragraph.C (GetLabelstring): renamed from GetLabestring. - (various files changed because of this) - - * src/Painter.C (text): fixed the drawing of smallcaps. - - * src/lyxfont.[Ch] (drawText): removed unused member func. - (drawString): ditto - - * src/*.C: added needed "using" statements and "std::" qualifiers. - -2000-03-31 Lars Gullik Bjønnes - - * src/*.h: removed all use of "using" from header files use - qualifier std:: instead. - -2000-04-03 Jean-Marc Lasgouttes - - * src/text.C (Backspace): some additional cleanups (we already - know whether cursor.pos is 0 or not). - - * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since - automake does not provide one). - - * src/bmtable.h: replace C++ comments with C comments. - -2000-04-02 Dekel Tsur - - * src/screen.C (ShowCursor): Change the shape of the cursor if - the current language is not equal to the language of the document. - (If the cursor change its shape unexpectedly, then you've found a bug) - - * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some - bugs [I hope...] - - * src/insets/insetnumber.[Ch]: New files. - - * src/LyXAction.C (init) - * src/lyxfunc.C (dispatch): Add command number-inset-insert - - * lyxrc.example - * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset - - * src/lyxparagraph.h - * src/paragraph.C: Changed insetlist to Vector. - (the vector is kept sorted). - - * src/text.C (GetVisibleRow): Draw selection correctly when there - is both LTR and RTL text. - - * src/paragraph.C (Clone): Use the assignment operator for cloning, - which is much faster. - - * src/text.C (GetVisibleRow and other): Do not draw the last space - in a row if the direction of the last letter is not equal to the - direction of the paragraph. - - * src/lyxfont.C (latexWriteStartChanges): - Check that font language is not equal to basefont language. - (latexWriteEndChanges): ditto - - * src/lyx_cb.C (StyleReset): Don't change the language while using - the font-default command. - - * src/paragraph.C (GetFirstFontSettings): Handle correctly an - empty paragraph before a footnote. - - * src/insets/insetcommand.C (draw): Increase x correctly. - - * src/screen.C (ShowCursor): Change cursor shape if - current language != document language. - - * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState() - -2000-03-31 Juergen Vigna - - * src/paragraph.C (GetInset): commented out text[pos] = ' ' - (Clone): changed mode how the paragraph-data is copied to the - new clone-paragraph. - - * src/lyxfunc.C (Dispatch): fixed small problem when calling - GetInset(pos) with no inset anymore there (in inset UNDO) - - * src/insets/insetcommand.C (draw): small fix as here x is - incremented not as much as width() returns (2 before, 2 behind = 4) - -2000-03-30 Juergen Vigna - - * src/insets/insettext.C (InsetText): small fix in initialize - widthOffset (should not be done in the init() function) - -2000-03-29 Amir Karger - - * lib/examples/it_ItemizeBullets.lyx: translation by - Stefano Mastella - - * Implemented \textasciitilde and fixed a tiny bug in reLyX - -2000-03-29 Juergen Vigna - - * src/insets/insetcollapsable.C (Clone): same as in InsetFoot - - * src/insets/insetfoot.C (Clone): small change as for the below - new init function in the text-inset - - * src/insets/insettext.C (init): new function as I've seen that - clone did not copy the Paragraph-Data! - (LocalDispatch): Added code so that now we have some sort of Undo - functionality (well actually we HAVE Undo ;) - - * src/text.C (Backspace): Small fix for the a | a Backspace problem - -2000-03-24 Dekel Tsur - - * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions - were erased) - -2000-03-22 Lars Gullik Bjønnes - - * src/main.C: added a runtime check that verifies that the xforms - header used when building LyX and the library used when running - LyX match. Exit with a message if they don't match. This is a - version number check only. - - * src/buffer.C (save): Don't allocate memory on the heap for - struct utimbuf times. - - * *: some using changes, use iosfwd instead of the real headers. - - * src/lyxfont.C use char const * instead of string for the static - strings. Rewrite some functions to use sstream. - -2000-03-28 Jean-Marc Lasgouttes - - * src/text.C (Backspace): hopefully fix the dreaded backaspace - bug. - -2000-03-27 Jean-Marc Lasgouttes - - * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal - of Geodesy (from Martin Vermeer) - - * lib/layouts/svjour.inc: include file for the Springer svjour - class. It can be used to support journals other than JoG. - - * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz - Miskiewicz ) - * lib/reLyX/Makefile.am: ditto. - -2000-03-27 Juergen Vigna - - * src/insets/insettext.C: added Cut/Copy/Paste inside insets, - also some modifications with operations on selected text. - - * src/BufferView.C (checkInsetHit): Now hopefully fixed all the - problems with clicking on insets (last famous words ;) - - * src/insets/insetcommand.C (draw): - (width): Changed to have a bit of space before and after the inset so - that the blinking cursor can be seen (otherwise it was hidden) - -2000-03-22 Jean-Marc Lasgouttes - - * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl - would not be added to the link list when an installed gettext (not - part of libc) is found. - -2000-03-24 Juergen Vigna - - * src/insets/insetcollapsable.C (Edit): - * src/mathed/formula.C (InsetButtonRelease): - (InsetButtonPress): fixed for new handling of ButtonPress/Release - handling. - - * src/BufferView.C (workAreaButtonPress): - (workAreaButtonRelease): - (checkInsetHit): Finally fixed the clicking on insets be handled - correctly! - - * src/insets/insetert.C (Edit): inserted this call so that ERT - insets work always with LaTeX-font - -2000-03-21 Kayvan A. Sylvan - - * src/lyx_main.C (easyParse): Removed misplaced gui=false which - caused lyx to startup with no GUI in place, causing in a crash - upon startup when called with arguments. - -2000-03-21 Jean-Marc Lasgouttes - - * src/FontLoader.C: better initialization of dummyXFontStruct. - -2000-03-20 José Abílio Matos - - * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags - for linuxdoc and docbook import and export format options. - - * lib/lyxrc.example Example of default values for the previous flags. - - * src/lyx_cb.C Use those flags instead of the hardwired values for - linuxdoc and docbook export. - - * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added - linuxdoc import. - - * src/menus.C Added menus entries for the new import/exports formats. - -2000-03-09 André Pönitz - - * src/lyxrc.*: Added support for running without Gui - (\use_gui false) - - * src/FontLoader.C: sensible defaults if no fonts are needed - - * src/lyx_cb.C: New function ShowMessage (writes either to the - minibuffer or cout in case of no gui - New function AskOverwrite for common stuff - Consequently various changes to call these functions - - * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false - wild guess at sensible screen resolution when having no gui - - * src/lyxfont.C: no gui, no fonts... set some defaults - -2000-03-20 Jean-Marc Lasgouttes - - * src/LColor.C: made the command inset background a bit lighter. - -2000-03-20 Hartmut Goebel - - * lib/layouts/stdstruct.inc: split into stdtitle.inc and - stdstruct.inc. Koma-Script added some title elements which - otherwise have been listed below "bibliography". This split allows - adding title elements to where they belong. - - * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then - define the additional title elements and then include - stdstruct.inc. - - * many other layout files: changed to include stdtitle.inc just - before stdstruct.inc. - -2000-03-18 Dekel Tsur - - * src/buffer.C: (save) Added the option to store all backup files - in a single directory - - * src/lyxrc.[Ch]: Added variable \backupdir_path - - * lib/lyxrc.example: Added descriptions of recently added variables - - * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a - bibtex inset, not closing the bibtex popup when deleting the inset) - -2000-03-17 Jean-Marc Lasgouttes - - * src/lyx_cb.C: add a couple using directives. - -2000-03-17 José Abílio Matos - * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc - import based on the filename. - - * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc - file would be imported at start, if the filename where of a sgml file. - - * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed. - - * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed. - -2000-03-16 Dekel Tsur - * src/lyxfont.h Replaced the member variable bits.direction by the - member variable lang. Made many changes in other files. - This allows having a multi-lingual document - - * src/lyxfunc.C, src/lyx_cb.C Added a new command "language " - that change the current language to . - Removed the command "font-rtl" - - * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file - format for Hebrew documents) - - * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode" - When auto_mathmode is "true", pressing a digit key in normal mode - will cause entering into mathmode. - If auto_mathmode is "rtl" then this behavior will be active only - when writing right-to-left text. - - * src/text2.C (InsertStringA) The string is inserted using the - current font. - - * src/paragraph.C (GetEndLabel) Gives a correct result for - footnote paragraphs. - - * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug - -2000-03-16 Lars Gullik Bjønnes - - * src/text.C (Backspace): move RemoveParagraph and RemoveRow in - front of PasteParagraph. Never insert a ' '. This should at least - fix some cause for the segfaults that we have been experiencing, - it also fixes backspace behaviour slightly. (Phu!) - - * src/support/lstrings.C (compare_no_case): some change to make it - compile with gcc 2.95.2 and stdlibc++-v3 - - * src/text2.C (MeltFootnoteEnvironment): change type o - first_footnote_par_is_not_empty to bool. - - * src/lyxparagraph.h: make text private. Changes in other files - because of this. - (fitToSize): new function - (setContentsFromPar): new function - (clearContents): new function - (SetChar): new function - - * src/paragraph.C (readSimpleWholeFile): deleted. - - * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold - the file, just use a simple string instead. Also read the file in - a more maintainable manner. - - * src/text2.C (InsertStringA): deleted. - (InsertStringB): deleted. - -2000-03-15 Lars Gullik Bjønnes - - * src/text2.C (DeleteEmptyParagraphMechanism): don't run, - RedoParagraphs from the doublespace handling part, just set status - to NEED_MORE_REFRESH. Also don't update cursor position (should be - done, but perhaps not like this.) - -2000-03-14 Jean-Marc Lasgouttes - - * src/text2.C (InsertStringA): don't forget to insert a META_INSET - character when inserting an inset. - -2000-03-12 Lars Gullik Bjønnes - - * src/bufferparams.C (readLanguage): now takes "default" into - consideration. - - * src/lyx_main.C (LyX): remove the setup of lyxrc. (new) - also initialize the toplevel_keymap with the default bindings from - lyxrc. - - * src/buffer.C (Buffer): remove lyxrc from the parameters. - - * all files using lyxrc: have lyxrc as a real variable and not a - pointer. remove all extern LyXRC * lyxrc. The equiv to this is - done in lyxrc.h. - - * src/lyxrc.C: remove double call to defaultKeyBindings - - * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of - toolbar defauls using lyxlex. Remove enums, structs, functions - related to this. - - * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing - toolbar defaults. Also store default keybindings in a map. - - * src/ToolbarDefaults.[Ch]: New file. This class is used for - storing the toolbar defaults without any xforms dependencies. - - * src/insets/figinset.C: patch posted to list by Andre Poenitz - applied. Changed to use iterators. - -2000-03-11 Kayvan A. Sylvan - - * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for - systems that don't have LINGUAS set to begin with. - -2000-03-10 Lars Gullik Bjønnes - - * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to - the list by Dekel Tsur. - -2000-03-10 Jean-Marc Lasgouttes - - * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage. - * src/insets/form_graphics.C: ditto. - - * src/insets/inseturl.C (Latex): the free_spc argument is not used. - -2000-03-10 Lars Gullik Bjønnes - - * src/bufferparams.C (readLanguage): use the new language map - - * src/intl.C (InitKeyMapper): use the new language map - - * src/lyx_gui.C (create_forms): use the new language map - - * src/language.[Ch]: New files. Used for holding the information - about each language. Now! Use this new language map enhance it and - make it really usable for our needs. - -2000-03-09 Dekel Tsur - - * screen.C (ShowCursor): Removed duplicate code. - (ShowManualCursor): Support for 3 cursor shapes: Bar (default), - L (LTR text in RTL document), and reversed-L (RTL text in LTR document) - - * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin - - * src/lyxtext.h - * src/text.C Added TransformChar method. Used for rendering Arabic - text correctly (change the glyphs of the letter according to the - position in the word) - - * src/buffer.C - * src/paragraph.C - * src/lyxrc.h - * src/lyxrc.C Added lyxrc command {language_command_begin, - language_command_end,language_command_ltr,language_command_rtl, - language_package} which allows the use of either arabtex or Omega - for Arabic - - * src/lyx_gui.C (init) - * src/lyxrc.h - * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows - to use encoding for menu fonts which is different than the encoding - for screen fonts - - * src/buffer.C (makeLaTeXFile): If params.language = "default", - do not load the babel package. - To write an English document with Hebrew/Arabic, change the document - language to "english". - - * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document - (alphaCounter): changed to return char - (loweralphaCounter, hebrewCounter, romanCounter): New functions - - * lib/lyxrc.example Added examples for Hebrew/Arabic - - * src/layout.h - * src/layout.C Added layout command endlabeltype - - * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const - - * src/text.C (GetVisibleRow): Draw a box at the end of proof layout - -2000-03-10 Lars Gullik Bjønnes - - * src/mathed/math_delim.C (search_deco): return a - math_deco_struct* instead of index. - -2000-03-09 Lars Gullik Bjønnes - - * All files with a USE_OSTREAM_ONLY within: removed all code that - was unused when USE_OSTREAM_ONLY is defined. - - * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead - of any less. Removed header and using. - - * src/text.C (GetVisibleRow): draw the string "Page Break - (top/bottom)" on screen when drawing a pagebreak line. - -2000-03-09 Jean-Marc Lasgouttes - - * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs. - - * src/mathed/math_macro.C (draw): do some cast magic. - (Metrics): ditto. - - * src/mathed/math_defs.h: change byte* argument to byte const*. - - * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method. - - * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I - know it is right to return InsetFoot* too, but cxx does not like - it...). - - * src/insets/insetcollapsable.[Ch] (Clone): make const. - - * development/lyx.spec.in: unset LINGUAS to avoid i18n problems. - - * src/mathed/math_delim.C: change == to proper assignment. - -2000-03-09 Juergen Vigna - - * src/insets/insettext.C (setPos): fixed various cursor positioning - problems (via mouse and cursor-keys) - (LocalDispatch): added posibility to add a Ctrl-Enter inside a text - inset (still a small display problem but it works ;) - - * src/insets/insetcollapsable.C (draw): added button_top_y and - button_bottom_y to have correct values for clicking on the inset. - - * src/support/lyxalgo.h: commented out 'using std::less' - -2000-03-08 Juergen Vigna - - * src/insets/insetcollapsable.C (InsetButtonRelease): Now a - Button-Release event closes as it is alos the Release-Event - which opens it. - - * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT - -2000-03-07 Kayvan A. Sylvan - - * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we - can add multiple spaces in Scrap (literate programming) styles... - which, by the way, is how I got hooked on LyX to begin with. - - * src/mathed/formula.C (Write): Added dummy variable to an - inset::Latex() call. - (Latex): Add free_spacing boolean to inset::Latex() - - * src/mathed/formula.h (Latex): Added free_spacing boolean arg. - - * src/insets/lyxinset.h: Changed definition of the inset::Latex() - virtual function to include the free_spacing boolean from - the containing paragraph's style. - - * src/insets/inseturl.C, src/insets/inseturl.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insettext.C, src/insets/insettext.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex): - Added free_spacing boolean and made sure that if in a free_spacing - paragraph, that we output normal space if there is a protected space. - - * src/insets/insetref.C, src/insets/insetref.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetparent.C, src/insets/insetparent.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added - free_spacing boolean arg to match inset.h - - * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/inseterror.C, src/insets/inseterror.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex): - Added free_spacing boolean arg to match inset.h - - * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added - free_spacing boolean arg to match inset.h - - * src/insets/figinset.C, src/insets/figinset.h (Latex): Added - free_spacing boolean arg to match inset.h - - * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to - ignore free_spacing paragraphs. The user's spaces are left - alone. - - * src/text.C (InsertChar): Fixed the free_spacing layout - attribute behavior. Now, if free_spacing is set, you can - add multiple spaces in a paragraph with impunity (and they - get output verbatim). - (SelectSelectedWord): Added dummy argument to inset::Latex() - call. - - * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...) - calls. - - * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing - paragraph layouts now only input a simple space instead. - Special character insets don't make any sense in free-spacing - paragraphs. - - * src/buffer.C (parseSingleLyXformat2Token): Code to convert - hard-spaces in the *input* file to simple spaces if the layout - is free-spacing. This converts old files which had to have - hard-spaces in free-spacing layouts where a simple space was - preferrable. - (writeFileAscii): Added free_spacing check to pass to the newly - reworked inset::Latex(...) methods. The inset::Latex() code - ensures that hard-spaces in free-spacing paragraphs get output - as spaces (rather than "~"). - -2000-03-09 Lars Gullik Bjønnes - - * src/mathed/math_delim.C (draw): draw the empty placeholder - delims with a onoffdash line. - (struct math_deco_compare): struct that holds the "functors" used - for the sort and the binary search in math_deco_table. - (class init_deco_table): class used for initial sort of the - math_deco_table. - (search_deco): use lower_bound to do a binary search in the - math_deco_table. - -2000-03-08 Lars Gullik Bjønnes - - * src/lyxrc.C: a small secret thingie... - - * src/lyxlex.C (printTable): changed to take a ostream as paramter - and to not flush the stream as often as it used to. - - * src/support/lyxalgo.h: new file - (sorted): template function used for checking if a sequence is - sorted or not. Two versions with and without user supplied - compare. Uses same compare as std::sort. - - * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort - it and give warning on lyxerr. - (pushTable): ditto - (struct compare_tags): struct with function operators used for - checking if sorted, sorting and lower_bound. - (search_kw): use lower_bound instead of manually implemented - binary search. - -2000-03-08 Jean-Marc Lasgouttes - - * src/insets/insetcollapsable.h: fix Clone() declaration. - * src/insets/insetfoot.h: ditto. - - * src/insets/lyxinset.h: remove an extra comma at the end of enum. - -2000-03-08 Juergen Vigna - - * src/insets/lyxinset.h: added owner call which tells us if - this inset is inside another inset. Changed also the return-type - of Editable to an enum so it tells clearer what the return-value is. - - * src/insets/insettext.C (computeTextRows): fixed computing of - textinsets which split automatically on more rows. - - * src/insets/insetert.[Ch]: changed this to be of BaseType - InsetCollapsable. - - * src/insets/insetfoot.[Ch]: added footnote inset - - * src/insets/insetcollapsable.[Ch]: added this BaseClass for - collapsable insets (like footnote, ert, ...) - -2000-03-08 Lars Gullik Bjønnes - - * src/lyxdraw.h: remvoe file - - * src/lyxdraw.C: remove file - - * src/insets/insettext.C: added . - -2000-03-07 Lars Gullik Bjønnes - - * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream - (matrix_cb): case MM_OK use string stream - - * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string - stream. - - * src/mathed/math_macro.C (draw): use string stream - (Metrics): use string stream - - * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write - directly to the ostream. - - * src/vspace.C (asString): use string stream. - (asString): use string stream - (asLatexString): use string stream - - * src/lyx_cb.C (UpdateLayoutDocument): use string stream for - setting Spacing::Other. - - * src/LaTeXFeatures.C (getPackages): use string stream instead of - sprintf when creating the stretch vale. - - * src/text2.C (alphaCounter): changed to return a string and to - not use a static variable internally. Also fixed a one-off bug. - (SetCounter): changed the drawing of the labels to use string - streams instead of sprintf. - - * src/support/lyxmanip.h: rewrite the newlineanDepth ostream - manipulator to use a scheme that does not require library support. - This is also the way it is done in the new GNU libstdc++. Should - work with DEC cxx now. - -2000-03-06 Lars Gullik Bjønnes - - * src/mathed/math_inset.h (Write(ostream & os): add a space at the - end. This fixes a bug. - - * src/mathed (all files concerned with file writing): apply the - USE_OSTREAM_ONLY changes to mathed too. - - * src/support/DebugStream.h: make the constructor explicit. - - * src/lyxfont.C (latexWriteStartChanges): small bug related to - count and ostream squashed. - -2000-03-06 Jean-Marc Lasgouttes - - * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h. - - * src/buffer.C (makeLaTeXFile): add a .c_str(), since - ostringstream uses STL strings, and we might not. - - * src/insets/insetspecialchar.C: add using directive. - * src/insets/insettext.C: ditto. - -2000-03-06 Lars Gullik Bjønnes - - * lib/layouts/seminar.layout: feeble attempt at a layout for - seminar.cls, far from completet and could really use some looking - at from people used to write layout files. - - * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to - use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is - a lot nicer and works nicely with ostreams. - - * src/mathed/formula.C (draw): a slightly different solution that - the one posted to the list, but I think this one works too. (font - size wrong in headers.) - - * src/insets/insettext.C (computeTextRows): some fiddling on - Jürgens turf, added some comments that he should read. - - * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never - used and it gave compiler warnings. - RC_SHOW_BANNER + "\\show_banner" added, also to reading and - writing of lyxrc. - - * src/lyx_gui.C (create_forms): do the right thing when - show_banner is true/false. - - * src/lyx_cb.C (TimerCB): no need to close or do anything if - show_banner is false. - - * most file writing files: Now use iostreams to do almost all of - the writing. Also instead of passing string &, we now use - stringstreams. mathed output is still not adapted to iostreams. - This change can be turned off by commenting out all the occurences - of the "#define USE_OSTREAM_ONLY 1" lines. - - * src/WorkArea.C (createPixmap): don't output debug messages. - (WorkArea): don't output debug messages. - - * lib/lyxrc.example: added a comment about the new variable - \show_banner - - * development/Code_rules/Rules: Added some more commente about how - to build class interfaces and on how better encapsulation can be - achieved. - -2000-03-03 Juergen Vigna - - * src/insets/insetert.C (InsetERT): Now ERT-insets break row - automatically with the width of the LyX-Window - - * src/insets/insettext.C (computeTextRows): fixed update bug in - displaying text-insets (scrollvalues where not initialized!) - -2000-03-02 Lars Gullik Bjønnes - - * src/mathed/math_utils.C (MathedLookupBOP): using only res->id == - id in the check of the result from lower_bound is not enough since - lower_bound can return last too, and then res->id will not be a - valid construct. - - * all insets and some code that use them: I have conditionalized - removed the Latex(string & out, ...) this means that only the - Latex(ostream &, ...) will be used. This is a work in progress to - move towards using streams for all output of files. - - * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type - c to 0. - -2000-03-02 Jean-Marc Lasgouttes - - * src/mathed/math_utils.C (MathedLookupBOP): fix the search - routine (this fixes bug where greek letters were surrounded by too - much white space). - - * src/support/filetools.C (findtexfile): change a bit the search - algorithm, to fix bug introduced in 1.1.4. Note that --format is - no longer passed to kpsewhich, we may have to change that later. - - * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent - warning options to avoid problems with X header files (from Angus - Leeming). - * acinclude.m4: regenerated. - -2000-03-02 Juergen Vigna - - * src/insets/insettext.C (WriteParagraphData): Using the - par->writeFile() function for writing paragraph-data. - (Read): Using buffer->parseSingleLyXformat2Token()-function - for parsing paragraph data! - - * src/buffer.C (readLyXformat2): removed all parse data and using - the new parseSingleLyXformat2Token()-function. - (parseSingleLyXformat2Token): added this function to parse (read) - lyx-file-format (this is called also from text-insets now!) - -2000-03-01 Lars Gullik Bjønnes - - * src/paragraph.C (BeginningOfMainBody): initialize previous_char - and temp. - - * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog - directly instead of going through a func. One very bad thing: a - static LyXFindReplace, but I don't know where to place it. - - * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a - string instead of char[]. Also changed to static. - (GetSelectionOrWordAtCursor): changed to static inline - (SetSelectionOverLenChars): ditto. - - * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of - current_view and global variables. both classes has changed names - and LyXFindReplace is not inherited from SearchForm. - - * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the - fl_form_search form. - - * src/lyx_gui.C (create_forms): removed the fl_form_search form. - -2000-03-01 Jean-Marc Lasgouttes - - * lib/bind/*.bind: make sure 'buffer-previous' function is not - bound (from Kayvan). - - * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h. - - * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address. - -2000-03-01 Lars Gullik Bjønnes - - * some things that I should comment but the local pub says head to - swirly... - - * comment out all code that belongs to the Roff code for Ascii - export of tables. (this is unused) - - * src/LyXView.C: use correct type for global variable - current_layout. (LyXTextClass::size_type) - - * some code to get the new insetgraphics closer to working I'd be - grateful for any help. - - * src/BufferView2.C (insertInset): use the return type of - NumberOfLayout properly. (also changes in other files) - - * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to - this as a test. I want to know what breaks because of this. - - * src/BufferView.[Ch] (tripleClick): name change from trippleClick. - -2000-02-29 Lars Gullik Bjønnes - - * lib/layouts/stdlists.inc: changed the lyxlist latex definition - to use a \makebox in the label, this allows proper justification - with out using protected spaces or multiple hfills. Now it is - "label" for left justified, "\hfill label\hfill" for center, and - "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5 - should be changed accordingly. - -2000-02-28 Jean-Marc Lasgouttes - - * src/lyxtext.h: change SetLayout() to take a - LyXTextClass::size_type instead of a char (when there is more than - 127 layouts in a class); also change type of copylayouttype. - * src/text2.C (SetLayout): ditto. - * src/LyXView.C (updateLayoutChoice): ditto. - - * src/LaTeX.C (scanLogFile): errors where the line number was not - given just after the '!'-line were ignored (from Dekel Tsur). - - * lib/lyxrc.example: fix description of \date_insert_format - - * lib/layouts/llncs.layout: new layout, contributed by Martin - Vermeer. - -2000-02-25 Lars Gullik Bjønnes - - * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc - 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in - cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C, - insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C, - BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C, - paragraph.C, text.C, text2.C) - -2000-02-25 Jean-Marc Lasgouttes - - * src/insets/insettext.C (LocalDispatch): remove extra break - statement. - - * src/insets/insetert.[Ch] (Clone): change return value to Inset* - * src/insets/insettext.[Ch] (Clone): change return value to Inset* - - * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier - * src/insets/insettext.[Ch] (GetCursorPos): ditto - - * src/insets/insetbib.h: move InsetBibkey::Holder and - InsetCitation::Holder in public space. - -2000-02-25 Lars Gullik Bjønnes - - * src/insets/insettext.h: small change to get the new files from - Juergen to compile (use "string", not "class string"). - - * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string - const & as parameter to LocalDispatch, use LyXFont const & as - paramter to some other func. This also had impacto on lyxinsets.h - and the two mathed insets. - -2000-02-24 Juergen Vigna - - * src/buffer.C: - * src/commandtags.h: - * src/LyXAction.C: - * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT - - * src/BufferView.h - * src/BufferView.C - * src/BufferView2.C: added/updated code for various inset-functions - - * src/insets/insetert.[Ch]: added implementation of InsetERT - - * src/insets/insettext.[Ch]: added implementation of InsetText - - * src/insets/inset.C (Edit): added "unsigned int button" parameter - (draw): added preliminary code for inset scrolling not finshed yet - - * src/insets/inset.C (LocalDispatch): changed arg parameter to string - as it is in lyxfunc.C now - - * src/insets/lyxinset.h: Added functions for text-insets - -2000-02-22 Lars Gullik Bjønnes - - * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into - BufferView and reimplement the list as a queue put inside its own - class. - - * src/bufferlist.[Ch] (updateInset): remove func, not needed. - - * several files: use the new interface to the "updateinsetlist" - - * src/WorkArea.C (work_area_handler): call BufferView::doubleClick - on doubleclick. - (work_area_handler): call BufferView::trippleClick on trippleclick. - - * src/BufferView.C (doubleClick): new function, selects word on - doubleclick. - (trippleClick): new function, selects line on trippleclick. - -2000-02-22 Allan Rae - - * lib/bind/xemacs.bind: buffer-previous not supported - -2000-02-21 Jean-Marc Lasgouttes - - * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods - as const. - -2000-02-20 Lars Gullik Bjønnes - - * src/bufferlist.C: get rid of current_view from this file - - * src/spellchecker.C: get rid of current_view from this file - - * src/vspace.C: get rid of current_view from this file - (inPixels): added BufferView parameter for this func - (asLatexCommand): added a BufferParams for this func - - * src/text.C src/text2.C: get rid of current_view from these - files. - - * src/lyxfont.C (getFontDirection): move this function here from - text.C - - * src/bufferparams.C (getDocumentDirection): move this function - here from text.C - - * src/paragraph.C (getParDirection): move this function here from - text.C - (getLetterDirection): ditto - -2000-02-18 Lars Gullik Bjønnes - - * WorkArea, Painter, LyXScreen: Fixed the crash that occured on - resize due to wrong pixmap beeing used. Also took the opurtunity - to make the LyXScreen stateless on regard to WorkArea and some - general cleanup in the same files. - -2000-02-17 Lars Gullik Bjønnes - - * src/Makefile.am: add missing direction.h - - * src/PainterBase.h: made the width functions const. - - * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some - missing ones. - - * src/insets/insetcommand.C (draw): draw Editable as buttons. - - * src/insets/insetlatexaccent.C (draw): make the accents draw - better, at present this will only work well with iso8859-1. - - * several files: remove the old drawing code, now we use the new - painter only. - - * several files: remove support for mono_video, reverse_video and - fast selection. - -2000-02-17 Juergen Vigna - - * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to - int ** as we have to return the pointer, otherwise we have only - NULL pointers in the returning function. - -2000-02-16 Jean-Marc Lasgouttes - - * src/LaTeX.C (operator()): quote file name when running latex. - -2000-02-15 Lars Gullik Bjønnes - - * src/toolbar.C (set): use fl_set_object_helper for the tooltop - (bubble tip), this removes our special handling of this. - - * Remove all code that is unused now that we have the new - workarea. (Code that are not active when NEW_WA is defined.) - - * Make the uses of XSync not conditionalized on define USE_XSYNC. - -2000-02-15 Jean-Marc Lasgouttes - - * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a - nonexisting layout; correctly redirect obsoleted layouts. - - * lib/lyxrc.example: document \view_dvi_paper_option - - * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option - variable. - - * src/lyx_cb.C (RunScript): handle $$FName for command names. - (PreviewDVI): handle the view_dvi_paper_option variable. - [Both from Roland Krause] - -2000-02-14 Lars Gullik Bjønnes - - * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int, - char const *, int, LyXFont) - (text(int, int, string, LyXFont)): ditto - - * src/text.C (InsertCharInTable): attempt to fix the double-space - feature in tables too. - (BackspaceInTable): ditto. - (GetVisibleRow): make bottom pagebreak line be a onoff line. - -2000-02-11 Lars Gullik Bjønnes - - * src/text2.C (owner): only complain if owner_ is set and bv != 0 - - * src/BufferView.C (resizeCurrentBuffer): set the owner of the - newly found text in textcache to this. - (buffer): set the owner of the text put into the textcache to 0 - - * src/insets/figinset.C (draw): fixed the drawing of figures with - the new Painter. - - * src/text.C src/mathed/math_cursor.C: nailed and fixed the - drawing of mathframe, hfills, protected space, table lines. I have - now no outstanding drawing problems with the new Painter code. - -2000-02-11 Jean-Marc Lasgouttes - - * src/PainterBase.C (ellipse, circle): do not specify the default - arguments. - - * src/LColor.h: add using directive. - - * src/Painter.[Ch]: change return type of methods from Painter& to - PainterBase&. Add a using directive. - - * src/WorkArea.C: wrap xforms callbacks in C functions - C_WorkArea_xxx. - - * lib/layouts/foils.layout: font fix and simplifications from Carl - Ollivier-Gooch. - -2000-02-10 Lars Gullik Bjønnes - - * a lot of files: The Painter, LColor and WorkArea from the old - devel branch has been ported to lyx-devel. Some new files and a - lot of #ifdeffed code. The new workarea is enabled by default, but - if you want to test the new Painter and LColor you have to compile - with USE_PAINTER defined (do this in config.h f.ex.) There are - still some rought edges, and I'd like some help to clear those - out. It looks stable (loads and displays the Userguide very well). - - -2000-02-10 Jean-Marc Lasgouttes - - * src/buffer.C (pop_tag): revert to the previous implementation - (use a global variable for both loops). - - * lib/kbd/iso8859-1.cdef: fix definition for \"{e}. - - * src/lyxrc.C (LyXRC): change slightly default date format. - - * src/paragraph.C (TeXOnePar): Generate a correct latex file when - there is an English text with a footnote that starts with a Hebrew - paragraph, or vice versa. - (TeXFootnote): ditto. - - * src/text.C (LeftMargin): allow for negative values for - parindent. Thanks to Philip Lehman for testing - this out. - - * src/lyx_gui.C (create_forms): add iso88595 as a possible choice - for input encoding (cyrillic) - -2000-02-08 Jean-Marc Lasgouttes - - * src/lyx_gui.C (create_forms): make combo box taller (from Dekel - Tsur). - - * src/toolbar.C (set): ditto - * src/insets/insetbib.C (create_form_citation_form): ditto - - * lib/CREDITS: added Dekel Tsur. - - * lib/kbd/hebrew.kmap, lib/kbd/null.kmap, - lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new - hebrew supports files from Dekel Tsur. - - * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen - - - * src/lyxrc.C: put \date_insert_format at the right place. - - * src/buffer.C (makeLaTeXFile): fix the handling of - BufferParams::sides when writing out latex files. - - * src/BufferView2.C: add a "using" directive. - - * src/support/lyxsum.C (sum): when we use lyxstring, - ostringstream::str needs an additional .c_str(). - -2000-02-07 Lars Gullik Bjønnes - - * src/support/filetools.C (ChangeExtension): patch from Etienne - applied. - - * src/TextCache.C (show): remove const_cast and make second - parameter non-const LyXText *. - - * src/TextCache.h: use non const LyXText in show. - - * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work - with hebrew. - -2000-02-04 Lars Gullik Bjønnes - - * src/support/lyxsum.C: rework to be more flexible. - - * several places: don't check if a pointer is 0 if you are going - to delete it. - - * src/text.C: remove some dead code. - - * src/insets/figinset.C: remove some dead code - - * src/buffer.C: move the BufferView funcs to BufferView2.C - remove all support for insetlatexdel - remove support for oldpapersize stuff - made some member funcs const - - * src/kbmap.C: use a std::list to store the bindings in. - - * src/BufferView2.C: new file - - * src/kbsequence.[Ch]: new files - - * src/LyXAction.C + others: remove all trace of buffer-previous - - * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we - only have one copy in the binary of this table. - - * hebrew patch: moved some functions from LyXText to more - appropriate places. (LyXParagraph, BufferParams, LyXFont) - - * several files: remove support for XForms older than 0.88 - whitespace changes. - remove some #if 0 #endif code - - * src/TextCache.[Ch]: new file. Holds the textcache. - - * src/BufferView.C: changes to use the new TextCache interface. - (waitForX): remove the now unused code. - - * src/BackStack.h: remove some commented code - - * lib/bind/emacs.bind: remove binding for buffer-previous - -2000-02-03 Lars Gullik Bjønnes - - * applied the hebrew patch. - - * src/lyxrow.h: make sure that all Row variables are initialized. - - * src/text2.C (TextHandleUndo): comment out a delete, this might - introduce a memory leak, but should also help us to not try to - read freed memory. We need to look at this one. - - * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0 - (LyXParagraph): initalize footnotekind. - - * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug - forgot this when applying the patch. Please heed the warnings. - - * src/BufferView.C (buffer): a fix for the buffer-reload problem - (aka. reformat problem) - - * src/bufferlist.C (exists): made const, and use const_iterator - (isLoaded): new func. - (release): use std::find to find the correct buffer. - - * src/bufferlist.h: made getState a const func. - made empty a const func. - made exists a const func. - new func: isLoaded - -2000-02-01 Juergen Vigna - - * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert - - * po/it.po: updated a bit the italian po file and also changed the - 'file nuovo' for newfile to 'filenuovo' without a space, this did - annoy me a lot :) - - * src/lyxrc.C (LyXRC): added support for a default insert_date_format - for the new insert_date command. - - * src/lyxfunc.C (Dispatch): added support for a insert_date function - from jdblair, to insert a date into the current text conforming to - a strftime format (for now only considering the locale-set and not - the document-language). - -2000-01-28 Jean-Marc Lasgouttes - - * src/lyxfont.C (textWidth): hopefully better fix for the Array - Bounds Read error seen by purify. The problem was that islower is - a macros which takes an unsigned char and uses it as an index for - in array of characters properties (and is thus subject to the - above error). - (drawText): ditto. - - * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set - correctly the paper sides radio buttons. - (UpdateDocumentButtons): ditto. - -2000-01-27 Lars Gullik Bjønnes - - * src/kbmap.C (getsym + others): change to return unsigned int, - returning a long can give problems on 64 bit systems. (I assume - that int is 32bit on 64bit systems) - -2000-01-27 Jean-Marc Lasgouttes - - * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by - LyXLookupString to be zero-terminated. Really fixes problems seen - by purify, I think. - -2000-01-27 Lars Gullik Bjønnes - - * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to - write a (char*)0 to the lyxerr stream. - - * src/lastfiles.C: move algorithm before the using statemets. - -2000-01-26 Jean-Marc Lasgouttes - - * src/lastfiles.C: move using directives in global scope (egcs 1.x - complains otherwise). - * src/table.C: ditto - - * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data - directory. - - * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable - that I removed earlier... It is really needed. - - * lib/examples/multicol.lyx: new file, splitted from Extended.lyx. - -2000-01-25 Jean-Marc Lasgouttes - - * INSTALL: update xforms home page URL. - - * lib/configure.m4: fix a bug with unreadable layout files. - - * src/table.C (calculate_width_of_column): add "using std::max" - directive. - -2000-01-25 Lars Gullik Bjønnes - - * several files: marked several lines with "DEL LINE", this is - lines that can be deleted without changing anything. - if () // DEL LINE /* this line is _never_ needed. Delete - checks this anyway */ - delete - - * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY - - * src/DepTable.C (update): add a "+" at the end when the checksum - is different. (debugging string only) - - * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused - the next inset to not be displayed. This should also fix the list - of labels in the "Insert Crossreference" dialog. - -2000-01-24 Lars Gullik Bjønnes - - * src/support/LSubstring.C (LSubstring): set pos to string::npos - when regex was not found. - - * src/support/lstrings.C (lowercase): use handcoded transform always. - (uppercase): ditto - - * src/text.C (Delete): fixed the crash. cursor.par->prev and - old_cursor.par->prev could be 0. - - * several files: changed post inc/dec to pre inc/dec - - * src/lastfiles.C (writeFile): use ostream_iterator and copy to - write the lastfiles to file. - - * src/BufferView.C (buffer): only show TextCache info when debugging - (buffer): ditto - (resizeCurrentBuffer): ditto - (workAreaExpose): ditto - - * lib/kbd/iso8859-7.cdef: changed to new quoting scheme - - * lib/kbd/iso8859-2.cdef: changed to new quoting scheme - - * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT - a bit better by removing the special case for \i and \j. - -2000-01-24 Jean-Marc Lasgouttes - - * src/lyx_main.C (easyParse): remove test for bad comand line - options, since this broke all xforms-related parsing. - - * src/kbmap.C (getsym): set return type to unsigned long, as - declared in header. On an alpha, long is _not_ the same as int. - - * src/support/LOstream.h: add a "using std::flush;" - - * src/insets/figinset.C: ditto. - -2000-01-21 Lars Gullik Bjønnes - - * src/bufferlist.C (write): use blinding fast file copy instead of - "a char at a time", now we are doing it the C++ way. - - * src/insets/figinset.C: get rid of struct pidwaitpit, use a - std::list instead. - (addpidwait): reflect move to std::list - (sigchldchecker): ditto - - * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5 - version also. - - * src/paragraph.C (FirstPhysicalPar): remove assert and comment - that obviously was wrong... - - * src/lyxfont.C (textWidth): have c as char c[2] instead of char - c, this avoids warnings with purify and islower. - - * src/insets/figinset.C: rename struct queue to struct - queue_element and rewrite to use a std::queue. gsqueue is now a - std::queue - (runqueue): reflect move to std::queue - (addwait): ditto - - * src/support/lstrings.h (tostr): specialize for bool, otherwise - we would get "1" "0" instead of "true" "false. Also make the tostr - functions inline. - -2000-01-21 Juergen Vigna - - * src/buffer.C (writeFileAscii): Disabled code for special groff - handling of tabulars till I fix this in table.C - -2000-01-21 Jean-Marc Lasgouttes - - * src/support/mkdir.C (mkdir): change second argument of mkdir to - unsigned long int. - * src/support/lyxlib.h: ditto. - -2000-01-20 Lars Gullik Bjønnes - - * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i' - and 'j' look better. This might fix the "macron" bug that has been - observed. - - * src/support/lstrings.[Ch] (tostr): reimplement all the tostr - functions as one template function. Delete the old versions. - - * src/support/lyxsum.C: move using std::ifstream inside - MODERN_STL_STREAMS - - * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C - and putenv.C - - * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used - - * src/mathed/formula.C: delete #include "bufferlist.h" never used - - * src/insets/figinset.C (InitFigures): use new instead of malloc - to allocate memory for figures and bitmaps. - (DoneFigures): use delete[] instead of free to deallocate memory - for figures and bitmaps. - (runqueue): use new to allocate - (getfigdata): use new/delete[] instead of malloc/free - (RegisterFigure): ditto - - * some files: moved some declarations closer to first use, small - whitespace changes use preincrement instead of postincrement where - it does not make a difference. - - * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a - step on the way to use stl::containers for key maps. - - * src/bufferlist.h: add a typedef for const_iterator and const - versions of begin and end. - - * src/bufferlist.[Ch]: change name of member variable _state to - state_. (avoid reserved names) - (makePup): removed - (getFileNames): returns the filenames of the buffers in a vector. - - * configure.in (ALL_LINGUAS): added ro - - * src/support/putenv.C: new file - - * src/support/mkdir.C: new file - -2000-01-20 Allan Rae - - * lib/layouts/IEEEtran.layout: Added several theorem environments - - * lib/templates/IEEEtran.lyx: Example theorem environments and a - couple of minor additions. - - * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites - (except for those in footnotes of course) - -2000-01-19 Lars Gullik Bjønnes - - * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction. - - * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use - std::sort and std::lower_bound instead of qsort and handwritten - binarysearch. - (struct compara): struct that holds the functors used by std::sort - and std::lower_bound in MathedLookupBOP. - -2000-01-19 Jean-Marc Lasgouttes - - * src/support/LAssert.h: do not do partial specialization. We do - not really need it. - - * src/support/lyxlib.h: note that lyx::getUserName() and - lyx::date() are not in use right now. Should these be suppressed? - - * src/buffer.C (makeLaTeXFile): we do not need the user name here. - (makeLinuxDocFile): do not put date and user name in linuxdoc - headers. - - * src/support/lyxlib.h (kill): change first argument to long int, - since that's what solaris uses. - - * src/support/kill.C (kill): fix declaration to match prototype. - - * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to - actually check whether namespaces are supported. This is not what - it used to do. - - * src/support/lyxsum.C: add a using directive. - -2000-01-17 Lars Gullik Bjønnes - - * src/support/kill.C: if we have namespace support we don't have - to include lyxlib.h. - - * src/support/lyxlib.h: use namespace lyx if supported. - -2000-01-14 Lars Gullik Bjønnes - - * src/support/date.C: new file - - * src/support/chdir.C: new file - - * src/support/getUserName.C: new file - - * src/support/getcwd.C: new file - - * src/support/abort.C: new file - - * src/support/kill.C: new file - - * src/support/lyxlib.h: moved all the functions in this file - insede struct lyx. Added also kill and abort to this struct. This - is a way to avoid the "kill is not defined in ", we make - C++ wrappers for functions that are not ANSI C or ANSI C++. - - * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS - instead of #if __GLIBCPP__. Since lyxsum is now put inside struct - lyx it has been renamed to sum. - -2000-01-14 Jean-Marc Lasgouttes - - * src/text.C: add using directives for std::min and std::max. - -2000-01-13 Jean-Marc Lasgouttes - - * src/texrow.C (getIdFromRow): actually return something useful in - id and pos. Hopefully fixes the bug with positionning of errorbox - insets. - - * src/lyx_main.C (easyParse): output an error and exit if an - incorrect command line option has been given. - - * src/spellchecker.C (ispell_check_word): document a memory leak. - - * src/bufferlist.C (write): fix mismatched allocation/deletion, - where a "struct utimbuf" is allocated with "new" and deleted with - "delete[]". - -2000-01-13 Lars Gullik Bjønnes - - * src/text2.C (CutSelection): don't delete double spaces. - (PasteSelection): ditto - (CopySelection): ditto - - * src/text.C (Backspace): don't delete double spaces. - - * src/lyxlex.C (next): fix a bug that were only present with - conformant std::istream::get to read comment lines, use - std::istream::getline instead. This seems to fix the problem. - -2000-01-12 Lars Gullik Bjønnes - - * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not - allowed to insert space before space" editing problem. Please read - commends at the beginning of the function. Comments about usage - are very welcome. - - * src/text.C (InsertChar): fix for the "not allowed to insert - space before space" editing problem. - - * src/text2.C (DeleteEmptyParagraphMechanism): when - IsEmptyTableRow can only return false this last "else if" will - always be a no-op. Commented out. - - * src/text.C (RedoParagraph): As far as I can understand tmp - cursor is not really needed. - - * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at - present it could only return false anyway. - (several functions): Did something not so smart...added a const - specifier on a lot of methods. - - * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve - and add a tmp->text.resize. The LyXParagraph constructor does the - resize for us. - (BreakParagraphConservative): ditto - - * src/support/path.h (Path): add a define so that the wrong usage - "Path("/tmp") will be flagged as a compilation error: - "`unnamed_Path' undeclared (first use this function)" - -2000-01-12 Jean-Marc Lasgouttes - - * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro, - which was bogus for several reasons. - - * src/LaTeX.C (scanAux): fix the regular expression used to scan - .aux files. - (runBibTeX): ditto. - - * autogen.sh: do not use "type -path" (what's that anyway?). - - * src/support/filetools.C (findtexfile): remove extraneous space - which caused a kpsewhich warning (at least with kpathsea version - 3.0). - -2000-01-11 Lars Gullik Bjønnes - - * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la - - * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la - - * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs - -2000-01-11 Jean-Marc Lasgouttes - - * src/paragraph.C (BreakParagraph): do not reserve space on text - if we don't need to (otherwise, if pos_end < pos, we end up - reserving huge amounts of memory due to bad unsigned karma). - (BreakParagraphConservative): ditto, although I have not seen - evidence the bug can happen here. - - * src/lyxparagraph.h: add a using std::list. - -2000-01-11 Juergen Vigna - - * src/menus.C (MenuDocu): output an Alert if the documentation-file - could not be found. - -2000-01-11 Lars Gullik Bjønnes - - * src/vc-backend.C (doVCCommand): change to be static and take one - more parameter: the path to chdir too be fore executing the command. - (retrive): new function equiv to "co -r" - - * src/bufferlist.C (loadLyXFile): implement the missing parts if - file_not_found_hook is true. - - * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook. - - * src/support/filetools.C (IsFileWriteable): use FileInfo to check - if a file is readwrite,readonly...anything else. - -2000-01-10 Lars Gullik Bjønnes - - * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput - (CreatePostscript): name change from MenuRunDVIPS (or something) - (PreviewPostscript): name change from MenuPreviewPS - (PreviewDVI): name change from MenuPreviewDVI - - * lib/lyxrc.example: added \pdflatex_command, \pdf_mode, - \view_pdf_command., \pdf_to_ps_command - - * lib/configure.m4: added search for PDF viewer, and search for - PDF to PS converter. - (lyxrc.defaults output): add \pdflatex_command, - \view_pdf_command and \pdf_to_ps_command. - - * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview. - - * src/bufferlist.C (write): we don't use blocksize for anything so - I removed it. - -2000-01-10 Jean-Marc Lasgouttes - - * src/support/block.h: disable operator T* (), since it causes - problems with both compilers I tried. See comments in the file. - - * lib/reLyX/configure.in: do not define LYX_DIR. support flag - --with-lyxname. - - * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env. - variable LYX_DIR_10x to LYX_DIR_11x. - - * src/Makefile.am: replace variable LYX_DIR with pkgdatadir. - - * INSTALL: document --with-lyxname. - * NEWS: ditto. - - * configure.in: new configure flag --with-lyxname which allows to - choose the name under which lyx is installed. Default is "lyx", of - course. It used to be possible to do this with --program-suffix, - but the later has in fact a different meaning for autoconf. - - * src/support/lstrings.h (lstrchr): reformat a bit. - - * src/lyxlex.h: include LIstream.h, for Sun CC this time. - * src/mathed/math_defs.h: ditto. - -2000-01-09 Lars Gullik Bjønnes - - * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to - true, decides if we create a backup file or not when saving. New - tag and variable \pdf_mode, defaults to false. New tag and - variable \pdflatex_command, defaults to pdflatex. New tag and - variable \view_pdf_command, defaults to xpdf. New tag and variable - \pdf_to_ps_command, defaults to pdf2ps. - -2000-01-08 Lars Gullik Bjønnes - - * src/bufferlist.C (close): don't call insetUnlock if the buffer - does not have a BufferView. - (unlockInset): ditto + don't access the_locking_inset if the - buffer does not have a BufferView. - - * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in - certain circumstances so that we don't continue a keyboard - operation long after the key was released. Try f.ex. to load a - large document, press PageDown for some seconds and then release - it. Before this change the document would contine to scroll for - some time, with this change it stops imidiatly. - - * src/support/block.h: don't allocate more space than needed. As - long as we don't try to write to the arr[x] in a array_type arr[x] - it is perfectly ok. (if you write to it you might segfault). - added operator value_type*() so that is possible to pass the array - to functions expecting a C-pointer. - - * lib/Makefile.am (dist-hook): don't fail completely if unable to - cvs. - - * intl/*: updated to gettext 0.10.35, tried to add our own - required modifications. Please verify. - - * po/*: updated to gettext 0.10.35, tried to add our own required - modifications. Please verify. - - * src/support/lstrings.C (tostr): go at fixing the problem with - cxx and stringstream. When stringstream is used return - oss.str().c_str() so that problems with lyxstring and basic_string - are avoided. Note that the best solution would be for cxx to use - basic_string all the way, but it is not conformant yet. (it seems) - - * src/lyx_cb.C + other files: moved several global functions to - class BufferView, some have been moved to BufferView.[Ch] others - are still located in lyx_cb.C. Code changes because of this. (part - of "get rid of current_view project".) - - * src/buffer.C + other files: moved several Buffer functions to - class BufferView, the functions are still present in buffer.C. - Code changes because of this. - - * config/lcmessage.m4: updated to most recent. used when creating - acinclude.m4. - - * config/progtest.m4: updated to most recent. used when creating - acinclude.m4. - - * config/gettext.m4: updated to most recent. applied patch for - tmplinguas. - - * config/gettext.m4.patch: new file that shows what changes we - have done to the local copy of gettext.m4. - - * config/libtool.m4: new file, used in creation of acinclude.m4 - - * config/lyxinclude.m4: new file, this is the lyx created m4 - macros, used in making acinclude.m4. - - * autogen.sh: GNU m4 discovered as a separate task not as part of - the lib/configure creation. - Generate acinlucde from files in config. Actually cat - lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it - easier to upgrade .m4 files that really are external. - - * src/Spacing.h: moved using std::istringstream to right after - . This should fix the problem seen with some compilers. - -2000-01-06 Lars Gullik Bjønnes - - * src/lyx_cb.C: began some work to remove the dependency a lot of - functions have on BufferView::text, even if not really needed. - (GetCurrentTextClass): removed this func, it only hid the - current_view. - - * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I - forgot this in last commit. - - * src/Bullet.C (bulletEntry): use static char const *[] for the - tables, becuase of this the return arg had to change to string. - (bulletSize): ditto - (~Bullet): removed unneeded destructor - - * src/BufferView.C (beforeChange): moved from lyx_cb.C - (insetSleep): moved from Buffer - (insetWakeup): moved from Buffer - (insetUnlock): moved from Buffer - - * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset - from Buffer to BufferView. - - * acinclude.m4: include libtool.m4 from libtool 1.3.4. - - * config/ltmain.sh: updated to version 1.3.4 of libtool - - * config/ltconfig: updated to version 1.3.4 of libtool - -2000-01-06 Jean-Marc Lasgouttes - - - * src/buffer.C (pop_tag): fix a dubious for() loop initialization. - Did I get that right? - - * src/lyxlex.h: add a "using" directive or two. - * src/Spacing.h: ditto. - * src/insets/figinset.C: ditto. - * src/support/filetools.C: ditto. - * src/support/lstrings.C: ditto. - * src/BufferView.C: ditto. - * src/bufferlist.C: ditto. - * src/lyx_cb.C: ditto. - * src/lyxlex.C: ditto. - - * NEWS: add some changes for 1.1.4. - -2000-01-06 Lars Gullik Bjønnes - - * src/BufferView.C: first go at a TextCache to speed up switching - between documents. - -2000-01-05 Jean-Marc Lasgouttes - - * lib/examples/ItemizeBullets.lyx: update from Tino Meinen. - * lib/examples/nl_voorbeeld_ruw.lyx: ditto. - * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto. - * lib/examples/nl_opsommingstekens.lyx: new translation from Tino - Meinen. - - * src/mathed/math_defs.h (MathedRowSt): make sure that all - members of the struct are correctly initialized to 0 (detected by - purify) - * src/lyxrc.C (LyXRC): ditto for print_adapt_output. - * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh. - - * src/insets/figinset.C (sigchldchecker): use "delete" to free a - pidwait, since it was allocated with "new". This was potentially - very bad. Thanks to Michael Schmitt for running purify for us. - - -2000-01-04 Jean-Marc Lasgouttes - - * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement. - - * src/lyx_gui_misc.h: add a 'using std::pair;' statement. - -1999-12-30 Allan Rae - - * lib/templates/IEEEtran.lyx: minor change - - * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel), - src/mathed/formula.C (LocalDispatch): askForText changes - - * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we - know when a user has cancelled input. Fixes annoying problems with - inserting labels and version control. - -1999-12-29 Lars Gullik Bjønnes - - * src/support/lstrings.C (tostr): rewritten to use strstream and - stringstream - -1999-12-28 Lars Gullik Bjønnes - - * src/support/filetools.C (IsFileWriteable): use fstream to check - (IsDirWriteable): use fileinfo to check - - * src/support/filetools.h (FilePtr): whole class deleted - - * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream. - - * src/lyxparagraph.h (readSimpleWholeFile): make arg istream - - * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr - - * src/bufferlist.C (write): use ifstream and ofstream instead of - FILE* - - * src/Spacing.h: use istrstream instead of sscanf - - * src/mathed/math_defs.h: change first arg to istream from FILE* - - * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr - - * src/mathed/math_parser.C: have yyis to be an istream - (LexGetArg): use istream (yyis) - (yylex): ditto - (mathed_parse): ditto - (mathed_parser_file): first arg istream instead of FILE*, set yyis - - * src/mathed/formula.C (Read): rewritten to use istream - - * src/mathed/formulamacro.C (Read): rewritten to use istream - - * src/lyxlex.h (~LyXLex): deleted desturctor - (getStream): new function, returns an istream - (getFile): deleted funtion - (IsOK): return is.good(); - - * src/lyxlex.C (LyXLex): delete file and owns_file - (setFile): open an filebuf and assign that to a istream instead of - using FILE* - (setStream): new function, takes an istream as arg. - (setFile): deleted function - (EatLine): rewritten us use istream instead of FILE* - (next): ditto - (nextToken): ditto - - * src/table.C (LyXTable): use istream instead of FILE* - (Read): rewritten to take an istream instead of FILE* - -1999-12-28 Jean-Marc Lasgouttes - - * src/buffer.C (Dispatch): remove an extraneous break statement. - - * src/support/filetools.C (QuoteName): change to do simple - 'quoting'. More work is necessary. Also changed to do nothing - under emx (needs fix too). - (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG. - - * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for - config.h.in to the AC_DEFINE_UNQUOTED() call. - (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv() - needs char * as argument (because Solaris 7 declares it like - that). - - * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION; - remove definition of BZERO. - -1999-12-24 Lars Gullik Bjønnes - - * src/support/LRegex.C: include if HAVE_REGEX_H is - defined, "lyxregex.h" if not. - - * src/support/Makefile.am (noinst_LTLIBRARIES): changed from - pkglib_ to noinst_ - (REGEX): new variable that is set to regex.c lyxregex.h when - AM_CONDITIONAL USE_REGEX is set. - (libsupport_la_SOURCES): add $(REGEX) - - * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from - pkglib_ to noinst_ - - * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from - pkglib_ to noinst_ - - * configure.in: add call to LYX_REGEX - - * acinclude.m4 (LYX_REGEX): checks if we need to use the included - regex or not. Uses a a AM_CONDITIONAL to decide what to compile. - -1999-12-22 Jean-Marc Lasgouttes - - * lib/bind/fi_menus.bind: new file, from - pauli.virtanen@saunalahti.fi. - - * src/buffer.C (getBibkeyList): pass the parameter delim to - InsetInclude::getKeys and InsetBibtex::getKeys. - - * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which - is passed to Buffer::getBibkeyList - - * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it - instead of the hardcoded comma. - - * src/insets/insetbib.C (getKeys): make sure that there are not - leading blanks in bibtex keys. Normal latex does not care, but - harvard.sty seems to dislike blanks at the beginning of citation - keys. In particular, the retturn value of the function is - - * INSTALL: make it clear that libstdc++ is needed and that gcc - 2.7.x probably does not work. - - * src/support/filetools.C (findtexfile): make debug message go to - the LATEX channel - * src/insets/insetbib.C (getKeys): ditto - - * src/debug.C (showTags): make sure that the output is correctly - aligned. - - * configure.in: add a comment for TWO_COLOR_ICON define. - - * acconfig.h: remove all the entries that already defined in - configure.in or acinclude.m4. - - * src/buffer.C (makeLaTeXFile): headers of latex file also changed - to avoid user name, date and copyright. - -1999-12-21 Juergen Vigna - - * src/table.C (Read): Now read bogus row format informations - if the format is < 5 so that afterwards the table can - be read by lyx but without any format-info. Fixed the - crash we experienced when not doing this. - -1999-12-21 Lars Gullik Bjønnes - - * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur - (RedoDrawingOfParagraph): ditto - (RedoParagraphs): ditto - (RemoveTableRow): ditto - - * src/text.C (Fill): rename arg paperwidth -> paper_width - - * src/buffer.C (insertLyXFile): rename var filename -> fname - (writeFile): rename arg filename -> fname - (writeFileAscii): ditto - (makeLaTeXFile): ditto - (makeLinuxDocFile): ditto - (makeDocBookFile): ditto - - * src/LaTeX.C (runMakeIndex): change arg name from file -> f - (runBibTeX): ditto - - * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C - - * src/bmtable.h: add extern "C" on this file when __cplusplus is - defined. - - * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is - compiled by a C compiler not C++. - - * src/layout.h (LyXTextClass): added typedef for const_iterator - (LyXTextClassList): added typedef for const_iterator + member - functions begin and end. - - * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use - iterators to fill the choice_class. - (updateLayoutChoice): rewritten to use iterators to fill the - layoutlist in the toolbar. - - * src/BufferView.h (BufferView::work_area_width): removed unused - variable. - - * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file' - - * src/buffer.C (sgmlOpenTag): drop the use of the static space array - (sgmlCloseTag): ditto - - * src/support/lstrings.h: return type of countChar changed to - unsigned char. - - * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose - what version of this func to use. Also made to return unsigned int. - - * configure.in: call LYX_STD_COUNT - - * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard - conforming std::count. - -1999-12-20 Jean-Marc Lasgouttes - - * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime - and a subscript would give bad display (patch from Dekel Tsur - ). - - * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public. - - * src/spellchecker.C (create_ispell_pipe): use a const_cast to - please sun CC. - - * src/chset.h: add a few 'using' directives - - * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not - triggered when no buffer is active - - * src/layout.C: removed `break' after `return' in switch(), since - it is unreachable. - - * src/lyx_main.C (init): make sure LyX can be ran in place even - when libtool has done its magic with shared libraries. Fix the - test for the case when the system directory has not been found. - - * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path - name for the latex file. - (MenuMakeHTML): ditto - - * src/buffer.h: add an optional boolean argument, which is passed - to ChangeExtension. - -1999-12-20 Allan Rae - - * lib/templates/IEEEtran.lyx: small correction and update. - - * configure.in: Attempted to use LYX_PATH_HEADER - - * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore - - * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after - input from JMarc. Now use preprocessor to find the header. - Also stopped making HAVE_STL_STRING_FWD_H and extended the comments. - (LYX_PATH_HEADER): My, so far, failed attempt to generalize - LYX_STL_STRING_FWD. See comments in file. - -1999-12-19 Asger Alstrup Nielsen - - * The global MiniBuffer * minibuffer variable is dead. - - * The global FD_form_main * fd_form_main variable is dead. - -1999-12-17 Jean-Marc Lasgouttes - - * src/toolbar.C (set): condition #warning on WITH_WARNINGS - - * src/table.h: add the LOstream.h header - * src/debug.h: ditto - - * src/LyXAction.h: change the explaination of the ReadOnly - attribute: is indicates that the function _can_ be used. - - * src/LyXAction.C (init): find-replace _can_ be used in read-only - mode. - -1999-12-16 Jean-Marc Lasgouttes - - * src/lyxfont.C (ascent): Make sure that char is _always_ used as - unsigned. - (descent): ditto - (lbearing): ditto - (rbearing): ditto - - * src/paragraph.C (GetWord): assert on pos>=0 - (GetChar): ditto - - * src/support/lyxstring.C: condition the use of an invariant on - ENABLE_ASSERTIONS - * src/support/lyxstring.h: ditto - - * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS. - Use LAssert.h instead of plain assert(). - - * src/support/lstrings.h: add LAssert.h, in case it is needed. - - * src/lyxfunc.C: do not include LAssert.h, it is not used. - * src/support/filetools.C: ditto - - * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS - is not defined. - - * INSTALL: document the new configure flags - - * configure.in: suppress --with-debug; add --enable-assertions - - * acinclude.m4: various changes in alignment of help strings. - -1999-12-16 Lars Gullik Bjønnes - - * src/kbmap.C: commented out the use of the hash map in kb_map, - beginning of movement to a stl::container. - - * several files: removed code that was not in effect when - MOVE_TEXT was defined. - - * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes - for escaping should not be used. We can discuss if the string - should be enclosed in f.ex. [] instead of "". - - * src/trans_mgr.C (insert): use the new returned value from - encodeString to get deadkeys and keymaps done correctly. - - * src/chset.C (encodeString): changed to return a pair, to tell - what to use if we know the string. - - * src/lyxscreen.h (fillArc): new function. - - * src/FontInfo.C (resize): rewritten to use more std::string like - structore, especially string::replace. - - * src/insets/insetlatexaccent.C (Draw): use fillArc for the - approp. accents. - - * configure.in (chmod +x some scripts): remove config/gcc-hack - -1999-12-15 Jean-Marc Lasgouttes - - * src/buffer.C (writeFile): change once again the top comment in a - .lyx file to point to www.lyx.org and to use LYX_DOCVERSION - instead of an hardcoded version number. - (makeDocBookFile): ditto - - * src/version.h: add new define LYX_DOCVERSION - - * po/de.po: update from Pit Sütterlin - * lib/bind/de_menus.bind: ditto. - - * src/lyxfunc.C (Dispatch): call MenuExport() - * src/buffer.C (Dispatch): ditto - - * src/lyx_cb.C (MenuMakeHTML): new function, moved from - LyXFunc::Dispatch(). - (MenuExport): new function, moved from - LyXFunc::Dispatch(). - - * src/trans_mgr.C (insert): small cleanup - * src/chset.C (loadFile): ditto - - * lib/kbd/iso8859-1.cdef: add missing backslashes - -1999-12-15 Lars Gullik Bjønnes - - * src/insets/insetlatexaccent.C (Lbearing): new function, used to - help with placing the manually drawn accents better. - (Rbearing): ditto - (Draw): x2 and hg changed to float to minimize rounding errors and - help place the accents better. - - * src/lyxfont.C (ascent): fixed faulty static_cast, casting from - unsigned short to char is just wrong...cast the char to unsigned - char instead so that the two values can compare sanely. This - should also make the display of insetlatexaccents better and - perhaps also some other insets. - (descent): ditto - (lbearing): new function - (rbearing): ditto - -1999-12-15 Allan Rae - - * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new - header that provides a wrapper around the very annoying SGI STL header - of the same name. - - * src/support/lyxstring.C, src/LString.h: - removed old SGI-STL-compatability attempts. - - * configure.in: Use LYX_STL_STRING_FWD. - - * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if - stl_string_fwd.h is around and try to determine it's location. - Major improvement over previous SGI STL 3.2 compatability. - Three small problems remain with this function due to my zero - knowledge of autoconf. JMarc and lgb see the comments in the code. - -1999-12-14 Jean-Marc Lasgouttes - - * src/broken_const.h, config/hack-gcc, config/README: removed - - * configure.in: remove --with-gcc-hack option; do not call - LYX_CXX_STL_STACK - - * INSTALL: remove documentation of --with-broken-const and - --with-gcc-hack - - * acconfig.h: remove all trace of BROKEN_CONST define - - * src/buffer.C (makeDocBookFile): update version number in output - file. - (SimpleDocBookOnePar): fix an assert when trying to a character - access beyond string length - [Patch from Jose'] - -1999-12-13 Jean-Marc Lasgouttes - - * po/de.po: fix the Export menu - - * lyx.man: update the description of -dbg - - * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel() - (commandLineHelp): updated - (easyParse): show list of available debug levels if -dbg is passed - without argument. - - * src/Makefile.am: add debug.C - - * src/debug.h: moved some code to debug.C - - * src/debug.C: new file. Contains code to set and show debug - level. - - * src/layout.C: remove 'break' after 'continue' in switch - statements, since these cannot be reached. - -1999-12-13 Allan Rae - - * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash. - (in_word_set): hash() -> math_hash() - - * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support - - * acconfig.h: Added a test for whether we are using exceptions in the - current compilation run. If so USING_EXCEPTIONS is defined. - - * config.in: Check for existance of stl_string_fwd.h - * src/LString.h: If compiling --with-included-string and SGI's - STL version 3.2 is present (see above test) we need to block their - forward declaration of string and supply a __get_c_string(). - However, it turns out this is only necessary if compiling with - exceptions enabled so I've a bit more to add yet. - - * src/insets/figinset.[Ch], src/insets/insetinclude.C, - src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h, - src/support/LRegex.h, src/undo.h: - Shuffle the order of the included files a little to ensure that - LString.h gets included before anything that includes stl_string_fwd.h - - * src/support/lyxstring.C: We need to #include LString.h instead of - lyxstring.h to get the necessary definition of __get_c_string. - (__get_c_string): New function. This is defined static just like SGI's - although why they need to do this I'm not sure. Perhaps it should be - in lstrings.C instead. - - * lib/templates/IEEEtran.lyx: New template file. - -1999-12-12 Lars Gullik Bjønnes - - * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@ - * intl/Makefile.in (MKINSTALLDIRS): ditto - - * src/LyXAction.C (init): changed to hold the LFUN data in a - automatic array in stead of in callso to newFunc, this speeds up - compilation a lot. Also all the memory used by the array is - returned when the init is completed. - - * a lot of files: compiled with -Wold-style-cast, changed most of - the reported offenders to C++ style casts. Did not change the - offenders in C files. - - * src/trans.h (Match): change argument type to unsigned int. - - * src/support/DebugStream.C: fix some types on the streambufs so - that it works on a conforming implementation. - -1999-12-10 Jean-Marc Lasgouttes - - * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence. - - * src/support/lyxstring.C: remove the inline added earlier since - they cause a bunch of unsatisfied symbols when linking with dec - cxx. Cxx likes to have the body of inlines at the place where they - are declared. - - * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid - accessing negative bounds in array. This fixes the crash when - inserting accented characters. - * src/trans.h (Match): ditto - - * src/buffer.C (Dispatch): since this is a void, it should not try - to return anything... - -1999-12-10 Lars Gullik Bjønnes - - * src/buffer.h: removed the two friends from Buffer. Some changes - because of this. Buffer::getFileName and Buffer::setFileName - renamed to Buffer::fileName() and Buffer::fileName(...). - -1999-12-09 Lars Gullik Bjønnes - - * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text - and Buffer::update(short) to BufferView. This move is currently - controlled by a define MOVE_TEXT, this will be removed when all - shows to be ok. This move paves the way for better separation - between buffer contents and buffer view. One side effect is that - the BufferView needs a rebreak when swiching buffers, if we want - to avoid this we can add a cache that holds pointers to LyXText's - that is not currently in use. - - * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by - André Pönitz. - -1999-11-18 André Pönitz - - * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level - - * lyx_main.C: new command line option -x (or --execute) and - -e (or --export). Now direct conversion from .lyx to .tex - (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex') - Unfortunately, X is still needed and the GUI pops up during the - process... - -1999-12-07 Jean-Marc Lasgouttes - - * src/Spacing.C: add a using directive to bring stream stuff into - normal namespace. - * src/paragraph.C: ditto - * src/buffer.C: ditto - - * NEWS: updated a bit the new features of 1.1.3 (took a few things - from Lars' announcement). - - * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial - example files from Tino Meinen. - -1999-12-06 Allan Rae - - * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair. - -1999-12-07 Lars Gullik Bjønnes - - * src/support/lyxstring.C: added a lot of inline for no good - reason - - * src/lyxfont.[Ch]: removed latexWriteStartChanges, and - latexWriteEndChanges, they were not used. - - * src/layout.h (operator<<): output operator for PageSides - - * src/mathed/math_iter.C (my_memcpy): slightly changed. - - * some example files: loaded in LyX 1.0.4 and saved again to update - certain constructs (table format) - - * a lot of files: did the change to use fstream/iostream for all - writing of files. Done with a close look at Andre Poenitz's patch. - - * some files: whitespace changes. - -1999-12-06 Jean-Marc Lasgouttes - - * src/mathed/math_iter.C (my_memcpy): new function. Since the - built-in memcpy() is broken on egcs and gcc 2.95 for alpha - architecture, we provide our own. It is used unconditionnally, but - I do not think this is a performance problem. Thanks to Angus - Leeming for the code (and again to Michal - Jaegermann for finding it the - first time). - (GetInset): use my_memcpy. - (Insert): ditto - (Copy): ditto - - * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure - it is easier to understand, but it uses less TeX-only constructs now. - - * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH - elements contain spaces - - * lib/configure: regenerated - - * lib/configure.m4 (SEARCH_PROG): make it work when the PATH - elements contain spaces; display the list of programs that are - tried. - - * autogen.sh: make sure lib/configure is executable - - * lib/examples/*: rename the tutorial examples to begin with the - two-letters language code. - - * src/lyxfunc.C (getStatus): do not query current font if no - buffer exists. - - * src/lyx_cb.C (RunScript): use QuoteName - (MenuRunDvips): ditto - (PrintApplyCB): ditto - - * src/support/filetools.[Ch] (QuoteName): new function. Add quotes - around argument, so that it works well with the current shell. - Does not work properly with OS/2 shells currently. - - * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName - * src/LyXSendto.C (SendtoApplyCB): ditto - * src/lyxfunc.C (Dispatch): ditto - * src/buffer.C (runLaTeX): ditto - (runLiterate): ditto - (buildProgram): ditto - (runChktex): ditto - * src/lyx_cb.C (RunScript): ditto - (MenuMakeLaTeX): ditto - - * src/buffer.h (getLatexName): new method - - * src/support/filetools.C (MakeLatexName): renamed from SpaceLess - -1999-12-02 Jean-Marc Lasgouttes - - * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm. - * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto - (create_math_panel): ditto - - * src/lyxfunc.C (getStatus): re-activate the code which gets - current font and cursor; add test for export to html. - - * src/lyxrc.C (read): remove unreachable break statements; add a - few "using". - - * src/bmtable.C (fl_set_bmtable_data): add a const_cast. - -1999-12-01 Lars Gullik Bjønnes - - * src/mathed/formula.C (LocalDispatch): fix small whitspace bug - introduced by faulty regex. - * src/buffer.C: ditto - * src/lastfiles.C: ditto - * src/paragraph.C: ditto - * src/table.C: ditto - * src/vspace.C: ditto - * src/insets/figinset.C: ditto - Note: most of these is absolutely harmless, except the one in - src/mathed formula.C. - -1999-11-30 Kayvan A. Sylvan - - * src/ImportNoweb.C (documentclass): fixed bounds for substr - operation, yielding correct results for the reLyX command. - -1999-12-01 Lars Gullik Bjønnes - - * src/support/filetools.C (ExpandPath): removed an over eager - Assert. - (ReplaceEnvironmentPath): ditto - - * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly - shows that we are doing something fishy in our code... - (BubblePost): ditto - (ToolbarCB): ditto - - * src/lyxrc.C (read): use a double switch trick to get more help - from the compiler. (the same trick is used in layout.C) - (write): new function. opens a ofstream and pass that to output - (output): new function, takes a ostream and writes the lyxrc - elemts to it. uses a dummy switch to make sure no elements are - forgotten. - - * src/lyxlex.h: added a struct pushpophelper for use in functions - with more than one exit point. - - * src/lyxlex.[Ch] (GetInteger): made it const - (GetFloat): ditto - (GetBool): ditto - - * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES - - * src/layout.[hC] : LayoutTags splitted into several enums, new - methods created, better error handling cleaner use of lyxlex. Read - the diff. - - * src/bmtable.[Ch]: change some member prototypes because of the - image const changes. - - * commandtags.h, src/LyXAction.C (init): new function: - "preferences-save", saves the lyxrc entries into .lyx/preferences. - This file is not read automatically but you can add \input - preferences to your lyxrc if you want to. We need to discuss how - to handle this. - - * src/LaTeX.C (runBibTeX): use regex to match for the needed lines - in .aux, also remove .bib and .bst files from dependencies when - running bibtex. - - * src/BufferView.C, src/LyXView.C: add const_cast several places - because of changes to images. - - * lib/images/*: same change as for images/* - - * lib/lyxrc.example: Default for accept_compound is false not no. - - * images/*: changed to be const, however I have som misgivings - about this change so it might be changed back. - -1999-11-26 Jean-Marc Lasgouttes - - * lib/configure, po/POTFILES.in: regenerated - - * autogen.sh: autogenerate lib/configure from lib/configure.m4 - - * config/lib_configure.m4: removed - - * lib/configure.m4: new file (was config/lib_configure.m4) - - * configure.in: do not test for rtti, since we do not use it. - -1999-11-26 Lars Gullik Bjønnes - - * src/support/lyxstring.C (lyxstring::Srep): Changed to use a - doubling of allocated space scheme. This makes it faster for large - strings end to use less memory for small strings. xtra rememoved. - - * src/insets/figinset.C (waitalarm): commented out. - (GhostscriptMsg): use static_cast - (GhostscriptMsg): use new instead of malloc to allocate memory for - cmap. also delete the memory after use. - - * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool - - * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks - for changes in bibtex database or style. - (runBibTeX): remove all .bib and .bst files from dep before we - begin. - (run): use scanAuc in when dep file already exist. - - * src/DepTable.C (remove_files_with_extension): new method - (exist): new method - - * src/DepTable.[Ch]: made many of the methods const. - -1999-11-25 Jean-Marc Lasgouttes - - * src/bufferparams.C: make sure that the default textclass is - "article". It used to be the first one by description order, but - now the first one is "docbook". - - * src/lyx_main.C (setDebuggingLevel): change type of argument to - string; call Debug::value. - (easyParse): pass complete argument to setDebuggingLevel(). - - * src/debug.h (value): fix the code that parses debug levels. - - * src/debug.h: add new debug type ACTION, reserved for LyXAction - class. - - * src/LyXAction.C: use Debug::ACTION as debug channel. - - * src/lyxlookup.C: make the debug statements go to Debug::KEY. - - * NEWS: updated for the future 1.1.3 release. - - * src/mathed/symbol_def.h: swap the definitions of \varepsilon and - \epsilon. Now \epsilon shows as red text, and \varepsilon shows as - it should. This is of course a controversial change (since many - people will find that their lyx workscreen is suddenly full of - red), but done for the sake of correctness. - - * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch], - src/mathed/math_root.[Ch] (Clone): return a MathedInset* - - * src/insets/inseterror.h, src/insets/inseturl.h, - src/insets/insetinfo.h, src/insets/figinset.h, - src/mathed/formulamacro.h, src/mathed/math_macro.h - (EditMessage): add a missing const and add _() to make sure that - translation happens - - * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C, - src/insets/insetbib.C, src/support/filetools.C: add `using' - directives for cxx. - - * src/lyxfunc.C (Dispatch): make sure nothing bad happens when - doing 'Insert index of last word' at the beginning of a paragraph. - -1999-11-24 Lars Gullik Bjønnes - - * several files: white-space changes. - - * src/mathed/formula.C: removed IsAlpha and IsDigit - - * src/insets/insetbib.C (getKeys): use findtexfile to look for the - .bib file. use a ifstream instead of FilePtr when parsing the .bib - file for keys. - - * src/insets/figinset.C (GetPSSizes): don't break when - "EndComments" is seen. But break when a boundingbox is read. - - * all classes inherited from Inset: return value of Clone - changed back to Inset *. - - * all classes inherited form MathInset: return value of Clone - changed back to MathedInset *. - - * src/insets/figinset.C (runqueue): use a ofstream to output the - gs/ps file. Might need some setpresicion or setw. However I can - see no problem with the current code. - (runqueue): use sleep instead of the alarm/signal code. I just - can't see the difference. - - * src/paragraph.C (LyXParagraph): reserve space in the new - paragraph and resize the inserted paragraph to just fit. - - * src/lyxfunc.h (operator|=): added operator for func_status. - - * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to - check for readable file. - - * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to - check for readable file. - (MenuMakeLinuxDoc): ditto - (MenuMakeDocBook): ditto - (MenuMakeAscii): ditto - (InsertAsciiFile): split the test for openable and readable - - * src/bmtable.C (draw_bitmaptable): use - fl_state[fl_get_vclass()].depth instead of DefualtScreen. - - * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and - findtexfile from LaTeX to filetools. - - * src/ImportNoweb.C (documentclass): rewrote to use ifstream - instead of FilePtr. Needs to be verified by a literate user. - -1999-11-23 Jean-Marc Lasgouttes - - * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'. - (EditMessage): likewise. - - * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^ - respectively as \textasciitilde and \textasciicircum. - -1999-11-22 Lars Gullik Bjønnes - - * src/support/lyxstring.h: made the methods that take iterators - use const_iterator. - - * src/support/lstrings.C (countChar): use std::cound(itr, itr, val) - (regexMatch): made is use the real regex class. - - * src/support/Makefile.am: changed to use libtool - - * src/support/.cvsignore: added *.lo, .libs and libsupport.la - - * src/mathed/math_defs.h: made the mathaligns be in a enum instead - of defines. - (MathIsInset ++): changed several macros to be inline functions - instead. - - * src/mathed/Makefile.am: changed to use libtool - - * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la - - * src/insets/inset* : Clone changed to const and return type is - the true insettype not just Inset*. - - * src/insets/Makefile.am: changed to use libtool - - * src/insets/.cvsignore: added *.lo, .libs and libinsets.la - - * src/undo.[Ch] : added empty() and changed some of the method - names. - - * src/texrow.[Ch]: rewrote to store texrow's in a std::list. - - * src/lyxparagraph.h: use id() and id(...) instead of getID and - setID use block<> for the bullets array, added const several places. - - * src/lyxfunc.C (getStatus): new function - - * src/lyxfunc.[Ch] : small changes to take advantage of the new - LyXAction, added const to several funtions. - - * src/filedlg.[Ch]: rewrote to store userchache and groupchache in - a std::map, and to store the dir items in a vector. - - * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files - as dependencies. - - * src/LyXView.[Ch] + other files : changed currentView to view. - - * src/LyXAction.[Ch] : ported from the old devel branch. - - * src/.cvsignore: added .libs and a.out - - * configure.in : changes to use libtool. - - * acinclude.m4 : inserted libtool.m4 - - * .cvsignore: added libtool - -1999-11-19 Jean-Marc Lasgouttes - - * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object - file name in insets and mathed directories (otherwise the - dependency is not taken in account under cygwin). - - * src/text2.C (InsertString[AB]): make sure that we do not try to - read characters past the string length. - -1999-11-18 Jean-Marc Lasgouttes - - * lib/doc/LaTeXConfig.lyx.in, - lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty. - - * src/buffer.C (writeFile): Do not add a comment on top of .lyx - file saying who created them and when this heppened; this is - useless and annoys tools like cvs. - - * lib/layouts/g-brief-{en,de}.layout, - lib/templates/g-brief-{en,de}.lyx: new versions of the textclass - from Thomas Hartkens . - - * src/{insets,mathed}/Makefile.am: do not declare an empty - LDFLAGS, so that it can be set at configure time (useful on Irix - for -n32 flag). - - * lib/reLyX/configure.in: make sure that the prefix is set - correctly in LYX_DIR. - -1999-11-18 André Pönitz - - * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to - be used by 'command-sequence' this allows to bind a key to a - sequence of LyX-commands - (Example: 'command-sequence math-insert alpha; math-insert beta;") - - * src/LyXAction.C: add "command-sequence" - - * src/LyXFunction.C: handling of "command-sequence" - - * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const - &cmd, string const &arg) to LyXFunc::Dispatch(string const& s) - - * src/lyxserver.C, src/minibuffer.C: Use this new interface - -1999-11-17 Jean-Marc Lasgouttes - - * src/buffer.C (writeFile): Do not output a comment giving user - and date at the beginning of a .lyx file. This is useless and - annoys cvs anyway; update version number to 1.1. - - * src/Makefile.am (LYX_DIR): add this definition, so that a - default path is hardcoded in LyX. - - * configure.in: Use LYX_GNU_GETTEXT. - - * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of - AM_GNU_GETTEXT with a bug fixed. - - * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx. - - * src/chset.C: add "using std::ifstream;" to please dec cxx. - - * src/lyx_main.C (init), INSTALL.OS2: the environment variable - which is used to point to LyX data is now LYX_DIR_11x. - - * lyx.man: convert to a unix text file; small updates. - -1999-11-15 Lars Gullik Bjønnes - - * src/support/LSubstring.[Ch]: made the second arg of most of the - constructors be a const reference. - - * src/mathed/math_parser.C (LexInitCodes): small bug introduced by - me fixed. - - * src/support/lyxstring.[Ch] (swap): added missing member function - and specialization of swap(str, str); - - * src/menus.C (ShowBufferMenu): to use the new BufferStorage - - * src/bufferlist.[Ch]: use the new BufferStorage class and remove all - trace of the old one. - - * src/undo.[Ch]: made the undostack use std::list to store undo's in - put the member definitions in undo.C. - - * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed - NEW_TEXT and have now only code that was included when this was - defined. - - * src/intl.C (LCombo): use static_cast - (LCombo2): ditto - (DispatchCallback): ditto - - * src/definitions.h: removed whole file - - * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX - - * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef - parsing and stores in a std:map. a regex defines the file format. - removed unneeded members. - - * src/bufferparams.h: added several enums from definitions.h here. - Removed unsused destructor. Changed some types to use proper enum - types. use block to have the temp_bullets and user_defined_bullets - and to make the whole class assignable. - - * src/bufferparams.C (Copy): removed this functions, use a default - assignment instead. - - * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and - isLiterate const. - - * src/buffer.C (readLyXformat2): commend out all that have with - oldpapersize to do. also comment out all that hve to do with - insetlatex and insetlatexdel. - (setOldPaperStuff): commented out - - * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C - - * src/LyXAction.C: remove use of inset-latex-insert - - * src/mathed/math_panel.C (button_cb): use static_cast - - * src/insets/Makefile.am (insets_o_SOURCES): removed - insetlatex.[Ch] - - * src/support/lyxstring.C (helper): use the unsigned long - specifier, UL, instead of a static_cast. - - * src/support/Makefile.am (libsupport_a_SOURCES): added block.h - - * src/support/block.h: new file. to be used as a c-style array in - classes, so that the class can be assignable. - -1999-11-15 Jean-Marc Lasgouttes - - * src/lyx_gui_misc.C (askForText): when fl_show_input() returns - NULL, make sure to return an empty string (it is not possible to - set a string to NULL). - -1999-11-10 Jean-Marc Lasgouttes - - * src/support/LRegex.C: use regex_t instead of re_pattern_buffer. - - * src/support/lyxstring.C (helper): fix bogus cast in assertion. - - * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the - link line, so that Irix users (for example) can set it explicitely to - "-n32". - - * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that - it can be overidden at make time (static or dynamic link, for - example). - - * src/vc-backend.C, src/LaTeXFeatures.h, - src/support/LRegex.C, src/support/LRegex.h: add a few "using" - statements to bring templates to global namespace. - -1999-11-10 Lars Gullik Bjønnes - - * src/support/lyxstring.C (operator[] const): make it standard - conforming. - - * src/minibuffer.C (Init): changed to reflect that more - information is given from the lyxvc and need not be provided here. - - * src/lyxvc.[Ch]: rewrote to use the vc-backend. - - * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch] - - * src/LyXView.C (UpdateTimerCB): use static_cast - (KeyPressMask_raw_callback): ditto - - * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer -> - buffer_, a lot of changes because of this. currentBuffer() -> - buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(), - also changes to other files because of this. - -1999-11-09 Lars Gullik Bjønnes - - * src/vc-backend.[Ch]: new files. The backends for vc handling, - have no support for RCS and partial support for CVS, will be - improved later. - - * src/insets/ several files: changes because of function name - changes in Bufferview and LyXView. - - * src/mathed/math_symbols.C (math_insert_symbol): use static_cast - - * src/support/LSubstring.[Ch]: new files. These implement a - Substring that can be very convenient to use. i.e. is this - possible: - string a = "Mary had a little sheep"; - Substring(a, "sheep") = "lamb"; - a is now "Mary has a little lamb". - - * src/support/LRegex.[Ch]: a regex class that can be used to pick - out patterns and subpatterns of strings. It is used by LSubstring - and also by vc-backend.C - - * src/support/lyxstring.C: went over all the assertions used and - tried to correct the wrong ones and flag which of them is required - by the standard. some bugs found because of this. Also removed a - couple of assertions. - - * src/support/Makefile.am (libsupport_a_SOURCES): added - LSubstring.[Ch] and LRegex.[Ch] - - * src/support/FileInfo.h: have struct stat buf as an object and - not a pointer to one, some changes because of this. - - * src/LaTeXFeatures.C (getTClassPreamble): also use the - information in layout when adding the layouts preamble to the - textclass preamble. - - * src/LaTeXFeatures.h: use a vector to store the layout - usage in. - - * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM - because of bug in OS/2. - -1999-11-08 Jean-Marc Lasgouttes - - * lib/layouts/lyxmacros.inc (lyxcode): set the font with - \verbatim@font instead of \ttfamily, so that it can be redefined. - - * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C, - src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C, - src/layout.h, src/text2.C: add 'using' directive to bring the - STL templates we need from the std:: namespace to the global one. - Needed by DEC cxx in strict ansi mode. - - * src/support/LIstream.h,src/support/LOstream.h, - src/support/lyxstring.h,src/table.h, - src/lyxlookup.h: do not include in header - files. This should be done in the .C files only. - - * development/lyx.spec.in: WHATSNEW has been renamed to NEWS - (from Kayvan). - - -1999-11-05 Jean-Marc Lasgouttes - - * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update - from Kayvan to fix the tth invokation. - - * development/lyx.spec.in: updates from Kayvan to reflect the - changes of file names. - -1999-11-05 Lars Gullik Bjønnes - - * src/text2.C (InsertStringB): use std::copy - (InsertStringA): use std::copy - - * src/bufferlist.C: use a vector to store the buffers in. This is - an internal change and should not affect any other thing. - - * src/BufferView.C (waitForX): use XSync instead of the lengthy - stuff in waitForX. - - * src/text.C (Fill): fix potential bug, one off bug. - -1999-11-04 Lars Gullik Bjønnes - - * src/Makefile.am (lyx_main.o): add more files it depends on. - - * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order. - - * src/support/lyxstring.C: use size_t for the reference count, - size, reserved memory and xtra. - (internal_compare): new private member function. Now the compare - functions should work for std::strings that have embedded '\0' - characters. - (compare): all compare functions rewritten to use - internal_compare. - -1999-11-03 Lars Gullik Bjønnes - - * src/support/lyxstring.C (compare): pass c_str() - (compare): pass c_str - (compare): pass c_str - -1999-11-03 Jean-Marc Lasgouttes - - * src/support/DebugStream.C: was not included correctly. - - * lib/configure: forgot to re-generate it :( I'll make this file - auto generated soon. - -1999-11-03 Lars Gullik Bjønnes - - * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x - is used. - - * src/support/lyxstring.C: some changes from length() to rep->sz. - avoids a function call. - - * src/support/filetools.C (SpaceLess): yet another version of the - algorithm...now per Jean-Marc's suggestions. - -1999-11-02 Lars Gullik Bjønnes - - * src/layout.C (less_textclass_desc): functor for use in sorting - of textclasses. - (LyXTextClass::Read): sort the textclasses after reading. - - * src/support/filetools.C (SpaceLess): new version of the - SpaceLess functions. What problems does this one give? Please - report. - - * images/banner_bw.xbm: made the arrays unsigned char * - -1999-11-02 Jean-Marc Lasgouttes - - * src/support/lyxstring.C (find): remove bogus assertion in the - two versions of find where this has not been done yet. - - * src/support/lyxlib.h: add missing int return type to - lyx::chdir(). - - * src/menus.C (ShowFileMenu): disable exporting to html if no - html export command is present. - - * config/lib_configure.m4: add a test for an HTML converter. The - programs checked for are, in this order: tth, latex2html and - hevea. - - * lib/configure: generated from config/lib_configure.m4. - - * src/lyxfunc.C (Dispatch): update and improve the execution of an - html converter. The parameters are now passed through $$FName and - $$OutName, instead of standard input/output. - - * src/lyxrc.{C,h}: rename \tth_command to \html_command. - - * lib/lyxrc.example: update description of \html_command. - add "quotes" around \screen_font_xxx font setting examples to help - people who use fonts with spaces in their names. - -1999-11-02 Lars Gullik Bjønnes - - * Distribution files: updates for v1.1.2 - - * src/support/lyxstring.C (find): remove bogus assert and return - npos for the same condition. - -1999-11-01 Lars Gullik Bjønnes - - * added patch for OS/2 from SMiyata. - -1999-10-29 Lars Gullik Bjønnes - - * src/text2.C (CutSelection): make space_wrapped a bool - (CutSelection): dont declare int i until we have to. - (alphaCounter): return a char const *. - -1999-10-28 Jean-Marc Lasgouttes - - * src/support/syscall.C (Systemcalls::kill): - src/support/filetools.C (PutEnv, PutEnvPath): - src/lyx_cb.C (addNewlineAndDepth): - src/FontInfo.C (FontInfo::resize): condition some #warning - directives with WITH_WARNINGS. - - -1999-10-28 Lars Gullik Bjønnes - - * src/layout.[Ch] + several files: access to class variables - limited and made accessor functions instead a lot of code changed - becuase of this. Also instead of returning pointers often a const - reference is returned instead. - - * src/form1.C (create_form_Figure): added a couple fo "no-c-format" - - * src/Makefile.am (dist-hook): added used to remove the CVS from - cheaders upon creating a dist - (EXTRA_DIST): added cheaders - - * src/support/lstrings.C (tostr(char)): fix it to handle param as - a character not as a small integer. - - * src/support/lyxstring.C (find): removed Assert and added i >= - rep->sz to the first if. - -1999-10-27 Lars Gullik Bjønnes - - * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C - src/LyXView.C src/buffer.C src/bufferparams.C - src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C - src/text2.C src/insets/insetinclude.C: - lyxlayout renamed to textclasslist. - - * src/layout.C: some lyxerr changes. - - * src/layout.[Ch] (LyXLayout::Read): changed second paramter to - LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY - (LyXLayoutList): removed all traces of this class. - (LyXTextClass::Read): rewrote LT_STYLE - (LyXTextClass::hasLayout): new function - (LyXTextClass::GetLayout): rewritten to return an iterator + has - both const and nonconst version. - (LyXTextClass::delete_layout): new function. - (LyXTextClassList::Style): bug fix. do the right thing if layout - is to big. - (LyXTextClassList::NumberOfLayout): new acces to layoutlist. - (LyXTextClassList::NameOfLayout): ditto - (LyXTextClassList::Load): ditto - - * src/buffer.C (makeLaTeXFile): new access to layoutlist - - * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist - - * src/LyXAction.C (LookupFunc): added a workaround for sun - compiler, on the other hand...we don't know if the current code - compiles on sun at all... - - * src/support/filetools.C (CleanupPath): subst fix - - * src/insets/insetbib.C (delDatabase): subst fix, this looks - _really_ weird. - - * src/support/filetools.C (PutEnvPath): subst fix, how come nobody - complained about this one? - - * src/insets/insetinclude.C (Latex): subst fix - - * src/insets/insetbib.C (getKeys): subst fix - - * src/LyXSendto.C (SendtoApplyCB): subst fix - - * src/lyx_main.C (init): subst fix - - * src/layout.C (Read): subst fix - - * src/lyx_sendfax_main.C (button_send): subst fix - - * src/buffer.C (RoffAsciiTable): subst fix - - * src/lyx_cb.C (MenuFax): subst fix - (PrintApplyCB): subst fix - -1999-10-26 Juergen Vigna - - * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0 - - (Read): Cleaned up this code so now we read only format vestion >= 5 - -1999-10-26 Lars Gullik Bjønnes - - * src/support/filetools.C (PutEnvPath): subst fix for EMX, how - come nobody has complained about this one? - - * src/insets/insetinclude.C (Latex): subst fix - - * src/insets/insetbib.C (getKeys): subst fix - - * src/lyx_main.C (init): subst fix - - * src/layout.C (Read): subst fix - - * src/buffer.C (RoffAsciiTable): subst fix - - * src/lyx_cb.C (MenuFax): subst fix. - - * src/layout.[hC] + some other files: rewrote to use - std::container to store textclasses and layouts in. - Simplified, removed a lot of code. Make all classes - assignable. Further simplifications and review of type - use still to be one. - - * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from - lastfiles to create the lastfiles partr of the menu. - - * src/lastfiles.[Ch]: rewritten to use deque to store the - lastfiles in. Uses fstream for reading and writing. Simplifies - code. - - * src/support/syscall.C: remove explicit cast. - - * src/BufferView.C (CursorToggleCB): removed code snippets that - were commented out. - use explicat C++ style casts instead of C style casts. also use - u_vdata instea of passing pointers in longs. - - * src/PaperLayout.C: removed code snippets that were commented out. - - * src/lyx_gui_misc.C: removed code snippets that were commented out. - - * src/lyx_main.C: removed code snippets that wer commented out. - - * src/paragraph.C: removed code snippets that were commented out. - - * src/lyxvc.C (logClose): use static_cast - (logUpdate): ditto - (viewLog): remove explicit cast to void* - (showLog): removed old commented code - - * src/menus.C: use static_cast instead of C style casts. use - u_vdata instead of u_ldata. remove explicit cast to (long) for - pointers. Removed old code that was commented out. - - * src/insets/inset.C: removed old commented func - - * src/insets/insetref.C (InsetRef): removed old code that had been - commented out for a long time. - (Edit): ditto - (escape): removed C style cast - - * src/insets/insetlatexaccent.C (Draw): removed old commented code - - * src/insets/insetlatex.C (Draw): removed old commented code - (Read): rewritten to use string - - * src/insets/insetlabel.C (escape): removed C style cast - - * src/insets/insetindex.h: removed vdata and ldata from FD_index_form - - * src/insets/insetindex.C: use static_cast and u_vdata, removed - old commented code. - - * src/insets/insetinclude.h: removed a couple of stupid bools - - * src/insets/insetinclude.C (include_cb): use static_cast and u_data. - (Clone): remove C style cast - (getKeys): changed list to lst because of std::list - - * src/insets/inseterror.C (Draw): removed som old commented code. - - * src/insets/insetcommand.C (Draw): removed some old commented code. - - * src/insets/insetbib.C (bibitem_cb): removed code that has been - commented out forever. - (bibitem_cb): use static_cast instead of C style cast - use of vdata changed to u_vdata. - - * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data - parameter. - (CloseUrlCB): use static_cast instead of C style cast. - (CloseUrlCB): added a fl_free form...it seemed to be missing. - - * src/insets/insetinfo.C (Edit): pass object in u_vdata instead - (C_InsetInfo_CloseInfoCB): forward the ob parameter - (CloseInfoCB): static_cast from ob->u_vdata instead. - (Edit): removed bogus arg from fl_set_object_shortcut, set to 1 - instead. - - * src/insets/inseterror.C (Edit): pass object in u_vdata instead - (C_InsetError_CloseErrorCB): forward the ob parameter - (CloseErrorCB): static_cast from ob->u_vdata instead. - - * src/vspace.h: include LString.h since we use string in this class. - - * src/vspace.C (lyx_advance): changed name from advance because of - nameclash with stl. And since we cannot use namespaces yet...I - used a lyx_ prefix instead. Expect this to change when we begin - using namespaces. - - * src/BufferView.[Ch] (BufferView::~BufferView): removed - - * src/BackStack.h: rewrote to use std::stack. made BackStackItem - and removed now defunct constructor and deconstructor. - - * src/BufferView.h: have backstack as a object not as a pointer. - removed initialization from constructor. added include for BackStack - - * development/lyx.spec.in (%build): add CFLAGS also. - - * src/screen.C (drawFrame): removed another warning. - -1999-10-25 Jean-Marc Lasgouttes - - * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to - OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2, - README and ANNOUNCE a bit for the next release. More work is - needed, of course. - - * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made - unbreakable if we are in freespacing mode (LyX-Code), but not in - latex mode. - -1999-10-25 Lars Gullik Bjønnes - - * src/BackStack.h: fixed initialization order in constructor - - * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in - - * acinclude.m4 (VERSION): new rules for when a version is - development, added also a variable for prerelease. - (warnings): we set with_warnings=yes for prereleases - (lyx_opt): prereleases compile with same optimization as development - (CXXFLAGS): only use pedantic if we are a development version - - * src/BufferView.C (restorePosition): don't do anything if the - backstack is empty. - - * src/BackStack.h: added member empty, use this to test if there - is anything to pop... - -1999-10-25 Juergen Vigna - - * forms/form1.fd + - * forms/layout_forms.fd + - * forms/latexoptions.fd + - * lyx.fd: changed for various form resize issues - - * src/mathed/math_panel.C + - * src/insets/inseterror.C + - * src/insets/insetinfo.C + - * src/insets/inseturl.C + - * src/insets/inseturl.h + - * src/LaTeXLog.C + - * src/LyXSendto.C + - * src/PaperLayout.C + - * src/ParagraphExtra.C + - * src/TableLayout.C + - * src/form1.C + - * src/layout_forms.C + - * src/lyx.C + - * src/lyx_cb.C + - * src/lyx_gui.C + - * src/lyxfr0.C + - * src/lyxfunc.C + - * src/lyxvc.C + - * src/menus.C: fixed various resize issues. So now forms can be - resized savely or not be resized at all. - - * forms/form_url.fd + - * src/insets/form_url.[Ch]: added because it's cleaner and easier - to modify IMO. - - * src/insets/Makefile.am: added files form_url.[Ch] - -1999-10-25 Jean-Marc Lasgouttes - - * INSTALL: it is now possible to compile LyX with digital C++ 6.1 - (and presumably 6.2). - - * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc, - menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around - remaining static member callbacks. - - * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer - messages. - - * src/support/lyxstring.h: declare struct Srep as friend of - lyxstring, since DEC cxx complains otherwise. - -1999-10-24 Lars Gullik Bjønnes - -1999-10-24 Lars Gullik Bjønnes - - * src/LaTeX.C (run): made run_bibtex also depend on files with - extension ".bst" - (runBibTeX): added scans for "\\bibstyle", now also ".bst" files - are put into the dependency file. - - * src/spellchecker.C (create_ispell_pipe): removed old #warning, - the code has shown itself to work - (create_ispell_pipe): removed another warning, added a comment - instead. - - * src/minibuffer.C (ExecutingCB): removed code that has been - commented out a long time - - * src/lyxfunc.C (processKeyEvent): removed some very old commented - out code + a warning. - - * src/support/lyxstring.h: comment out the three private - operators, when compiling with string ansi conforming compilers - they make problems. - - * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be - unsigned char *. - (pixmapFromBitmapData): change type of bdata to be unsigned char * - (pixmapFromBitmapData): add a reinterpret_cast in the call to - XCreateImage - - * src/mathed/math_panel.h: change 6th arg to AddBitmap to be - unsigned char * - - * src/mathed/math_panel.C (create_math_panel): remove explicit - casts - - * src/bmtable.h: change last paramter to fl_set_bmtable_data to be - unsigned char *. - - * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char * - (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call - to XCreatePixmapFromBitmapData - (fl_set_bmtable_data): change the last argument to be unsigned - char * - (fl_set_bmtable_file): change bdata to unsinged char *, change bw - and bh to be unsigned int, remove explicit casts in call to - XReadBitmapFileData. - - * images/arrows.xbm: made the arrays unsigned char * - * images/varsz.xbm: ditto - * images/misc.xbm: ditto - * images/greek.xbm: ditto - * images/dots.xbm: ditto - * images/brel.xbm: ditto - * images/bop.xbm: ditto - - * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in - - * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed. - (LYX_PROG_CXX): added -pedantic to g++ compile options when - with-warnings, removed the __STRING_ANSI__ hack, seems to not be - needed. - (LYX_CXX_CHEADERS): added to the test. - -1999-10-23 Lars Gullik Bjønnes - - * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append. - - * src/support/lyxstring.C (append): fixed something that must be a - bug, rep->assign was used instead of rep->append. - - * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h - and LOstream.h - - * src/lyxfunc.C (processKeyEvent): removed faulty line that made - lyx insert double chars. Fix spotted by Kayvan. - -1999-10-23 Asger Alstrup Nielsen - - * Fixed the tth support. I messed up with the Emacs patch apply feature - and omitted the changes in lyxrc.C. - -1999-10-22 Juergen Vigna - - * src/insets/figinset.C (CallbackFig): Just changed the defines a bit. - - * src/lyx_cb.C (MenuInsertRef) + - * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that - the form cannot be resized under it limits (fixes a segfault) - - * src/lyx.C (create_form_form_ref) + - * forms/lyx.fd: Changed Gravity on name input field so that it is - resized correctly. - -1999-10-22 Jean-Marc Lasgouttes - - * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers - and . - - * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks - whether provides the latest standard features, or if we - have an oldstyle library (like in egcs). - (LYX_CXX_STL_STRING): fix the test. - - * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the - code on MODERN_STL_STREAM. - - * src/support/lyxstring.h: use L{I,O}stream.h. - - * src/support/L{I,O}stream.h: new files, designed to setup - correctly streams for our use - - includes the right header depending on STL capabilities - - puts std::ostream and std::endl (for LOStream.h) or - std::istream (LIStream.h) in toplevel namespace. - -1999-10-22 Lars Gullik Bjønnes - - * src/LaTeX.C (run): added a check in 0 sumchange so that if it - was a bib file that had been changed we ensure that bibtex is run. - (runBibTeX): enhanced to extract the names of the bib files and - getting their absolute path and enter them into the dep file. - (findtexfile): static func that is used to look for tex-files, - checks for absolute patchs and tries also with kpsewhich. - Alternative ways of finding the correct files are wanted. Will - probably be moved. - (do_popen): function that runs a command using popen and returns - the whole output of that command in a string. Should be moved to - somewhere else. - - * src/DepTable.[Ch] (extchanged): new function that returns true if a - file with extension ext has changed. - - * src/insets/figinset.C: added ifdef guards around the fl_free - code that jug commented out. Now it is commented out when - compiling with XForms == 0.89. - - * src/support/lyxstring.C: moved the definition of lyxstring::Srep - to lyxstring.C, and only keep a forward declaration in - lyxstring.h. Simplifies the header file a bit and should help a - bit on compile time too. Also changes to Srep will not mandate a - recompile of code just using string. - (~lyxstring): definition moved here since it uses srep. - (size): definition moved here since it uses srep. - - * src/support/lyxstring.h: removed a couple of "inline" that should - not be there. - -1999-10-21 Jean-Marc Lasgouttes - - * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass - the 'ob' argument. - -1999-10-21 Juergen Vigna - - * src/table.C (SetPWidth): Just a small fix so the alignment is not - set to left if I just remove the width entry (or it is empty). - - * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong - paragraph when having dummy paragraphs. - -1999-10-20 Juergen Vigna - - * src/insets/figinset.C: just commented some fl_free_form calls - and added warnings so that this calls should be activated later - again. This avoids for now a segfault, but we have a memory leak! - - * src/lyxfunc.C (processKeyEvent) (Dispatch): changed - 'const char * argument' to 'string argument', this should - fix some Asserts() in lyxstring.C. - - * src/lyxfunc.h: Removed the function argAsString(const char *) - as it is not used anymore. - -1999-10-20 Lars Gullik Bjønnes - - * src/support/lyxstring.C (getline): reads now _all_ chars. uses - get instead of >> - - * src/Literate.h: some funcs moved from public to private to make - interface clearer. Unneeded args removed. - - * src/Literate.C (scanLiterateLogFile): rewritten to use iostream - instead of lyxlex. - (scanBuildLogFile): ditto - - * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into - normal TeX Error. Still room for improvement. - - * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed. - - * src/buffer.C (insertErrors): changes to make the error - desctription show properly. - - * src/LaTeX.C (deplog): removed the test for file in lyx doc dir. - could never happen - - * src/support/lyxstring.C (helper): changed to use - sizeof(object->rep->ref). - (operator>>): changed to use a pointer instead. - - * src/support/lyxstring.h: changed const reference & to value_type - const & lets see if that helps. - -1999-10-19 Lars Gullik Bjønnes - - * Makefile.am (rpmdist): fixed to have non static package and - verison. - - * src/support/lyxstring.C: removed the compilation guards - - * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things - a bit clearer. - - * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for - conditional compile of lyxstring.Ch - - * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a - stupid check, but it is a lot better than the bastring hack. - (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING - - * several files: changed string::erase into string::clear. Not - really needed. - - * src/chset.C (encodeString): use a char temporary instead - - * src/table.C (TexEndOfCell): added tostr around - column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1 - (TexEndOfCell): ditto - (TexEndOfCell): ditto - (TexEndOfCell): ditto - (DocBookEndOfCell): ditto - (DocBookEndOfCell): ditto - (DocBookEndOfCell): ditto - (DocBookEndOfCell): ditto - - * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1 - - * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count - - * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret - (MenuBuildProg): added tostr around ret - (MenuRunChktex): added tostr around ret - (DocumentApplyCB): added tostr around ret - - * src/chset.C (encodeString): added tostr around t->ic - - * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth - (makeLaTeXFile): added tostr around tocdepth - (makeLaTeXFile): added tostr around ftcound - 1 - - * src/insets/insetbib.C (setCounter): added tostr around counter. - - * src/support/lyxstring.h: added an operator+=(int) to catch more - mistakes. - - * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers. - (lyxstring): We DON'T allow NULL pointers. - -1999-10-19 Jean-Marc Lasgouttes - - * src/mathed/math_macro.C (MathMacroArgument::Write, - MathMacroTemplate::WriteDef): add tostr() around macro arg numbers - when writing them out. - - * src/LString.C: remove, since it is not used anymore. - - * src/support/lyxstring.C: condition the content to - USE_INCLUDED_STRING macro. - - * src/mathed/math_symbols.C, src/support/lstrings.C, - src/support/lyxstring.C: add `using' directive to specify what - we need in . I do not think that we need to - conditionalize this, but any thought is appreciated. - - * many files: change all callback functions to "C" linkage - functions to please strict C++ compilers like DEC cxx 6.1 in mode - strict_ansi. Those who were static are now global. - The case of callbacks which are static class members is - trickier, since we have to make C wrappers around them (see - InsetError, InsetInfo and InsetUrl). The same holds for friends. I - did not finish this yet, since it defeats the purpose of - encapsulation, and I am not sure what the best route is. - -1999-10-19 Juergen Vigna - - * src/support/lyxstring.C (lyxstring): we permit to have a null - pointer as assignment value and just don't assign it. - - * src/vspace.C (nextToken): corrected this function substituting - find_first(_not)_of with find_last_of. - - * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB) - (TableOptCloseCB) (TableSpeCloseCB): - inserted fl_set_focus call for problem with fl_hide_form() in - xforms-0.89. - -1999-10-19 Jean-Marc Lasgouttes - - * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a - string. - -1999-10-18 Jean-Marc Lasgouttes - - * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses - LyXLex::next() and not eatline() to get its argument. - -1999-10-17 Lars Gullik Bjønnes - - * src/DepTable.[Ch]: rewritten to store the dependencies in a map - instead, use fstreams for io of the depfile, removed unneeded - functions and variables. - - * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a - vector instead, removed all functions and variables that is not in - use. - -1999-10-16 Lars Gullik Bjønnes - - * src/buffer.C (insertErrors): use new interface to TeXError - - * Makefile.am (rpmdist): added a rpmdist target - - * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as - per Kayvan's instructions. - -1999-10-15 Jean-Marc Lasgouttes - - * src/Makefile.am: add a definition for localedir, so that locales - are found after installation (Kayvan) - -1999-10-14 Lars Gullik Bjønnes - - * development/.cvsignore: new file. - -1999-10-14 Jean-Marc Lasgouttes - - * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the - C++ compiler provides wrappers for C headers and use our alternate - version otherwise. - - * configure.in: use LYX_CXX_CHEADERS. - - * src/cheader/: new directory, populated with cname headers from - libstdc++-2.8.1. They are a bit old, but probably good enough for - what we want (support compilers who lack them). - - * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support - from includes. It turns out is was stupid. - -1999-10-14 Lars Gullik Bjønnes - - * lib/Makefile.am (install-data-local): forgot a ';' - (install-data-local): forgot a '\' - (libinstalldirs): needed after all. reintroduced. - -1999-10-13 Lars Gullik Bjønnes - - * configure.in (AC_OUTPUT): added lyx.spec - - * development/lyx.spec: removed file - - * development/lyx.spec.in: new file - - * po/*.po: merged with lyx.pot becuase of make distcheck - - * lib/Makefile.am (dist-hook): added dist-hook so that - documentation files will be included when doing a make - dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run. - (pkgdata_SCRIPTS): added configure.cmd for now, we can use som - conditional later. - more: tried to make install do the right thing, exclude CVS dirs - etc. - - * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that - Path would fit in more nicely. - - * all files that used to use pathstack: uses now Path instead. - This change was a lot easier than expected. - - * src/support/path.h: new file - - * src/support/Makefile.am (libsupport_a_SOURCES): added path.h - - * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch] - - * src/support/lyxstring.C (getline): Default arg was given for - para 3. removed. - - * Configure.cmd: removed file - -1999-10-13 Jean-Marc Lasgouttes - - * src/support/DebugStream.[Ch]: remove the explicit std:: before - streams classes and types, add the proper 'using' statements when - MODERN_STL is defined. - - * src/debug.h: move the << operator definition after the inclusion - of DebugStream.h - - * src/support/filetools.C: include "LAssert.h", which is needed - later. - - * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support - to includes. - - * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h: - include "debug.h" to define a proper ostream. - -1999-10-12 Asger Alstrup Nielsen - - * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)" - method to the SystemCall class which can kill a process, but it's - not fully implemented yet. - - * src/*.C: Changed Systemcalls::Startscript() to startscript() - - * src/support/FileInfo.h: Better documentation - - * src/lyxfunc.C: Added support for buffer-export html - - * src/menus.C: Added Export->As HTML... - - * lib/bind/*.bind: Added short-cut for buffer-export html - - * src/lyxrc.*: Added support for new \tth_command - - * lib/lyxrc.example: Added stuff for new \tth_command - -1999-10-12 Lars Gullik Bjønnes - - * lib/Makefile.am (IMAGES): removed images/README - (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it - installes in correct place. Check permisions is installed - correctly. - - * src/LaTeX.C: some no-op changes moved declaration of some - variables around. - - * src/LaTeX.h (LATEX_H): changed include guard name - -1999-10-12 Jean-Marc Lasgouttes - - * lib/reLyX/Makefile.am: install noweb2lyx. - - * lib/Makefile.am: install configure. - - * lib/reLyX/configure.in: declare a config aux dir; set package - name to lyx (not sure what the best solution is); generate noweb2lyx. - - * lib/layouts/egs.layout: fix the bibliography layout. - -1999-10-08 Jürgen Vigna - - * src/support/filetools.C (FileOpenSearch): Fixed a bug where - when in the PATH was something like /usr/bin;;/bin (note: the ;;) - it returned without continuing to search the path. - -1999-10-07 Lars Gullik Bjønnes - - * src/insets/insetquotes.C (Draw): Simplified a gread deal. This - also fixes a bug. It is not allowed to do tricks with std::strings - like: string a("hei"); &a[e]; this will not give what you - think... Any reason for the complexity in this func? - -1999-10-06 Asger Alstrup Nielsen - - * Updated README and INSTALL a bit, mostly to check that my - CVS rights are correctly set up. - -1999-10-06 Lars Gullik Bjønnes - - * src/support/lyxstring.C (helper): removed bogus Assert. strlen - does not allow '\0' chars but lyxstring and std::string does. - -1999-10-05 Lars Gullik Bjønnes - - * autogen.sh (AUTOCONF): let the autogen script create the - POTFILES.in file too. POTFILES.in should perhaps now not be - included in the cvs module. - - * some more files changed to use C++ includes instead of C ones. - - * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended - not assigned. - (Reread): added tostr to nlink. buggy output otherwise. - (Reread): added a string() around szMode when assigning to Buffer, - without this I got a log of garbled info strings. - - * acconfig.h: commented out the PTR_AS_INT macros. They should not - be needed. - - * I have added several ostream & operator<<(ostream &, some_type) - functions. This has been done to avoid casting and warnings when - outputting enums to lyxerr. This as thus eliminated a lot of - explicit casts and has made the code clearer. Among the enums - affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of - mathed enums, some font enum the Debug::type enum. - - * src/support/lyxstring.h (clear): missing method. equivalent of - erase(0, npos). - - * all files that contained "stderr": rewrote constructs that used - stderr to use lyxerr instead. (except bmtable) - - * src/support/DebugStream.h (level): and the passed t with - Debug::ANY to avoid spurious bits set. - - * src/debug.h (Debug::type value): made it accept strings of the - type INFO,INIT,KEY. - - * configure.in (Check for programs): Added a check for kpsewhich, - the latex generation will use this later to better the dicovery of - all used files. - - * src/BufferView.C (create_view): we don't need to cast this to - (void*) that is done automatically. - (WorkAreaButtonPress): removed some dead code. - -1999-10-05 Jean-Marc Lasgouttes - - * src/minibuffer.C (Init): make sure that the "Welcome to LyX!" - is not overwritten when translated (David Sua'rez de Lis). - - * lib/CREDITS: Added David Sua'rez de Lis - - * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX. - - * src/bufferparams.C (BufferParams): default input encoding is now - "latin1" - - * acinclude.m4 (cross_compiling): comment out macro - LYX_GXX_STRENGTH_REDUCE. - - * acconfig.h: make sure that const is not defined (to empty) when - we are compiling C++. Remove commented out code using SIZEOF_xx - macros. - - * configure.in : move the test for const and inline as late as - possible so that these C tests do not interefere with C++ ones. - Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness - has not been proven. - -1999-10-04 Jean-Marc Lasgouttes - - * src/table.C (getDocBookAlign): remove bad default value for - isColumn parameter. - - * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles - shortcut. - (ShowFileMenu2): ditto. - - * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list - of files to ignore. - -1999-10-04 Lars Gullik Bjønnes - - * Most files: finished the change from the old error code to use - DebugStream for all lyxerr debugging. Only minor changes remain - (e.g. the setting of debug levels using strings instead of number) - -1999-10-02 Lars Gullik Bjønnes - - * src/layout.C (Add): Changed to use compare_no_case instead of - strcasecmp. - - * src/FontInfo.C: changed loop variable type too string::size_type. - -1999-10-01 Lars Gullik Bjønnes - - * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and - set ETAGS_ARGS to --c++ - -1999-09-30 Lars Gullik Bjønnes - - * src/table.C (DocBookEndOfCell): commented out two unused variables - - * src/paragraph.C: commented out four unused variables. - - * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i - insed a if clause with type string::size_type. - - * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to - string::size_type. - - * src/lyxfunc.C (Dispatch): use string::size_type as loop variable. - - * src/lyx_cb.C (ReplaceWord): use string::size_type as loop - variable, also changed loop to go from 0 to lenght + 1, instead of - -1 to length. This should be correct. - - * src/LaTeX.C (scanError): use string::size_type as loop variable - type. - - * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines - (l.896) since y_tmp and row was not used anyway. - - * src/insets/insetref.C (escape): use string::size_type as loop - variable type. - - * src/insets/insetquotes.C (Width): use string::size_type as loop - variable type. - (Draw): use string::size_type as loop variable type. - - * src/insets/insetlatexaccent.C (checkContents): use - string::size_type as loop variable type. - - * src/insets/insetlabel.C (escape): use string::size_type as loop - variable type. - - * src/insets/insetinfo.C: added an extern for current_view. - - * src/insets/insetcommand.C (scanCommand): use string::size_type - as loop variable type. - - * most files: removed the RCS tags. With them we had to recompile - a lot of files after a simple cvs commit. Also we have never used - them for anything meaningful. - - * most files: tags-query-replace NULL 0. As adviced several plases - we now use "0" instead of "NULL" in our code. - - * src/support/filetools.C (SpaceLess): use string::size_type as - loop variable type. - -1999-09-29 Lars Gullik Bjønnes - - * src/paragraph.C: fixed up some more string stuff. - -1999-09-28 Lars Gullik Bjønnes - - * src/support/filetools.h: make modestr a std::string. - - * src/filetools.C (GetEnv): made ch really const. - - * src/lyxlib.h: removed the Maximum and Minimum inline functions, - made code that used these use max/min from instead. - - * changed several c library include files to their equivalent c++ - library include files. All is not changed yet. - - * created a support subdir in src, put lyxstring and lstrings - there + the extra files atexit, fileblock, strerror. Created - Makefile.am. edited configure.in and src/Makefile.am to use this - new subdir. More files moved to support. - - * imported som of the functions from repository lyx, filetools - - * ran tags-query-replace on LString -> string, corrected the bogus - cases. Tried to make use of lstrings.[hC], debugged a lot. There - is still some errors in there. This is errors where too much or - too litle get deleted from strings (string::erase, string::substr, - string::replace), there can also be some off by one errors, or - just plain wrong use of functions from lstrings. Viewing of quotes - is wrong. - - * LyX is now running fairly well with string, but there are - certainly some bugs yet (see above) also string is quite different - from LString among others in that it does not allow null pointers - passed in and will abort if it gets any. + * ChangeLog: store old and begin new - * Added the revtex4 files I forgot when setting up the repository. - -1999-09-27 Lars Gullik Bjønnes - - * All over: Tried to clean everything up so that only the files - that we really need are included in the cvs repository. - * Switched to use automake. - * Generaton of reLyX is not perfect, LYX_DIR does not get substituted. - * Install has not been checked. - -1999-09-22 Lars Gullik Bjønnes - - * po/pt.po: Three errors: - l.533 and l.538 format specification error - l. 402 duplicate entry, I just deleted it. + * src/version.h (LYX_DOCVERSION): update to 1.2.0cvs diff --git a/ChangeLog.1 b/ChangeLog.1 new file mode 100644 index 0000000000..c5137413f6 --- /dev/null +++ b/ChangeLog.1 @@ -0,0 +1,13357 @@ +2001-01-11 Jean-Marc Lasgouttes + + * src/buffer.C (getTocList): make the method const, so that + InsetTOC::Ascii compiles. + + * src/insets/insettoc.C (Ascii): return 0 + +2001-01-11 Dekel Tsur + + * src/insets/insettoc.C (Ascii): New method. + + * src/lyx_main.C (init) Set first_start to false when running + without a GUI. + +2000-12-19 Dekel Tsur + + * src/paragraph.C (TeXOnePar,SimpleTeXOnePar) Fix problem with + aligned paragraphs. + +2001-01-11 Lars Gullik Bjønnes + + * src/buffer.C (writeFile): add missing ' ' after lyxformat. + + * src/buffer.h: change format to int, and change name to file_format + + * src/buffer.C: change LYX_FORMAT to int, and bump version number + to 218. + (readLyXformat2): handle it + handle it + (readFile): handle it + (writeFile): handle it + +2001-01-10 Dekel Tsur + + * src/insets/insettext.C (LocalDispatch): Add handling of + LFUN_BREAKPARAGRAPHKEEPLAYOUT. + +2001-01-10 Lars Gullik Bjønnes + + * src/tabular.C (Write): write lowercase identifiers + (Read): read lowercase identifiers + +2001-01-10 Jean-Marc Lasgouttes + + * src/support/lyxstring.C (rfind): better fix (from Dekel). + + * src/tabular.h: add a couple std:: qualifiers. + +2001-01-10 Lars Gullik Bjønnes + + * src/support/lyxstring.C (rfind): also test the first char in the + string and be sure that t >= 0. + +2001-01-09 Lars Gullik Bjønnes + + * src/tabular.C (ReadNew): new method + (Read): changed to call ReadNew or ReadOld depending on the + tabular version found. + + * src/tabular-old.C: new file with the support functions and the + ReadOld method. + (ReadOld): new method + + * src/frontends/xforms/FormDocument.C (CheckChoiceClass): make tc + unsigned to remove a signed/usigned warning. + + * src/tabular.C (tostr): new spesializations, replaces type2string + (Write): use the new spesializations + +2001-01-09 Juergen Vigna + + * src/tabular.C (OldFormatRead): convert the footer/header information + to the right row. + (getTokenValue): chaned this functions again. + (string2type): added a bunch of this functions per type. + (Write): use type2string and write columns first. + (type2string): added a bunch of this functions per type. + (TeXBottomHLine): + (TeXTopHLine): check row parameter. + +2001-01-08 Dekel Tsur + + * src/tabular.C (getTokenValue): Fix crash with malformed files. + (Read): Read the rotate attribute. + +2001-01-09 Jean-Marc Lasgouttes + + * src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix + class switching; do not do anything if class has not been changed. + +2001-01-07 Dekel Tsur + + * lib/build-listerrors: Exit if literate-article doesn't appear in + textclass.lst + +2001-01-09 Jean-Marc Lasgouttes + + * src/combox.h (getline): small fix for sun CC 6.0 + * src/combox.C (input_cb): ditto. + * src/spellchecker.C (sigchldhandler): ditto. + + * src/lyx_main.C (init): do not query for creation of user + directory when running without a GUI. + +2001-01-08 Dekel Tsur + + * src/mathed/formula.C (LocalDispatch): Toggle font properties. + +2001-01-07 Dekel Tsur + + * BufferView2.C (open_new_inset): Added 2nd argument. + (getParentText, getParentLanguage): New methods. + + * src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and + LFUN_INSET_TABULAR for RTL text. + + * src/tabular.C (Latex): Put \R{} around RTL cells. + + * src/text2.C (InsertInset): Change cursor position for highly + editable insets. + + * src/frontends/xforms/FormTabularCreate.C (apply): Create the + tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...) + + * src/insets/insettabular.C (LocalDispatch): When dispatching + LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was + locked, then the insettext of the new cell will be locked. + (moveLeft, moveRight): Fixed for RTL tabulars. + (moveNextCell, movePrevCell): Ditto. + (isRightToLeft): New method. + + * src/insets/insettext.C (LocalDispatch): Fixed handling of + non-dispatched function in the locking inset. + (Edit): If the inset is empty set the language of the current font + to the language to the surronding text (this code was moved from + LocalDispatch to allow the user to change the languaeg before + inserting text). + (moveRight, moveLeft): Fixed for RTL text. + (checkAndActivateInset): Fixed. + + * src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font. + +2001-01-08 Jean-Marc Lasgouttes + + * src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate + the tooltip. + (set): ditto. + + * src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL + around some ispell code. + + * src/lyxcursor.[Ch]: add proper constructor, to avoid tons of + Unitialized Memory Read in purify. + + * lib/examples/nl_splash.lyx: update from Tino Meinen. + +2001-01-04 Dekel Tsur + + * src/frontends/xforms/FormDocument.C (FormDocument::build): + Disable class_->choice_doc_class and language_->choice_language to + allow using the class/language combox with keyboard. + +2001-01-08 Lars Gullik Bjønnes + + * src/support/snprintf.c (va_copy): only define va_copy if undefined + +2001-01-06 Lars Gullik Bjønnes + + * src/lyxvc.C (showLog): give the tempfile a mask + + * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed + branch on !rename + + * src/support/filetools.C (IsDirWriteable): give the tempfile a + mask and unlink the tempfile after use. + +2001-01-04 Juergen Vigna + + * src/insets/insettabular.C (resetPos): an extra scroll, but we + really should redo all this scrolling code! + (TabularFeatures): unlock the_locking_inset before add/del rows/colums. + + * src/text.C (GetVisibleRow): check that y/h values are good otherwise + change them. + + * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION. + (pasteSelection): pay attention to multicolumn cells. + (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc. + +2001-01-03 Jean-Marc Lasgouttes + + * src/mathed/math_panel.C (deco_cb): check the decoration index is + valid. + + * src/frontends/xforms/FormPreferences.C (feedback): apply + formatting to the translated string, not to the original one. + (printWarning): ditto. + + * src/gettext.C (_): translate empty string with empty string. + + * src/frontends/xforms/FormCopyright.C (build): use _() instead of + N_(). + + * NEWS: small update + + * UPGRADING: mention that tabular format has been changed. + +2001-01-03 Juergen Vigna + + * src/insets/insettabular.C (InsetButtonPress): look for button==2 + and do Clipboard Paste! + + * src/insets/insettext.C (SetText): added function. + + * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and + new LFUN_PASTESELECTION. + + * src/insets/insettext.C (draw): don't clear if top_x changes. + + * src/insets/insettabular.C (draw): clear only if the inset didn't + change in the draw routine. + + * src/insets/insettext.C (width): make the width dependant on the + textWidth too. + + * src/text.C (draw): comment out the UpdateInset call. + + * src/screen.C (DrawOneRow): + (DrawFromTo): check for bv->text->status not text->status. + + * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate + dimensions of ascent-descent for the whole row. + + * src/insets/insettext.C (draw): check also for need_update == INIT. + +2001-01-03 Jean-Marc Lasgouttes + + * Makefile.am (EXTRA_DIST): add autogen.sh + +2001-01-03 Miyata Shigeru + + * development/OS2/quick_fix.patch: + * lib/configure.cmd: update OS/2 support files. + +2001-01-02 Juergen Vigna + + * src/insets/insettabular.C (pasteSelection): rewritten correctly. + + * src/tabular.C (TeXTopHLine): + (TeXBottomHLine): fixed Lars new code. + + * src/insets/insettext.C (LocalDispatch): added support for math_greek. + + * src/mathed/math_symbols.C (math_insert_greek): removed current_view + from this function and added a BufferView * parameter. + + * src/mathed/math_symbols.C (math_insert_symbol): ditto + +2000-12-31 Lars Gullik Bjønnes + + * src/version.h: set to pre3 + +2000-12-31 Lars Gullik Bjønnes + + * src/Makefile.am (lyx_SOURCES): added Floating.C + + * src/Floating.h: moved all the inlines to Floating.C + + * src/Floating.C: new file + +2000-12-29 Jean-Marc Lasgouttes + + * src/frontends/xforms/FormPreferences.C (feedback): fix + description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG. + +2000-12-29 Lars Gullik Bjønnes + + * src/support/FileInfo.h: move unistd.h to after sys/types.h and + sys/stat.h. + + * src/support/FileInfo.C: don't include sys/types. and sys/stat.h + + * src/mathed/math_inset.h: move LString.h to be included first + + * src/insets/insetfloat.C: adjust for change in private variable names + + * src/frontends/xforms/xform_helpers.h : don't include config.h + + * src/frontends/xforms/xform_helpers.C: adjust the order of + includes, some whitespace changes. + + * src/trans.C (Load): constify filename and res + + * src/text2.C (SetCounter): call Floating::name() + + * src/screen.C: change to not use owner from WorkArea, but from + text instead. + + * src/lyxfunc.C: adjust because of changes in Intl. + + * src/intl.h: make trans a object instead of pointer, inlucd + trans_mgr.h in this file. + (getTrans): return a reference to TransManager + + * src/intl.C: don't include trans_mgr.h here + modify calls to trans to work on object instead of on pointer + + * src/WorkArea.h: add using for Signal1 + comment out forward decl of BufferView. + add signal scrollCB + remove class variable owner_ and getter method for this. + + * src/WorkArea.C: don't include BufferView.h + (WorkArea): change to not take a BufferView.h, use signals + instead. + (scroll_cb): emit signal + + * src/LaTeXFeatures.C: include Floatlist.h + (getPackages): only load float.sty when needed + (getMacros): prepare for outputting the correct code to preamble. + + * src/Floating.h: make all variables private + rename to var_. + (Floating): default ctor + (Floating): complex ctor to set a complete Floating + (type): getter + (placement): getter + (name): getter + (builtin): getter + + * src/FloatList.C (FloatList): use Floating's constructor + (begin): new method + (end): ditto + (newFloat): call type() + (defaultPlacement): call placement() + (operator): new operator + + * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea + (scrollUp): call pimpl's scrollCB + (scrollDown): ditto + (pasteClipboard): constify clip + + * src/BufferView2.C (insertLyXFile): constify fname, fi and c. + (insertErrors): constify desctext, errortext, msgtxt and errorrow + (open_new_inset): delete some commented code. + + * src/BufferView.[Ch] (enterView): comment out + (leaveView): ditto + (scrollCB): ditto + (workAreaMotionNotify): ditto + (workAreaButtonPress): ditto + (doubleClick): ditto + (tripleClick): ditto + (workAreaButtonRelease): ditto + (workAreaExpose): ditto + + * config/lyxinclude.m4 (cross_compiling): small stuff to be able + to compile with cvs gcc (2.97). + +2000-12-28 Dekel Tsur + + * lib/ui/default.ui: menu structure cleanup. + + * lib/languages: add description of entries. + +2000-12-27 Jean-Marc Lasgouttes + + * src/insets/ExternalTemplate.C (readTemplates): change debug + messages a bit. + (readTemplate): use lyxlex.printError to report read errors. + (readFormat): ditto. + + * src/insets/insetexternal.C (Read): suppress debug message when + not needed. + +2000-12-21 Dekel Tsur + + * src/insets/insetinclude.C (Ascii): New method. Currently + supports only verbatim input. + +2000-12-27 Jean-Marc Lasgouttes + + * lib/bind/fi_menus.bind: update from Pauli Virtanen. + +2000-12-22 Juergen Vigna + + * src/insets/insettabular.C (InsetButtonPress): do nothing if we + have a selection and button == 3. + (UpdateLocal): if what == INIT clear selection if existent! + (InsetButtonPress): don't activate the cell inset on button==3 + (Edit): ditto + (LocalDispatch): move curor up/down if exiting an inset which this + keys. + +2000-12-20 Juergen Vigna + + * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when + calling for the math-panel (do not unlock the math-inset if locked)! + + * src/text.C (GetVisibleRow): fixed drawing of depth lines inside + text-insets (with x-offset). + + * src/tabular.C (TeXCellPreamble): fixed wrong output of special + alignment of multicolumn-cells. + +2000-12-19 Juergen Vigna + + * src/lyxfunc.C (Dispatch): + * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions + for insettext. + +2000-12-19 Lars Gullik Bjønnes + + * src/WorkArea.C (work_area_handler): simplify the key/keysym + handling for XForms 0.89, this might have rendered some cases + unusable. I have at least deadkeys, accent-xxx and KP_x working. + Please report proplems. + + * src/lyxfunc.C (processKeySym): make the self-insert handling + work as it should + +2000-12-18 Baruch Even + + * src/LaTeX.C (deplog): fix spelling errors + * src/text2.C (CutSelection): ditto + * src/lyxfunc.C (Dispatch): ditto + +2000-12-18 Lars Gullik Bjønnes + + * lib/layouts/stdlayouts.inc: only allow align Center for Caption + + * src/mathed/math_inset.C (MathMatrixInset): initialize v_align + and h_align in default init. + adjust calls to MathedRowSt + + * src/mathed/math_iter.C: adjust calls to MathedRowSt + * src/mathed/math_iter.h (getAD): ditto + + * src/mathed/math_defs.h (class MathedRowSt): remove friends, add + methods setBaseline, ascent, descent + (class MathMatrixInset): remove method GetAlign, change h_align + from char* to string + + * src/lyxfunc.C (processKeySym): discover the correct argument if + the action is LFUN_SELFINSERT + +2000-12-18 Dekel Tsur + + * src/mathed/math_cursor.C (Interpret) Suppress a debug message + in normal run. + +2000-12-17 Lars Gullik Bjønnes + + * src/support/copy.C: don't include filetools.h + + * lib/images: revert to old banner, drop the cucumber. + +2000-12-12 Dekel Tsur + + * src/converter.C (Formats::View): Change the current directory to + the directory of the file. + +2000-12-17 Lars Gullik Bjønnes + + * src/kbsequence.C (addkey): also clear sequence and modifiers if + length == 0 + + * src/BufferView2.C (theLockingInset): return 0 if text is 0 + +2000-12-17 Dekel Tsur + + * Many files: Fix RTL support for insettext. + +2000-12-11 John Levon + + * README: add mention of broken ghostscript versions, remove + reference to non-existent BUGS file + +2000-12-13 Angus Leeming + + * src/support/lstrings.C (compare_no_case): small fix. When passed + length, should use it in the size comparison. + +2000-12-11 Jean-Marc Lasgouttes + + * src/insets/insetexternal.C (getScreenLabel): Return a default + value if the template label is empty. + + * src/lyxlookup.C: do not condition on FL_REVISION. + + * forms/sp_form.fd: + * src/sp_form.C: fix the font size of some text entries + + * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator + after TOC when there is no TOC. + + * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main + bind file if it has not been done yet. + (read): remove local bindFile variable. Try to fix the handling of + RC_BIND and RC_BINDFILE. + + * src/lyx_main.C (init): use readBindFileIfNeeded(). + + * lib/languages: Change description of german to "German (new + spelling)". + +2000-12-07 Angus Leeming + + * src/frontends/xforms/FormInset.C (createInset): activate "Ok", + "Apply" buttons if arg is non-zero. + + * src/lyxfunc.C (Dispatch): enable citation to be inserted without + launching the popup if sufficient info is passed to + LFUN_CITATION_CREATE. + +2000-11-23 Dekel Tsur + + * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new + labels (disabled in 1.1.6). + + * src/lyxrc.[Ch]: New variable label_init_length + + * mathed/formula.C (LocalDispatch): Preserve the label when + changing from display math to eqnarray (however, the label + do not appear at the first line, as one might expects, but at the + second line). + (LocalDispatch): When inserting a label to a formula which already + have a label, the old label is used as default value. + Also, if the label is changed, then all references to the label + are changed. + + * src/mathed/math_iter.C (setLabel): Allow to set the label + even if it is empty. This is needed to allow deletion of a label + in an eqnarray. + + * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the + refernces only if the old label appears once in the document. + +2000-12-07 Angus Leeming + + * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert + + + * src/frontends/xforms/FormBase.C: comment out debug.h + + * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse + code in xform_helpers instead. + (d-tor): comment out "delete dialog;" and so prevent a crash on exit. + + * src/frontends/xforms/FormPreferences.C: use AddName() in more places. + Use N_(), rather than _() when creating strings to pass to browseFile() + because browseFile calls gettext() itself now. + + * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and + display the filename correctly. + +2000-12-09 Dekel Tsur + + * src/converter.C (Move): New method. Used to move file or files + from temp dir to the output dir. (this fixes the bug that + exporting linuxdoc/docbook document to html would not move all + html file from temp directory). + + * src/support/filetools.C (DirList): Fixed. + + * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??). + +2000-12-08 Dekel Tsur + + * src/converter.C (Add): Remove $$i when setting latex_command. + + * src/text.C (IsBoundary): Return false when pos = 0. + +2000-12-08 Dekel Tsur + + * lib/kbd/hebrew.kmap: Add Hebrew points (nikud). + +2000-12-07 Angus Leeming + + * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't + need to empty the fields to turn off use of the geometry package! + +2000-12-07 Angus Leeming + + * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a + (Buffer const &), not a (BufferParams const &) and so fix a crash + caused by using current_view before it had been initialised. Not + the best way to do this, but much easier than changing + Inset::Clone(Buffer const &) to Inset::Clone(). + + * src/CutAndPaste.C: + * src/tabular.C: changed call to CopyIntoMinibuffer(). + +2000-12-07 Jean-Marc Lasgouttes + + * lib/ui/default.ui: put TOC at the beginning of the TOC menu. + + * src/lyxfunc.C (getStatus): disable insertion of floats in a + tabular. + +2000-12-06 Angus Leeming + + * src/frontends/xforms/FormPreferences.C (ScreenFonts::build): + changed filter for screen fonts input filter from int to float + + * src/frontends/xforms/input_validators.c: removed. + * src/frontends/xforms/input_validators.C: new file. Can now call C++ + functions from within the filter functions. + + * src/frontends/xforms/input_validators.[Ch] + (fl_unsigned_float_filter): new filter function. + + * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get + confused now! And if you think I'm going to do this in + ./forms/fdfix.sh with its "sed -e" declarations, then think again! + +2000-12-06 Lars Gullik Bjønnes + + * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon + + * src/WorkArea.C (work_area_handler): don't handle button requests + if xbutton.button == 0 + +2000-12-06 Jean-Marc Lasgouttes + + * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode. + It creates a lot of interesting problems. + +2000-12-06 Jean-Marc Lasgouttes + + * src/frontends/xforms/Menubar_pimpl.C (openByName): check that + the menu exists in the current menubar before opening it. + + * src/MenuBackend.C (hasSubmenu): new method. + + * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus + action value by offsetting actions by a large constant (so that + bogs choice result will be less than this constant). + + * lib/bind/fi_menus.bind: more cleanup to menus. + * lib/bind/sciword.bind: ditto. + * lib/bind/xemacs.bind: ditto. + * lib/bind/emacs.bind: ditto. + * lib/bind/pt_menus.bind: ditto. + * lib/bind/hu_menus.bind: ditto. + + * src/gettext.h (locale_init): set locale LC_NUMERIC to "C". + + * INSTALL: update PROBLEMS section. + + * src/lyxlookup.h: remove condition on xforms version, since we + should not include it if not appropriate. + +2000-12-05 John Levon + + * src/LColor.C: "latex text" -> "latex inset" (from + Angus Leeming) + + * src/lyxrc.C: "it's" -> "its" (from Angus Leeming) + + * src/frontends/kde/FormTabularCreate.C: + * src/frontends/kde/citationdlg.C: + * src/frontends/kde/copyrightdlg.C: + * src/frontends/kde/paradlg.C: + * src/frontends/kde/paraextradlg.C: + * src/frontends/kde/parageneraldlg.C: + * src/frontends/kde/printdlg.C: + * src/frontends/kde/refdlg.C: + * src/frontends/kde/tabcreatedlg.C: + * src/frontends/kde/tocdlg.C: + * src/frontends/kde/urldlg.C: add necessary headers + (from Angus Leeming) + + * src/frontends/kde/dlg/emptytable.C: + * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have + default parameters (from Angus Leeming) + + * src/frontends/kde/dlg/moc/.cvsignore: + * src/frontends/kde/dlg/.cvsignore: + * src/frontends/kde/moc/.cvsignore: fix the library name + (from Angus Leeming) + + * src/frontends/kde/paradlg.C: + * src/frontends/kde/parageneraldlg.C: + * src/frontends/kde/dlg/para.dlg: + * src/frontends/kde/dlg/paradlgdata.C: added accelerators + + * src/frontends/kde/dlg/README: clarified qtarch version + + * src/frontends/kde/dlg/Makefile.am: removed the + dlg rules as they created spontaneous rebuilds + (not a good idea as it requires qtarch) + +2000-12-05 Jean-Marc Lasgouttes + + * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the + fixlevel along with xforms version. + + * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when + xforms version is strictly less than 0.89.5. + * src/lyx_gui.C (LyXGUI): ditto. + * src/LyXView.C (show): ditto. + +2000-12-02 Dekel Tsur + + * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse + movement in inset in RTL text. + (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text. + (workAreaButtonRelease): Do not open a float when there is a selection. + + * src/insets/insettext.C (cx): Fixed for insets in RTL text. + + * src/spellchecker.C (RunSpellChecker): Open all floats before + spellchecking. + + * src/text.C (InsertChar): Consider "," as a part of a number + (for LTR numbers in RTL text code). + (IsBoundary): Fixed (and simplified). + (InsertChar): Recalculate cursor boundary. + (Backspace): Ditto. + +2000-12-04 John Levon + + * src/spellchecker.C: fix figures with pspell enabled + + * src/insets/figinset.C: workaround for gs hang xforms bug + +2000-12-05 Jean-Marc Lasgouttes + + * lib/bind/??_menus.bind: comment out the entries corresponding to + real menus. They should be eventually removed, but I'll let the + language maintainers do that. + +2000-12-04 John Levon + + * src/frontends/kde/parageneraldlg.C: + * src/frontends/kde/parageneraldlg.h: don't use + a derived class for SpaceAbove/Below + + * src/frontends/kde/dlg/README: add some info + + * src/frontends/kde/dlg/*: update data files, update + dialog files. + + * src/frontends/kde/dlg/moc/Makefile.am: add + ${FRONTEND_INCLUDES} + +2000-12-04 John Levon + + * configure.in: add new KDE Makefiles + * src/vspace.h: return GlueLength not a normal one + * src/support/lstrings.h: + * src/support/lstrings.C: add isStrUnsignedInt(), + strToUnsignedInt() + + * src/frontends/kde/*: big reorganisation, update + FormParagraph, add FormTabCreate + +2000-12-04 Angus Leeming + + * lib/ui/default.ui: small grammatical change. + + * src/frontends/xforms/xform_macros.h: removed. + + * src/frontends/xforms/FormBase.C: + * src/frontends/xforms/FormPreferences.C: + * src/frontends/xforms/Makefile.am: changes associated with removing + xform_macros.h. Should make Lars' debugging a little easier. + + * src/frontends/xforms/FormPreferences.C: + * src/frontends/xforms/FormPreferences.h: + * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no + longer use X11 color name database. HSV and RGB dials/sliders. + Please let this be the end of this! + +2000-11-30 Dekel Tsur + + * Several files: Allow compilation when the compiler doesn't + support namespaces. + +2000-11-30 Angus Leeming + + * lyx.man: + * src/lyx_main.C (commandLineHelp, easyParse): documented remaining + command line options. + +2000-11-17 Jean-Marc Lasgouttes + + * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use + FL_MENU_BUTTON for items in menu bar. Not sure what difference it + makes, anyway. + +2000-11-29 Angus Leeming + + * src/frontends/xforms/FormRef.C (updateBrowser): + * src/frontends/xforms/forms/form_ref.fd: try clicking on + different insets with the sort key active. Now apply this patch! + +2000-11-29 John Levon + + * src/frontends/xforms/FormPrint.C: set to valid() + when we update from the passed parameters. + +2000-11-29 Angus Leeming + + * src/LColor.C (getFromGUIName): internationalise the comparison. + + * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a + FormPreferences choice. + + * src/frontends/xforms/FormPreferences.C: some additional Color safety. + Should be redundant. + +2000-11-29 John Levon + + * src/lyxrc.C: more detail for the printer program config + dialog. + + * src/LColor.C: ert->latex text. LColor needs a big revamp + but will have to wait till after 1.1.6 + + * src/buffer.C: bring up a dialog if we load a document + with an un-installed text class, rather than just complain + on the console. + +2000-11-29 Angus Leeming + + * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing + the browser form for a combox in a tabbed folder. Bug fix courtesy of + Steve Lamont . + + * src/frontends/xforms/FormDocument.C (build): + * src/frontends/xforms/FormPreferences.C (Language::build): + pass tabfolders to Combox::add() in order to use this work around. + + * src/frontends/xforms/FormCitation.C (connect): remove max size + limitation. + (update): sort list of bibliography keys. + + * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser, + setSize): removed. + No max size limitation. Same popup for new and existing insets. Fixes + bugs reported by Rob Lahaye. + + * src/frontends/xforms/FormCitation.C (c-tor): + * src/frontends/xforms/FormCopyright.C (c-tor): + * src/frontends/xforms/FormError.C (c-tor): + * src/frontends/xforms/FormGraphics.C (c-tor): + * src/frontends/xforms/FormIndex.C (c-tor): + * src/frontends/xforms/FormRef.C (c-tor): + * src/frontends/xforms/FormToc.C (c-tor): + * src/frontends/xforms/FormUrl.C (c-tor): + use correct policy for ButtonController. + + * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more. + + * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr + call a little. + + * src/frontends/xforms/forms/form_citation.fd: some resizing changes. + + * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons. + Some resizing changes. + +2000-11-28 Lars Gullik Bjønnes + + * configure.in: fix typo + + * lib/languages: add ukraninian and change no to no_NO + + * src/lyxfont.[Ch] (setGUISize): comment out setGUISize + + * src/bufferview_funcs.C (FontSize): use setLyXSize + +2000-11-24 Kayvan A. Sylvan + + * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests + to check for systems where mkstemp() is available but not declared + in headers. The new autoconf macro lyx_CHECK_DECL can be used + to check for declarations in headers. + +2000-11-23 Angus Leeming + + * forms/bibforms.fd: tiny fix to get it to run with fdesign. + + * forms/makefile: added bibforms.fd, include_form.fd. + Removed lyx_sendfax.fd. + + * src/LaTeXLog.C (ShowLatexLog): + * src/LyXAction.C (init): + * src/bufferparams.C (readLanguage): altered messages as suggested by + John Levon. + + * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to + Dialogs::redrawGUI. + + * src/credits.C: made fd_form_credits non-static, so that it can be + redrawn should the xforms colors be re-mapped. + * src/spellchecker.C ditto fd_form_spell_options. + + * src/filedlg.[Ch] (redraw): + * src/intl.[Ch] (redraw): + * src/lyxfr0.[Ch] (redraw): + * src/insets/figinset.[Ch] (redraw): + * src/insets/insetexternal.[Ch] (redraw): + new methods, connected to Dialogs::redrawGUI. + + * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function + to be connected to Dialogs::redrawGUI. + + * src/frontends/xforms/FormCitation.C (build): + * src/frontends/xforms/FormCopyright.C (build): + * src/frontends/xforms/FormError.C (build): + * src/frontends/xforms/FormGraphics.C (build): + * src/frontends/xforms/FormIndex.C (build): + * src/frontends/xforms/FormTabularCreate.[Ch] (update): + * src/frontends/xforms/FormToc.C (build): + * src/frontends/xforms/FormUrl.C (build): + use the ButtonController correctly. + + * src/frontends/xforms/FormCopyright.C (build): + * src/frontends/xforms/forms/form_copyright.fd: moved the text out of + the .fd file and into build(). + + * src/frontends/xforms/FormPreferences.C: tiny clean-up. + + * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input(). + + * src/frontends/xforms/forms/form_citation.fd: + * src/frontends/xforms/forms/form_copyright.fd: + * src/frontends/xforms/forms/form_error.fd: + * src/frontends/xforms/forms/form_graphics.fd: + * src/frontends/xforms/forms/form_index.fd: + * src/frontends/xforms/forms/form_toc.fd: + * src/frontends/xforms/forms/form_url.fd: + renamed some of the objects. Named others explicitly for the first time. + Added Restore and Apply buttons where appropriate. + + * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not + used. + +2000-11-22 Lars Gullik Bjønnes + + * src/version.h: try the pre2 again + +2000-11-22 Angus Leeming + + * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI. + + * src/frontends/kde/FormParagraph.C: added using directive. + + * src/frontends/kde/paradlg.C: added config.h and using directive. + + * src/frontends/kde/paradlg.h: added std::qualifier. + + * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD. + +2000-11-22 Lars Gullik Bjønnes + + * configure.in (AC_OUTPUT): don't output src/xtl/Makefile + + * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files + +2000-11-22 Lars Gullik Bjønnes + + * src/version.h: set back to 1.1.6cvs + +2000-11-22 Lars Gullik Bjønnes + + * src/version.h: set to 1.1.6pre2 + +2000-11-20 Marko Vendelin + + * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI + + * src/frontends/gnome/Makefile.am: updated list of XForms object files + +2000-11-21 Angus Leeming + + * src/LColor.C (init): + * src/lyxrc.C (getDescription): changed some comments as suggested by + John Levon. + + * src/frontends/xforms/FormBase.[Ch]: modified to connect and + disconnect the redrawGUI signal in best-practice fashion. + + * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as + long_opts_tab to reflect the change in name of this tabfolder, as + suggested by John Levon. + (connect, disconnect): new methods. Don't do much at present other than + ensuring that we can't resize the dialog. This just makes xforms go + crazy. + (lots of methods in Colors): made void rather than bool. The idea is + to have an isOk() function that keeps track of whether any input is + genuinely invalid and should therefore block Save, Apply. + Easier to manipulate the counters rapidly. + (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's + compiler will like this code. Much cleaner way of doing things. + + * src/frontends/xforms/forms/fdfix.sh: a little speed up fix. + + * src/frontends/xforms/forms/form_preferences.fd: used normal counters + rather than simple counters, following suggestion by John Levon. + + * src/frontends/xforms/forms/form_print.fd: used labelframe rather + than engraved frame + text. + + * src/frontends/xforms/forms/makefile: removed spurious command. + +2000-11-17 Angus Leeming + + * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry + array. + * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib + ReadOnly|NoBuffer. + + * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix. + + * src/frontends/xforms/FormPreferences.C: re-formatted so that I can + see what Lars has changed and what is just white space! + Now used X directly to ascertain the RGB color associated with the + color name. + Replaced the RGB sliders with HSV equivalent. Should be more intuitive + to use. + Added some sort capability. + The X11 color name database input is only displayed if the database + isn't found in the standard place. + Got rid of struct compare_converter; it wasn't used. + Probably some other stuff that I've forgotten. + + * src/frontends/xforms/FormPreferences.h: changed the names of some + methods in the Colors struct. Added a couple of structs to help sort + colors by name and by RGBColor. + + * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc + functions into a new class RWInfo. + + * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts. + The dialog is now almost navigable using the keyboard. Unfortunately, + the cursor has to be inside a browser for it to be activated. There is + no visual feedback for the key shortcuts to the arrow keys (use + Alt-appropriate arrow key, Alt-x). + + * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab + around a lot. + + * src/support/filetools.[Ch]: moved out ReadableFile etc and into + xform_helpers.[Ch]. See above. + +2000-11-17 Lars Gullik Bjønnes + + * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody + + * src/screen.C (setCursorColor): new method. Sets the color of the + cursor. + (ShowManualCursor): call it. + Constify some local variables. + + * src/LColor.[Ch] (LColor): add entry for cursor + * lib/configure(.m4) (word_to_latex_command): add quotes, removes + a warning. + +2000-11-19 Juergen Vigna + + * src/insets/insettabular.C (draw): fixed text border redraw problem. + (calculate_dimensions_of_cells): try to boost up when inserting chars. + +2000-11-15 Rob Lahaye + + * lib/ui/default.ui: OptItem used for Fax entry + +2000-11-17 Matej Cepl + + * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard. + +2000-11-15 John Levon + + * src/vspace.C (nextToken): fix so it can handle length phrases like + "10mm+-20mm", "40inplus16mmminus10cm" etc. + +2000-11-17 Lars Gullik Bjønnes + + * src/frontends/xforms/FormPreferences.C: constify several variables + (BrowserLyX): rewrite to not need the choice variable + (Modify): rewrite to not need the choide variable + (compare_converter): make operator const + + * src/lyxrc.C (output): be a bit nicer og os usage, and try to + correct the writing of \set_color + (getDescription): return a const string + + * src/kbsequence.[Ch] (addkey): remove dead code + + * src/Painter.C (text): remove some commented code + +2000-11-15 Angus Leeming + + * src/ColorHandler.[Ch]: removed some header files from .h file. + Included LColor.h in .C file. + + * src/LColor.[Ch]: made class copyable so that I could create a + system_lcolor instance. + + * src/Painter.h: removed LColor.h. + + * src/lyx_gui.C (create_forms): used AddName. + + * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading + of user preferences/lyxrc file. + + * src/lyxrc.C (output): output changes to lcolor. + + * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct, + NamedColor. + Moved class xformColor to files xform_helpers.[Ch]. These files, + Color.[Ch], could now be moved into src if they would be useful to + other GUIs. + + * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here. + Also moved FormPreferences::browseFile here as it can be used by any + xform dialog with a "Browse" button. FormGraphics is a perfect example. + + * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile, + ReadableFile): changed the FormPreferences methods a little and moved + them here as they'll be useful elsewhere also. + + * src/frontends/xforms/FormPreferences.h: a bit more cleaning up. + Removed some header files and used forward declarations instead. + Better commenting. + Removed some methods as they'll be useful elsewhere (see above). + + * src/frontends/xforms/FormPreferences.C: a bit more cleaning up. + Can also now modify the LyX LColors. However, for reasons that I don't + yet understand, it appears that we can use + LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer + present. The problem appears to lie in ColorHandler, because I can + change the color using LColor.SetColor(). Similarly, when reading in a + preferences file with some set_color instances, I'll get a warning + like: Color sea green is undefined or may not be redefined + Bad lyxrc set_color for sea green + + Once the buffer is loaded, however, I can happily change to this color. + + Finally, it appears that I have to set the color of "inset frame" + explicitly, or it oscillates from "black" to "indian red" with each + successive "Apply". + +2000-11-15 Angus Leeming + + * ANNOUNCE: corrected a spelling mistake. + + * src/tabular.C (OldFormatRead): variable "h" was set but never used. + Removed. + +2000-11-15 Lars Gullik Bjønnes + + * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch. + + * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from + distdir. + + * src/support/lyxfunctional.h: make back_insert_fun_iterator(s) + match the requirements from the standard better. This is required + to work with gnu libstdc++-v3 + + * src/frontends/xforms/FormPreferences.C: add explict pair + arguments to browse calls. include support/lyxmanip.h remvoe + extern fmt. whitespace changes. reorder variables in + FormPreferences.h, to match initalizaton order. + + * several files: constify more local variables. + + * src/buffer.C: remove some commented functions. + + * src/DepTable.C (remove_files_with_extension): temporary + work around for gcc 2.97 + * src/filedlg.C (find): ditto + * src/Variables.C (set): ditto + * src/LyXAction.C (searchActionArg): ditto + (retrieveActionArg): ditto + + * configure.in: check for mktemp too + + * UPGRADING: prepare for 1.1.6 + + * Makefile.am (lgbtags): add backup tags for when etags are + different than usual. + + * ANNOUNCE: prepare for 1.1.6 + + * src/support/tempname.C (make_tempfile): new function, wrapper + around mkstemp and mktemp. Only mkstemp has been tested. + (tempName): call it. + +2000-11-14 Rob Lahaye + + * default.ui: capitalized some menu items to improve shortcuts. + +2000-11-14 Jean-Marc Lasgouttes + + * src/frontends/xforms/FormPreferences.C (ok): use AddName(). + + * src/frontends/xforms/Dialogs.C: add "using" directive. + +2000-11-13 Angus Leeming + + * src/filedlg.C (Select): highlight suggested file in browser, if + it is present. + + * src/frontends/xforms/FormPreferences.[Ch]: re-written so that + each tab folder is encapsulated in its own class. + The Language keymaps are now chosen using a text input and a + browser button, rather than a Combox. + All the browser buttons are now functional, although LyXFileDlg + still needs to be modified to make it straighhtforward to return a + directory if that is what is desired. + + * src/frontends/xforms/forms/form_preferences.fd: use text input + and browse button to input the Language keymaps. Add a few + callbacks for the browse buttons. + +2000-11-14 Lars Gullik Bjønnes + + * src/support/tempname.C (tempName): small changes to make it + safer. remove the '.' before XXXXXX + + * src/support/filetools.C (TmpFileName): remove func + (GetCWD): ditto + + * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp + * src/frontends/xforms/FormUrl.C (FormUrl): ditto + * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto + * src/frontends/xforms/FormTabular.C (FormTabular): ditto + + * src/frontends/xforms/FormInset.h (FormInset): remove default for bp + (FormCommand): ditto + + * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit + call the bp + + * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy + for bp (this fixes a reproducible hard crash) + + * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit + call the bp + + * src/frontends/xforms/FormBase.h: make bp_ private + (FormBaseBI): remove default for bp + (FormBaseBD): ditto + + * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it + is safe enough. + + * src/frontends/xforms/Color.C (RGBColor): made several vars + const, changed initialization of j to allow it to be const + (HSVColor): similar + + * several files: added const to local variables. + + * src/lyx_cb.C: removed several function prototypes and moved them + to lyx_cb.h + (MenuWrite): + (MenuWriteAs): + (UpdateLayoutPreamble): + (MenuLayoutSave): + (MenuInsertLabel): add BufferView as arguemnt + (LayoutsCB): make tmp const + + * src/layout_forms.h: regenerated + + * src/debug.C: add Debug::FILES + (showLevel) (showTags): translate the desc + + * src/debug.h: add FILES as debug target + + * src/bufferlist.C: use current_view as an interim measure becuase + of added arguments to MenuWrite and MenuWriteAs + + * forms/layout_forms.h.patch: make the patch more correct and more appalyable + + * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve + string. + (LYX_PROG_CXX): change 2.97 rules to include the -f.. that + libstdc++ is compiled with. + +2000-11-13 José Abílio Matos + + * lib/layouts/docbook-book.layout + * lib/layouts/docbook.layout + * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now + those paragraphs are expresse as SGML comments . + + * src/LaTeXFeatures.h + * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as + parameter, this allows to express all the include files as relative + paths to the master buffer. The verbatim insert works as the other + include file modes. + + * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname + is a SGML comment. + (MakeLinuxdocFile) (MakeDocBookFile): included files are relative + to master path. + (MakeDocBookFile): top_element is always written. Some clean up, as + sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case. + + * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix. + (DocBook) added close tag to inlinegraphics trick for verbatim. Now + a reference is written instead of the name. + (Validate): use the relative path for the filename. + + * src/insets/insetlabel.C (DocBook): write end tag, for XML + compatibility. + + * src/support/filetools.h + * src/support/filetools.C (IsSGMLFilename): added. + (BasePath): added. + +2000-11-13 Miyata Shigeru + + * development/OS2/quick_fix.patch: + * lib/configure.cmd: + * README.OS2: quick update to the OS/2 port. + +2000-11-13 Jean-Marc Lasgouttes + + * src/converter.C: add "using" directive. + + * src/frontends/xforms/FormPreferences.C: add "using" directive. + (compare_converter): add "int" as return type. + + * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here + too. + +2000-11-11 Angus Leeming + + * src/lyx_gui.C (create_forms): map the xform colours, should a + mapping exist. Ie, call XformColor::read(). + + * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor + and struct HSV as HSVColor. + (XformColor::read, XformColor::write) : new methods that + input/output any changes to the cform GUI colors. + + * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer + included. + + * src/frontends/xforms/FormPreferences.C Lots of little changes + associated with the changed name of the RGB and HSV structs. Can + now save changes to xforms GUI to file. Commented out + FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't + used currently anyway. + +2000-11-11 Dekel Tsur + + * src/converter.C: A lot of changes: + - It is no longer possible to choose between two or more ways to + export to some format (the new code uses only the shortest path). + However, it is still possible to choose between pdflatex/ps2pdf + for creating a PDF file, by defining two PDF formats: pdf & pdf2. + - Added several methods that makes the FormPreferences code simpler. + - Changed the tokens $$FName and $$OutName to $$i and $$o. + + * src/exporter.C (Export): lyxrc.use_pdf is set before + makeLaTeXFile is called. This works but not very nice. + + * src/frontends/xforms/FormPreferences.C: The formats/converters + tabs are now fully functional. + + * src/buffer.C (getTocList): Add numbers to the captions. + + * lib/lyxrc.example: Removed fax section + + * src/support/rename.C (rename): Delete the old file if lyx::copy + is called. + +2000-11-13 Rob Lahaye + + * lib/ui/default.ui: minor polishing. + +2000-11-10 Jean-Marc Lasgouttes + + * src/frontends/xforms/Color.C: include and + headers. + + * lib/Makefile.am (DOCINST): do not install everything in the + documentation directory. + +2000-11-10 John Levon + + * src/bufferlist.C (newFile): set the filename to the constructed + newfileXX.lyx + + * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the + constructed "newfileXX.lyx" name to the dialog + + * src/frontends/DialogBase.h: make update() non-abstract so + KDE doesn't need to implement two update methods for every form + + * src/frontends/kde/Makefile.am: add missing xforms objects + to compile again + + * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog + +2000-11-09 Angus Leeming + + * src/frontends/xforms/Color.[Ch]: new files, defining the color + structs RGB and HSV. May not be the best place for these files. + Perhaps move them into src ? + + * src/frontends/xforms/Makefile.am: added new files. + + * src/frontends/xforms/forms/form_preferences.fd: + * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and + replaced all instances of "colour" with "color"! + + * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab + slightly yet again. + + * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors + tab. Can now alter the colors of the xform's GUI on the fly. With + the aid of a single static Signal (see below), can "Apply" these + changes to all currently open dialogs. (Well, to all of the NEW + dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL + subsequently opened dialogs will, of course, also have the new + color scheme. Cannot yet save (or load) the choices to file, so + they are lost when exiting LyX. + + * src/frontends/Dialogs.h: + * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal. + Used to trigger a redraw of any dialogs connected to it because, + for example, the GUI colours have been re-mapped. + + * src/frontends/xforms/FormBase.[Ch]: + * src/frontends/xforms/FormDocument.[Ch]: + * src/frontends/xforms/FormParagraph.[Ch]: + * src/frontends/xforms/FormPreferences.[Ch]: + * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual + method, to be connected to Dialogs::redrawGUI. Method must be + virtual, because dialogs with tabbed folders need to redraw the + forms of each tab folder. + + * src/LyXView.C (d-tor): + * src/frontends/xforms/FormBase.C (d-tor): connected + Dialogs::redrawGUI signal to redraw(). + + * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD): + removed Assert, because it is identical to that in FormBase. + +2000-11-10 Rob Lahaye + + * lib/ui/default.ui: minor polishing. + +2000-11-10 Juergen Vigna + + * src/insets/insettext.C (resizeLyXText): check !cache[bv] + (deleteLyXText): ditto + + * src/insets/insettabular.C (InsetButtonPress): don't clear the + selection on mouse-button-3. + + * src/insets/insettabular.h: new function clearSelection(), use this + functions inside insettabular.C. + + * src/insets/insettabular.C (TabularFeatures): clear the selection + on remove_row/column. + + * src/insets/inset.C (scroll): fixed some scroll stuff. + + * src/insets/insettabular.C (draw): fixed another minor draw problem. + +2000-11-10 Jean-Marc Lasgouttes + + * lib/CREDITS: add Yves Bastide + +2000-11-03 Yves Bastide + + * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to + check whether C library functions are in the global namespace. + + * configure.in: calls it. + + * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of + #ifndef __GLIBCPP__. + +2000-11-08 Dekel Tsur + + * src/frontends/xforms/FormPreferences.C (updateLanguage): Check + iterators to prevent crash. + +2000-11-08 Angus Leeming + + * src/converter.h (getprettyname, getFromToPrettyname): new methods. + + * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro + shortcut for xforms CB to the preemptive or post-handler function. + + * src/frontends/xforms/forms/form_preferences.fd (form_preferences): + removed the HIDDEN_TIMER as it's no longer used. + Various other small changes. + + * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a + preemptive handler to obtain feedback, rather than the post-handler. + (ColoursLoadBrowser): find "black" and "white" based on RGB values + rather than name. + Formats tab is now complete. Converters tab is nearly so. + +2000-11-09 Juergen Vigna + + * src/insets/insettext.C (~InsetText): + (clear): + (Read): + (SetParagraphData): set cache.second to 0 after deleting it! + (getLyXText): check if cache.second is not 0 if finding it. + +2000-11-08 Jean-Marc Lasgouttes + + * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use + lyxlex to parse the rgb.txt file. + + * src/lyxlex.[Ch]: + * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to + replace the default '#' comment character. + + * src/support/tempname.C: add "using" directive + * src/frontends/ButtonPolicies.C: ditto. + + * src/support/filetools.C (DirList): add an explicit cast to avoid + a compile error (probably not the right fix) + +2000-11-08 Lars Gullik Bjønnes + + * src/support/filetools.C (DirList): implement using system functions + + * src/support/tempname.C: new file + + * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C + + * src/insets/insetexternal.C (InsetExternal): use lyx::tempName + + * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use + lyx::tempName + + * src/frontends/xforms/ButtonController.C: new file + + * src/os2_defines.h: remove getcwd define + + * src/lyxvc.C: include support/lyxlib.h + (showLog): use lyx::tempName + + * src/lyx_cb.C: comment out includes that we don't need + (AutoSave): use lyx::tempName + + * src/filedlg.C: include support/lyxlib.h + (Reread): use lyx::getcwd + + * src/converter.C: include support/filetools.h + (add_options): change to static inline, make tail const + (Add): make old_viewer const + (GetAllFormats): make it a const method, use const_iterator + (enable): make static inline + (SplitFormat): make using_format const + + * src/LaTeX.C (run): use lyx::getcwd + + * configure.in: check for mkstemp as well + +2000-11-07 Angus Leeming + + * src/converter.[Ch] (GetAllCommands): new method. + + * src/support/filetools.[Ch] (DirList): new method. + + * src/frontends/xforms/FormPreferences.C: started (just!) adding + functionality to the converters tab. + The formats tab is now nearly complete. + The kbmap choices in Languages tab now display the contents of + system_lyxdir/kbd/*.kmap in readable form. + + * src/frontends/xforms/FormPreferences.h: made struct RGB private. + Moved some variables into the class. + + * src/frontends/xforms/forms/form_preferences.fd: Revert colour of + inactive tab folder to FL_COL1. Haven't yet worked out how to change + colour of active folder to lighter grey instead. Any takers? + (form_colours): added an "Apply" button. + (form_converters): added a "Flags" input field. + (form_formats): added a "Shortcut" input field. Note that we can't use + names such as "input_shortcut" as this buggers up the sed script stuff. + +2000-11-07 Angus Leeming + + * src/LaTeXLog.C: + * src/LyXSendto.C: + * src/credits.C: + * src/filedlg.C: + * src/intl.C: + * src/lyx_cb.C: + * src/lyx_sendfax_main.C: + * src/lyxfr0.C: + * src/lyxvc.C: + * src/spellchecker.C: + * src/insets/figinset.C: + * src/insets/insetbib.C: + * src/insets/insetexternal.C: + * src/insets/insetinclude.C: + * src/insets/insetinfo.C: + * src/mathed/math_panel.C: + use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so + all "daughter" dialogs now have identical "feel". + +2000-11-07 Angus Leeming + + * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer + used (and was only used in one place prior to this patch. Incorrectly!) + + * src/frontends/xforms/FormDocument.C: changed some instances of + FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more + sense. Also added fl_set_input_return() for class_->input_doc_extra and + for options_->input_float_placement. This fixes a bug reported by + Rob Lahaye. + + * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed + functionality into d-tor. + + * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow + input of numerals also. + + * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in + fl_set_form_atclose(). Can now close dialog from window manager, + fixing a bug reported by Rob Lahaye. + +2000-11-06 Angus Leeming + + * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders + are no longer dark. Haven't yet worked out how to lighten the colour of + the active tabfolder. Any ideas anybody? + Adjusted Colours tab a little. + Added Shortcut field to converters tab. Note that we can't create an + fdesign label like "input_shortcut" as this buggers up the sed-script + stuff. + + * src/frontends/xforms/FormPreferences.[Ch]: + (feedback): fixed crash due to to ob=0. + (LanguagesXXX): the kbmap choices now contain the files + sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually + be replaced by an input with a file browse button, but since the browse + buttons don'y yet work, this'll do for the moment. + (FormatsXXX): think that this is now nearly fully functional. + Some points/questions though: + 1. Does "Apply" remove formats if no longer present? + 2. I think that the browser should list the GUI names rather than the + format names. + 3. Must ensure that we can't delete Formats used by an existing + Converter. + + * src/support/filetools.[Ch] (DirList): new function. Not at all sure + if this is the best way to do this. + +2000-11-07 Jean-Marc Lasgouttes + + * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message. + + * lib/configure.m4 (latex_to_html_command): avoid spaces around = + for variable assignment. + +2000-11-07 Rob Lahaye + + * src/lib/ui/default.ui: added sub/superscripts to menu as + Insert->Special characters and cleaned-up the file a bit + +2000-11-07 Allan Rae + + * src/frontends/xforms/FormPreferences.C (feedback): make sure + ob isn't 0 before using it. See comments in function. + + * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix. + + * src/frontends/xforms/form_*.C: regenerated + +2000-11-07 Lars Gullik Bjønnes + + * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty) + + * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when + compiling with gcc-2.96 + +2000-11-06 Jean-Marc Lasgouttes + + * src/support/lyxstring.C: add a couple "using" directives. + + * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add + a .c_str() here too for good measure. + * src/Spacing.C (set): ditto. + * src/lyxfunc.C (Dispatch): ditto. + + * src/insets/insettabular.C (copySelection): change .str() to + .str().c_str() to fix problems with lyxstring. + * src/support/filetools.C (GetFileContents): ditto. + * src/buffer.C (asciiParagraph): ditto. + * src/paragraph.C (String): ditto. + + * lib/bind/fi_menus.bind: change symbol-insert to math-insert. + * lib/bind/sciword.bind: ditto. + + * src/LyXAction.C (init): remove "symbol-insert" function, which + shared LFUN_INSERT_MATH with "math-insert". + + * lib/configure.m4: == is not a valid operator for command test. + + * src/lyxrc.C: add using directive. + + * src/converter.h: add std:: qualifier. + +2000-11-03 Dekel Tsur + + * src/converter.[Ch] and other files: Change the Format class to a + real class, and create two instances: formats and system_format. + + * src/lyxrc.C (output): Output the difference between formats and + system_formats. + + * src/frontends/xforms/FormPreferences.C (input): Simplify. + (buildFormats): Insert formats into browser. + (inputFormats): Made the browser and add button functional. + (applyFormats): Update formats from format_vec. + + * src/converter.C: Changed all (*it). to it-> + (Format::dummy): New method. + (Format::importer): New format flag. + (Formats::GetAllFormats): New method. + (Formats::Add): Delete format from the map if prettyname is empty. + (Converter::Convert): Print an error message if moving the file fails. + (Converter::GetReachableTo): New method + + * src/MenuBackend.[Ch]: Add support for importformats tag. + + * src/support/rename.C (rename): Call to lyx::copy if ::rename fails. + + * lib/configure.m4: Add word->tex and ps->fax converters. + + * lib/ui/default.ui: Use ImportFormats on file->import menu. + Return fax to file menu. + + * NEWS: Updated. + +2000-11-04 Lars Gullik Bjønnes + + * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB + (operator!): ditto + + * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify + the use of FileInfo + + * src/lyxfunc.C (processKeyEvent): removed + + * src/bufferlist.C (emergencyWrite): removed the out commented + emergency write code. + + * src/Makefile.am (lyx_main.o): add dep for commandtags.h + + * src/LyXView.[Ch]: remove the outcommented raw_callback code + + * many files: change formatting to be a bit more uniform for + if,while,for,switch statements, remove some parantesis not needed. + + +2000-11-03 John Levon + + * config/kde.m4: make config more robust when KDEDIR is set + +2000-11-03 Jean-Marc Lasgouttes + + * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has + not returned a pixmap for "math-insert". + + * src/LyXAction.C (init): sort the entries a bit. + +2000-11-03 Juergen Vigna + + * src/insets/insettabular.h: added fixed number to update codes so + that update is only in one direction. + + * src/insets/insettabular.C (UpdateLocal): modified a bit don't think + it matters. + + * src/insets/insettext.C (InsetButtonPress): set the_locking_inset + before call to edit because of redraw. + + * src/insets/insetcollapsable.C (draw): fixed clearing too much. + +2000-11-03 Jean-Marc Lasgouttes + + * lib/ui/default.ui: Populate "edit_float" menu + + * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE. + + * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name + "floats-operate". The name is ugly (and the func also), but this + is just a band-aid until we switch to new insets. + +2000-11-03 Rob Lahaye + + * lib/ui/default.ui: update again the menu layout (fix some + shortcuts). + +2000-11-03 Jean-Marc Lasgouttes + + * src/MenuBackend.h (fulllabel): new method. + + * src/MenuBackend.C (checkShortcuts): new method. Checks whether + the menu shortcuts of a menu are unique and whether they + correspond to a letter of the label. + (expand): call checkShortcuts when debugging. + +2000-11-03 Andre Poenitz + + * src/insets/insettext.C (InsetButtonPress): shut off warning. + +2000-11-02 Lior Silberman + + * lib/examples/*.lyx : '\language default' => '\language english' + + * lib/examples/it_splash.lyx : except where it should be italian + + * lib/templates/*.lyx : the same + + * doc/*.lyx* : the same + +2000-11-03 Jean-Marc Lasgouttes + + * lib/bind/menus.bind: remove the Layout menu entries, which I + somehow forgot earlier. + +2000-11-03 Rob Lahaye + + * lib/ui/old-default.ui: keep the old one here for reference (to + be deleted later). + + * lib/ui/default.ui: update the menu layout + +2000-11-02 Angus Leeming + + * src/frontends/xforms/FormCitation.C: made use of ButtonController. + Can now Apply to different insets without closing the dialog. + + * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs. + Can't actually DO anything with them yet, but I'd like a little + feedback. + + * src/frontends/xforms/input_validators.[ch] + (fl_lowercase_filter): new. + +2000-10-27 Dekel Tsur + + * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead + of MATH_CODE. This fixes a bug with math-macros in RTL text. + + * src/text.C (PrepareToPrint): Show math-macros block aligned. + +2000-11-02 Juergen Vigna + + * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE + on char insertion as it has already be updated by bv->updateInset(). + + * src/insets/insettabular.C (UpdateInsetInInset): update the inset + if an inset inside was updated. + + * lib/configure.cmd: commented out fax-search code + +2000-11-01 Yves Bastide + + * src/tabular.C (OldFormatRead): set tabular language to the + document's one. + +2000-11-02 Jean-Marc Lasgouttes + + * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of + class names with non-letter characters (from Yves Bastide). + + * lib/ui/default.ui: change Item to OptItem in import menu. + Comment out fax stuff. + + * lib/configure.m4: comment out fax-related stuff. + +2000-10-31 Angus Leeming + + * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for + useful xforms helper functions. At present contains only formatted(). + Input a string and it returns it with line breaks so that in fits + inside the label. + + * src/frontends/xforms/Makefile.am: add new files. + + * src/lyxrc.[Ch] (getDescription): new name for getFeedback. + * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected + punctuation. + + * src/frontends/xforms/FormPreferences.[Ch]: + * src/frontends/xforms/forms/form_preferences.fd: No new functionality + but lots of little clean ups. Removed enum State. Make use of + formatted(). Constify lots of methods. Perhaps best of all: removed + requirement for that horrible reinterpret_cast from pointer to long in + feedbackPost(). + +2000-11-02 Lars Gullik Bjønnes + + * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION, + conditionalize build on xforms < 0.89 + + * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89 + + * src/lyxfunc.C (getStatus): commenout LFUN_FAX + + * src/LyXAction.C (init): comment out fax + + * src/lyxrc.h: comment out the fax enums + comment out the fax variables + + * src/commandtags.h: comment out LFUN_FAX + + * src/lyxrc.C: disable fax variables. + (read): disable parsing of fax variables + (output): disable writing of fax variables + (getFeedback): now description for fax variables + + * src/lyxfunc.C: comment out MenuFax + (Dispatch): disable LFUN_FAX + + * src/lyx_cb.C (MenuFax): comment out + + * src/WorkArea.C: add + (work_area_handler): better key handling, should be ok now. + for accented chars + etc + + * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C + lyx_sendfax.h and lyx_sendfax_man.C + + * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89 + (show): don't call InitLyXLookup when using xforms 0.89 + +2000-11-01 Lars Gullik Bjønnes + + * src/trans.C (AddDeadkey): better fix, the other one could crash... + + * src/support/filetools.C (GetFileContents): close to dummy change + +2000-10-31 Lars Gullik Bjønnes + + * src/trans.C (AddDeadkey): workaround stupid compilers. + +2000-10-31 Jean-Marc Lasgouttes + + * src/frontends/xforms/FormDocument.C (class_update): fix setting + of two-sided document. + +2000-10-31 Juergen Vigna + + * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines. + + * src/insets/insettabular.C (ActivateCellInset): passed the wrong + xposition to the Edit call. + +2000-10-31 Lars Gullik Bjønnes + + * src/trans.C (AddDeadkey): cast explicitly to char. + +2000-10-30 Lars Gullik Bjønnes + + * src/tabular.C (AsciiBottomHLine): simplify? + (AsciiTopHLine): simplify? + (print_n_chars): simplify + (DocBook): remove most of the << endl; we should flush the stream + as seldom as possible. + (Latex): ditto + (TeXBottomHLine): ditto + (TeXTopHLine): ditto + (Write): formatting + (write_attribute): try a templified version. + (set_row_column_number_info): lesson scope of variables + + * src/support/lstrings.h (tostr): new specialization of tostr + + * src/trans.C (AddDeadkey): slightly cleaner fix. + +2000-10-28 Dekel Tsur + + * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by + '%%' in Toc menu labels. + (add_toc2): ditto + + * src/insets/insetlatexaccent.C (draw): Correct rendering when + font_norm is iso10646-1. + + * src/font.C (ascent): Fixed for 16bit fonts + (descent,lbearing,rbearing): ditto + +2000-10-30 Angus Leeming + + * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file. + (getFeedback): new static method. + + * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs. + Now use combox rather than choice to display languages. + Feedback is now output using a new timer callback mechanism, identical + to that in Toolbar_pimpl. Individual messages obtained from lyxrc. + +2000-10-30 Jean-Marc Lasgouttes + + * src/minibuffer.C: fix for older compilers + +2000-10-30 Juergen Vigna + + * src/insets/insettext.C (InsertInset): fixed this as the cursor + has to be Left of the inset otherwise LyXText won't find it! + + * src/BufferView2.C (open_new_inset): delete the inset if it can + not be inserted. + +2000-10-30 Rob Lahaye + + * lyx.man: fix typo. + +2000-10-29 Marko Vendelin + * src/frontends/gnome/FormCitation.C + * src/frontends/gnome/FormCitation.h + * src/frontends/gnome/FormCopyright.C + * src/frontends/gnome/FormCopyright.h + * src/frontends/gnome/FormError.C + * src/frontends/gnome/FormError.h + * src/frontends/gnome/FormIndex.C + * src/frontends/gnome/FormIndex.h + * src/frontends/gnome/FormPrint.C + * src/frontends/gnome/FormPrint.h + * src/frontends/gnome/FormRef.C + * src/frontends/gnome/FormRef.h + * src/frontends/gnome/FormToc.C + * src/frontends/gnome/FormToc.h + * src/frontends/gnome/FormUrl.C + * src/frontends/gnome/FormUrl.h + * src/frontends/gnome/Menubar_pimpl.C + * src/frontends/gnome/mainapp.C + * src/frontends/gnome/mainapp.h + * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and + changing update() to updateSlot() where appropriate + +2000-10-27 Angus Leeming + + * src/frontends/xforms/FormPreferences.[Ch]: + * src/frontends/xforms/forms/form_preferences.fd: added a Languagues + tab. + +2000-10-28 Juergen Vigna + + * src/insets/insettabular.C (draw): fixed drawing bug. + + * src/insets/insettext.C (clear): + (Read): + (SetParagraphData): clearing the TEXT buffers when deleting the + paragraphs used by it. + + * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem. + + * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array. + +2000-10-27 Juergen Vigna + + * src/tabular.C (~LyXTabular): removed not needed anymore. + + * src/tabular.h: changed rowofcell and columnofcell to vector + (from Andre). + +2000-10-27 Angus Leeming + + * src/frontends/Dialogs.h: remove hideTabular signal as it is no + longer used. + + * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min + size. + + * src/frontends/xforms/FormPreferences.[Ch]: + * src/frontends/xforms/forms/form_preferences.fd: lots and lots! + Reorganised as modules based on tabs. Much easier to follow the + flow and to add new tabs. Added warning and feedback messages. + Added new tabs. + +2000-10-27 Jean-Marc Lasgouttes + + * src/tabular.h (DocBook): add std:: qualifier. + +2000-10-26 José Abílio Matos + + * src/buffer.h (SimpleDocBookOnePar): becomes public and const. + * src/buffer.C (SimpleDocBookOnePar): this method goes const. + + * insettabular.h + * insettabular.C (DocBook): uses the tabular methods to export + docbook + + * src/insets/insettext.h + * src/insets/insettext.C (DocBook): Implemented export for docbooc. + +2000-10-26 Lars Gullik Bjønnes + + * src/frontends/ButtonPolicies.h (operator<<): reinsert for State + and SMInput + + * src/lyxfunc.C (MenuNew): lessen the scope of fname + moved misplaced AllowInput two lines up. + + * src/buffer.C (readFile): compare float with float, not with int + +2000-10-26 Jean-Marc Lasgouttes + + * src/minibuffer.C: add "using SigC::slot" statement. + +2000-10-25 Angus Leeming + + * src/frontends/xforms/forms/README: updated section about make. + + * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts. + Tidied some forms up, made two of form_tabular's tabs more + self-consistent, fixed Jean-Marc's size problem in form_preferences, + fixed translation problem with "Column". + +2000-10-25 Lars Gullik Bjønnes + + * src/minibuffer.h: use Timeout instead of the xforms timer + object. + (setTimer) rewrite for the Timeout, change to unsigned arg + (set): change to unsigned timer arg + (TimerCB): remove + + * src/minibuffer.C (TimerCB): removed func + (C_MiniBuffer_TimerCB): removed func + (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB + (peek_event): use a switch statement + (add): don't use fl_add_timer. + (Set): rewrite to use the Timeout + (Init): ditto + + * src/Timeout.[Ch] (setType): return a Timeout & + (setTimeout): ditto, change to unsigned arg for timeout + +2000-10-25 Dekel Tsur + + * src/mathed/formula.C (mathed_string_width): Use string instead + of a constant size char array. + +2000-10-25 Lars Gullik Bjønnes + + * src/frontends/ButtonPolicies.h: remove the LOstream and remove + the two recently added operator<< for SMInput and State. + + * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast + SMI_TOTAL to int. + (OkCancelPolicy): ditto + (OkCancelReadOnlyPolicy): ditto + (NoRepeatedApplyReadOnlyPolicy): ditto + (OkApplyCancelReadOnlyPolicy): ditto + (OkApplyCancelPolicy): ditto + (NoRepeatedApplyPolicy): ditto + +2000-10-25 Jean-Marc Lasgouttes + + * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and + add the usual std:: qualifiers. + +2000-10-25 Juergen Vigna + + * src/screen.C (ShowManualCursor): fixed another uint -> int problem. + +2000-10-25 Lars Gullik Bjønnes + + * src/support/filetools.C (MakeRelPath): change some types to + string::size_type + + * src/frontends/ButtonPolicies.h (operator<<): new operator for + ButtonPolicy::SMInput and ButtonPolicy::State. + + * src/FontLoader.C (reset): small cleanup + (unload): small cleanup + + * src/FontInfo.C (getFontname): initialize error to 10000.0 + +2000-10-24 Angus Leeming + + * src/frontends/xforms/FormPreferences.[Ch]: + * src/frontends/xforms/forms/form_preferences.fd: added spell checker, + TeX encoding and default paper size sections. + +2000-10-24 Lars Gullik Bjønnes + + * src/frontends/xforms/FormTabularCreate.C: add missing #pragma + implementation + + * src/frontends/xforms/FormError.C (disconnect): use erase() to + make the message_ empty. + (FormError): don't initialize message_ in initializer list. + +2000-10-24 Angus Leeming + + * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot. + +2000-10-24 Jean-Marc Lasgouttes + + * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi) + +2000-10-24 John Levon + + * src/frontends/kde/*data.[Ch]: _("") is not + allowed + +2000-10-24 Angus Leeming + + * src/buffer.C: removed redundant using directive. + + * src/frontends/DialogBase.h: revert to original definition of + update(). + + * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular + stuff into two classes, one for each dialog, requires a new + element in the dialogs vector, FormTabularCreate. + + * src/frontends/xforms/FormXXX.[Ch] (update): revert to original + definition. + + * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new + method. Continues Allan's idea, but means that derived classes + don't need to worry about "update or hide?". + + * src/frontends/xforms/FormError.C (showInset): add connection + again ;-) + + * src/frontends/xforms/FormTabular.[Ch]: split into two classes, + one for each dialog. FormTabular now contains main tabular dialog + only. + + * src/frontends/xforms/FormTabularCreate.[Ch]: + * src/frontends/xforms/forms/form_tabular_create.fd: the create + dialog. + + * src/frontends/xforms/FormGraphics.[Ch]: + * src/frontends/xforms/forms/form_graphics.fd + * src/frontends/xforms/FormTabular.[Ch]: + * src/frontends/xforms/forms/form_tabular.fd: made daughter + classes of FormInset. + + * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create + class names properly. Eg, form_my_new_dialog -> FormMyNewDialog. + + * src/frontends/xforms/Makefile.am: + * src/frontends/xforms/forms/makefile: added new files. + + * src/insets/insettabular.[Ch]: removed (Dialogs *) member + variable. added Signal0 hide signal, in keeping with other GUI-I + insets. + + * src/support/lstrings.h: removed redundant std:: qualifier as + it's already declared in Lsstream.h. + +2000-10-23 Jean-Marc Lasgouttes + + * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to + open a new display. + (runqueue): ditto. + +2000-10-24 Lars Gullik Bjønnes + + * src/tabular.C (Ascii): minimize scope of cell. + + * src/BufferView2.C (nextWord): return string() instead of 0; + +2000-10-23 Jean-Marc Lasgouttes + + * src/converter.h: add a std:: qualifier + +2000-10-21 Dekel Tsur + + * src/importer.[Ch]: New files. Used for importing files into LyX. + + * src/lyxfunc.C (doImport): Use the new Importer class. + + * src/converter.h: Add shortcut member to the Format class. + Used for holding the menu shortcut. + + * src/converter.C and other files: Made a distinction between + format name and format extension. New formats can be defined using + the \format lyxrc tag. + Added two new converter flags: latex and disable. + +2000-10-20 Jean-Marc Lasgouttes + + * src/support/lyxlib.h: unify namespace/struct implementation. + Remove extra declarations. + + * src/support/chdir.C (chdir): remove version taking char const * + argument. + * src/support/rename.C: ditto. + * src/support/lyxsum.C: ditto. + +2000-10-19 Angus Leeming + + * src/frontends/xforms/FormBase.[Ch]: + * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter: + read the xforms manual to discover that fl_set_form_minsize()/maxsize() + work only for the next call to fl_show_form(). The correct place to set + them, therefore is in connect() immediately BEFORE fl_show_form(). Now + done. FormBase also stores minw_, minh_ itself. All dialogs derived + from FormBase have the minimum size set; no more stupid crashes with + tabbed folders etc. + +2000-10-20 Jean-Marc Lasgouttes + + * lib/ui/default.ui: fix shortcut for Insert->Include File. + +2000-10-19 Jean-Marc Lasgouttes + + * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch + + * src/support/lyxlib.h: changed second argument of mkdir to + unsigned long int (unsigned int would probably have been enough, + but...). Removed header. + * src/support/mkdir.C (mkdir): ditto. + + * NEWS: update. + +2000-10-19 Juergen Vigna + + * src/lyxfunc.C (MenuNew): small fix (form John) + + * src/screen.C (Update): removed unneeded code. + + * src/tabular.C (Ascii): refixed int != uint bug! + + * src/support/lyxlib.h: added sys/types.h include for now permits + compiling, but I don't like this! + +2000-10-18 Juergen Vigna + + * src/text2.C (ClearSelection): if we clear the selection we need + more refresh so set the status apropriately + + * src/insets/insettext.C (draw): hopefully finally fixed draw + problems! + +2000-10-12 Juergen Vigna + + * src/insets/insettext.C (draw): another small fix and make a block + so that variables are localized. + +2000-10-18 Angus Leeming + + * src/support/lstrings.C (lowercase, uppercase): + use explicit casts to remove compiler warnings. + + * src/support/LRegex.C (Impl): + * src/support/StrPool.C (add): + * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath) + (AddPath, MakeDisplayPath): + * src/support/lstrings.C (prefixIs, subst): + use correct type to remove compiler warnings. + + * src/support/lstrings.[Ch] (countChar): returns string::size_type. + + * src/support/lyxlib.h: + * src/support/mkdir.C (mkdir): change parameter to mode_t for + portability and to remove compiler warning with DEC cxx. + + * src/support/FileInfo.[Ch] (flagRWX): ditto. + +2000-10-18 Jean-Marc Lasgouttes + + * src/minibuffer.C (peek_event): retun 1 when there has been a + mouseclick in the minibuffer. + + * NEWS: updated. + +2000-10-17 John Levon + + * src/frontends/xforms/FormParagraph.C: more space above/below + fixes + +2000-10-17 Dekel Tsur + + * src/lyxfunc.C (Dispatch): Call to showState() after insertion of + a char only if real_current_font was changed. + +2000-10-17 Jean-Marc Lasgouttes + + * NEWS: update somewhat for 1.1.6 + + * lib/ui/default.ui: clean up. + +2000-10-17 Angus Leeming + + * lib/CREDITS: clean up + +2000-10-16 Angus Leeming + + * src/combox.[Ch] (select): changed argument back to int + * src/combox.C (peek_event): removed num_bytes as it is declared but + never referenced. + + * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply): + modified calls to Combox::select() to remove warnings about type + conversion. + + * src/insets/insetbutton.C (width): explicit cast to remove warning + about type conversion. + + * src/insets/insetcite.C (getScreenLabel): use string::size_type not + size_t. + + * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and + sel_pos_end, refering to cursor position are changed to + LyXParagraph::size_type. + + * src/insets/insettext.h (cpos): returns LyXParagraph::size_type, + consistent with LyXCursor::pos(). + (inset_pos): changed to LyXParagraph::size_type for same reason. + + * src/insets/insettext.C (resizeLyXText): changed some temporary + variables refing to cursor position to LyXParagraph::size_type. + +2000-10-16 John Levon + + * src/frontends/kde/: The Great Renaming, + add FormParagraph + +2000-10-17 Jean-Marc Lasgouttes + + * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix. + +2000-10-16 Jean-Marc Lasgouttes + + * src/mathed/math_macro.C (MathMacroTemplate): initialize args to + 0 when there are no arguments. + +2000-10-16 Angus Leeming + + * src/insets/insetbib.C: re-introduce current_view as a temporary fix + to segfaults when pressing Ok in InsetBibtex dialog. + +2000-10-16 Angus Leeming + + * forms/layout_forms.fd: + * src/layout_forms.C (create_form_form_character): small change to use + labelframe rather than engraved frame + text + + * src/lyx_gui.C (create_forms): initialise choice_language with some + arbitrary value to prevent segfault when dialog is shown. + +2000-10-16 Baruch Even + + * src/converter.C (runLaTeX, scanLog): Added a warning when there + is no resulting file. This pertains only to LaTeX output. + +2000-10-14 Dekel Tsur + + * src/text.C (Backspace): Make sure that the row of the cursor is + rebreaked. + + * src/lyxfunc.C (Dispatch): Call to showState() after insertion of + a char. + + * src/lyx_gui.C (init): Prevent a crash when only one font from + menu/popup fonts is not found. + + * lib/lyxrc.example: Add an example for binding a key for language + switching. + +2000-10-15 Dekel Tsur + + * src/converter.C (GetReachable): Changed the returned type to + vector + (IsReachable): New method + + * src/MenuBackend.C (expand): Handle formats that appear more + than once + +2000-10-16 Jean-Marc Lasgouttes + + * src/frontends/support/Makefile.am + (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and + not in SOURCES. + + * lib/CREDITS: add Garst Reese. + + * src/support/snprintf.h: add extern "C" {} around the definitions. + + * src/cheaders/cstdarg: new header file, taken from GNU libstdc++. + +2000-10-13 Angus Leeming + + * src/combox.[Ch]: + * src/frontends/xforms/FormDocument.C: + * src/frontends/xforms/Menubar_pimpl.C: small changes so that they + compile without "conversion to integral type of smaller size" + warnings. + +2000-10-13 Dekel Tsur + + * src/text.C (GetColumnNearX): Fixed disabled code. + +2000-10-13 Lars Gullik Bjønnes + + * configure.in (CPPFLAGS): add snprintf and vsnprintf to + AC_CHECK_FUNCS + + * src/support/snprintf.[ch]: new files + +2000-10-13 John Levon + + * src/frontends/kde/formprintdialog.C: add + file browser for selecting postscript output + + * src/frontends/kde/formprintdialogdata.C: + * src/frontends/kde/formprintdialogdata.h: re-generate + correctly + +2000-10-13 John Levon + + * src/frontends/gnome/Makefile.am: + * src/frontends/kde/Makefile.am: FormCommand.C + disappeared from xforms + + * src/frontends/kde/FormCitation.C: + * src/frontends/kde/FormIndex.C: read-only + correctness + +2000-10-13 Jean-Marc Lasgouttes + + * src/support/lyxfunctional.h (void_class_fun_t): fix name of + constructor. + + * src/bufferlist.C: add using directive. + +2000-10-13 Lars Gullik Bjønnes + + * src/support/lyxfunctional.h: version of class_fun for void + returns added, const versions of back_inseter_fun and compare_fun + added. + +2000-10-13 Angus Leeming + + * src/frontends/xforms/FormInset.C (showInset): fix typo. + +2000-10-13 Jean-Marc Lasgouttes + + * ChangeLog: cleanup. + + * lib/CREDITS: update to add all the contributors we've forgotten. + I have obviously missed some, so tell me whether there were + errors. + +2000-10-13 Marko Vendelin + + * src/frontends/gnome/FormCitation.C + * src/frontends/gnome/FormCitation.h + * src/frontends/gnome/FormError.C + * src/frontends/gnome/FormIndex.C + * src/frontends/gnome/FormRef.C + * src/frontends/gnome/FormRef.h + * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal + + * src/frontends/gnome/FormCitation.C + * src/frontends/gnome/FormCopyright.C + * src/frontends/gnome/FormError.C + * src/frontends/gnome/FormIndex.C + * src/frontends/gnome/FormRef.C + * src/frontends/gnome/FormToc.C + * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where + appropriate. + + * src/frontends/gnome/Menubar_pimpl.C + * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to + fill the menus. + +2000-10-11 Baruch Even + + * src/minibuffer.h: + * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand + to convey its real action. + + * src/minibuffer.C (peek_event): Added action when mouse clicks to + clear the minibuffer and prepare to enter a command. + + * src/mathed/formula.C (LocalDispatch): Changed to conform with + the rename from ExecCommand to PrepareForCommand. + * src/lyxfunc.C (Dispatch): ditto. + +2000-10-11 Baruch Even + + * src/buffer.C (writeFile): Added test for errors on writing, this + catches all errors and not only file system full errors as intended. + +2000-10-13 Dekel Tsur + + * src/lyx_gui.C (create_forms): better fix for crash with + translated interface. + +2000-10-12 John Levon + + * src/frontends/kde/Makefile.am: + * src/frontends/kde/FormCopyright.C: + * src/frontends/kde/formcopyrightdialog.C: + * src/frontends/kde/formcopyrightdialog.h: + * src/frontends/kde/formcopyrightdialogdata.C: + * src/frontends/kde/formcopyrightdialogdata.h: + * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: + * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert + copyright to use qtarch + +2000-10-12 Dekel Tsur + + * src/encoding.C (read): Fixed bug that caused an error message at + the end of the file. + + * po/Makefile.in.in: Fixed rule for ext_l10n.h + + * lib/lyxrc.example: Fixed hebrew example. + +2000-10-13 Allan Rae + + * src/frontends/xforms/FormPreferences.C (input): reworking the + checking + (build, update, apply): New inputs in various tabfolders + + * src/frontends/xforms/FormToc.C: use new button policy. + * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for + dialogs that either can't use any existing policy or where it just + doesn't care. + + * src/frontends/xforms/FormTabular.h: removed copyright notice that + said it was mine. + + * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs): + added a bool parameter which is ignored. + + * src/buffer.C (setReadonly): + * src/BufferView_pimpl.C (buffer): + * src/frontends/kde/FormCopyright.h (update): + * src/frontends/kde/FormCitation.[Ch] (update): + * src/frontends/kde/FormIndex.[Ch] (update): + * src/frontends/kde/FormPrint.[Ch] (update): + * src/frontends/kde/FormRef.[Ch] (update): + * src/frontends/kde/FormToc.[Ch] (update): + * src/frontends/kde/FormUrl.[Ch] (update): + * src/frontends/gnome/FormCopyright.h (update): + * src/frontends/gnome/FormCitation.[Ch] (update): + * src/frontends/gnome/FormError.[Ch] (update): + * src/frontends/gnome/FormIndex.[Ch] (update): + * src/frontends/gnome/FormPrint.[Ch] (update): + * src/frontends/gnome/FormRef.h (update): + * src/frontends/gnome/FormToc.[Ch] (update): + * src/frontends/gnome/FormUrl.[Ch] (update): + * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes + to updateBufferDependent and DialogBase + + * src/frontends/xforms/FormCitation.[hC]: + * src/frontends/xforms/FormDocument.[hC]: also removed restore() + * src/frontends/xforms/FormError.[Ch]: + * src/frontends/xforms/FormGraphics.[Ch]: + * src/frontends/xforms/FormIndex.[Ch]: + * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s + and fixed readOnly handling. + * src/frontends/xforms/FormPrint.[Ch]: + * src/frontends/xforms/FormRef.[Ch]: + * src/frontends/xforms/FormTabular.[Ch]: + * src/frontends/xforms/FormToc.[Ch]: + * src/frontends/xforms/FormUrl.[Ch]: + * src/frontends/xforms/FormInset.[Ch]: + * src/frontends/xforms/FormBase.[hC]: modifications to use the new + form of updateBufferDependent. + + * src/frontends/xforms/FormBase.C (hide): only call disconnect() + if form()->visible just in case someone does stuff to the form in a + derived class. + + * src/frontends/DialogBase.h (enum): removed enum since we can now use + the buttoncontroller for everything the enum used to be used for. + (update) It would seem we need to force all dialogs to use a bool + parameter or have two update functions. I chose to go with one. + I did try removing update() from here and FormBase and defining the + appropriate update signatures in FormBaseB[DI] but then ran into the + problem of the update() call in FormBase::show(). Whatever I did + to get around that would require another function and that just + got more confusing. Hence the decision to make everyone have an + update(bool). An alternative might have been to override show() in + FormBaseB[DI] and that would allow the different and appropriate + update signatures. + + * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool. + true == buffer change occurred. I decided against using a default + template parameter since not all compilers support that at present. + +2000-10-11 Angus Leeming + + * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss + army knife" by removing functionality. + (clearStore): removed. All such housekeeping on hide()ing the dialog + is to be carried out by overloaded disconnect() methods. + (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but + superceded by Baruch's neat test (FormGraphics) to update an existing + dialog if a new signal is recieved rather than block all new signals + until it is closed. + (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant + only to Inset dialogs. + (FormBaseBI, FormBaseBD): new classes derived from FormBase for + "Buffer Independent" and "Buffer Dependent" dialogs respectively. + + * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch] + + * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined + as a base class to all inset dialogs. Used solely to connect/disconnect + the Inset::hide signal and to define what action to take on receipt of + a UpdateBufferDependent signal. + (FormCommand): now derived from FormInset. + + * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as + disconnect(). + + * src/frontends/xforms/FormCopyright.[Ch]: + * src/frontends/xforms/FormPreferences.[Ch]: + now derived from FormBaseBI. + + * src/frontends/xforms/FormDocument.[Ch]: + * src/frontends/xforms/FormParagraph.[Ch]: + * src/frontends/xforms/FormPrint.[Ch]: + now derived from FormBaseBD. + + * src/frontends/xforms/FormError.[Ch]: now derived from FormInset. + + * src/frontends/xforms/FormCitation.[Ch]: + * src/frontends/xforms/FormError.[Ch]: + * src/frontends/xforms/FormRef.[Ch]: + * src/frontends/xforms/FormToc.[Ch]: + (clearStore): reworked as disconnect(). + + * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding + FormInset.[Ch]. + +2000-10-12 Jean-Marc Lasgouttes + + * src/converter.C (runLaTeX): constify buffer argument + (scanLog): ditto. + + * src/frontends/support/Makefile.am (INCLUDES): fix. + + * src/buffer.h: add std:: qualifier + * src/insets/figinset.C (addpidwait): ditto + * src/MenuBackend.C: ditto + * src/buffer.C: ditto + * src/bufferlist.C: ditto + * src/layout.C: ditto + * src/lyxfunc.C: ditto + +2000-10-11 Jean-Marc Lasgouttes + + * src/lyxtext.h (bidi_level): change return type to + LyXParagraph::size_type. + + * src/lyxparagraph.h: change size_type to + TextContainer::difference_type. This should really be + TextContainer::size_type, but we need currently to support signed + values. + +2000-10-11 Marko Vendelin + * src/frontends/gnome/FormError.h + * src/frontends/gnome/FormRef.C + * src/frontends/gnome/FormRef.h + * src/frontends/gnome/FormError.C + * src/frontends/gnome/Makefile.am + * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported + to Gnome frontend. Both dialogs use "action" area. + +2000-10-12 Baruch Even + + * src/graphics/GraphicsCacheItem_pimpl.C: + * src/graphics/Renderer.C: + * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts. + It now compiles. + +2000-10-12 Juergen Vigna + + * src/insets/insettext.C (draw): fixed drawing bug (specifically + visible when selecting). + + * development/Code_rules/Rules: fixed some typos. + +2000-10-09 Baruch Even + + * src/filedlg.C (GroupCache::find): de-inlined the function, makes + compiling on egcs 1.1.2 possible. + + * src/filedlg.C (comp_direntry::operator() ): ditto. + +2000-08-31 Baruch Even + + * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the + Buffer parameter. + + * src/frontends/xforms/FormGraphics.C: Changed the dialog to be + transient it now only gets freed when the object is destructed. + +2000-08-24 Baruch Even + + * src/frontends/FormGraphics.h: + * src/frontends/FormGraphics.C: Changed to use ButtonController and + ButtonPolicies. + +2000-08-20 Baruch Even + + * src/insets/insetgraphics.C: + (draw): Added messages to the drawn rectangle to report status. + (updateInset): Disabled the use of the inline graphics, + (draw): ditto. + +2000-08-17 Baruch Even + + * src/frontends/support: Directory added for the support of GUII LyX. + + * src/frontends/support/LyXImage.h: + * src/frontends/support/LyXImage.C: Base class for GUII holding of + images. + + * src/frontends/support/LyXImage_X.h: + * src/frontends/support/LyXImage_X.C: Implementation of the Xlib + version of LyXImage, this uses the Xlib Pixmap. + + * src/PainterBase.h: + * src/PainterBase.C: + * src/Painter.h: + * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII + replacement to Pixmap. + + * src/insets/insetgraphics.h: + * src/insets/insetgraphics.C: + * src/graphics/GraphicsCacheItem.h: + * src/graphics/GraphicsCacheItem.C: + * src/graphics/GraphicsCacheItem_pimpl.h: + * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage + instead of Pixmap. + + * src/graphics/GraphicsCacheItem.h: + * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create + another copy of the object. + + * src/insets/insetgraphics.C (Clone): Changed to create a second copy + of cacheHandle, this fixed a bug that sent LyX crashing. + + * src/graphics/XPM_Renderer.h: + * src/graphics/XPM_Renderer.C: + * src/graphics/EPS_Renderer.h: + * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF. + +2000-10-12 Lars Gullik Bjønnes + + * src/lyxfunc.C (processKeySym): only handle the + lockinginset/inset stuff if we have a buffer and text loaded... + + * lib/Makefile.am (EXTRA_DIST): add encodings and languages + +2000-10-12 Lars Gullik Bjønnes + + * src/support/lyxfunctional.h: add operator= that takes a reference + + * src/lyxserver.C (mkfifo): make first arg const + + * src/layout.h: renamed name(...) to setName(...) to work around + bugs in egcs. + + * src/buffer.C (setFileName): had to change name of function to + work around bugs in egcs. (renamed from fileName) + +2000-10-11 Lars Gullik Bjønnes + + * src/support/translator.h: move helper template classes to + lyxfunctional.h, include "support/lyxfunctional.h" + + * src/support/lyxmanip.h: add delaration of fmt + + * src/support/lyxfunctional.h: new file + (class_fun_t): new template class + (class_fun): helper template function + (back_insert_fun_iterator): new template class + (back_inserter_fun): helper template function + (compare_memfun_t): new template class + (compare_memfun): helper template function + (equal_1st_in_pair): moved here from translator + (equal_2nd_in_pair): moved here from translator + + * src/support/fmt.C: new file + (fmt): new func, can be used for a printf substitute when still + using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl; + + * src/support/StrPool.C: add some comments + + * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and + lyxfunctional.h + + * src/insets/figinset.C (addpidwait): use std::copy with + ostream_iterator to fill the pidwaitlist + + * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay + + * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove + c_str() + + * src/frontends/xforms/Menubar_pimpl.C: make several file scope + variables static + + * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi + + * src/frontends/xforms/FormDocument.C (build): remove c_str() + (class_update): ditto + (BulletPanel): ditto + (CheckChoiceClass): move initialization of tc and tct + + * src/tabular.C: remove current_view + (OldFormatRead): similar to right below [istream::ignore] + + * src/lyxlex_pimpl.C (next): add code for faster skipping of + chars, unfortunately this is buggy on gcc 2.95.2, so currently + unused [istream::ignore] + + * src/lyxfunc.C: include "support/lyxfunctional.h" + (getInsetByCode): use std::find_if and compare_memfun + + * src/lyxfont.C (stateText): remove c_str() + + * src/lyx_main.C (setDebuggingLevel): make static + (commandLineHelp): make static + + * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get + Screen* together with fl_get_display() and fl_screen + + * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen* + togheter with fl_get_display() and fl_screen + (create_forms): remove c_str() + + * src/layout.C: include "support/lyxfunctional.h" + (hasLayout): use std::find_if and compare_memfun + (GetLayout): use std::find_if and comapre_memfun + (delete_layout): use std::remove_if and compare_memfun + (NumberOfClass): use std:.find_if and compare_memfun + + * src/gettext.h: change for the new functions + + * src/gettext.C: new file, make _(char const * str) and _(string + const & str) real functions. + + * src/font.C (width): rewrite slightly to avoid one extra variable + + * src/debug.C: initialize Debug::ANY here + + * src/commandtags.h: update number comments + + * src/combox.h (get): make const func + (empty): make const + (getline): make const + + * src/combox.C (input_cb): handle case where fl_get_input can + return NULL + + * src/bufferlist.C: add , "support/lyxmanip.h", + "support/lyxfunctional.h", remove current_view variable. + (resize): use std::for_each with std::mem_fun + (getFileNames): use std::copy with back_inserter_fun + (getBuffer): change arg type to unsigned int + (emergencyWriteAll): call emergencyWrite with std::for_each and + class_fun. + (emergencyWrite): new method, the for loop in emergencyWriteAll + has been unrolled. + (exists): use std::find_if with compare_memfun + (getBuffer): use std::find_if and compare_memfun + + * src/buffer.h: add typedefs for iterator_category, value_type + difference_type, pointer and reference for inset_iterator + add postfix ++ for inset_iterator + make inset_iterator::getPos() const + + * src/buffer.C: added support/lyxmanip.h + (readFile): use lyxerr << fmt instead of printf + (makeLaTeXFile): use std::copy to write out encodings + + * src/Painter.C (text): rewrite slightly to avoid extra font variable + + * src/MenuBackend.C (read): remove c_str(), as well as strdup and + free and the char * temp. + (hasMenu): use std::find_if and compare_memfun + (getMenu): ditto + + * src/Makefile.am (lyx_SOURCES): added gettext.C + + * src/LyXAction.C (retrieveActionArg): clear the arg, use + string::insert small change to avoid temporary + + * src/LColor.C (getGUIName): remove c_str() + + * several files: change all occurrences of fl_display to + fl_get_display() + + * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so + that -pedantic is not used for gcc 2.97 (cvs gcc) + + * boost/Makefile.am: begin slowly to prepare for a real boost lib + +2000-10-11 Allan Rae + + * src/frontends/xforms/FormPreferences.C (input): template path must be + a readable directory. It doesn't need to be writeable. + (build, delete, update, apply): New inputs in the various tabfolders + + * src/frontends/xforms/forms/form_preferences.fd: + * src/frontends/xforms/FormPreferences.h: New tabfolder and added + several new entries to existing folders. Shuffled some existing stuff + around. + + * src/frontends/xforms/forms/form_print.fd: + * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated. + Should probably rework PrinterParams as well. Note that the switch to + collated is effectively the same as !unsorted so changing PrinterParams + will require a lot of fiddly changes to reverse the existing logic. + + * src/lyx_cb.C (TimerCB): cleaned up Angus's patch. + +2000-10-10 Angus Leeming + + * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist. + +2000-10-10 Allan Rae + + * src/lyxrc.[Ch]: + * src/lyxfunc.C (Dispatch): + * src/lyx_gui.C: + * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a + member of LyXRC + + * src/lyxrc.C (output): Only write the differences between system lyxrc + and the users settings. + + * src/lyx_main.C: + * src/lyxrc.[Ch]: commented out noncopyable so I can keep a + system_lyxrc. + I'll rewrite this later, after 1.1.6 probably, to keep a single + LyXRC but two instances of a LyXRCStruct. + +2000-10-10 Jean-Marc Lasgouttes + + * lib/Makefile.am (pkgdata_DATA): add encoding and languages + + * src/tabular.h: add a few std:: qualifiers. + + * src/encoding.C: add using directive. + * src/language.C: ditto. + + * src/insets/insetquotes.C (Validate): use languages->lang() + instead of only language. + +2000-10-07 Dekel Tsur + + * lib/languages: New file. + + * lib/encodings: New file. + + * src/language.C (Languages): New class. + (read): New method. Reads the languages from the 'languages' file. + + * src/encoding.C (Encodings): New class. + (read): New method. Reads the encodings from the 'encodings' file. + + * src/lyx_main.C (init): Call to LyXSetStyle() after languages + initialization. + + * src/bufferparams.h and a lot of files: Deleted the member language, + and renamed language_info to language + + * src/buffer.C (makeLaTeXFile): Use babel() instead of lang() + * src/lyxfont.C (latexWriteStartChanges): ditto. + * src/paragraph.C (validate,TeXOnePar): ditto. + + * src/lyxfont.C (update): Restored deleted code. + + * src/frontends/xforms/FormDocument.C (build): Made the combox taller + +2000-10-10 Angus Leeming + + * src/BufferView_pimpl.C (buffer): cleaned up a little. + + * src/insets/figinset.[Ch]: + * src/insets/insetinclude.[Ch]: + * src/insets/insetinclude.[Ch]: + * src/insets/insetparent.[Ch]: + * src/insets/insetref.[Ch]: + * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &. + + * src/insets/*.[Ch]: + * src/mathed/formula.[Ch]: + * src/mathed/formulamacro.C (Clone): passed Buffer const &. + + * src/buffer.C (parseSingleLyXformat2Token, readInset): + * src/lyx_cb.C (FigureApplyCB): + * src/lyxfunc.C (getStatus, Dispatch): + * src/frontends/xforms/FormTabular.C: use modified c-tors to some + insets. + + * src/lyxfunc.C (Dispatch): string "ref" not used. Removed. + + * src/converter.[Ch] (Formats::View): + * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter. + + * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed + *current_view->buffer(). This will change later, but this patch is way + big enough already! + +2000-10-09 Juergen Vigna + + * src/text.C (GetRow): small fix. + + * src/BufferView_pimpl.C (cursorPrevious): + (cursorNext): added LyXText parameter to function. + + * src/insets/insettabular.C (LocalDispatch): activate cell inset on + keypress depending on cursor position. + +2000-10-06 Juergen Vigna + + * src/insets/insettabular.C (Ascii): finally call right ascii-function. + (copySelection): redone this function and also copy ascii representa- + tion to clipboard. + + * src/tabular.C (Ascii): + (AsciiPrintCell): + (AsciiBottomHLine): + (AsciiTopHLine): + (print_n_chars): new functions to realize the ascii export of tabulars. + +2000-10-05 Juergen Vigna + + * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix + if we don't have a buffer. + +2000-10-10 Allan Rae + + * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem + with closing dialog. It seems that nested tabfolders require hiding + of inner tabfolders before hiding the dialog itself. Actually all I + did was hide the active outer folder. + + * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent + unless there really is a buffer. hideBufferDependent is called + instead. + + * po/Makefile.in.in (POTFILES.in): one little tweak to ensure + POTFILES.in stays in $(srcdir). + +2000-10-09 Dekel Tsur + + * lib/lyxrc.example: Few changes. + +2000-10-05 Angus Leeming + + * src/BufferView_pimpl.C (buffer): only need one the + updateBufferDependent signal to be emitted once! Moved to the end of + the method to allow bv_->text to be updated first. + + * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_ + and hSignal_ with Dialogs * and BufferDependency variables. + New Buffer * parent_, initialised when the dialog is launched. Used to + check whether to update() or hide() dialog in the new, private + updateOrHide() method that is connected to the updateBufferDependent + signal. Daughter classes dictate what to do using the + ChangedBufferAction enum, passed to the c-tor. + + * src/frontends/xforms/FormCitation.C: + * src/frontends/xforms/FormCommand.C: + * src/frontends/xforms/FormCopyright.C: + * src/frontends/xforms/FormDocument.C: + * src/frontends/xforms/FormError.C: + * src/frontends/xforms/FormIndex.C: + * src/frontends/xforms/FormPreferences.C: + * src/frontends/xforms/FormPrint.C: + * src/frontends/xforms/FormRef.C: + * src/frontends/xforms/FormToc.C: + * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase + c-tor. + + * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a + ChangedBufferAction enum. + + * src/frontends/xforms/FormParagraph.[Ch] + * src/frontends/xforms/forms/form_paragraph.fd: now derived from + FormBase. + +2000-10-06 Jean-Marc Lasgouttes + + * lib/bind/cua.bind: fix a bit. + * lib/bind/emacs.bind: ditto. + + * lib/bind/menus.bind: remove real menu entries from there. + + * src/spellchecker.C: make sure we only include strings.h when + _AIX is defined. + +2000-10-05 Dekel Tsur + + * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New + function. It enlarges the maximum number of pup when needed. + (add_toc2): Open a new menu if maximum number of items per menu has + reached. + +2000-10-05 John Levon + + * src/frontends/kde/FormPrint.C: fix error reporting + + * src/frontends/xforms/FormDocument.C: fix compiler + warnings + + * lib/.cvsignore: add Literate.nw + +2000-10-05 Dekel Tsur + + * buffer.C + * bufferview_funcs.[Ch] + * lyxfont.[Ch] + * text.C + * text2.C: Add support for numbers in RTL text. + +2000-10-06 Allan Rae + + * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed + to be gettext.m4 friendly again. ext_l10n.h is now + generated into $top_srcdir instead of $top_builddir + so that lyx.pot will be built correctly -- without + duplicate parsing of ext_l10n.h. + +2000-10-04 John Levon + + * src/frontends/kde/FormCitation.C: make the dialog + behave more sensibly + +2000-10-03 John Levon + + * config/kde.m4: fix consecutive ./configure runs, + look for qtarch, fix library order + + * src/frontends/kde/Makefile.am: tidy up, + add Print dialog, add .dlg dependencies + + * src/frontends/kde/FormPrint.C: + * src/frontends/kde/FormPrint.h: + * src/frontends/kde/formprintdialog.C: + * src/frontends/kde/formprintdialog.h: + * src/frontends/kde/formprintdialogdata.C: + * src/frontends/kde/formprintdialogdata.h: + * src/frontends/kde/dlg/formprintdialog.dlg: add + print dialog + + * src/frontends/kde/dlg/README: Added explanatory readme + + * src/frontends/kde/dlg/checkinitorder.pl: small perl + script to double-check qtarch's output + + * src/frontends/kde/formindexdialog.C: + * src/frontends/kde/formindexdialogdata.C: + * src/frontends/kde/formindexdialogdata.h: + * src/frontends/kde/dlg/formindexdialog.dlg: update + for qtarch, minor fixes + +2000-10-05 Allan Rae + + * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent + dialogs when switching buffers update them instead. It's up to each + dialog to decide if it should still be visible or not. + update() should return a bool to control visiblity within show(). + Or perhaps better to set a member variable and use that to control + visibility. + + * lib/build-listerrors: create an empty "listerrors" file just to stop + make trying to regenerate it all the time if you don't have noweb + installed. + + * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-* + + * po/Makefile.in.in (ext_l10n.h): added a rule to build + $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/ + is built before src/ and ext_l10n.h isn't actually needed to build lyx. + (POTFILES.in): added a rule to build POTFILES.in. It is also now safe + to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/. + + * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make. + +2000-10-04 Angus Leeming + + * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when + deleting buffer. Closes all buffer-dependent dialogs. + + * src/frontends/xforms/FormBase.[Ch] (input): modified to pass + FL_OBJECT * also. + * src/frontends/xforms/FormCitation.[Ch]: + * src/frontends/xforms/FormPreferences.[Ch]: + * src/frontends/xforms/FormPrint.[Ch]: + * src/frontends/xforms/FormRef.[Ch]: + * src/frontends/xforms/FormUrl.[Ch]: ditto + + * src/frontends/xforms/FormDocument.[Ch]: + * src/frontends/xforms/forms/form_document.C.patch: + * src/frontends/xforms/forms/form_document.fd: all input callbacks now + pass through a single input() function. + +2000-10-04 John Levon + + * lib/build-listerrors: return status as OK + +2000-10-04 Dekel Tsur + + * lib/lyxrc.example: Updated to new export code + +2000-10-04 Jean-Marc Lasgouttes + + * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to + LexAlpha. + + * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR + character. + + * lib/layouts/amsart.layout: include lyxmacros.inc, so that + LyX-Code is defined. + * lib/layouts/amsbook.layout: ditto. + + * boost/Makefile.am: fix typo. + + * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use + Menu::expand. + (add_lastfiles): removed. + (add_documents): removed. + (add_formats): removed. + + * src/frontends/Menubar.C: remove useless "using" directive. + + * src/MenuBackend.h: add a new MenuItem constructor. + + * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the + xforms frontend. + +2000-10-04 Allan Rae + + * lib/Makefile.am (listerrors): + * lib/build-listerrors: make $builddir != $srcdir compiles work again. + I haven't got notangle installed so Kayvan please test. The output + should end up in $builddir. This also allows people who don't have + noweb installed to complete the make process without error. + + * src/frontends/xforms/FormCommand.[Ch] (showInset): + * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found + by JMarc's picky compiler. + +2000-10-03 Lars Gullik Bjønnes + + + * src/insets/insettabular.C (setPos): change for loop to not use + sequencing operator. Please check this Jürgen. + + * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c" + instead of 'c' + * src/insets/insetcite.C (getScreenLabel): ditto + * src/support/filetools.C (QuoteName): ditto + (ChangeExtension): ditto + + * src/BufferView_pimpl.C (scrollCB): make heigt int + + * src/BufferView2.C (insertInset): comment out unused arg + + * boost/Makefile.am (EXTRADIST): new variable + +2000-10-03 Dekel Tsur + + * src/exporter.C (IsExportable): Fixed + + * lib/configure.m4: Small fix + +2000-10-03 Dekel Tsur + + * src/insets/insetbutton.C (width): Changed to work with no GUI. + * src/insets/insetbib.C (bibitemWidest): ditto. + * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto. + +2000-10-03 Juergen Vigna + + * src/BufferView2.C (theLockingInset): removed const because of + Agnus's compile problems. + + * src/insets/insettext.C (LocalDispatch): set the language of the + surronding paragraph on inserting the first character. + + * various files: changed use of BufferView::the_locking_inset. + + * src/BufferView2.C (theLockingInset): + (theLockingInset): new functions. + + * src/BufferView.h: removed the_locking_inset. + + * src/lyxtext.h: added the_locking_inset + + * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int. + + * src/insets/lyxinset.h: added bool to ShowInsetCursor definition. + +2000-10-02 Angus Leeming + + * src/mathed/formula.C (IsMacro): declared but not referenced; removed. + * src/mathed/math_cursor.C (IsAlpha): ditto. + * src/mathed/math_inset.C (strnew): ditto. + * src/mathed/math_iter.C: SizeFont declared but not referenced;removed. + (IMetrics): cxp set but never used; removed. + * src/insets/figinset.C (InitFigures): removed redundant for loop, now + that the variable in question has been removed also! + + + * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by + using the Buffer * passed to Latex(), using the BufferView * passed to + bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys() + + * src/insets/insetinclude.C: use the Buffer * passed to Latex(), + Linuxdoc() and DocBook() rather than the stored Buffer * master. + + * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor + * src/buffer.C (readInset): used new InsetBibtex c-tor + * (getBibkeyList): used new InsetBibtex::getKeys + +2000-10-01 Dekel Tsur + + * lib/configure.m4 + * lib/build-listerrors + * src/converter.C + * src/exporter.C: Add literate programming support to the export code + + * src/buffer.C + * src/lyx_cb.C: Remove old literate code. + + * src/lyxrc.[Ch]: Remove many obsolete (due to new export code) + variables. + + * src/lyxfunc.C (getStatus): Use Exporter::IsExportable + * src/converter.C (View, Convert): Use QuoteName. + + * src/insets/figinset.C (Preview): Use Formats::View. + + * lib/configure.m4: Add sgml->dvi converter to lyxrc.default + +2000-10-02 Jean-Marc Lasgouttes + + * src/lyxfunc.C (Dispatch): move declaration of text variable at + the top of the function, because compaq cxx complains that the + "goto exit_with_message" when the function is disabled bypasses + its initialization. + (MenuNew): try a better fix for the generation of new file names. + This time, I used AddName() instead of AddPath(), hoping Juergen + will be happier :) + +2000-10-03 Allan Rae + + * src/frontends/xforms/forms/form_preferences.fd: + * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using + nested tabfolders has begun. The old "Miscellaneous" was renamed as + "Look and Feel"->"General" but will need to be split up further into + general output and general input tabs. Current plan is for four outer + tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI + stuff; "Inputs" for input and import configuration; "Outputs" for + output and export configuration; and one more whatever is left over + called "General". The leftovers at present look like being which + viewers to use, spellchecker, language support and might be better + named "Support". I've put "Paths" in "Inputs" for the moment as this + seems reasonable for now at least. + One problem remains: X error kills LyX when you close Preferences. + +2000-10-02 Angus Leeming + + * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const. + qualifier from form() + * src/frontends/xforms/FormCitation.[Ch]: + * src/frontends/xforms/FormCopyright.[Ch]: + * src/frontends/xforms/FormDocument.[Ch]: + * src/frontends/xforms/FormError.[Ch]: + * src/frontends/xforms/FormIndex.[Ch]: + * src/frontends/xforms/FormPreferences.[Ch]: + * src/frontends/xforms/FormPrint.[Ch]: + * src/frontends/xforms/FormRef.[Ch]: + * src/frontends/xforms/FormToc.[Ch]: + * src/frontends/xforms/FormUrl.[Ch]: ditto. + + * src/frontends/xforms/FormCitation.[Ch]: + * src/frontends/xforms/FormIndex.[Ch]: + * src/frontends/xforms/FormRef.[Ch]: + * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent + with Allan's naming policy + + * src/frontends/xforms/FormCitation.C: some static casts to remove + compiler warnings. + +2000-10-02 Juergen Vigna + + * src/insets/insettabular.C (LocalDispatch): fixed selection code, + now you can type or do stuff inside the table-cell also when in dummy + position, fixed visible cursor. + + * src/insets/insettext.C (Edit): fixing cursor-view position. + + * src/lyxfunc.C (Dispatch): use * text variable so that it can + be used for equal functions in lyxfunc and insettext. + + * src/text.C (GetVisibleRow): fixed a small clear_area bug. + +2000-10-02 John Levon + + * src/frontends/gnome/FormCitation.h: + * src/frontends/gnome/FormCopyright.h: + * src/frontends/gnome/FormIndex.h: + * src/frontends/gnome/FormPrint.h: + * src/frontends/gnome/FormToc.h: + * src/frontends/gnome/FormUrl.h: + * src/frontends/kde/FormCitation.h: + * src/frontends/kde/FormCopyright.h: + * src/frontends/kde/FormIndex.h: + * src/frontends/kde/FormRef.h: + * src/frontends/kde/FormToc.h: + * src/frontends/kde/FormUrl.h: fix remaining users of + support/utility.hpp + +2000-10-02 Jean-Marc Lasgouttes + + * src/buffer.C (linuxDocHandleFootnote): remove const modifier + from depth argument. + (DocBookHandleCaption): ditto. + (DocBookHandleFootnote): ditto. + (SimpleDocBookOnePar): ditto. + + * src/frontends/xforms/FormDocument.h (form): remove extra + FormDocument:: qualifier. + + * sigc++/macros/basic_signal.h.m4: remove erroneous virtual + destructor. + * sigc++/handle.h: ditto. + + * src/lyx_gui_misc.C: add "using" directive. + + * src/cheaders/cstddef: new file, needed by the boost library (for + compaq cxx). + +2000-10-02 Juergen Vigna + + * src/insets/insettext.C (SetFont): better support. + + * src/insets/insettabular.C (draw): fixed drawing of single cell. + + * src/screen.C (DrawOneRow): some uint refixes! + +2000-10-02 Allan Rae + + * boost/.cvsignore: ignore Makefile as well + + * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for + LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:. + + * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh. + Left this one out by accident. + + * src/frontends/xforms/FormBase.h (restore): default to calling + update() since that will restore the original/currently-applied values. + Any input() triggered error messages will require the derived classes + to redefine restore(). + + * src/frontends/xforms/FormDocument.C: initialize a few variables to + avoid a segfault. combo_doc_class is the main concern. + +2000-10-01 Kayvan A. Sylvan + + * Simplify build-listerrors in view of GUI-less export ability! + +2000-10-01 Dekel Tsur + + * src/lyx_main.C (easyParse): Disable gui when exporting + + * src/insets/figinset.C: + * src/LaTeX.C + * src/converter.C + * src/lyx_gui_misc.C + * src/tabular.C: Changes to allow no-gui. + +2000-10-02 Lars Gullik Bjønnes + + * src/support/utility.hpp: removed file + * src/support/block.h: removed file + + * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h + and utility.hpp + + * src/mathed/formula.C: add support/lyxlib.h + * src/mathed/formulamacro.C: ditto + + * src/bufferparams.h: use boost/array.hpp instead of support/block.h + * src/lyxparagraph.h: ditto + + * src/Makefile.am (BOOST_INCLUDES): the boost include dir + * src/frontends/Makefile.am (INCLUDES): ditto + * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto + * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto + * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto + * src/graphics/Makefile.am (BOOST_INCLUDES): ditto + * src/insets/Makefile.am (BOOST_INCLUDES): ditto + * src/mathed/Makefile.am (BOOST_INCLUDES): ditto + + * src/BufferView.h: use boost/utility.hpp + * src/LColor.h: ditto + * src/LaTeX.h: ditto + * src/LyXAction.h: ditto + * src/LyXView.h: ditto + * src/bufferlist.h: ditto + * src/lastfiles.h: ditto + * src/layout.h: ditto + * src/lyx_gui.h: ditto + * src/lyx_main.h: ditto + * src/lyxlex.h: ditto + * src/lyxrc.h: ditto + * src/frontends/ButtonPolicies.h: ditto + * src/frontends/Dialogs.h: ditto + * src/frontends/xforms/FormBase.h: ditto + * src/frontends/xforms/FormGraphics.h: ditto + * src/frontends/xforms/FormParagraph.h: ditto + * src/frontends/xforms/FormTabular.h: ditto + * src/graphics/GraphicsCache.h: ditto + * src/graphics/Renderer.h: ditto + * src/insets/ExternalTemplate.h: ditto + * src/insets/insetcommand.h: ditto + * src/support/path.h: ditto + + * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96 + and introduce clause for 2.97. + + * boost/libs/README: new file + + * boost/boost/utility.hpp: new file + + * boost/boost/config.hpp: new file + + * boost/boost/array.hpp: new file + + * boost/Makefile.am: new file + + * boost/.cvsignore: new file + + * configure.in (AC_OUTPUT): add boost/Makefile + + * Makefile.am (SUBDIRS): add boost + +2000-10-01 Dekel Tsur + + * src/support/lstrings.C (suffixIs): Fixed. + +2000-10-01 Allan Rae + + * src/PrinterParams.h: moved things around to avoid the "can't + inline call" warning. + + * src/frontends/xforms/RadioButtonGroup.h: turned a comment + into doc++ documentation. + + * src/frontends/xforms/FormCommand.[Ch]: support button policy + + * src/frontends/xforms/FormRef.C: make use of button controller + * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase + cleaned up button controller usage. + * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase + * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and + use the button controller + + * src/frontends/xforms/forms/*.fd: and associated generated files + updated to reflect changes to FormBase. Some other FormXxxx files + also got minor updates to reflect changes to FormBase. + + * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new + (hide): made virtual. + (input): return a bool. true == valid input + (RestoreCB, restore): new + (CancelCB, OKCB): renamed from HideCB and ApplyHideCB. + Changes to allow derived dialogs to use a ButtonController and + make sense when doing so: OK button calls ok() and so on. + + * src/frontends/xforms/ButtonController.h (class ButtonController): + Switch from template implementation to taking Policy parameter. + Allows FormBase to provide a ButtonController for any dialog. + + * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time + Probably should rename connect and disconnect. + (apply): use the radio button groups + (form): needed by FormBase + (build): setup the radio button groups + +2000-09-29 Lars Gullik Bjønnes + + * several files: type changes to reduce the number of warnings and + to unify type hangling a bit. Still much to do. + +2000-09-29 Jean-Marc Lasgouttes + + * lib/images/*: rename a bunch of icons to match Dekel converter + changes. + + * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to + last parameter. + + * src/frontends/xforms/FormBase.C (disconnect): remove bogus test. + + * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a + virtual destructor + * sigc++/handle.h: ditto for class Handle. + +2000-09-27 John Levon + + * config/kde.m4: make Qt fail immediately if Qt2 is picked up + +2000-09-28 Dekel Tsur + + * src/intl.C (InitKeyMapper): Correct the value of n due to the + removal of the "default" language. + + * src/combox.h (getline): Check that sel > 0 + +2000-09-29 José Abílio Matos + + * lib/examples/docbook_example.lyx + * lib/examples/docbook_article.lyx: file renamed to avoid confusion. + + * lib/layouts/docbook-book.layout: new docbook book layout. + + * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy. + + * lib/layouts/manpage.layout: Same as above. Style SubSection removed. + + * src/insets/figinset.C (DocBook):fixed small typo. + + * src/insets/insetinclude.C (DocBook): new export for verbatim type. + + * src/insets/insetinclude.h: string include_label doesn't need to be + mutable. + +2000-09-29 Allan Rae + + * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new. + Allow derived type to control connection and disconnection from signals + of its choice if desired. + +2000-09-28 Juergen Vigna + + * src/insets/insettabular.C (update): fixed cursor setting when + the_locking_inset changed. + (draw): made this a bit cleaner. + (InsetButtonPress): fixed! + + * various files: added LyXText Parameter to fitCursor call. + + * src/BufferView.C (fitCursor): added LyXText parameter. + + * src/insets/insettabular.C (draw): small draw fix. + + * src/tabular.C: right setting of left/right celllines. + + * src/tabular.[Ch]: fixed various types in funcions and structures. + * src/insets/insettabular.C: ditto + * src/frontends/xforms/FormTabular.C: ditto + +2000-09-28 Allan Rae + + * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was + that the #ifdef's had been applied to part of what should have been + a complete condition. It's possible there are other tests that + were specific to tables that are also wrong now that InsetTabular is + being used. Now we need to fix the output of '\n' after a table in a + float for the same reason as the original condition: + "don't insert this if we would be adding it before or after a table + in a float. This little trick is needed in order to allow use of + tables in \subfigures or \subtables." + Juergen can you check this? + +2000-09-27 Lars Gullik Bjønnes + + * src/insets/insettext.C (Ascii): return numer of '\n' in the text + output to the ostream. + + * several files: fixed types based on warnings from cxx + +2000-09-26 John Levon + + * src/frontends/kde/Makefile.am: fix rule for + formindexdialogdata_moc.C + + * src/.cvsignore: add ext_l10n.h to ignore + + * acconfig.h: stop messing with __STRICT_ANSI__ + * config/gnome.m4: remove option to set -ansi + * config/kde.m4: remove option to set -ansi + * config/lyxinclude.m4: don't set -ansi + +2000-09-27 Juergen Vigna + + * various files: remove "default" language check. + + * src/insets/insetquotes.C: removed use of current_view. + + * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but + the one should have red ears by now! + + * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts + in more then one paragraph. Fixed cursor-movement/selection. + + * src/frontends/xforms/FormParagraph.C: disable pagebreaks for + paragraphs inside a text inset. + + * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the + text-inset if this owner is an inset. + +2000-09-27 Lars Gullik Bjønnes + + * src/Bullet.h: changed type of font, character and size to int + + * src/buffer.C (asciiParagraph): remove actcell and fname1. + + * src/insets/inseturl.[Ch]: + * src/insets/insetref.[Ch]: + * src/insets/insetlabel.[Ch]: add linelen to Ascii + +2000-09-26 Angus Leeming + + * src/buffer.C (readFile): block-if statement rearranged to minimise + bloat. Patch does not reverse Jean-Marc's change ;-) + + * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks. + Class rewritten to store pointers to hide/update signals directly, + rather than Dialogs *. Also defined an enum to ease use. All xforms + forms can now be derived from this class. + + * src/frontends/xforms/FormCommand.[Ch] + * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase. + + * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h + out of header file. + + * src/frontends/xforms/forms/form_citation.fd + * src/frontends/xforms/forms/form_copyright.fd + * src/frontends/xforms/forms/form_error.fd + * src/frontends/xforms/forms/form_index.fd + * src/frontends/xforms/forms/form_ref.fd + * src/frontends/xforms/forms/form_toc.fd + * src/frontends/xforms/forms/form_url.fd: remamed callbacks + + * src/frontends/xforms/forms/makefile: small change to work with DEC sh. + + * src/insets/insetfoot.C: removed redundent using directive. + +2000-09-26 Jean-Marc Lasgouttes + + * lib/layouts/siamltex.layout: new textclass for SIAM journals, + from Kornelia Pietsch + + * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now + created in the constructors in different groups. Then set() just + have to show the groups as needed. This fixes the redraw problems + (and is how the old menu code worked). + + * src/support/lyxlib.h: declare the methods as static when we do + not have namespaces. + +2000-09-26 Juergen Vigna + + * src/buffer.C (asciiParagraph): new function. + (writeFileAscii): new function with parameter ostream. + (writeFileAscii): use now asciiParagraph. + + * various inset files: added the linelen parameter to the Ascii-func. + + * src/tabular.C (Write): fixed error in writing file introduced by + the last changes from Lars. + + * lib/bind/menus.bind: removed not supported functions. + + * src/insets/insettext.C (Ascii): implemented this function. + + * src/insets/lyxinset.h (Ascii): added linelen parameter. + + * src/tabular.C (write_attribute[int,string,bool]): new functions. + (Write): use of the write_attribute functions. + + * src/bufferlist.C (close): fixed reasking question! + +2000-09-26 Lars Gullik Bjønnes + + * src/support/unlink.C src/support/remove.C src/support/mkdir.C: + new files use the everwhere possible. + + * several files: + * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h + src/log_form.C src/lyx.C: + regenerated + + * src/buffer.C (runLaTeX): remove func + + * src/PaperLayout.C: removed file + * src/ParagraphExtra.C: likewise + * src/bullet_forms.C: likewise + * src/bullet_forms.h: likewise + * src/bullet_forms_cb.C: likewise + + * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C, + ParagraphExtra.C, bullet_forms.C, bullet_forms.h and + bullet_forms_cb.C + + * several files: remove all traces of the old fd_form_paragraph, + and functions belonging to that. + + * several files: remove all traces of the old fd_form_document, + and functions belonging to that. + + * several files: constify local variables were possible. + + * several files: remove all code that was dead when NEW_EXPORT was + defined + + * several files: removed string::c_str in as many places as + possible. + + * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C] + (e): be a bit more outspoken when patching + (updatesrc): only move files if changed. + + * forms/layout_forms.h.patch: regenerated + + * forms/layout_forms.fd: remove form_document and form_paragraph + and form_quotes and form_paper and form_table_options and + form_paragraph_extra + + * forms/form1.fd: remove form_table + + * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and + the fdui->... rewrite. Update some comments to xforms 0.88 + + * forms/bullet_forms.C.patch: removed file + * forms/bullet_forms.fd: likewise + * forms/bullet_forms.h.patch: likewise + + * development/Code_rules/Rules: added a section on switch + statements. Updated some comment to xforms 0.88. + +2000-09-26 Jean-Marc Lasgouttes + + * src/buffer.C (readFile): make sure that the whole version number + is read after \lyxformat (even when it contains a comma) + + * lib/ui/default.ui: change shortcut of math menu to M-a. + +2000-09-25 Jean-Marc Lasgouttes + + * src/vspace.C (nextToken): use isStrDbl() to check for proper + double values. + + * src/LyXView.C (updateWindowTitle): show the full files name in + window title, limited to 30 characters. + + * src/support/lyxstring.C (lyxstring): fix it correctly this time. + When a number of characters has been given, we should not assume + that the string is 0-terminated. + + * src/intl.C (InitKeyMapper): remove a bunch of string::c_str() + calls (fixes some memory leaks) + + * src/intl.[Ch]: add a destructor for Intl, in order to delete the + trans member on exit. + +2000-09-22 Jean-Marc Lasgouttes + + * src/converter.C (GetReachable): fix typo. + + * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and + understand ',' instead of '.'. + (GetInteger): rewrite to use strToInt(). + +2000-09-26 Juergen Vigna + + * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields, + better visibility and error-message on wrong VSpace input. + + * src/language.C (initL): added english again. + +2000-09-25 Juergen Vigna + + * src/frontends/kde/Dialogs.C (Dialogs): + * src/frontends/gnome/Dialogs.C (Dialogs): + * src/frontends/kde/Makefile.am: + * src/frontends/gnome/Makefile.am: added FormParagraph from xforms. + + * src/frontends/xforms/forms/makefile: added form_paragraph.fd. + + * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph. + + * src/frontends/xforms/Makefile.am: added files for FormParagraph. + + * src/frontends/xforms/FormParagraph.C: + * src/frontends/xforms/FormParagraph.h: + * src/frontends/xforms/form_paragraph.C: + * src/frontends/xforms/form_paragraph.h: + * src/frontends/xforms/forms/form_paragraph.fd: new files for the new + paragraph layout. + + * src/lyxfunc.C (Dispatch): call the new layout paragraph. + + * src/tabular.C (OldFormatRead): forgot to delete the temporary + Paragraph-Data after use. + + * src/insets/insettext.C (LocalDispatch): don't set the layout on + non breakable paragraphs. + +2000-09-25 Garst R. Reese + + * src/language.C (initL): added missing language_country codes. + +2000-09-25 Juergen Vigna + + * src/insets/insettext.C (InsetText): + (deleteLyXText): remove the not released LyXText structure! + +2000-09-24 Marko Vendelin + + * src/frontends/gnome/mainapp.C + * src/frontends/gnome/mainapp.h: added support for keyboard + accelerators + + * src/frontends/gnome/FormCitation.C + * src/frontends/gnome/FormCitation.h + * src/frontends/gnome/Makefile.am + * src/frontends/gnome/pixbutton.h: completed the rewrite of + FormCitation to use "action area" in mainapp window + + * src/frontends/gnome/Menubar_pimpl.C + * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle + large TOC. + +2000-09-23 Dekel Tsur + + * src/mathed/formula.C (MathFuncInset::Metrics): Use default + width/descent/ascent values if name is empty. + (mathed_string_height): Use std::max. + +2000-09-25 Allan Rae + + * src/frontends/xforms/forms/form_preferences.fd: resize to stop + segfault. This will be completely redesigned soon. + + * sigc++: updated libsigc++. Fixes struct timespec bug. + + * development/tools/makeLyXsigc.sh: .cvsignore addition + +2000-09-23 Lars Gullik Bjønnes + + * several files: removed almost all traces of the old table + (tabular) code. + + * src/TableLayout.C: removed file + +2000-09-22 Juergen Vigna + + * src/frontends/kde/Dialogs.C: added credits forms. + + * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms. + + * src/frontends/gnome/Dialogs.C: added some forms. + + * src/spellchecker.C (init_spell_checker): set language in pspell code + (RunSpellChecker): some modifications for setting language string. + + * src/language.[Ch]: added language_country code. + +2000-09-21 Angus Leeming + + * src/frontends/Dialogs.h: added new signal showError. + Rearranged existing signals in some sort of alphabetical order. + + * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch], + FormError.[Ch], form_error.[Ch] + * src/frontends/xforms/forms/makefile: added new file form_error.fd + * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError. + + * src/frontends/xforms/FormBase.[Ch]: new base class for xforms + dialogs. I think that this can be used as the base to all these + dialogs. + + * src/frontends/xforms/FormError.[Ch] + * src/frontends/xforms/forms/form_error.fd: new files. Xforms + implementation of InsetError dialog. + + * src/insets/inseterror.[Ch]: rendered GUI-independent. + + * src/frontends/kde/Dialogs.C: added new xforms dialog FormError. + * src/frontends/kde/Makefile.am: ditto + +2000-09-21 Dekel Tsur + + * src/mathed/math_cursor.[Ch]: Removed class members macroln and + macrobf. This fixes a bug of invisible text. + +2000-09-22 Jean-Marc Lasgouttes + + * lib/doc/LaTeXConfig.lyx.in: updated. + + * src/language.C (initL): remove language "francais" and change a + bit the names of the two other french variations. + + * src/support/lyxstring.C (lyxstring): do not apply strlen() on a + string that may not be 0-terminated. + +2000-09-20 Lars Gullik Bjønnes + + * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h + +2000-09-20 Marko Vendelin + + * src/frontends/gnome/FormCitation.C + * src/frontends/gnome/FormIndex.C + * src/frontends/gnome/FormToc.C + * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering + the variable initialization to shut up the warnings + +2000-09-20 Lars Gullik Bjønnes + + * src/table.[Ch]: deleted files + + * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch + second arg. + +2000-09-18 Juergen Vigna + + * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete + problems with selection. Inserted new LFUN_PASTESELECTION. + (InsetButtonPress): inserted handling of middle mouse-button paste. + + * src/spellchecker.C: changed word to word.c_str(). + +2000-09-16 Kayvan A. Sylvan + + * src/Makefile.am: Add sources to lyx_SOURCES so they will be + included in the ``make dist'' tarball. + +2000-09-15 Juergen Vigna + + * src/CutAndPaste.C (cutSelection): small fix return the right + end position after cut inside one paragraph only. + + * src/insets/insettext.C (resizeLyXText): only reset the cursor if + we are locked as otherwise we don't have a valid cursor position! + + * src/insets/figinset.C (draw): small bugfix but why is this needed??? + +2000-09-19 Angus Leeming + + * src/frontends/kde/FormRef.C: added using directive. + * src/frontends/kde/FormToc.C: ditto + + * src/frontends/kde/formtocdialog.h: changed endl to std::endl. + + * src/frontends/kde/FormRef.h: removed trailing comma from enums. + +2000-09-19 Marko Vendelin + + * src/frontends/gnome/Menubar_pimpl.C + * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now + Toc, ViewFormats, UpdateFormats, and ExportFormats. + + * src/frontends/gnome/mainapp.C + * src/frontends/gnome/mainapp.h: support for menu update used + by Toc menu. + + * src/frontends/gnome/mainapp.C + * src/frontends/gnome/mainapp.h: support for "action" area in the + main window. This area is used by small simple dialogs, such as + FormUrl. + + * src/frontends/gnome/FormIndex.C + * src/frontends/gnome/FormIndex.h + * src/frontends/gnome/FormUrl.C + * src/frontends/gnome/FormUrl.h: rewrite to use main window action + area + + * src/frontends/gnome/FormCitation.C + * src/frontends/gnome/FormCitation.h: rewrite to use main window + action area. Only "Insert new citation" is implemented. + +2000-09-19 Lars Gullik Bjønnes + + * src/buffer.C (Dispatch): fix call to Dispatch + * src/insets/insetref.C (Edit): likewise + * src/insets/insetparent.C (Edit): likewise + * src/insets/insetinclude.C (include_cb): likewise + * src/frontends/xforms/FormUrl.C (apply): likewise + * src/frontends/xforms/FormToc.C (apply): likewise + * src/frontends/xforms/FormRef.C (apply): likewise + * src/frontends/xforms/FormIndex.C (apply): likewise + * src/frontends/xforms/FormCitation.C (apply): likewise + * src/lyxserver.C (callback): likewise + * src/lyxfunc.C (processKeySym): likewise + (Dispatch): likewise + (Dispatch): likewise + * src/lyx_cb.C (LayoutsCB): likewise + + * Makefile.am (sourcedoc): small change + +2000-09-18 Lars Gullik Bjønnes + + * src/main.C (main): Don't make an empty GUIRunTime object. all + methods are static. constify a bit remove unneded using + headers. + + * src/tabular.C: some more const to local vars move some loop vars + + * src/spellchecker.C: added some c_str after some word for pspell + + * src/frontends/GUIRunTime.h: add new static method setDefaults + * src/frontends/xforms/GUIRunTime.C (setDefaults): + * src/frontends/kde/GUIRunTime.C (setDefaults): + * src/frontends/gnome/GUIRunTime.C (setDefaults): new method + + * src/mathed/math_cursor.C (MacroModeClose): don't call SetName + with strnew in arg, use correct emptystring when calling SetName. + + * several files: remove all commented code with relation to + HAVE_SSTREAM beeing false. We now only support stringstream and + not strstream. + +2000-09-15 Jean-Marc Lasgouttes + + * src/lyxfunc.C: construct correctly the automatic new file + names. + + * src/text2.C (IsStringInText): change type of variable i to shut + off a warning. + + * src/support/sstream.h: do not use namespaces if the compiler + does not support them. + +2000-09-15 Marko Vendelin + * src/frontends/gnome/FormCitation.C + * src/frontends/gnome/FormCitation.h + * src/frontends/gnome/diainsertcitation_interface.c + * src/frontends/gnome/dialogs/diainsertcitation.glade: adds + regexp support to FormCitation [Gnome]. + +2000-09-15 John Levon + + * acconfig.h + * configure.in: remove unused KDE/GTKGUI define + + * src/frontends/kde/FormRef.C + * src/frontends/kde/FormRef.h + * src/frontends/kde/formrefdialog.C + * src/frontends/kde/formrefdialog.h: double click will + go to reference, now it is possible to change a cross-ref + after the fact + + * src/frontends/kde/FormToc.C + * src/frontends/kde/FormToc.h + * src/frontends/kde/formtocdialog.C + * src/frontends/kde/formtocdialog.h: add a depth + slider + + * src/frontends/kde/Makefile.am: add QtLyXView.h + to the sources list + +2000-09-15 Angus Leeming + + * src/frontends/kde/FormCitation.h: added some using directives. + + * src/frontends/kde/FormToc.h: corrected definition of doTree. + + * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not + cerr. + + * src/mathed/math_defs.h: redefine SetAlign to use string rather + than char *. + +2000-09-15 Jean-Marc Lasgouttes + + * src/buffer.C (pop_tag): revert for the second time a change by + Lars, who seems to really hate having non-local loop variables :) + + * src/Lsstream.h: add "using" statements. + + * src/support/copy.C (copy): add a bunch of std:: qualifiers + * src/buffer.C (writeFile): ditto + +2000-09-14 Lars Gullik Bjønnes + + * src/buffer.C (writeFile): try to fix the locale modified format + number to always be as we want it. + + * src/WorkArea.C (work_area_handler): try to workaround the bugs + in XForms 0.89. C-space is now working again. + + * src/Lsstream.h src/support/sstream.h: new files. + + * also commented out all cases where strstream were used. + + * src/Bullet.h (c_str): remove method. + + * remove all stuff that is irrelevant when NEW_MENUBAR is defined + + * a lot of files: get rid of "char const *" and "char *" is as + many places as possible. We only want to use them in interaction + with system of other libraries, not inside lyx. + + * a lot of files: return const object is not of pod type. This + helps ensure that temporary objects is not modified. And fits well + with "programming by contract". + + * configure.in: check for the locale header too + + * Makefile.am (sourcedoc): new tag for generation of doc++ + documentation + +2000-09-14 Juergen Vigna + + * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the + callback to check which combo called it and do the right action. + + * src/combox.C (combo_cb): added combo * to the callbacks. + (Hide): moved call of callback after Ungrab of the pointer. + + * src/intl.h: removed LCombo2 function. + + * src/intl.C (LCombo): added Combox * to call and removed LCombo2 + function as this can now be handled in one function. + + * src/combox.h: added Combox * to callback prototype. + + * src/frontends/xforms/Toolbar_pimpl.C: + * src/lyx_cb.C (LayoutsCB): added Combox * to function call. + +2000-09-14 Garst Reese + + * lib/tex/hollywood.cls changed length of parenthicals to 1.5in + moved usepackage{xxx}'s to beginning of file. Changed left margin + to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed + underlining from title. Thanks to John Culleton for useful suggestions. + +2000-09-13 Jean-Marc Lasgouttes + + * src/lyxlex_pimpl.C (setFile): change error message to debug + message. + +2000-09-13 Juergen Vigna + + * src/frontends/xforms/FormDocument.C: implemented choice_class + as combox and give callback to combo_language so OK/Apply is activated + on change. + + * src/bufferlist.C (newFile): small fix so already named files + (via an open call) are not requested to be named again on the + first save! + +2000-09-13 John Levon + + * src/frontends/kde/Makefile.am + * src/frontends/kde/FormRef.C + * src/frontends/kde/FormRef.h + * src/frontends/kde/formrefdialog.C + * src/frontends/kde/formrefdialog.h: implement + cross-ref dialog + +2000-09-13 John Levon + + * src/frontends/kde/formtocdialog.C + * src/frontends/kde/formtocdialog.h + * src/frontends/kde/FormToc.C + * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly + +2000-09-11 John Levon + + * src/frontends/kde/FormCitation.C: fix thinko + where we didn't always display the reference text + properly + + * src/frontends/kde/formurldialog.C + * src/frontends/kde/formurldialog.h + * src/frontends/kde/FormUrl.C + * src/frontends/kde/FormUrl.h: minor cleanups + + * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling + + * src/frontends/kde/Makefile.am + * src/frontends/kde/FormToc.C + * src/frontends/kde/FormToc.h + * src/frontends/kde/FormCitation.C + * src/frontends/kde/FormCitation.h + * src/frontends/kde/FormIndex.C + * src/frontends/kde/FormIndex.h + * src/frontends/kde/formtocdialog.C + * src/frontends/kde/formtocdialog.h + * src/frontends/kde/formcitationdialog.C + * src/frontends/kde/formcitationdialog.h + * src/frontends/kde/formindexdialog.C + * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs + +2000-09-12 Juergen Vigna + + * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version + static strings. + +2000-09-11 Jean-Marc Lasgouttes + + * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr, + not cerr. + +2000-09-09 Dekel Tsur + + * src/converter.C (Add, Convert): Added support for converter flags: + needaux, resultdir, resultfile. + (Convert): Added new parameter view_file. + (dvips_options): Fixed letter paper option. + + * src/exporter.C (Export, BufferExtension): Added support for Docbook. + (Export, GetExportableFormats, GetViewableFormats): Added support + for Ascii. + + * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary + directory! + (easyParse): Fixed to work with new export code. + + * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete + directories. + + * lyx-devel-export/lib/configure.m4: Changed flags of tth. + + * lib/bind/*.bind: Replaced + buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by + buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps + +2000-09-11 Juergen Vigna + + * src/lyx_gui.C (runTime): uses global guiruntime variable. + + * src/main.C (main): now GUII defines global guiruntime! + + * src/frontends/gnome/GUIRunTime.C (initApplication): + * src/frontends/kde/GUIRunTime.C (initApplication): + * src/frontends/xforms/GUIRunTime.C (initApplication): + * src/frontends/GUIRunTime.h: added new function initApplication. + + * src/spellchecker.C (sc_accept_word): change to add_to_session. + + * src/vspace.C (nextToken): fixed error with number 0cm as unvalid. + +2000-09-08 Juergen Vigna + + * src/lyx_gui.C (create_forms): don't display the "default" entry as + we have already "Reset". + + * src/language.C (initL): inserted "default" language and made this + THE default language (and not american!) + + * src/paragraph.C: inserted handling of "default" language! + + * src/lyxfont.C: ditto + + * src/text.C: ditto + + * src/paragraph.C: output the \\par only if we have a following + paragraph otherwise it's not needed. + +2000-09-05 Juergen Vigna + + * config/pspell.m4: added entry to lyx-flags + + * src/spellchecker.C: modified version from Kevin for using pspell + +2000-09-01 Marko Vendelin + * src/frontends/gnome/Makefile.am + * src/frontends/gnome/FormCitation.C + * src/frontends/gnome/FormCitation.h + * src/frontends/gnome/diainsertcitation_callbacks.c + * src/frontends/gnome/diainsertcitation_callbacks.h + * src/frontends/gnome/diainsertcitation_interface.c + * src/frontends/gnome/diainsertcitation_interface.h + * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation + dialog for Gnome frontend + + * src/main.C: Gnome libraries require keeping application name + and its version as strings + + * src/frontends/gnome/mainapp.C: Change the name of the main window + from GnomeLyX to PACKAGE + +2000-09-05 Jean-Marc Lasgouttes + + * src/frontends/Liason.C: add "using: declaration. + +2000-08-31 Dekel Tsur + + * src/mathed/math_macro.C (Metrics): Set the size of the template + + * src/mathed/formulamacro.C (Latex): Fixed the returned value + +2000-09-04 Dekel Tsur + + * src/converter.C (add_options): New function. + (SetViewer): Change $$FName into '$$FName'. + (View): Add options when running xdvi + (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName. + (Convert): The 3rd parameter is now the desired filename. Converts + calls to lyx::rename if necessary. + Add options when running dvips. + (dvi_papersize,dvips_options): New methods. + + * src/exporter.C (Export): Use getLatexName() instead of fileName(). + + * src/frontends/Liason.C (printBuffer): Removed duplicate code by + using a call to Converter::dvips_options. + Fixed to work with nex export code. + + * src/support/copy.C + * src/support/rename.C: New files + + * src/support/syscall.h + * src/support/syscall.C: Added Starttype SystemDontWait. + + * lib/ui/default.ui: Changed to work with new export code + + * lib/configure.m4: Changed to work with new export code + + * src/encoding.C: Changed latex name for iso8859_7 encoding. + +2000-09-04 Angus Leeming + + + * src/frontends/xforms/Menubar_pimpl.C: added two using directives + so that code compiles with DEC cxx. + + * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn + to work correctly! Also now supports the additional elements + neeeded by natbib. + +2000-09-01 Allan Rae + + * src/frontends/ButtonPolicies.C: renamed all the references to + PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy. + + * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS + since it's a const not a type. + + * src/frontends/xforms/ButtonController.h: cleanup before Lars does. + +2000-08-31 Juergen Vigna + + * src/insets/figinset.C: Various changes to look if the filename has + an extension and if not add it for inline previewing. + +2000-08-31 Lars Gullik Bjønnes + + * src/frontends/ButtonPolicies.h: add a Button AllButtons. + make buttonStatus and isReadOnly be const methods. (also reflect + this in derived classes.) + + * src/frontends/ButtonPolicies.C: remove sum_ and bogus_ + (nextState): change to be static inline, pass the StateMachine as + a const reference + (PreferencesPolicy): remove casts + (OkCancelPolicy): remvoe casts + (OkCancelReadOnlyPolicy): remove casts + (NoRepeatedApplyReadOnlyPolicy): remove casts + (OkApplyCancelReadOnlyPolicy): remove casts + (OkApplyCancelPolicy): remove casts + (NoRepeatedApplyPolicy): remove casts + +2000-08-31 Angus Leeming + + * src/converter.C: added some using directives + + * src/frontends/ButtonPolicies.C: changes to overcome + "need lvalue" error with DEC c++ + + * src/frontends/xforms/FormDocument.C (c-tor): use C callback + to WMHideCB for DEC c++ + + * src/frontends/xforms/Menubar_pimpl.C: added using directive + + * src/frontends/xforms/forms/form_document.C.patch: use C callback + to BulletBMTableCB for DEC c++ + +2000-08-31 Allan Rae + + * src/lyx_gui.C (create_forms): build combo_language2 which is part of + character dialog separately from old document dialogs combo_language. + Stops a segfault. + +2000-08-30 Dekel Tsur + + * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH. + Removed LFUN_REF_CREATE. + + * src/MenuBackend.C: Added new tags: toc and references + + * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool + (add_lastfiles, add_documents, add_formats): Removed the unused smn + parameter. + (add_toc, add_references): New methods. + (create_submenu): Handle correctly the case when there is a + seperator after optional menu items. + + * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK. + (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT. + (dispatch): New code for LFUN_GOTO_PARAGRAPH. + + * src/frontends/xforms/FormToc.C (apply): Use Dispatch. + +2000-08-30 Dekel Tsur + + * src/converter.[Ch]: New file for converting between different + formats. + + * src/export.[Ch]: New file for exporting a LyX file to different + formats. + + * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined: + MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript, + PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX, + MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML, + MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc, + RunDocBook, MenuExport. + + * src/lyxfunc.C (Dispatch): Use the Exporter::Export and + Exporter::Preview methods if NEW_EXPORT is defined. + + * src/buffer.C (Dispatch): Use Exporter::Export. + + * src/lyxrc.C: Added new tags: \converter and \viewer. + + * src/commandtags.h + * src/LyXAction.C: Define new lyx-function: buffer-update. + Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps + when NEW_EXPORT is defined. + + * src/MenuBackend.C: Added new tags: updateformats and viewformats. + + * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method. + + * lib/ui/default.ui: Added submenus "view" and "update" to the + "file" menu. + + * src/filetools.C (GetExtension): New function. + + * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used. + +2000-08-29 Allan Rae + + * lib/bind/xemacs.bind: update a binding due to Juergen's recent work + + * src/frontends/xforms/FormDocument.C (checkReadOnly): new function + (EnableDocumentLayout): removed + (DisableDocumentLayout): removed + (build): make use of ButtonController's read-only handling to + de/activate various objects. Replaces both of the above functions. + + * src/frontends/xforms/ButtonController.h (readWrite): was read_write + (readOnly): was read_only + (refresh): fixed dumb mistakes with read_only_ handling + + * src/frontends/xforms/forms/form_document.fd: + * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the + tabbed dialogs so the tabs look more like tabs and so its easier to + work out which is the current tab. + + * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix + segfault with form_table + + * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL. + +2000-08-28 Juergen Vigna + + * acconfig.h: added USE_PSPELL. + + * src/config.h.in: added USE_PSPELL. + + * autogen.sh: added pspell.m4 + + * config/pspell.m4: new file. + + * src/spellchecker.C: implemented support for pspell libary. + +2000-08-25 Juergen Vigna + + * src/LyXAction.C (init): renamed LFUN_TABLE to + LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences. + + * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries. + + * src/lyxscreen.h: add force_clear variable and fuction to force + a clear area when redrawing in LyXText. + + * src/text.C (GetVisibleRow): look if the screen forces a redraw. + +2000-08-25 Lars Gullik Bjønnes + + * some whitespace and comment changes. + + * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones. + + * src/buffer.C: up te LYX_FORMAT to 2.17 + +2000-08-23 Juergen Vigna + + * src/BufferView_pimpl.C (tripleClick): disable this when in a + locking_inset. + + * src/insets/insettabular.C (pasteSelection): delete the insets + LyXText as it is not valid anymore. + (copySelection): new function. + (pasteSelection): new function. + (cutSelection): new function. + (LocalDispatch): implemented cut/copy/paste of cell selections. + + * src/insets/insettext.C (resizeLyXText): don't need resize if I still + don't have a LyXText. + + * src/LyXAction.C (init): a NEW_TABULAR define too much. + + * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing + NEW_TABULAR define. + +2000-08-22 Juergen Vigna + + * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): + ifdef form_table out if NEW_TABULAR. + +2000-08-21 Juergen Vigna + + * src/insets/insettabular.C (TabularFeatures): BoxType is enum now. + (draw): fixed draw position so that the cursor is positioned in the + right place. + (InsetMotionNotify): hide/show cursor so the position is updated. + (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell), + using cellstart() function where it should be used. + + * src/insets/insettext.C (draw): ditto. + + * src/tabular.C: fixed initialization of some missing variables and + made BoxType into an enum. + +2000-08-22 Marko Vendelin + * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome + stock menu item using action numerical value, not its string + representation. + + +2000-08-22 Lars Gullik Bjønnes + + * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add + GUIRunTime.C remove GUIRunTime_pimpl.[Ch] + + * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file + + * src/frontends/xforms/GUIRunTime.C: new file + + * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add + GUIRunTime.C and remove GUIRunTime_pimpl.[Ch] + + * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file + + * src/frontends/kde/GUIRunTime.C: new file + + * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add + GUIRunTime.C and remove GUIRunTime_pimpl.[Ch] + + * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file + + * src/frontends/gnome/GUIRunTime.C: new file + + * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed + GUIRunTime.C + + * src/frontends/GUIRunTime.h: removed constructor and destructor, + small change to documetentation. + + * src/frontends/GUIRunTime.C: removed file + + * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR + + * src/lyxparagraph.h: enable NEW_TABULAR as default + + * src/lyxfunc.C (processKeySym): remove some commented code + + * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add + NEW_TABULAR around the fd_form_table_options. + + * src/lyx_gui.C (runTime): call the static member function as + GUIRunTime::runTime(). + +2000-08-21 Allan Rae + + * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the + policy here also. + +2000-08-21 Dekel Tsur + + * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present + +2000-08-21 Allan Rae + + * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to + keep Garst happy ;-) + * src/frontends/xforms/FormPreferences.C (build): use setOK + * src/frontends/xforms/FormDocument.C (build): use setOK + (FormDocument): use the appropriate policy. + +2000-08-21 Allan Rae + + * src/frontends/xforms/ButtonController.h (class ButtonController): Allow + automatic [de]activation of arbitrary objects when in a read-only state. + + * src/frontends/ButtonPolicies.h: More documentation + (isReadOnly): added to support the above. + + * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save + +2000-08-18 Juergen Vigna + + * src/insets/insettabular.C (getStatus): changed to return func_status. + + * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always + display toggle menu entries if they are. + + * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the + new document layout now. + + * src/lyxfunc.C: ditto + + * src/lyx_gui_misc.C: ditto + + * src/lyx_gui.C: ditto + + * lib/ui/default.ui: removed paper and quotes layout as they are now + all in the document layout tabbed folder. + + * src/frontends/xforms/forms/form_document.fd: added Restore + button and callbacks for all inputs for Allan's ButtonPolicy. + + * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added. + (CheckChoiceClass): added missing params setting on class change. + (UpdateLayoutDocument): added for updating the layout on params. + (build): forgot to RETURN_ALWAYS input_doc_spacing. + (FormDocument): Implemented Allan's ButtonPolicy with the + PreferencesPolicy. + +2000-08-17 Allan Rae + + * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection + so we can at least see the credits again. + + * src/frontends/xforms/FormPreferences.C: Used the appropriate button + controller calls for the appropriate callbacks. Note that since Ok + calls apply followed by cancel, and apply isn't a valid input for the + APPLIED state, the bc_ calls have to be made in the static callback not + within each of the real callbacks. + + * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay() + (setOk): renamed from setOkay() + +2000-08-17 Juergen Vigna + + * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function + in the implementation part. + (composeUIInfo): don't show optional menu-items. + + * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset. + + * src/insets/insettext.C (UpdateLocal): call to LyXView::showState() + + * src/bufferview_funcs.C (CurrentState): fixed to show also the + text-state when in a text-inset. + + * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now. + +2000-08-17 Marko Vendelin + * src/frontends/gnome/FormIndex.C + * src/frontends/gnome/FormIndex.h + * src/frontends/gnome/FormToc.C + * src/frontends/gnome/FormToc.h + * src/frontends/gnome/dialogs + * src/frontends/gnome/diatoc_callbacks.c + * src/frontends/gnome/diatoc_callbacks.h + * src/frontends/gnome/diainsertindex_callbacks.h + * src/frontends/gnome/diainsertindex_callbacks.c + * src/frontends/gnome/diainsertindex_interface.c + * src/frontends/gnome/diainsertindex_interface.h + * src/frontends/gnome/diatoc_interface.h + * src/frontends/gnome/diatoc_interface.c + * src/frontends/gnome/Makefile.am: Table of Contents and + Insert Index dialogs implementation for Gnome frontend + + * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs + + * src/frontends/gnome/Menubar_pimpl.C: remove historical comments + + * src/frontends/gnome/diainserturl_interface.c: make the dialog + resizable + +2000-08-17 Lars Gullik Bjønnes + + * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and + destructor. Don't definde if you don't need it + (processEvents): made static, non-blocking events processing for + xforms. + (runTime): static method. event loop for xforms + * similar as above for kde and gnome. + + * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong + new Pimpl is correct + (runTime): new method calss the real frontends runtime func. + + * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime + +2000-08-16 Lars Gullik Bjønnes + + * src/lyx_gui.C (create_forms): fix the "No change" gettext missing + +2000-08-16 Juergen Vigna + + * src/lyx_gui.C (runTime): added GUII RunTime support. + + * src/frontends/Makefile.am: + * src/frontends/GUIRunTime.[Ch]: + * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: + * src/frontends/kde/GUIRunTime_pimpl.[Ch]: + * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support + + * src/LyXAction.C (init): added dummy LFUN_INSERT_URL. + + * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include + as this is already set in ${FRONTEND_INCLUDE} if needed. + + * configure.in (CPPFLAGS): setting the include dir for the frontend + directory and don't set FRONTEND=xforms for now as this is executed + always. + +2000-08-16 John Levon (moz@compsoc.man.ac.uk) + + * src/frontends/kde/Makefile.am: + * src/frontends/kde/FormUrl.C: + * src/frontends/kde/FormUrl.h: + * src/frontends/kde/formurldialog.h: + * src/frontends/kde/formurldialog.C: Add KDE URL dialog + +2000-08-15 Kayvan A. Sylvan + + * src/frontend/Makefile.am: Add gnome and kde to dist tar file. + +2000-08-16 Lars Gullik Bjønnes + + * src/BufferView_pimpl.C (workAreaKeyPress): enable the + processKeySym + +2000-08-15 Lars Gullik Bjønnes + + * src/WorkArea.C (work_area_handler): more work to get te + FL_KEYBOARD to work with xforms 0.88 too, please test. + + * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard. + +2000-08-15 Dekel Tsur + + * src/frontends/ButtonPolicies.C: make gcc happy when compiling with + -pedantic + +2000-08-14 Lars Gullik Bjønnes + + * src/Timeout.h: remove Qt::emit hack. + + * several files: changes to allo doc++ compilation + + * src/lyxfunc.C (processKeySym): new method + (processKeyEvent): comment out if FL_REVISION < 89 + + * src/WorkArea.C: change some debugging levels. + (WorkArea): set wantkey to FL_KEY_ALL + (work_area_handler): enable the FL_KEYBOARD clause, this enables + clearer code and the use of compose with XForms 0.89. Change to + use signals instead of calling methods in bufferview directly. + + * src/Painter.C: change some debugging levels. + + * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback + if FL_REVISION < 89 + + * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals. + (workAreaKeyPress): new method + +2000-08-14 Juergen Vigna + + * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs. + + * config/kde.m4: addes some features + + * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to + include missing xforms dialogs. + + * src/Timeout.h: a hack to be able to compile with qt/kde. + + * sigc++/.cvsignore: added acinclude.m4 + + * lib/.cvsignore: added listerros + + * src/frontends/Makefile.am: modified for now to ALWAYS compile the + xforms tree as objects are needed for other frontends. + + * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for + linking with not yet implemented xforms objects. + + * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument. + +2000-08-14 Baruch Even + + * src/frontends/xforms/FormGraphics.h: + * src/frontends/xforms/FormGraphics.C: + * src/frontends/xforms/RadioButtonGroup.h: + * src/frontends/xforms/RadioButtonGroup.C: + * src/insets/insetgraphics.h: + * src/insets/insetgraphics.C: + * src/insets/insetgraphicsParams.h: + * src/insets/insetgraphicsParams.C: Changed indentation to use tabs + instead of spaces, and various other indentation issues to make the + sources more consistent. + +2000-08-14 Marko Vendelin + + * src/frontends/gnome/dialogs/diaprint.glade + * src/frontends/gnome/FormPrint.C + * src/frontends/gnome/FormPrint.h + * src/frontends/gnome/diaprint_callbacks.c + * src/frontends/gnome/diaprint_callbacks.h + * src/frontends/gnome/diaprint_interface.c + * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome + implementation + + * src/frontends/gnome/dialogs/diainserturl.glade + * src/frontends/gnome/FormUrl.C + * src/frontends/gnome/FormUrl.h + * src/frontends/gnome/diainserturl_callbacks.c + * src/frontends/gnome/diainserturl_callbacks.h + * src/frontends/gnome/diainserturl_interface.c + * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog + Gnome implementation + + * src/frontends/gnome/Dialogs.C + * src/frontends/gnome/Makefile.am: added Print, Insert Url and + all other dialogs. Copy all unimplemented dialogs from Xforms + frontend + + * src/frontends/gnome/support.c + * src/frontends/gnome/support.h: support files generated by Glade + + * autogen.sh + * configure.in + * config/gnome.m4: Gnome configuration scripts + + * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in + configure --help message + + * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime() + only if there are no events pendling in Gnome/Gtk. This enhances + the performance of menus. + + +2000-08-14 Allan Rae + + * lib/Makefile.am: listerrors cleaning + + * lib/listerrors: removed -- generated file + * acinclude.m4: ditto + * sigc++/acinclude.m4: ditto + + * src/frontends/xforms/forms/form_citation.fd: + * src/frontends/xforms/FormCitation.C (setSize): Made the form a more + manageable size. + + * src/frontends/xforms/forms/makefile: I renamed the `install` target + `updatesrc` and now we have a `test` target that does what `updatesrc` + used to do. I didn't like having an install target that wasn't related + to the dist. + + * src/frontends/xforms/Form*.[hC]: Removed the free() member functions + on all except FormGraphics. This may yet happen. Followed by a major + cleanup including using FL_TRANSIENT for most of the dialogs. More + changes to come when the ButtonController below is introduced. + + * src/frontends/xforms/ButtonController.h: New file for managing up to + four buttons on a dialog according to an externally defined policy. + * src/frontends/xforms/Makefile.am: added above + + * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok, + Apply and Cancel/Close buttons and everything in between and beyond. + * src/frontends/Makefile.am: added above. + + * src/frontends/xforms/forms/form_preferences.fd: + * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController + and removed variable 'status' as a result. Fixed the set_minsize thing. + Use the new screen-font-update after checking screen fonts were changed + Added a "Restore" button to restore the original lyxrc values while + editing. This restores everything not just the last input changed. + That's still a tricky one. As is the "LyX: this shouldn't happen..." + + * src/LyXAction.C: screen-font-update added for updating buffers after + screen font settings have been changed. + * src/commandtags.h: ditto + * src/lyxfunc.C: ditto + + * forms/lyx.fd: removed screen fonts dialog. + * src/lyx_gui.C: ditto + * src/menus.[Ch]: ditto + * src/lyx.[Ch]: ditto + * src/lyx_cb.C: ditto + code from here moved to make + screen-font-update. And people wonder why progress on GUII is + slow. Look at how scattered this stuff was! It takes forever + just find it all. + + * forms/fdfix.sh: Fixup the spacing after commas. + * forms/makefile: Remove date from generated files. Fewer clashes now. + * forms/bullet_forms.C.patch: included someones handwritten changes + + * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN + once I've discovered why LyXRC was made noncopyable. + * src/lyx_main.C: ditto + +2000-08-14 Angus Leeming + + * src/frontends/xforms/forms/fdfix.sh: + * src/frontends/xforms/forms/fdfixh.sed: + * src/frontends/xforms/forms/fdfixc.sed: New file from Angus + * src/frontends/xforms/Form*.[hC]: + * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation + scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to + provide a destructor for the struct FD_form_xxxx. Another version of + the set_[max|min]size workaround and a few other cleanups. Actually, + Angus' patch from 20000809. + +2000-08-13 Baruch Even + + * src/insets/insetgraphics.C (Clone): Added several fields that needed + copying. + +2000-08-11 Juergen Vigna + + * src/insets/insetgraphics.C (InsetGraphics): changing init + order because of warnings. + + * src/frontends/xforms/forms/makefile: adding patching .C with + .C.patch files. + + * src/frontends/xforms/forms/fdfix.sh: changing patching file .c + from .C.patch to .c.patch + + * src/frontends/xforms/FormCommand.C (FormCommand): changing init + order because of warning. + + * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog + + * src/frontends/Liason.C (setMinibuffer): new helper function + + * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument + + * src/lyxfunc.C (Dispatch): calling new Document-Layout + + * lib/ui/default.ui: commented out PaperLayout entry + + * src/frontends/xforms/form_document.[Ch]: new added files + + * src/frontends/xforms/FormDocument.[Ch]: ditto + + * src/frontends/xforms/forms/form_document.fd: ditto + + * src/frontends/xforms/forms/form_document.C.patch: ditto + +2000-08-10 Juergen Vigna + + * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle. + (InsetGraphics): initialized cacheHandle to 0. + (draw): changed call to updateInset to status=CHANGE_IN_DRAW. + +2000-08-10 Baruch Even + + * src/graphics/GraphicsCache.h: + * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work + correctly as a cache. + + * src/graphics/GraphicsCacheItem.h: + * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow + reference counting. + + * src/graphics/GraphicsCacheItem_pimpl.h: + * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the + GraphicsCacheItem. + + * src/insets/insetgraphics.h: + * src/insets/insetgraphics.C: Changed from using a signal notification + to polling when image is not loaded. + +2000-08-10 Allan Rae + + * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note + that there are two functions that have to been taken out of line by + hand and aren't taken care of in the script. (Just a reminder note) + + * sigc++/macros/*.h.m4: Updated as above. + +2000-08-09 Juergen Vigna + + * src/insets/insettext.C (draw): small fix for clearing rectangle. + + * src/insets/insettabular.C: make drawing of single cell smarter. + +2000-08-09 Marko Vendelin + * src/frontends/gnome/Menubar_pimpl.C + * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar + implementation: new files + + * src/frontends/gnome/mainapp.C + * src/frontends/gnome/mainapp.h: Gnome main window (temporary + implementation) + + * src/main.C: create Gnome main window + + * src/frontends/xforms/Menubar_pimpl.h + * src/frontends/Menubar.C + * src/frontends/Menubar.h: added method Menubar::update that calls + Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one) + + * src/LyXView.C: calls Menubar::update to update the state + of menu items + + * src/frontends/gnome/Makefile.am: added new files + + * src/frontends/Makefile.am: added frontend compiler options + +2000-08-08 Juergen Vigna + + * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled! + + * src/bufferlist.C (close): + * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed() + documents if exiting without saving. + + * src/buffer.C (save): use removeAutosaveFile() + + * src/support/filetools.C (removeAutosaveFile): new function. + + * src/lyx_cb.C (MenuWrite): returns a bool now. + (MenuWriteAs): check if file could really be saved and revert to the + old name if not. + (MenuWriteAs): removing old autosavefile if existant. + + * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration + before Goto toggle declaration, because of compiler warning. + + * src/frontends/xforms/FormRef.C: forgot include of + + * src/lyxfunc.C (MenuNew): small fix. + + * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag. + + * src/bufferlist.C (newFile): + * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc. + + * src/lyxrc.C: added new_ask_filename tag + +2000-08-07 Angus Leeming + + * src/lyx.fd: removed code pertaining to form_ref + * src/lyx.[Ch]: ditto + * src/lyx_cb.C: ditto + * src/lyx_gui.C: ditto + * src/lyx_gui_misc.C: ditto + + * src/BufferView_pimpl.C (restorePosition): update buffer only + if file has changed + + * src/commandtags.h (LFUN_REFTOGGLE): removed + (LFUN_INSERT_REF): renamed LFUN_REF_INSERT + (LFUN_REFGOTO): renamed LFUN_REF_GOTO + (LFUN_REFBACK): renamed LFUN_REF_BACK + + * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE + * src/menus.C: ditto + * src/lyxfunc.C (Dispatch): ditto. + InsertRef dialog is now GUI-independent. + + * src/texrow.C: added using std::endl; + + * src/insets/insetref.[Ch]: strip out large amounts of code. + The inset is now a container and this functionality is now + managed by a new FormRef dialog + + * src/frontends/Dialogs.h (showRef, createRef): new signals + + * src/frontends/xforms/FormIndex.[Ch], + src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug + when setting dialog's min/max size + * src/frontends/xforms/FormIndex.[Ch]: ditto + + * src/frontends/xforms/FormRef.[Ch], + src/frontends/xforms/forms/form_ref.fd: new xforms + implementation of an InsetRef dialog + + * src/graphics/GraphicsCache.[Ch]: small changes to compile with + DEC cxx + + * src/graphics/XPM_Renderer.C (isImageFormatOK): + ios::nocreate is not part of the standard. Removed. + +2000-08-07 Baruch Even + + * src/graphics/Renderer.h: + * src/graphics/Renderer.C: Added base class for rendering of different + image formats into Pixmaps. + + * src/graphics/XPM_Renderer.h: + * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed + in a different class. + + * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to + easily add support for other formats. + + * src/insets/figinset.C: plugged a leak of an X resource. + +2000-08-07 Lars Gullik Bjønnes + + * src/CutAndPaste.[Ch]: make all metods static. + + * development/Code_rules/Rules: more work, added section on + Exceptions, and a References section. + + * a lot of header files: work to make doc++ able to generate the + source documentation, some workarounds of doc++ problems. Doc++ is + now able to generate the documentation. + +2000-08-07 Juergen Vigna + + * src/insets/insettabular.C (recomputeTextInsets): removed function + + * src/tabular.C (SetWidthOfMulticolCell): + (SetWidthOfCell): + (calculate_width_of_column_NMC): fixed return value so that it really + only returns true if the column-width has changed (there where + problems with muliticolumn-cells in this column). + +2000-08-04 Juergen Vigna + + * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks + also on the scrollstatus of the inset. + (workAreaMotionNotify): ditto. + + * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2. + +2000-08-01 Juergen Vigna + + * src/insets/insettabular.C (resetPos): scroll tabular automatically. + + * src/commandtags.h: + * src/LyXAction.C (init): + * src/insets/inset.C (LocalDispatch): added support for + LFUN_SCROLL_INSET. + + * src/insets/inset.C (scroll): new functions. + + * src/insets/insettext.C (removeNewlines): new function. + (SetAutoBreakRows): removes forced newlines in the text of the + paragraph if autoBreakRows is set to false. + + * src/tabular.C (Latex): generates a parbox around the cell contents + if needed. + + * src/frontends/xforms/FormTabular.C (local_update): removed + the radio_useparbox button. + + * src/tabular.C (UseParbox): new function + +2000-08-06 Baruch Even + + * src/graphics/GraphicsCache.h: + * src/graphics/GraphicsCache.C: + * src/graphics/GraphicsCacheItem.h: + * src/graphics/GraphicsCacheItem.C: Made them to actually do something + usefull. + + * src/insets/insetgraphics.h: + * src/insets/insetgraphics.C: Added the use of the GraphicsCache + and the drawing of the inline image. + + * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be + loaded into the wrong position. + + * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now + launched. + +2000-08-05 Lars Gullik Bjønnes + + * src/support/translator.h: move all typedefs to public section + + * src/support/filetools.C (MakeLatexName): return string const + (QuoteName): ditto + (TmpFileName): ditto + (FileOpenSearch): ditto + (FileSearch): ditto + (LibFileSearch): ditto + (i18nLibFileSearch): ditto + (GetEnv): ditto + (GetEnvPath): ditto + (CreateTmpDir): ditto + (CreateBufferTmpDir): ditto + (CreateLyXTmpDir): ditto + (GetCWD): ditto + (OnlyPath): ditto + (MakeAbsPath): ditto + (AddName): ditto + (OnlyFilename): ditto + (ExpandPath): ditto + (NormalizePath): ditto + (CleanupPath): ditto + (GetFileContents): ditto + (ReplaceEnvironmentPath): ditto + (MakeRelPath): ditto + (AddPath): ditto + (ChangeExtension): ditto + (MakeDisplayPath): ditto + (do_popen): return cmdret const + (findtexfile): return string const + + * src/support/DebugStream.h: add some /// to please doc++ + + * src/frontends/DialogBase.h (endif): add some /// to please doc++ + + * src/texrow.C (same_rownumber): functor to use with find_if + (getIdFromRow): rewritten to use find_if and to not update the + positions. return true if row is found + (increasePos): new method, use to update positions + + * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable + + * src/lyxlex_pimpl.C (verifyTable): new method + (pushTable): use it + (Pimpl): use it + (GetString): return string const + (pushTable): rewrite to use std::stack + (popTable): ditto + (setFile): better check + (setStream): ditto + + * src/lyxlex.h: make LyXLex noncopyable + + * src/lyxlex.C (text): return char const * const + (GetString): return string const + (getLongString): return string const + + * src/lyx_gui_misc.C (askForText): return pair<...> const + + * src/lastfiles.[Ch] (operator): return string const + + * src/buffer.C (parseSingleLyXformat2Token): pass string to + istringstream not char const *. + move token.end() out of loop. + (readFile): move initializaton of token + + * src/BufferView2.C (insertErrors): run texrow.increasePos if + getIdFromRow is successful. + + * lib/bind/emacs.bind: don't include menus bind + + * development/Code_rules/Rules: the beginnings of making this + better and covering more of the unwritten rules that we have. + + * development/Code_rules/Recommendations: a couple of wording + changes. + +2000-08-04 Jean-Marc Lasgouttes + + * src/support/strerror.c: remove C++ comment. + +2000-08-04 Angus Leeming + + * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to + LFUN_INDEX_INSERT_LAST + + * src/texrow.C (getIdFromRow): changed from const_iterator to + iterator, allowing code to compile with DEC cxx + + * src/frontends/xforms/FormCitation.[Ch]: made vector + stores part of the class, as suggested by Allan. Will allow + multiple LyXViews. + (apply): test to apply uses InsetCommandParams operator!= + + * src/frontends/xforms/FormIndex.C: moved set_minsize into build + (apply): test to apply uses InsetCommandParams operator!= + + * src/frontends/xforms/FormToc.[Ch]: made vector + stores part of the class. + (update): removed limits on min/max size. + + * src/frontends/xforms/FormUrl.C: moved set_minsize into build + (apply): test to apply uses InsetCommandParams operator!= + + * src/insets/insetcommand.[Ch] InsetCommand made noncopyable + (Read, Write, scanCommand, getCommand): moved functionality + into InsetCommandParams. + (Clone): removed + (getScreenLabel): made pure virtual + new InsetCommandParams operators== and != + + * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new + c-tors based on InsetCommandParams. Removed others. + * src/insets/insetinclude.[Ch]: ditto + * src/insets/insetlabel.[Ch]: ditto + * src/insets/insetparent.[Ch]: ditto + * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C + + * src/buffer.C (parseSingleLyXformat2Token, readInset): all + insets derived from InsetCommand created using similar c-tors + based on InsetCommandParams + * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto + * src/menus.C (ShowRefsMenu): ditto + * src/paragraph.C (Clone): ditto + * src/text2.C (SetCounter): ditto + * src/lyxfunc.C (Dispatch) ditto + Also recreated old InsetIndex behaviour exactly. Can now + index-insert at the start of a paragraph and index-insert-last + without launching the pop-up. + +2000-08-03 Lars Gullik Bjønnes + + * lib/lyxrc.example: mark te pdf options as non functional. + + * src/support/lstrings.C (strToInt): move initalization of tmpstr + (isStrDbl): move tmpstr.end() out of loop. + (strToDbl): move intialization of tmpstr + (lowercase): return string const and move tmp.end() out of loop. + (uppercase): return string const and move tmp.edn() out of loop. + (prefixIs): add assertion + (suffixIs): ditto + (contains): ditto + (contains): ditto + (contains): ditto + (containsOnly): ditto + (containsOnly): ditto + (containsOnly): ditto + (countChar): make last arg char not char const + (token): return string const + (subst): return string const, move tmp.end() out of loop. + (subst): return string const, add assertion + (strip): return string const + (frontStrip): return string const, add assertion + (frontStrip): return string const + (split): ditto + (split): ditto + (rsplit): ditto + + * src/support/lstrings.C: add inclde "LAssert.h" + (isStrInt): move tmpstr.end() out of loop. + + * src/frontends/xforms/Toolbar_pimpl.C (activate): move + toollist.end() out of loop. + (deactivate): move toollist.end() out of loop. + (update): move toollist.end() out of loop. + (updateLayoutList): move tc.end() out of loop. + (add): move toollist.end() out of loop. + + * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move + md.end() out of loop. + + * src/texrow.h: make getIdFromRow const, make rowlist mutable. + + * src/texrow.C (getIdFromRow): make const, more rowlist.end() out + of loop. + + * src/paragraph.C (Erase): move fontlist.end() out of loop. + (Erase): move insetlist.end() out of loop. + + * src/lyx_sendfax_main.C: make show_logfile static and to take a + ref to const string as first arg. Move initialization of some + variables, whitespace changes. + + * src/kbmap.C (defkey): move table.end() out of loop. + (kb_keymap): move table.end() out of loop. + (findbinding): move table.end() out of loop. + + * src/MenuBackend.C (hasMenu): move end() out of loop. + (getMenu): move end() out of loop. + (getMenu): move menulist_.end() out of loop. + + * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out. + + * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end() + out of loop. + + * src/LColor.C (getFromGUIName): move infotab.end() out of loop. + (getFromLyXName): move infotab.end() out of loop. + + * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add + -fvtable-thunks -ffunction-sections -fdata-sections + +2000-08-03 Dekel Tsur + + * src/frontends/xforms/RadioButtonGroup.h: Changed to + FORMS_H_LOCATION. + +2000-08-03 Angus Leeming + + * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed + + * src/frontends/xforms/FormCitation.[Ch], + src/frontends/xforms/FormIndex.[Ch], + src/frontends/xforms/FormToc.[Ch], + src/frontends/xforms/FormUrl.[Ch] (d-tors): call free() + +2000-08-03 Angus Leeming + + * src/commandtags.h: renamed, created some flags for citation + and index + + * src/lyx_gui_misc.C: stripped out old FD_index_form code + + * src/lyxfunc.C (dispatch): use signals to insert index entry + + * src/frontends/Dialogs.h: new signal createIndex + + * src/frontends/xforms/FormCommand.[Ch], + src/frontends/xforms/FormCitation.[Ch], + src/frontends/xforms/FormToc.[Ch], + src/frontends/xforms/FormUrl.[Ch]: clean up and comment better + + * src/insets/insetindex.[Ch]: GUI-independent + + * src/frontends/xforms/FormIndex.[Ch], + * src/frontends/xforms/forms/form_index.fd: xforms implementation + of the Index dialog + +2000-08-01 Dekel Tsur + + * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect + before \overbrace, \underbrace, \overleftarrow, or \overrightarrow. + +2000-08-02 Lars Gullik Bjønnes + + * src/insets/insetref.C (Latex): rewrite so that there is now + question that a initialization is requested. + + * src/insets/insetcommand.h: reenable the hide signal + +2000-08-01 Jean-Marc Lasgouttes + + * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to + fix handling of shortcuts (many bugs :) + (add_lastfiles): ditto. + + * lib/ui/default.ui: fix a few shortcuts. + +2000-07-27 Kayvan A. Sylvan + + * Makefile.am: Fix ``rpmdist'' target to return the exit + status of the ``rpm'' command, instead of the last command in + the chain (the ``rm lyx.xpm'' command, which always returns + success). + +2000-08-02 Allan Rae + + * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables. + * src/frontends/xforms/FormCitation.C (FormCitation): ditto + * src/frontends/xforms/FormToc.C (FormToc): ditto + + * src/frontends/xforms/Makefile.am: A few forgotten files + + * src/frontends/xforms/FormCommand.C (showInset): The rest of the + Signals-not-copyable-problem Lars' started commenting out. + + * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx. + +2000-08-01 Lars Gullik Bjønnes + + * src/insets/insetcommand.h: Signals is not copyable so anoter + scheme for automatic hiding of forms must be used. + + * src/frontends/xforms/FormCitation.h: don't inerit from + noncopyable, FormCommand already does that. + * src/frontends/xforms/FormToc.h: ditto + * src/frontends/xforms/FormUrl.h: ditto + + * src/frontends/xforms/FormCitation.C: add include + +2000-08-01 Angus Leeming + + * src/insets/insetcommand.h (hide): new SigC::Signal0 + (d-tor) new virtual destructor emits hide signal + + * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed + * src/insets/inseturl.[Ch] (hide, d-tor): ditto + + * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA, + LOF and LOT. Inset is now GUI-independent + + * src/insets/insetloa.[Ch]: redundant + * src/insets/insetlof.[Ch]: ditto + * src/insets/insetlot.[Ch]: ditto + + * src/frontends/xforms/forms/form_url.fd: tweaked! + * src/frontends/xforms/forms/form_citation.fd: ditto + + * src/frontends/xforms/FormCommand.[Ch]: new base class to those + dialogs dealing with InsetCommand insets + + * src/frontends/xforms/FormCitation.[Ch]: now makes use of + FormCommand base class + * src/frontends/xforms/FormUrl.[Ch]: ditto + + * src/frontends/xforms/forms/form_toc.fd: Xforms implementation + of the TOC dialog + * src/frontends/xforms/FormToc.[Ch]: ditto + + * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all + passed a generic InsetCommand pointer + * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc + + * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class + and modified InsetTOC class + * src/buffer.C: ditto + + * forms/lyx.fd: strip out old FD_form_toc code + * src/lyx_gui_misc.C: ditto + * src/lyx_gui.C: ditto + * src/lyx_cb.C: ditto + * src/lyx.[Ch]: ditto + +2000-08-01 Lars Gullik Bjønnes + + * src/support/utility.hpp: tr -d '\r' + +2000-08-01 Juergen Vigna + + * src/insets/insettabular.h: removed initFeatures() as it's not needed. + + * src/commandtags.h: + * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and + LFUN_TABULAR_FEATURES. + + * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and + LFUN_LAYOUT_TABULAR. + + * src/insets/insettabular.C (getStatus): implemented helper function. + + * lib/ui/default.ui: implemented edit-table-menu and layout-tabular. + +2000-07-31 Juergen Vigna + + * src/text.C (draw): fixed screen update problem for text-insets. + + * src/text2.C (SetParagrpah): call an update of the inset-owner when + something changed probably this has to be added in various other + functions too. + + * src/insets/insettext.C (cy): fixed to give back the right cursor.y(). + +2000-07-31 Baruch Even + + * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew + templates to satisfy compaq cxx. + + +2000-07-31 Lars Gullik Bjønnes + + * src/support/translator.h (equal_1st_in_pair::operator()): take + const ref pair_type as arg. + (equal_2nd_in_pair::operator()): ditto + (Translator::~Translator): remove empty d-tor. + + * src/graphics/GraphicsCache.C: move include config.h to top, also + put initialization of GraphicsCache::singleton here. + (~GraphicsCache): move here + (addFile): take const ref as arg + (removeFile): ditto + + * src/lyxlex_pimpl.C (setFile): comment in old behaviour + + * src/BufferView2.C (insertLyXFile): change te with/without header + check slightly. + +2000-07-31 Jean-Marc Lasgouttes + + * src/frontends/xforms/FormGraphics.C (apply): add some + static_cast. Not very nice, but required by compaq cxx. + + * src/frontends/xforms/RadioButtonGroup.h: include header + instead of + + * src/insets/insetgraphicsParams.C: add using directive. + (readResize): change return type to void. + (readOrigin): ditto. + + * src/lyxfunc.C (getStatus): add missing break for build-program + function; add test for Literate for export functions. + + * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid + entries in Options menu. + +2000-07-31 Baruch Even + + * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=): + protect against auto-allocation; release icon when needed. + +2000-07-31 Matej Cepl + + * lib/kbd/czech.kmap: new file. standard Czech keyboard as found + on usual typewriter. + + * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the + earlier czech.kmap), useful only for programming. + +2000-07-28 Jean-Marc Lasgouttes + + * src/frontends/xforms/FormCitation.h: fix conditioning around + #pragma. + +2000-07-31 Juergen Vigna + + * src/frontends/xforms/FormTabular.C (local_update): changed + radio_linebreaks to radio_useparbox and added radio_useminipage. + + * src/tabular.C: made support for using minipages/parboxes. + + * src/bufferlist.C (QwriteAll): small fix for asking for save. + + * src/insets/insetgraphics.C (draw): just draw the inset so that the + cursor is visible. + (descent): so the cursor is in the middle. + (width): bit smaller box. + + * src/insets/insetgraphics.h: added display() function. + +2000-07-31 Baruch Even + + * src/frontends/Dialogs.h: Added showGraphics signals. + + * src/frontends/xforms/forms/form_graphics.fd: Added file, the + xforms form definition of the graphics dialog. + + * src/frontends/xforms/FormGraphics.h: + * src/frontends/xforms/FormGraphics.C: Added files, the + GUIndependent code of InsetGraphics + + * src/insets/insetgraphics.h: + * src/insets/insetgraphics.C: Major writing to make it work. + + * src/insets/insetgraphicsParams.h: + * src/insets/insetgraphicsParams.C: Added files, parameter passing + struct between InsetGraphics and GUI. + + * src/LaTeXFeatures.h: + * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled + support for graphicx package. + + * src/buffer.C (parseSingleLyXformat2Token): Fixed read support + for the graphics inset. + + * src/support/translator.h: Added file, used in + InsetGraphicsParams. this is a template to translate between two + types. + + * src/frontends/xforms/RadioButtonGroup.h: + * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a + way to easily control a radio button group. + +2000-07-28 Juergen Vigna + + * src/insets/insettabular.C (LocalDispatch): + (TabularFeatures): added support for lyx-functions of tabular features. + (cellstart): refixed this function after someone wrongly changed it. + + * src/commandtags.h: + * src/LyXAction.C (init): added support for tabular-features + +2000-07-28 Allan Rae + + * src/frontends/xforms/FormPreferences.C (build): Setup input return + checking. NOTE: It seems that pressing ESC to cancel the dialog also + triggers the callback for input checking. As a result we sometimes get + "LyX: This shouldn't happen..." printed to cerr. + (input): Started using status variable since I only free() on + destruction. Some input checking for paths and font sizes. + + * src/frontends/xforms/FormPreferences.h: Use status to control + activation of Ok and Apply + + * src/frontends/xforms/forms/form_preferences.fd: Setup input return + callback. Also resized to stop segfaults with 0.88. The problem is + that xforms-0.88 requires the folder to be wide enough to fit all the + tabs. If it isn't it causes all sorts of problems. + + * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form... + + * src/frontends/xforms/forms/README: Reflect reality. + + * src/frontends/xforms/forms/fdfix.sh: Clean up comments + * src/frontends/xforms/forms/makefile: ditto. + + * src/commandtags.h: Get access to new Preferences dialog + * src/LyXAction.C: ditto + * src/lyxfunc.C: ditto + * lib/ui/default.ui: ditto + +2000-07-27 Jean-Marc Lasgouttes + + * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh. + + * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a + few files. + + * src/frontends/xforms/form_url.[Ch]: added. + +2000-07-27 Lars Gullik Bjønnes + + * src/insets/insetbib.h: fixed bug in previous commit + + * src/frontends/xforms/FormUrl.h: ditto + + * src/frontends/xforms/FormPrint.h: ditto + + * src/frontends/xforms/FormPreferences.h: ditto + + * src/frontends/xforms/FormCopyright.h: ditto + + * src/frontends/xforms/FormCitation.C: ditto + + * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove + private copyconstructor and private default contructor + + * src/support/Makefile.am: add utility.hpp + + * src/support/utility.hpp: new file from boost + + * src/insets/insetbib.h: set owner in clone + + * src/frontends/xforms/FormCitation.C: added missing include + algorithm + + * src/insets/form_url.[Ch]: removed + +2000-07-26 Kayvan A. Sylvan + + * development/lyx.spec.in + * Makefile.am: Fix buglet for LyX RPM generation resulting from + file/directory re-organization. + +2000-07-26 Angus Leeming + + * src/insets/insetcommand.[Ch]: moved the string data and + associated manipulation methods into a new stand-alone class + InsetCommandParams. This class has two additional methods + getAsString() and setFromString() allowing the contents to be + moved around as a single string. + (addContents) method removed. + (setContents) method no longer virtual. + + * src/buffer.C (readInset): made use of new InsetCitation, + InsetUrl constructors based on InsetCommandParams. + + * src/commandtags.h: add LFUN_INSERT_URL + + * src/lyxfunc.C (Dispatch): changed to accomadate GUI- + independent InsetUrl and use InsetCommandParams to extract + string info and create new Insets. + + * src/frontends/Dialogs.h: add signals showUrl, createUrl. + + * src/frontends/xforms/FormCitation.C (apply): uses + InsetCommandParams. + + * src/frontends/xforms/form_url.C + * src/frontends/xforms/form_url.h + * src/frontends/xforms/FormUrl.h + * src/frontends/xforms/FormUrl.C + * src/frontends/xforms/forms/form_url.fd: new files + + * src/insets/insetcite.[Ch]: removed unused constructors. + + * src/insets/insetinclude.[Ch]: no longer store filename + + * src/insets/inseturl.[Ch]: GUI-independent. + +2000-07-26 Juergen Vigna + * renamed frontend from gtk to gnome as it is that what is realized + and did the necessary changes in the files. + +2000-07-26 Marko Vendelin + * autogen.sh + * configure.in: cleaning up gnome configuration scripts + +2000-07-26 Jean-Marc Lasgouttes + + * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing + shortcuts syndrom by redrawing them explicitely (a better solution + would be appreciated). + + * src/lyxfunc.C (getStatus): fix crash when functions are disabled. + + * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of + the button. + + * src/lyx_cb.C (MenuExport): change html export to do the right + thing depending of the document type (instead of having + html-linuxdoc and html-docbook). + * src/lyxfunc.C (getStatus): update for html + * lib/ui/default.ui: simplify due to the above change. + * src/menus.C (ShowFileMenu): update too (in case we need it). + + * src/MenuBackend.C (read): if a menu is defined twice, add the + new entries to the exiting one. + +2000-07-26 Juergen Vigna + + * src/buffer.h: added functions setUnnamed(bool) and isUnnamed(). + + * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs + and return a bool if it did actual save the file. + (AutoSave): don't autosave a unnamed doc. + + * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll): + check if this is an UNNAMED new file and react to it. + (newFile): set buffer to unnamed and change to not mark a new + buffer dirty if I didn't do anything with it. + + * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new. + +2000-07-26 Lars Gullik Bjønnes + + * src/frontends/Menubar.h: make "struct Pimpl;" public + the + friend as per Angus's patch posted to lyx-devel. + + * src/ext_l10n.h: updated + + * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run + gettext on the style string right before inserting them into the + combox. + + * autogen.sh: add code to extract style strings form layout files, + not good enough yet. + + * src/frontends/gtk/.cvsignore: add MAKEFILE + + * src/MenuBackend.C (read): run the label strings through gettext + before storing them in the containers. + + * src/ext_l10n.h: new file + + * autogen.sh : generate the ext_l10n.h file here + +2000-07-25 Jean-Marc Lasgouttes + + * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color + arguments. + + * lib/ui/default.ui: fix a couple of typos. + + * config/gnome/gtk.m4: added (and added to the list of files in + autogen.sh). + + * src/insets/insetinclude.C (unique_id): fix when we are using + lyxstring instead of basic_string<>. + * src/insets/insettext.C (LocalDispatch): ditto. + * src/support/filetools.C: ditto. + + * lib/configure.m4: create the ui/ directory if necessary. + + * src/LyXView.[Ch] (updateToolbar): new method. + + * src/BufferView_pimpl.C (buffer): update the toolbar when + opening/closing buffer. + +2000-07-24 Jean-Marc Lasgouttes + + * src/LyXAction.C (getActionName): enhance to return also the name + and options of pseudo-actions. + (init): New lyxfunc LFUN_MATH_PANEL=="math-panel". + + * lib/ui/default.ui: use OptItem in the vc submenu (intented just + as an example of what is possible). Used in File->Build too (more + useful) and in the import/export menus (to mimick the complicated + handling of linuxdoc and friends). Try to update all the entries. + + * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle + optional entries. + + * src/MenuBackend.C (read): Parse the new OptItem tag. + + * src/MenuBackend.h: Add a new optional_ data member (used if the + entry should be omitted when the lyxfunc is disabled). + + * src/frontends/xforms/Menubar_pimpl.C (string_width): new + function, used as a shortcut. + (create_submenu): align correctly the shortcuts on the widest + entry. + + * src/MenuBackend.h: MenuItem.label() only returns the label of + the menu without shortcut; new method shortcut(). + +2000-07-14 Marko Vendelin + + * src/frontends/gtk/Dialogs.C: + * src/frontends/gtk/FormCopyright.C: + * src/frontends/gtk/FormCopyright.h: + * src/frontends/gtk/Makefile.am: added these source-files for the + Gtk/Gnome support of the Copyright-Dialog. + + * src/main.C: added Gnome::Main initialization if using + Gtk/Gnome frontend-GUI. + + * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome + frontend-GUI. + * config/gnome/aclocal-include.m4 + * config/gnome/compiler-flags.m4 + * config/gnome/curses.m4 + * config/gnome/gnome--.m4 + * config/gnome/gnome-bonobo-check.m4 + * config/gnome/gnome-common.m4 + * config/gnome/gnome-fileutils.m4 + * config/gnome/gnome-ghttp-check.m4 + * config/gnome/gnome-gnorba-check.m4 + * config/gnome/gnome-guile-checks.m4 + * config/gnome/gnome-libgtop-check.m4 + * config/gnome/gnome-objc-checks.m4 + * config/gnome/gnome-orbit-check.m4 + * config/gnome/gnome-print-check.m4 + * config/gnome/gnome-pthread-check.m4 + * config/gnome/gnome-support.m4 + * config/gnome/gnome-undelfs.m4 + * config/gnome/gnome-vfs.m4 + * config/gnome/gnome-x-checks.m4 + * config/gnome/gnome-xml-check.m4 + * config/gnome/gnome.m4 + * config/gnome/gperf-check.m4 + * config/gnome/gtk--.m4 + * config/gnome/linger.m4 + * config/gnome/need-declaration.m4: added configuration scripts + for Gtk/Gnome frontend-GUI + + * configure.in: added support for the --with-frontend=gtk option + + * autogen.sh: added config/gnome/* to list of config-files + + * acconfig.h: added define for GTKGUI-support + + * config/lyxinclude.m4: added --with-frontend[=value] option value + for Gtk/Gnome frontend-GUI support. + +2000-07-25 Lars Gullik Bjønnes + + * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring + can be used. + (suffixIs): ditto + + * src/paragraph.C (GetChar): remove non-const version + + * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96 + (search_kw): use it. + + * src/lyx_main.C (init): if "preferences" exist, read that instead + of "lyxrc". + (ReadRcFile): return bool if the file could be read ok. + (ReadUIFile): add a check to see if lex file is set ok. + + * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc + bastring can be used instead of lyxstring (still uses the old code + if std::string is good enough or if lyxstring is used.) + + * src/encoding.C: make the arrays static, move ininle functions + here + * src/encoding.h: from here. + + * src/buffer.C: have last_isnet_read as a file scope variable for now. + (parseSingleLyXformat2Token): move inset parsing to separate method + (readInset): new private method + + * src/Variables.h: remove virtual from get(). + + * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get + access to NEW_INSETS and NEW_TABULAR + + * src/MenuBackend.h: remove superfluous forward declaration of + MenuItem. Add documentations tags "///", remove empty MenuItem + destructor, remove private default contructor. + + * src/MenuBackend.C (MenuItem): remove unneeded copy contructor + (add): return *this + (read): more string mlabel and mname to where they are used + (read): remove unused variables mlabel and mname + (defaults): unconditional clear, make menusetup take advantage of + add returning Menu &. + + * src/LyXView.h: define NEW_MENUBAR as default + + * src/LyXAction.C: include lyxparagraph.h temporary to get access + to NEW_INSETS and NEW_TABULAR. + (init): commetn out some funcs that is obsolete when NEW_INSETS is + defined. Change some of the "xxxx-inset-insert" functions names to + "xxxx-insert". + + * several files: more enahncements to NEW_INSETS and the resulting + LyXParagraph code. + + * lib/lyxrc.example (\date_insert_format): move to misc section + + * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc + bastring and use AC_CACHE_CHECK. + (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of + the system have the newest methods. uses AC_CACHE_CHECK + (LYX_CXX_MUTABLE): use AC_CACHE_CHECK + (LYX_CXX_PARTIAL): use AC_CACHE_CHECK + (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK + + * configure.in: add LYX_CXX_GOOD_STD_STRING + + * acinclude.m4: recreated + +2000-07-24 Amir Karger + + * README: add Hebrew, Arabic kmaps + * ANNOUNCE: typo + +2000-07-24 Jean-Marc Lasgouttes + + * src/buffer.C (writeFileAscii): Define actcell as an int instead + of int*. + +2000-07-23 Jean-Marc Lasgouttes + + * Lot of files: add pragma interface/implementation. + + * src/lyx_main.C (ReadUFile): new method. Read the UI file. + + * lib/ui/default.ui: new file (ans new directory). Contains the + default menu and toolbar. + + * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to + global space. Toolbars are now read (as menus) in ui files. + + * src/debug.C: change Debug::TOOLBAR to Debug::GUI. + + * src/lyxfunc.C (getStatus): do not exit immediately if a command + is disabled because the document is read-only. We want to have the + toggle state of the function anyway. + (getStatus): add code for LFUN_VC* functions (mimicking what is + done in old-style menus) + + * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER, + LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN. + + * src/LyXView.[Ch]: add code for the NEW_MENUBAR define. + * src/BufferView_pimpl.C: ditto. + * src/lyxfunc.C: ditto. + + * src/LyXView.h: add a define NEW_MENUBAR (commented out by + default). This replaces old-style menus by new ones. + + * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and + MenuItem. Contain the data structure of a menu. + + * src/insets/insettext.C: use LyXView::setLayout instead of + accessing directly the toolbar combox. + * src/lyxfunc.C (Dispatch): ditto. + + * src/LyXView.C (setLayout): new method, which just calls + Toolbar::setLayout(). + (updateLayoutChoice): move part of this method in Toolbar. + + * src/toolbar.[Ch]: removed. + + * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms + implementation the toolbar. + + * src/frontend/Toolbar.[Ch]: new files. The abstract interface of + the toolbar. It might make sense to merge it with ToolbarDefaults + later. + (setLayout): new function. + (updateLayoutList): ditto. + (openLayoutList): ditto. + + * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the + xforms implementation of the toolbar. + (get_toolbar_func): comment out, since I do not + know what it is good for. + + * src/ToolbarDefaults.h: Add the ItemType enum. + + * src/support/StrPool.[Ch]: new class. Acts as a reference holder + for a list of allocated C strings. Used in Menubar xforms + implementation to avoid memory leaks. + + * src/support/lstrings.[Ch] (uppercase): new version taking and + returning a char. + (lowercase): ditto. + + * lib/bind/xemacs.bind: remove bogus binding for lyx-quit. + * lib/bind/emacs.bind: ditto. + +2000-07-21 Lars Gullik Bjønnes + + * src/toolbar.h: include commandtags.h instead of lyxfunc.h, + forward decl of LyXView. + + * src/toolbar.C (toolbarItem): moved from toolbar.h + (toolbarItem::clean): ditto + (toolbarItem::~toolbarItem): ditto + (toolbarItem::operator): ditto + + * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff + + * src/paragraph.h: control the NEW_TABULAR define from here + + * src/buffer.C: remove define USE_PARSE_FUNCTION, change + USE_TABULAR_INSETS to NEW_TABULAR + + * src/ToolbarDefaults.C: add include "lyxlex.h" + + * files using the old table/tabular: use NEW_TABULAR to control + compilation of old tabular stuff. + + * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef + to correct place. + + * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the + planemet in reading of old style floats, fix the \end_deeper + problem when reading old style floats. + +2000-07-20 Lars Gullik Bjønnes + + * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif + +2000-07-20 Serge Winitzki + + * lib/bind/sciword.bind: updated. + +2000-07-20 Lars Gullik Bjønnes + + * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the + layout write problem + +2000-07-20 Jean-Marc Lasgouttes + + * src/Makefile.am (INCLUDES): remove image directory from include + path. + + * src/bullet_forms.C (create_form_form_bullet): small cleanup. + * src/bullet_forms_cb.C (BulletPanelCB): ditto. + + * src/LyXView.C (create_form_form_main): read the application icon + from the disk. + + * lib/images/*.xpm: change the icons to use transparent color for + background. + + * src/toolbar.C (update): change the color of the button when it + is toggled on. + +2000-07-20 Jean-Marc Lasgouttes + + * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of + setting explicitely the minibuffer. + * src/BufferView_pimpl.C (workAreaButtonRelease): ditto. + + * src/LyXView.C (showState): new function. Shows font information + in minibuffer and update toolbar state. + (LyXView): call Toolbar::update after creating the + view. + + * src/toolbar.C: change toollist to be a vector instead of a + linked list. + (BubbleTimerCB): get help string directly from the callback + argument of the corresponding icon (which is the action) + (set): remove unnecessary ugliness. + (update): new function. update the icons (depressed, disabled) + depending of the status of the corresponding action. + + * src/toolbar.h: remove help in toolbarItem + +2000-07-19 Dekel Tsur + + * src/Painter.C (text): Added code for using symbol glyphs from + iso10646 fonts. Currently diabled. + + * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and + symbol_encoding. + + * src/language.C (initL): Fixed encodings for esperanto,lsorbian, + magyar,turkish and usorbian. + + * src/paragraph.C (isMultiLingual): Made more efficient. + + * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek + keyboard. + + * src/mathed/math_symbols.C (math_insert_greek): Changed to use + LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol(). + Also changed the prototype to "bool math_insert_greek(char)". + +2000-07-19 Lars Gullik Bjønnes + + * lots of files: apply the NEW_INSETS on all code that will not be + needed when we move to use the new insets. Enable the define in + lyxparagrah.h to try it. + + * src/insets/insettabular.C (cellstart): change to be a static + inline function + (InsetTabular): initialize buffer in the initializer list. + +2000-07-19 Angus Leeming + + * src/frontends/xforms/FormPrint.[Ch] : moved #include + form_print.h out of the header file. Replaced with forward + declarations of the relevant struct. + + * src/frontends/xforms/FormPreferences.[Ch] : ditto for + form_preferences.h. + + * src/commandtags.h: do not include "debug.h" which does not + belong there. #include it in some other places because of this + change. + +2000-07-19 Jean-Marc Lasgouttes + + * src/insets/insetcaption.C: add a couple "using" directives. + + * src/toolbar.C (add): get the help text directly from lyxaction. + (getPixmap): nuked. + (setPixmap): new function. Loads from disk and sets a pixmap on a + botton; the name of the pixmap file is derived from the command + name. + + * src/toolbar.h: remove members isBitmap and pixmap from + toobarItem struct. + + * lib/images/*.xbm *_bw.xpm: remove (not used any more). + * lib/images/: move many files from images/banner.xpm. + + * src/lyx_gui.C (create_forms): read banner pixmap from file. + + * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support. + * src/toolbar.C: ditto. + * configure.in: ditto. + * INSTALL: document. + + * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when + the spellchecker popup is closed from the WM. + +2000-07-19 Juergen Vigna + + * src/insets/insetfloat.C (Write): small fix because we use the + insetname for the type now! + +2000-07-18 Angus Leeming + + * src/frontends/xforms/forms/form_citation.fd: object sizes are + now set here + + * src/frontends/Dialogs.h: removed hideCitation signal + + * src/insets/insetcite.h: added hide signal + + * src/insets/insetcite.C (~InsetCitation): emits new signal + (getScreenLabel): "intelligent" label should now fit on the screen! + + * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed + + * src/frontends/xforms/FormCitation.C (showInset): connects + hide() to the inset's hide signal + (show): modified to use fl_set_object_position rather than + fl_set_object_geometry wherever possible + +2000-07-18 Lars Gullik Bjønnes + + * src/insets/lyxinset.h: add caption code + + * src/insets/insetfloat.C (type): new method + + * src/insets/insetcaption.C (Write): new method + (Read): new method + (LyxCode): new method + + * src/text2.C (SetCounter): revert Jürgens code, but use his idea + to get it right together with using the FloatList. + + * src/commandtags.h: add LFUN_INSET_CAPTION + * src/lyxfunc.C (Dispatch): handle it + + * src/buffer.C (parseSingleLyXformat2Token): add code to read a + caption inset. + + * src/Variables.[Ch]: make expand take a const reference, remove + the destructor, some whitespace changes. + + * src/LyXAction.C (init): add caption-inset-insert + + * src/FloatList.C (FloatList): update the default floats a bit. + +2000-07-17 Jean-Marc Lasgouttes + + * src/Variables.[Ch]: new files. Intended to be used for language + specific strings (like \chaptername) and filename substitution in + commands. + + * src/trans.C (AddDeadkey): replace keyword "all" with "native" in + kmap files. + * lib/kbd/american.kmap: update + + * src/trans_mgr.C (normalkey): do not test allowAccent anymore. + + * src/bufferparams.[Ch]: remove member allowAccents. + + * src/menus.C (ShowOptionsMenu): remove the LaTeX entry. + + * src/LaTeXLog.C: use the log_form.h header. + * src/lyx_gui.C: ditto. + * src/lyx_gui_misc.C: ditto. + * src/lyxvc.h: ditto. + + * forms/log_form.fd: new file, created from latexoptions.fd. I + kept the log popup and nuked the options form. + + * src/{la,}texoptions.[Ch]: removed. + * src/lyx_cb.C (LaTeXOptions): ditto + + * src/lyx_gui.C (create_forms): do not handle the + fd_latex_options form. + +2000-07-18 Juergen Vigna + + * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the + name of the inset so that it can be requested outside (text2.C). + + * src/text2.C (SetCounter): modified so it sees insetfloat for caption + labels. + +2000-07-17 Lars Gullik Bjønnes + + * src/mathed/formula.h (ConvertFont): constify + + * src/mathed/formula.C (Read): add warning if \end_inset is not + found on expected place. + + * src/insets/lyxinset.h (ConvertFont): consify + + * src/insets/insetquotes.C (ConvertFont): constify + * src/insets/insetquotes.h: ditto + + * src/insets/insetinfo.h: add labelfont + + * src/insets/insetinfo.C (InsetInfo): set the labelfont + (ascent): use labelfont + (descent): likewise + (width): likewise + (draw): likewise + (Write): make .lyx file a bit nicer + + * src/insets/insetfloat.C (Write): simplify somewhat... + (Read): add warning if arg is not found + + * src/insets/insetcollapsable.C: add using std::max + (Read): move string token and add warning in arg is not found + (draw): use std::max to get the right ty + (getMaxWidth): simplify by using std::max + + * src/insets/insetsection.h: new file + * src/insets/insetsection.C: new file + * src/insets/insetcaption.h: new file + * src/insets/insetcaption.C: new file + + * src/insets/inset.C (ConvertFont): constify signature + + * src/insets/Makefile.am (libinsets_la_SOURCES): add + insetcaption.[Ch] and insetsection.[Ch] + + * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all + uses to use LABEL_COUNTER_CHAPTER instead. + * src/text2.C (SetCounter): here + + * src/counters.h: new file + * src/counters.C: new file + * src/Sectioning.h: new file + * src/Sectioning.C: new file + + * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch] + +2000-07-17 Jean-Marc Lasgouttes + + * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir}, + not always in "."! + + * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of + the last argument. + +2000-07-17 Juergen Vigna + + * src/tabular.C (Validate): check if array-package is needed. + (SetVAlignment): added support for vertical alignment. + (SetLTFoot): better support for longtable header/footers + (Latex): modified to support added features. + + * src/LaTeXFeatures.[Ch]: added array-package. + +2000-07-17 R. Lahaye + + * src/lyx_gui.C (LyXGUI): make sure that the height is large + enough. + +2000-07-17 Kayvan Sylvan + + * configure.in: do not forget to put a space after -isystem. + +2000-07-10 Dekel Tsur + + * lib/kbd/arabic.kmap: a few fixes. + +2000-07-16 Lars Gullik Bjønnes + + * some whitespace chagnes to a number of files. + + * src/support/DebugStream.h: change to make it easier for + doc++ to parse correctly. + * src/support/lyxstring.h: ditto + + * src/mathed/math_utils.C (compara): change to have only one + operator() + (MathedLookupBOP): change because of the above. + + * src/mathed/math_delim.C (math_deco_compare): change to have only + one operator() + (search_deco): change becasue of the above. + + * src/insets/insettabular.C (DrawCellSelection): use std::swap + instead of manually coded one. + + * src/insets/insetquotes.C (Read): read the \end_inset too + + * src/insets/insetlatex.h: remove file + * src/insets/insetlatex.C: remove file + + * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default + constructor + (InsetPrintIndex): remove destructor + + * src/insets/insetinclude.h: remove default constructor + + * src/insets/insetfloat.C: work to make it work better + + * src/insets/inseterror.[Ch] (InsetError): remove default constructor + + * src/insets/insetcite.h (InsetCitation): remove default constructor + + * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor + + * src/text.C (GetColumnNearX): comment out some currently unused code. + + * src/paragraph.C (writeFile): move some initializations closer to + first use. + (CutIntoMinibuffer): small change to use new matchIT operator + (Erase): ditto + (Erase): ditto + (InsertChar): ditto + (InsertInset): ditto + (GetInset): ditto + (GetInset): ditto + (InsetIterator): ditto + (Erase): small change to use new matchFT operator + (InsertChar): ditto + (GetFontSettings): ditto + (HighestFontInRange): ditto + (SetFont): ditto + + * src/lyxparagraph.h: some chars changed to value_type + (matchIT): because of some stronger checking (perhaps too strong) + in SGI STL, the two operator() unified to one. + (matchFT): ditto + + * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved + + * src/buffer.C (parseSingleLyXformat2Token): static string to hold + the last inset read added + (parseSingleLyXformat2Token): some more (future) compability code added + (parseSingleLyXformat2Token): warning about solitary \end_inset added + (parseSingleLyXformat2Token): set last_inset_read + (parseSingleLyXformat2Token): more code to read new "Float" correctly + (parseSingleLyXformat2Token): don't double intializw string next_token + + * src/TextCache.C (text_fits::operator()): add const's to the signature + (has_buffer::operator()): ditto + + * src/Floating.h: add some comments on the class + + * src/FloatList.[Ch] (typeExist): new method + (getType): ditto + + * src/BackStack.h: added default constructor, wanted by Gcc. + +2000-07-14 Juergen Vigna + + * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts. + + * src/frontends/xforms/forms/form_tabular.fd: updated a bit. + + * src/insets/insettabular.C (resizeLyXText): need this to be able to + do a redraw when the window is resized! + (LocalDispatch): small fix so LFUN_TAB works only with locked_inset. + + * src/insets/insettext.C (resizeLyXText): added function to correctly + being able to resize the LyXWindow. + + * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr) + +2000-07-13 Angus Leeming + + * src/frontends/Dialogs.h (hideCitation) : new signal to prevent + crashes when closing dialog to a deleted inset. + + * src/insets/insetcite.[Ch] (Edit) : the return of this former + method! Now similar to other insets. + +2000-07-13 Juergen Vigna + + * src/text.C (GetVisibleRow): fixed clearing of rows with insets! + + * lib/examples/Literate.lyx: small patch! + + * src/insets/insetbib.C (Read): added this function because of wrong + Write (without [begin|end]_inset). + +2000-07-11 Juergen Vigna + + * src/BufferView2.C (open_new_inset): changed to a bool returnvalue + as the insertInset could not be good! + + * src/screen.C (ToggleSelection): fixed toggle selection bug as + the bool param should not be last. + +2000-07-10 Jean-Marc Lasgouttes + + * sigc++/configure.in: fix bug in threading-related code (Yes, I + did submit that to Karl). + + * configure.in: use -isystem instead of -I for X headers. This + fixes a problem on solaris with a recent gcc; + put the front-end code after the X detection code; + configure in sigc++ before lib/ + + * src/lyx_main.C (commandLineHelp): remove -display from command + line help. + +2000-07-09 Kayvan A. Sylvan + + * lib/Makefile.am: added lib/build-listerrors to DIST tarfile. + Also put in Makefile rules for building the ``listerrors'' + program for parsing errors from literate programs written in LyX. + + * lib/build-listerrors: Added small shell script as part of compile + process. This builds a working ``listerrors'' binary if noweb is + installed and either 1) the VNC X server is installed on the machine, + or 2) the user is compiling from within a GUI. The existence of a GUI + is necessary to use the ``lyx --export'' feature for now. This + hack can be removed once ``lyx --export'' no longer requires a GUI to + function. + +2000-07-09 Bernard Michael Hurley + + * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are + now passed back correctly from gcc and placed "under" error + buttons in a Literate LyX source. + +2000-07-08 Dekel Tsur + + * src/text.C (GetColumnNearX): Better behavior when a RTL + paragraph is ended by LTR text. + + * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern): + Ditto + +2000-07-08 Dekel Tsur + + * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to + true when clipboard is empty. + +2000-07-08 Dekel Tsur + + * text.C (Backspace): Prevent rebreaking of a row if it is the last + row of the paragraph. + (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false + to prevent calculation of bidi tables + +2000-07-07 Juergen Vigna + + * src/screen.C (ToggleSelection): added y_offset and x_offset + parameters. + + * src/insets/insettext.C (InsetMotionNotify): fixed selection with + mouse. + + * src/text.C (GetVisibleRow): fixed selection drawing in insets. + + * src/insets/insettext.C: fixed Layout-Display! + +2000-07-07 Jean-Marc Lasgouttes + + * configure.in: add check for strings.h header. + + * src/spellchecker.C: include in order to have a + definition for bzero(). + +2000-07-07 Juergen Vigna + + * src/insets/insettext.C (draw): set the status of the bv->text to + CHANGED_IN_DRAW if top_x changed and so a reinit is necessary. + + * src/screen.C (DrawOneRow): + (DrawFromTo): redraw the actual row if something has changed in it + while drawing. + + * src/text.C (draw): call an update of the toplevel-inset if something + has changed inside while drawing. + + * src/lyxtext.h: added CHANGED_IN_DRAW status. + +2000-07-06 Angus Leeming + + * src/insets/insetbib.[Ch] (callback) new method, moving callback + processing inside class. + + * src/insets/insetindex.[Ch] (callback) new method, moving callback + processing inside class. + + * src/insets/insetindex.h new struct Holder, consistent with other + insets. + + * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms + citation dialog from main code and placed it in src/frontends/xforms. + Dialog launched through signals instead of callbacks + +2000-07-06 R. Lahaye + + * lyx.man: update the options description. + +2000-07-05 R. Lahaye + + * src/lyx_gui.C src/lyx_main.C: improve the -geometry support, + handle neg values, set min width to 590, add doc about -display + +2000-07-05 Juergen Vigna + + * src/insets/lyxinset.h: changed Painter & in ascent(), descent() + calls to BufferView *. + + * src/insets/insettext.C (checkAndActivateInset): small fix non + HIGHLY_EDITABLE insets should not be entered by cursor-move-over! + + * src/insets/insetcommand.C (Read): Fixed as insets should read till + their \end_inset token! + +2000-07-04 edscott + + * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C, + lib/lyxrc.example: added option \wheel_jump + +2000-07-04 R. Lahaye + + * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and + remove support for -width,-height,-xpos and -ypos. + +2000-07-01 Dekel Tsur + + * src/encoding.[Ch]: New files. + + * src/painter.C (text(int,int,XChar2b const *,...)): New method. + (text): Call to the underline() method only when needed. + + * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods. + + * src/buffer.C (makeLaTeXFile): Compute automatically the input + encoding(s) for the document. + + * src/bufferparams.C (BufferParams): Changed default value of + inputenc to "auto". + + * src/language.C (newLang): Removed. + (items[]): Added encoding information for all defined languages. + + * src/lyx_gui.C (create_forms): Added "auto" option to the input + encoding choice button. + + * src/lyxrc.h (font_norm_type): New member variable. + (set_font_norm_type): New method. + + * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between + paragraphs with different encodings. + + * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C + (TransformChar): Changed to work correctly with Arabic points. + (draw): Added support for drawing Arabic points. + (draw): Removed code for drawing underbars (this is done by + the Painter!) + + * src/support/textutils.h (IsPrintableNonspace): New function. + + * src/BufferView_pimpl.h: Added "using SigC::Object". + * src/LyXView.h: ditto. + + * src/insets/insetinclude.h (include_label): Changed to mutable. + +2000-07-04 Lars Gullik Bjønnes + + * src/mathed/math_iter.h: remove empty destructor + + * src/mathed/math_cursor.h: remove empty destructor + + * src/insets/lyxinset.h: add THEOREM_CODE + + * src/insets/insettheorem.[Ch]: new files + + * src/insets/insetminipage.C: (InsertInset): remove + + * src/insets/insetmarginal.C: inherit from InsetFootLike instead + of InsetCollapsable + (InsertInset): remove + + * src/insets/insetlist.C: (InsertList): remove + + * src/insets/insetfootlike.[Ch]: new files + + * src/insets/insetfoot.C: inherit from InsetFootLike instead of + InsetCollapsable. + (Write): remove + (InsertInset): ditto + + * src/insets/insetert.C: remove include Painter.h, reindent + (InsertInset): move to header + + * src/insets/insetcollapsable.h: remove explicit from default + contructor, remove empty destructor, add InsertInset + + * src/insets/insetcollapsable.C (InsertInset): new func + + * src/insets/Makefile.am (libinsets_la_SOURCES): add new files + + * src/vspace.h: add explicit to constructor + + * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of + \textcompwordmark, please test this. + + * src/lyxrc.C: set ascii_linelen to 65 by default + + * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM + + * src/commandtags.h: add LFUN_INSET_THEOREM + + * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem + (makeLinuxDocFile): remove _some_ of the nice logic + (makeDocBookFile): ditto + + * src/Painter.[Ch]: (~Painter): removed + + * src/LyXAction.C (init): entry for insettheorem added + + * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES + enum + (deplog): code to detect files generated by LaTeX, needs testing + (deptex): removed + +2000-07-03 Lars Gullik Bjønnes + + * src/FloatList.[Ch]: moved inlines out of line to FloatList.C + +2000-07-02 Lars Gullik Bjønnes + + * src/LaTeX.C (deplog): Add a check for files that are going to be + created by the first latex run, part of the project to remove the + all_files array. + + * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of + contents to the extension list. + +2000-07-04 Juergen Vigna + + * src/text.C (NextBreakPoint): added support for needFullRow() + + * src/insets/lyxinset.h: added needFullRow() + + * src/insets/insetcollapsable.C: redone now this uses a text-inset + and isn't one. + + * src/insets/insettext.C: lots of changes for update! + +2000-07-03 Angus Leeming + + * src/LaTeXFeatures.h: add a missing std:: qualifier. + +2000-07-02 José Abílio Matos + + * src/insets/insetinclude.C (InsetInclude): fixed + initialization of include_label. + (unique_id): now returns a string. + +2000-07-01 José Abílio Matos + + * src/LaTeXFeatures.h: new member IncludedFiles, for + a map of key, included file name. + + * src/LaTeXFeatures.C (getIncludedFiles): returns a string + with the included files for inclusion in SGML preamble, + i. e., linuxdoc and docbook. + + * src/buffer.h: + * src/buffer.C (makeLinuxDocFile): takes two new arguments, + nice (is the generated linuxdoc code to be exported?), that + allows to remove column, and only_body that will be true for + slave documents. Insets are allowed inside SGML font type. + New handling of the SGML preamble for included files. + (makeDocBookFile): the same for docbook. + + * src/insets/insetinclude.h: + * src/insets/insetinclude.C (Validate): keeps a list of included files. + (Linuxdoc): + (DocBook): new export methods. + + * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile + and makeDocBookFile. + + * src/lyx_main.C (easyParse): accept linuxdoc and docbook as + formats to export with command line argument -x. + +2000-06-29 Juergen Vigna + + * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements + to return DISPATCHED_NOUPDATE so that a it does not redraw the inset! + + * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the + region could already been cleared by an inset! + +2000-06-28 Lars Gullik Bjønnes + + * src/BufferView_pimpl.h: remove member variables lyx_focus and + work_area_focus + + * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus + and lyx_focus + (cursorToggle): remove special handling of lyx focus. + +2000-06-28 Juergen Vigna + + * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight > + insetHeight. + +2000-06-28 Jean-Marc Lasgouttes + + * src/insets/insetindex.C (Edit): add a callback when popup is + closed by the WM. + + * src/insets/insettext.C (LocalDispatch): + * src/insets/insetmarginal.h: + * src/insets/insetlist.h: + * src/insets/insetfoot.h: + * src/insets/insetfloat.h: + * src/insets/insetert.h: add a missing std:: qualifier. + +2000-06-28 Lars Gullik Bjønnes + + * src/support/lyxsum.C (sum): '\0' teminate file read when using + strstream. + + * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE + + * src/insets/insettext.C (Read): remove tmptok unused variable + (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING + (InsertInset): change for new InsetInset code + + * src/insets/insettext.h: add TEXT inline method + + * src/insets/insettext.C: remove TEXT macro + + * src/insets/insetmarginal.C (Write): new method + (Latex): change output slightly + + * src/insets/insetfoot.C (Write): new method + (Latex): change output slightly (don't use endl when no need) + + * src/insets/insetert.C (Write): new method + + * src/insets/insetcollapsable.h: make button_length, button_top_y + and button_bottm_y protected. + + * src/insets/insetcollapsable.C (Write): simplify code by using + tostr. Also do not output the float name, the children class + should to that to get control over own arguments + + * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch] + src/insets/insetminipage.[Ch]: + new files + + * src/insets/Makefile.am (libinsets_la_SOURCES): add new files + + * src/lyxfunc.C (Dispatch): cases for new insets/commands + + * src/Makefile.am (lyx_SOURCES): add the new files + + * src/LyXAction.C (init): add LFUN_INSET_MARGINAL, + LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST + * src/commandtags.h: ditto + + * src/LaTeXFeatures.h: add a std::set of used floattypes + + * src/LaTeXFeatures.C (getPackages): add basic support for float.sty + + * src/FloatList.[Ch] src/Floating.h: new files + + * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to + InsertInset. + * src/lyx_cb.C (TableApplyCB): ditto + * src/text.C: ditto + * src/text2.C: ditto + * src/buffer.C (SimpleLinuxDocOnePar): ditto + (parseSingleLyXformat2Token): ditto + add code for + backwards compability for old float styles + add code for new insets + + * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new + method + (InsertInset(size_type, Inset *, LyXFont)): new method + (InsetChar(size_type, char)): changed to use the other InsetChar + with a LyXFont(ALL_INHERIT). + (InsetInset(size_type, Inset*)): changed to use InsetChar to + insert the META_INSET. + + * sigc++/thread.cc (Privete::operator int&): move definition + out of line. + * sigc++/thread.h (Threads): from here + + * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move + definition out of line + * sigc++/scope.h: from here + +2000-06-27 Jean-Marc Lasgouttes + + * src/lyxrc.C (read): make sure the .kmap files exist when a keymap + is specified (adapted from a patch from edscott ). + + * Makefile.am (bindist): new target. + + * INSTALL: add instructions for doing a binary distribution. + + * development/tools/README.bin.example: update a bit. + +2000-06-26 Lior Silberman + + * src/lyxrc.C: + * lib/lyxrc.example: new lyxrc tag \set_color. + + * src/lyxfunc.C (Dispatch): + * src/commandtags.h: + * src/LyXAction.C: new lyxfunc "set-color". + + * src/LColor.[Ch] (setColor): new method to set colors from a lyxname + and an x11name given as strings. + + * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC + cache when a color is changed. + +2000-06-26 Juergen Vigna + + * src/lyxrow.C (width): added this functions and variable. + + * src/insets/insetcite.C (create_form_citation_form): some Gravity + changes. + + * src/text.C (SetHeightOfRow): fixed calcualting of width. + +2000-06-26 Jean-Marc Lasgouttes + + * images/undo_bw.xpm: new icon. + * images/redo_bw.xpm: ditto. + + * configure.in (INSTALL_SCRIPT): change value to + ${INSTALL} to avoid failures of install-script target. + * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto + + * src/BufferView.h: add a magic "friend" declaration to please + compaq cxx. + +2000-06-23 Angus Leeming + + * forms/cite.fd: modified to allow resizing without messing + up the dialog. + + * src/insetcite.C: Uses code from cite.fd almost without + tweaking. ;-) + User can now resize dialog in the x-direction. + Resizing the dialog in the y-direction is prevented, as the + code does this intelligently already. + +2000-06-22 Jean-Marc Lasgouttes + + * INSTALL: remove obsolete entry in "problems" section. + + * lib/examples/sl_*.lyx: update of the slovenian examples. + + * src/support/FileInfo.[Ch] (getBlockSize): remove. + +2000-06-23 Juergen Vigna + + * src/lyxtext.h: added a 'cleared' flag to draw() function. + + * src/buffer.C (resize): delete the LyXText of textinsets. + + * src/paragraph.C (SetInsetOwner): set the owner in the insets too. + + * src/insets/lyxinset.h: added another parameter 'cleared' to + the draw() function. + + * src/lyxfunc.C (processKeyEvent): move cursor to the right of the + unlocking inset in inset. + +2000-06-22 Juergen Vigna + + * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings + of insets and moved first to LyXText. + + * src/mathed/formulamacro.[Ch]: + * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos + +2000-06-21 Juergen Vigna + + * src/text.C (GetVisibleRow): look if I should clear the area or not + using Inset::doClearArea() function. + + * src/insets/lyxinset.h: added doClearArea() function and + modified draw(Painter &, ...) to draw(BufferView *, ...) + + * src/text2.C (UpdateInset): return bool insted of int + +2000-06-20 Dekel Tsur + + * src/lyx_gui.C (create_forms): Add "Reset" option to the language + combox in the character popup + + * src/lyx_cb.C (UserFreeFont): Add argument to the method: + BufferParams const & params + +2000-06-20 Juergen Vigna + + * src/insets/insettext.C (SetParagraphData): set insetowner on + 2- paragraphs. + +2000-06-21 Lars Gullik Bjønnes + + * src/Timeout.[Ch]: Change to use signals instead of callbacks. + * src/LyXView.h (struct FD_form_main): remove, LyXView inherits + from SigC::Object + (form_main_): remove + + * src/LyXView.C (LyXView_AutosaveTimerCB): remove + (create_form_form_main): remove FD_form_main stuff, connect to + autosave_timeout signal + + * src/LyXView.[Ch] (getMainForm): remove + (UpdateTimerCB): remove + * src/BufferView_pimpl.h: inherit from SigC::Object + + * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with + signal instead of callback + + * src/BufferView.[Ch] (cursorToggleCB): remove + +2000-06-20 Lars Gullik Bjønnes + + * src/BufferView_pimpl.C: changes because of the one below + + * src/screen.[Ch]: Made the lyxscreen take LyXText as argument + instead of storing a pointer to a LyXText. + + * src/buffer.[Ch]: apply Baruch's remove isdviclean patch. + +2000-06-10 Dekel Tsur + + * src/lyxparagraph.h + + * src/paragraph.C: Changed fontlist to a sorted vector. + +2000-06-19 Juergen Vigna + + * src/BufferView.h: added screen() function. + + * src/insets/insettext.C (LocalDispatch): some selection code + fixed. + + * src/vspace.C (nextToken): use stringfunctions instead of sscanf. + + * src/insets/insettext.C (SetParagraphData): + (Read): + (InsetText): fixes for multiple paragraphs. + +2000-06-17 Kayvan A. Sylvan + + * development/lyx.spec.in: Call configure with ``--without-warnings'' + to work around a bug with the Makefiles when doing ``make lyxrpm''. + This should be fine, however, since we generally don't want to be + verbose when making an RPM. + +2000-06-16 Dekel Tsur + + * lib/scripts/fig2pstex.py: New file + +2000-06-16 Juergen Vigna + + * src/insets/insettabular.C (UpdateLocal): + * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem. + (LocalDispatch): Changed all functions to use LyXText. + +2000-06-15 Juergen Vigna + + * src/text.C (SetHeightOfRow): call inset::update before requesting + any width/height. + + * src/insets/insettext.C (update): + * src/insets/insettabular.C (update): added implementation + + * src/insets/lyxinset.h: added update function + +2000-06-15 Jean-Marc Lasgouttes + + * src/text.C (SelectNextWord): protect against null pointers with + old-style string streams. (fix from Paul Theo Gonciari + ) + + * src/cite.[Ch]: remove erroneous files. + + * lib/configure.m4: update the list of created directories. + + * src/lyxrow.C: include + * src/lyxcursor.C: ditto. + +2000-06-13 Jean-Marc Lasgouttes + + * lib/examples/decimal.lyx: new example file from Mike. + + * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch() + to find template definitions (from Dekel) + + * src/frontends/.cvsignore: add a few things. + + * src/frontends/xforms/input_validators.[ch]: remove C++ comments. + + * src/Timeout.C (TimeOut): remove default argument. + + * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have + "C" linkage. + + * src/insets/ExternalTemplate.C: add a "using" directive. + + * src/lyx_main.h: remove the act_ struct, which seems unused + anyway. + +2000-06-12 Lars Gullik Bjønnes + + * LyX Developers Meeting: All files changed, due to random C++ (by + coincidence) code generator script. + + - external inset (cool!) + - initial online editing of preferences + - insettabular breaks insettext(s contents) + - cleanup + - some DocBook fixes + - example files update + - other cool stuff, create a diff and look for yourself. + +2000-06-09 The Great LyX Application + + * src/insets/insettext.C (computeTextRows): if the maxWidth is + -1 this is a non-line-breaking textinset. + + * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1 + if there is no width set. + +2000-06-10 Lars Gullik Bjønnes + + * Lots of files: Merged the dialogbase branch. + +2000-06-09 Allan Rae + + * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and + and the Dispatch methods that used it. + + * src/frontends/Liason.[Ch]: replaced with a Liason namespace for + access to functions formerly kept in Dispatch. + +2000-05-19 Allan Rae + + * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C: + made to_page and count_copies integers again. from_page remains a + string however because I want to allow entry of a print range like + "1,4,22-25" using this field. + + * src/LyXAction.C: added action info and commands for buffer-print-xtl + and printer-params-get. These aren't useful from the minibuffer but + could be used by a script/LyXServer app provided it passes a suitable + auto_mem_buffer. I guess I should take a look at how the LyXServer + works and make it support xtl buffers. + + * sigc++/: updated to libsigc++-1.0.1 + + * src/xtl/: updated to xtl-1.3.pl.11 + + * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure + those changes done to the files in src/ are actually recreated when + they get regenerated. Please don't ever accept a patch that changes a + dialog unless that patch includes the changes to the corresponding *.fd + file. + + * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's + stringOnlyContains, renamed it and generalised it. + + * lots-of-files: Rolled the "rae" branch over into the "dialogbase" + branch. Removed the remaining old form_print code. + +2000-04-26 Allan Rae + + * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same + trap I was trying to fix with the ID: fields in src/xtl/ :-) + +2000-04-25 Allan Rae + + * src/xtl/: Updated to incorporate Angus's two patches as well as mine + against a base of xtl-1.3.pl.4 + + * development/tools/lxtl.sh: fixed a couple of silly typos and now + filter the Id: entries so they still show the xtl version number + they are based on. + + * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated + into the src/xtl code. Patch still pending with José (XTL) + +2000-04-24 Allan Rae + + * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is + both more generic and much safer. Use the new template functions. + * src/buffer.[Ch] (Dispatch): ditto. + + * src/frontends/xforms/FormPrint.C (update): Use new template functions + and mem buffer more intelligently. Also a little general cleanup. + (apply): ditto. + + * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot. + * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore + * src/xtl/Makefile.am: ditto. + * src/xtl/.cvsignore: ditto. + * src/Makefile.am: ditto. + + * src/PrinterParams.h: Removed the macros member functions. Added a + testInvariant member function. A bit of tidying up and commenting. + Included Angus's idea for fixing operation with egcs-1.1.2. + + * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really + cool expansion of XTL's mem_buffer to support automatic memory + management within the buffer itself. Removed the various macros and + replaced them with template functions that use either auto_mem_buffer + or mem_buffer depending on a #define. The mem_buffer support will + disappear as soon as the auto_mem_buffer is confirmed to be good on + other platforms/compilers. That is, it's there so you've got something + to compare against. + + * src/xtl/objio.h: Changes to support auto_mem_buffer. This has + effectively forked XTL. However I expect José will include my code + into the next major release. Also fixed a memory leak. + * src/xtl/text.h: ditto. + * src/xtl/xdr.h: ditto. + * src/xtl/giop.h: ditto. + +2000-04-16 Allan Rae + + * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated + by autogen.sh and removed by maintainer-clean anyway. + * .cvsignore, sigc++/.cvsignore: Support the above. + + * sigc++/.cvsignore: Forgot that retbind.h was generated. + + * src/buffer.C (Dispatch): Couldn't print a single page. Fixed. + + * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using + macros, renamed static callback-target member functions to suit new + scheme and made them public. + * src/frontends/xforms/forms/form_print.fd: ditto. + * src/frontends/xforms/forms/form_copyright.fd: ditto. + + * src/support/lxtl.h: small cleanup to use typedef instead of #define + for gui_format. + + * src/xtl/: New directory containing a minimal distribution of XTL. + This is XTL-1.3.pl.4. + + * development/tools/lxtl.sh: A script to generate the above mini-dist. + +2000-04-15 Allan Rae + + * development/tools/makeLyXsigc.sh: Remove the library version numbers + + * sigc++/: Updated to libsigc++-1.0.0 + +2000-04-14 Allan Rae + + * src/frontends/xforms/xform_macros.h: Remove specific macros and just + use the generic ones in future. I'll modify my conversion script. + + * src/frontends/xforms/FormCopyright.C: Reverse the earlier change. + + * src/lyx_gui_misc.[Ch]: Removed references to form_print. + (CloseAllBufferRelatedDialogs): Renamed. + (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog + + * src/frontends/xforms/FormCopyright.C: Use the specific macros instead + of the generic ones. These are the same ones my conversion script + generates. + + * src/PrinterParams.h: Allow you to print a range of odd or even pages. + * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup + * src/buffer.C (Dispatch): ditto + + * src/LyXView.C (LyXView): Use new signals instead of old hard coded + functions for updating and hiding buffer dependent dialogs. + * src/BufferView.C (buffer): ditto + * src/buffer.C (setReadonly): ditto + * src/lyxfunc.C (CloseBuffer): ditto + + * src/buffer.h: Take setReadonly() out of line so I don't have to include + Dialogs.h, and hence all the SigC stuff, into every file that includes + buffer.h. We also don't need to include lyx_gui_misc.h in everything. + + * src/BufferView2.C: reduce the number of headers included by buffer.h + +2000-04-11 Allan Rae + + * src/frontends/xforms/xform_macros.h: A small collection of macros + for building C callbacks. + + * src/frontends/xforms/Makefile.am: Added above file. + + * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback + scheme again. This time it should work for JMarc. If this is + successful I'll revise my conversion script to automate some of this. + The static member functions in the class also have to be public for + this scheme will work. If the scheme works (it's almost identical to + the way BufferView::cursorToggleCB is handled so it should work) then + FormCopyright and FormPrint will be ready for inclusion into the main + trunk immediately after 1.1.5 is released -- provided we're prepared + for complaints about lame compilers not handling XTL. + + * src/support/lxtl.h: Switched to XDR_format instead of raw_format. + +2000-04-07 Allan Rae + + * config/lyxinclude.m4: A bit more tidying up (Angus) + + * src/LString.h: JMarc's header fix + + * src/PrinterParams.h: Used string for most data to remove some + ugly code in the Print dialog and avoid even uglier code when + appending the ints to a string for output. + + * src/buffer.C (Dispatch): Added a couple of braces to fix an error + and moved "default:" back to the end of switch statement. Cleaned + up the printing so it uses the right function calls and so the + "print to file" option actually puts the file in the right directory. + + * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus). + + * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking + and Ok+Apply button control into a separate method: input (Angus). + (input) Cleaned it up and improved it to be very thorough now. + (All CB) static_cast used instead of C style cast (Angus). This will + probably change again once we've worked out how to keep gcc-2.8.1 happy + with real C callbacks. + (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to + ignore some of the bool settings and has random numbers instead. Needs + some more investigation. Added other input length checks and checking + of file and printer names. + + * src/frontends/xforms/FormPrint.h: Removed pragma statement so it + would link (Angus). Seems the old code doesn't compile with the pragma + statement either. Separated callback entries from internal methods. + + * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus). + +2000-03-17 Allan Rae + + * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really + need it? Maybe it could go in Dialogs instead? I could make it a + LFUN but you'd have to call Dispatch(int, int, char*) with dummy + values to get the bool return value. + (Dispatch): New overloaded method for xtl support. + + * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly + extern "C" callback instead of static member functions. Hopefully, + JMarc will be able to compile this. I haven't changed + forms/form_copyright.fd yet. Breaking one of my own rules already. + + * src/commandtags.h: New xtl-based LFUN's no description in LyXAction + because they aren't useful from the minibuffer. Maybe a LyXServer + might want a help message though? + + * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support. + + * config/lyxinclude.m4: Changes to g++ flags to suit compiling with + xtl which needs both rtti and exceptions. + + * src/support/Makefile.am: + * src/support/lxtl.h: New file. Some helper macros for using XTL. + + * src/frontends/xforms/input_validators.[ch]: input filters and + validators. These conrol what keys are valid in input boxes. + Use them and write some more. Much better idea than waiting till + after the user has pressed Ok to say that the input fields don't make + sense. + + * src/frontends/xforms/Makefile.am: + * src/frontends/xforms/forms/form_print.fd: + * src/frontends/xforms/forms/makefile: + * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to + new scheme. Still have to make sure I haven't missed anything from + the current implementation. + + * src/Makefile.am, src/PrinterParams.h: New data store. + + * other files: Added a couple of copyright notices. + +2000-03-06 Jean-Marc Lasgouttes + + * src/insets/insetbib.h: move Holder struct in public space. + + * src/frontends/include/DialogBase.h: use SigC:: only when + SIGC_CXX_NAMESPACES is defined. + * src/frontends/include/Dialogs.h: ditto. + + * sigc++/Makefile.am (%.h): use the autodected GNU m4. + + * src/frontends/xforms/FormCopyright.[Ch]: do not + mention SigC:: explicitely. + +2000-03-03 Jean-Marc Lasgouttes + + * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which + deals with testing KDE in main configure.in + * configure.in: ditto. + +2000-02-22 Allan Rae + + * Lots of files: Merged from HEAD + + * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible + with the etags shipped with SuSE-6.3 (fancier than gnu-etags). + + * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4 + + * sigc++/: new minidist. + +2000-02-14 Allan Rae + + * development/tools/makeLyXsigc.sh: Small fix for Makefile.am + +2000-02-08 Juergen Vigna + + * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data + file for the buildin GUI builder of KDevelop of the copyright-dialog. + + * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop + for this port and so it is much easier for other people to port + dialogs in a common development environment. + + * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for + the QT/KDE implementation. + + * src/frontends/kde/Dialogs.C: + * src/frontends/kde/FormCopyright.C: + * src/frontends/kde/FormCopyright.h: + * src/frontends/kde/Makefile.am: + * src/frontends/kde/formcopyrightdialog.C: + * src/frontends/kde/formcopyrightdialog.h: + * src/frontends/kde/formcopyrightdialogdata.C: added this source-files + for the kde support of the Copyright-Dialog. + + * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@ + subdir-substitution instead of hardcoded 'xforms' as we now have also + the kde subdir. + + * src/frontends/include/DialogBase.h (Object): just commented the + label after #endif (nasty warning and I don't like warnings ;) + + * src/main.C (main): added KApplication initialization if using + KDE frontend-GUI. + + * src/lyx_gui.C (runTime): added support for multiple toolkit support. + For now only the KDE event-loop is added if frontend==kde. + + * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support + + * configure.in: added support for the --with-frontend[=value] option + + * autogen.sh: added kde.m4 file to list of config-files + + * acconfig.h: added define for KDEGUI-support + + * config/kde.m4: added configuration functions for KDE-port + + * config/lyxinclude.m4: added --with-frontend[=value] option with + support for xforms and KDE. + +2000-02-08 Allan Rae + + * all Makefile.am: Fixed up so the make targets dist, distclean, + install and uninstall all work even if builddir != srcdir. Still + have a new sigc++ minidist update to come. + + * config/lyxinclude.m4: Some more builddir!=srcdir fixes. + +2000-02-01 Allan Rae + + * config/lyxinclude.m4, development/tools/makeLyXsigc.sh: + Many mods to get builddir != srcdir working. + + * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both + for building on NT and so we can do the builddir != srcdir stuff. + +2000-01-30 Allan Rae + + * sigc++/doc/*: Selected documentation for the libsigc++ mini dist. + This will stay in "rae" branch. We probably don't really need it in + the main trunk as anyone who wants to help programming it should get + a full library installed also. So they can check both included and + system supplied library compilation. + + * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4: + Added a 'mini' distribution of libsigc++. If you feel the urge to + change something in these directories - Resist it. If you can't + resist the urge then you should modify the following script and rebuild + the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it + all happen. Still uses a hacked version of libsigc++'s configure.in. + I'm quite happy with the results. I'm not sure the extra work to turn + the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is + worth the trouble and would probably lead to extra maintenance + headaches. + I haven't tested the following important make targets: install, dist. + Not ready for prime time but very close. Maybe 1.1.5. + + * development/tools/makeLyXsigc.sh: A shell script to automatically + generate our mini-dist of libsigc++. It can only be used with a CVS + checkout of libsigc++ not a tarball distribution. It's well commented. + This will end up as part of the libsigc++ distribution so other apps + can easily have an included mini-dist. If someone makes mods to the + sigc++ subpackage without modifying this script to generate those + changes I'll be very upset! + + * src/frontends/: Started the gui/system indep structure. + + * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s + to access the gui-indep dialogs are in this class. Much improved + design compared to previous revision. Lars, please refrain from + moving this header into src/ like you did with Popups.h last time. + + * src/frontends/include/DialogBase.h: Abstract base class for dialogs. + + * src/frontends/xforms/: Started the gui-indep system with a single + dialog: FormCopyright. Initial testing of use of libsigc++ was very + successful. + + * src/frontends/xforms/forms: Repository for the xforms .fd files. + Here you'll find a very useful makefile and automated fdfix.sh that + makes updating dailogs a no-brainer -- provided you follow the rules + set out in the README. I'm thinking about adding another script to + automatically generate skeleton code for a new dialog given just the + name of the dialog. + + * src/commandtags.h, src/lyxfunc.C, src/menus.C: + * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd: + Made FormCopyright gui-indep and added a lyxfunc to get to it. + +2000-06-09 Lars Gullik Bjønnes + + * src/support/LSubstring.C (operator): simplify + + * src/lyxtext.h: removed bparams, use buffer_->params instead + + * src/lyxrow.h: make Row a real class, move all variables to + private and use accessors. + + * src/lyxparagraph.h (getParLanguage): add BufferParamas as + arguament. + (isRightToLeftPar): ditto + (ChangeLanguage): ditto + (isMultiLingual): ditto + (String): ditto + (TeXOnePar): ditto + (SimpleTeXOnePar): ditto + (TeXEnvironment): ditto + (GetEndLabel): ditto + (SetLayout): ditto + (SetOnlyLayout): ditto + (BreakParagraph): ditto + (BreakParagraphConservative): ditto + (GetFontSettings): ditto + (getFont): ditto + (CopyIntoMinibuffer): ditto + (CutIntoMinibuffer): ditto + (PasteParagraph): ditto + (SetPExtraType): ditto + (UnsetPExtraType): ditto + (DocBookContTableRows): ditto + (SimpleDocBookOneTablePar): ditto + (TeXDeeper): ditto + (TeXFootnote): ditto + (SimpleTeXOneTablePar): ditto + (TeXContTableRows): ditto + (SimpleTeXSpecialChars): ditto + + + * src/lyxcursor.h: make LyXCursor a real class, move all variables + to private and use accessors. + + * src/lyx_cb.C: remove char updatetimer, and all code that uses + this, we did not use it anymore and has not been for ages. Just a + waste of cpu cycles. + + * src/language.h: make Language a real class, move all variables + to private and use accessors. + + * src/BufferView_pimpl.C (Pimpl): use new timer code. + (create_view): remove + (update): some changes for new timer + (cursorToggle): use new timer + (beforeChange): change for new timer + + * src/BufferView.h (cursorToggleCB): removed last paramter because + of new timer code. + + * src/BufferView.C (C_BufferView_CursorToggleCB): removed + (cursorToggleCB): change because of new timer code + + * lib/CREDITS: updated own mailaddress + +2000-06-08 Jean-Marc Lasgouttes + + * src/support/filetools.C (PutEnv): fix the code in case neither + putenv() nor setenv() have been found. + + * INSTALL: mention the install-strip Makefile target. + + * src/LyXAction.C (init): make LFUN_BUILDPROG available in + read-only documents. + +2000-06-07 Jean-Marc Lasgouttes + + * lib/reLyX/configure.in (VERSION): avoid using a previously + generated reLyX wrapper to find out $prefix. + + * lib/examples/eu_adibide_lyx-atua.lyx: + * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque + translation of the Tutorial (Dooteo) + +2000-06-06 Angus Leeming + + * forms/cite.fd: new citation dialog + + * src/insetcite.[Ch]: the new citation dialog is moved into + its own files. + + * src/insetbib.C: InsetBibtex::getKeys() uses STL containers + (Dekel). + + * src/insets/insetcommand.h: data members made private. + +2000-06-06 Lars Gullik Bjønnes + + * LyX 1.1.5 released + +2000-06-06 Lars Gullik Bjønnes + + * src/version.h (LYX_RELEASE): to 1.1.5 + + * src/spellchecker.C (RunSpellChecker): return false if the + spellchecker dies upon creation. + +2000-06-06 Jean-Marc Lasgouttes + + * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file + in \include{} (from Tomasz Motylewski ) + + * NEWS: update. + + * lib/CREDITS: update entry for Martin Vermeer. + +2000-06-06 Dekel Tsur + + * src/text.C (draw): Draw foreign language bars at the bottom of + the row instead of at the baseline. + + * lib/examples/Minipage.lyx: Use the new multi-lingual support. + +2000-06-06 Lars Gullik Bjønnes + + * lib/bind/de_menus.bind: updated + +2000-06-05 Dekel Tsur + + * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref + +2000-06-05 Dekel Tsur + + * src/menus.C (Limit_string_length): New function + (ShowTocMenu): Limit the number of items/length of items in the + LOT/LOF/LOA menus. + + * src/paragraph.C (String): Correct result for a paragraph inside + a footnote. + +2000-06-05 Lars Gullik Bjønnes + + * src/bufferlist.C (close): test of buf->getuser() == NULL + +2000-06-02 Dekel Tsur + + * src/BufferView2.C (removeAutoInsets): Fix a bug: + Do not call to SetCursor when the paragraph is a closed footnote! + +2000-06-01 Dekel Tsur + + * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a + label is changed. + + * src/text.C (SetCursor): Made the computation of cursor_vpos safer. + +2000-05-31 Dekel Tsur + + * forms/lyx.fd + * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert + reference popup, that activates the reference-back action + + * src/menus.C (ShowRefsMenu): Added "Go Back" menu item. + + * src/menus.C (Add_to_refs_menu): Limit the size of each item in + the menus. Also fixed a bug. + + * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close + the math panels when switching buffers (unless new buffer is readonly). + + * src/BufferView.C (NoSavedPositions) + * src/BufferView_pimpl.C (NoSavedPositions): New methods + +2000-06-01 Lars Gullik Bjønnes + + * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard + less of dvi dirty or not. + + * src/trans_mgr.[Ch] (insert): change first parameter to string + const &. + + * src/chset.[Ch] (encodeString): add const to first parameter + +2000-05-31 Lars Gullik Bjønnes + + * src/support/lyxstring.C (begin): fix a "shared" string bug. use + rep->get_own_copy() + (end): ditto + + * src/LaTeX.C (deplog): better searching for dependency files in + the latex log. Uses now regexps. + + * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil + instead of the box hack or \hfill. + +2000-05-31 Jean-Marc Lasgouttes + + * src/lyxfunc.C (doImportHelper): do not create the file before + doing the actual import. + (doImportASCIIasLines): create a new file before doing the insert. + (doImportASCIIasParagraphs): ditto. + + * lib/lyxrc.example: remove mention of non-existing commands + + * lyx.man: remove mention of color-related switches. + + * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR. + + * src/lyx_gui.C: remove all the color-related ressources, which + are not used anymore. + + * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file + name. + +2000-05-31 Dekel Tsur + + * src/lyxrc.C (read): Add a missing break in the switch + +2000-05-30 Dekel Tsur + + * src/text2.C (InsertStringA): Fix a bug with insertion into table + + * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the + text is Hebrew. + +2000-05-27 Dekel Tsur + + * src/text.C (draw): draw bars under foreign language words. + + * src/LColor.[Ch]: add LColor::language + +2000-05-27 Dekel Tsur + + * src/lyxcursor.h (boundary): New member variable + + * src/text.C (IsBoundary): New methods + + * src/text.C: Use the above for currect cursor movement when there + is both RTL & LTR text. + + * src/text2.C: ditto + + * src/bufferview_funcs.C (ToggleAndShow): ditto + +2000-05-30 Jean-Marc Lasgouttes + + * src/text.C (DeleteLineForward): set selection to true to avoid + that DeleteEmptyParagraphMechanism does some magic. This is how it + is done in all other functions, and seems reasonable. + (DeleteWordForward): do not jump over non-word stuff, since + CursorRightOneWord() already does it. + + Remove the CHECK tag from DeleteLineForward, DeleteWordForward and + DeleteWordBackward, since they seem safe to me (since selection is + set to "true") DeleteEmptyParagraphMechanism does nothing. + +2000-05-29 Jean-Marc Lasgouttes + + * src/lyx_main.C (easyParse): simplify the code by factoring the + part that removes parameters from the command line. + (LyX): check wether wrong command line options have been given. + +2000-05-29 Lior Silberman + + * src/lyx_main.C : add support for specifying user LyX + directory via command line option -userdir. + +2000-05-26 Dekel Tsur + + * src/menus.C (Add_to_toc_menu): Limit the number of popups, and + the number of items per popup. + (Add_to_refs_menu): Ditto. + +2000-05-26 Jean-Marc Lasgouttes + + * src/lyxparagraph.h: renamed ClearParagraph() to + StripLeadingSpaces() and moved it to paragraph.C. We pass the + textclass as parameter, and do nothing if free_spacing is + true. This fixes part of the line-delete-forward problems. + + * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces. + (pasteSelection): ditto. + (SwitchLayoutsBetweenClasses): more translatable strings. + + * src/text2.C (CutSelection): use StripLeadingSpaces. + (PasteSelection): ditto. + (DeleteEmptyParagraphMechanism): ditto. + +2000-05-26 Juergen Vigna + + * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this + is not needed in tabular insets. + + * src/insets/insettabular.C (TabularFeatures): added missing features. + + * src/tabular.C (DeleteColumn): + (AppendColumn): + (AppendRow): implemented this functions + (cellsturct::operator=): clone the inset too; + +2000-05-23 Juergen Vigna + + * src/insets/insettabular.C (LocalDispatch): better selection support + when having multicolumn-cells. + +2000-05-26 Jose Abilio Oliveira Matos + + * lib/layouts/linuxdoc.layout: fix indentation of paragraphs. + +2000-05-25 Jean-Marc Lasgouttes + + * src/ColorHandler.C (getGCForeground): put more test into _() + + * lib/examples/eu_splash.lyx: new file (Basque translation) from + Dooteo. + + * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to + get the version. + +2000-05-25 Dekel Tsur + + * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when + there are no labels, or when buffer is readonly. + + * src/menus.C (ShowRefsMenu) disable appropriate menu items when + there are no labels, buffer is SGML, or when buffer is readonly. + +2000-05-25 Lars Gullik Bjønnes + + * src/LColor.C (LColor): change a couple of grey40 to grey60 + (LColor): rewore initalization to make compiles go some magnitude + faster. + (getGUIName): don't use gettext until we need the string. + +2000-05-09 Dekel Tsur + + * src/Bullet.[Ch]: Fixed a small bug. + +2000-05-21 Dekel Tsur + + * src/paragraph.C (String): Several fixes/improvements + + * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method + +2000-05-22 Lars Gullik Bjønnes + + * src/paragraph.C (String): give more correct output. + +2000-05-20 Dekel Tsur + + * src/lyxfont.C (stateText) Do not output the language if it is + eqaul to the language of the document. + + * src/paragraph.C (TeXOnePar): Do not put language switch commands + between two paragraphs with the same language. + + * src/paragraph.C (getParLanguage) Return a correct answer for an + empty dummy paragraph. + + * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA + menus. + + * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the + layout menu. + + * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for + the menus/popup, if requested fonts are unavailable. + +2000-05-22 Juergen Vigna + + * src/insets/insettabular.C (LocalDispatch): added some more cursor + movement support (Up/Down/Tab/Shift-Tab). + (LocalDispatch): added also preliminari cursor-selection. + + * src/LyXAction.C (init): added SHIFT-Tab as tab-backward. + + * src/paragraph.C (PasteParagraph): Hopefully now right! + +2000-05-22 Garst R. Reese + + * layouts/hollywood.layout, broadway.layout : move Dialogue to top + of list, change all references to Environment to Command + * tex/hollywood.cls : rewrite environments as commands, add + \uppercase to interiorshot and exteriorshot to force uppecase. + * tex/broadway.cls : rewrite environments as commands. Tweak + whitespace. + +2000-05-22 Jean-Marc Lasgouttes + + * src/menus.C (Add_to_toc_menu): fix the code which limits the + size of items: use a constant intead of the hardcoded 40, and more + importantly do not remove the %m and %x tags added at the end. + (Add_to_refs_menu): use vector::size_type instead of + unsigned int as basic types for the variables. _Please_ do not + assume that size_t is equal to unsigned int. On an alpha, this is + unsigned long, which is _not_ the same. + + * src/language.C (initL): remove language "hungarian", since it + seems that "magyar" is better. + +2000-05-22 Juergen Vigna + + * src/CutAndPaste.C: hopefully fixed memory the problem defenitively! + + * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable + end markers! + + * src/paragraph.C (PasteParagraph): Possibly a memory leak as + next was deleted but not set to 0. + +2000-05-21 Lars Gullik Bjønnes + + * src/language.C (initL): change the initialization of languages + so that compiles goes _fast_. + + * src/menus.C (Add_to_toc_menu): limit the line length in TOC to + 40 chars. + + * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0. + +2000-05-21 Lars Gullik Bjønnes + + * release 1.1.5pre3 + +2000-05-20 Lars Gullik Bjønnes + + * src/WorkArea.C (request_clipboard_cb): give "C" linkage. + +2000-05-19 Dekel Tsur + + * src/commandtags.h + * src/LyXAction.C + * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW + and LFUN_LOAVIEW + + * src/insets/insetlo*.[Ch]: Made editable + +2000-05-20 Lars Gullik Bjønnes + + * src/text2.C (SetSelection): call BufferView::stuffClipboard with + the current selection. + + * src/BufferView_pimpl.C (stuffClipboard): new method + + * src/BufferView.C (stuffClipboard): new method + + * src/paragraph.C (String): new method + + * src/LColor.C (getFromLyXName): return LColor::inherit instead of + LColor::ignore when lyxname is not found. + + * src/BufferView.C (pasteSelection): new method + + * src/BufferView_pimpl.C (pasteSelection): new method + + * src/lyxfunc.C (Dispatch): use the new clipboard functions. + + * src/WorkArea.C (request_clipboard_cb): new static function + (getClipboard): new method + (putClipboard): new method + +2000-05-19 Lars Gullik Bjønnes + + * LyX 1.1.5pre2 released + +2000-05-19 Lars Gullik Bjønnes + + * src/vspace.C (operator=): removed + (operator=): removed + + * src/lyx_gui_misc.C (askForText): manually set the type in make_pair + + * src/layout.C (NumberOfClass): manually set the type in make_pair + (NumberOfLayout): ditto + + * src/language.C: use the Language constructor for ignore_lang + + * src/language.h: add constructors to struct Language + + * src/BufferView_pimpl.C (scrollDown): change to pair + + * src/text2.C (SetCursorIntern): comment out #warning + + * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast + + * src/mathed/math_iter.h: initialize sx and sw to 0 + +2000-05-10 Dekel Tsur + + * forms/lyx.fd: Redesign of form_ref + + * src/LaTeXFeatures.[Ch] + * src/buffer.C + * src/lyx_cb.C + * src/menus.C + * src/insets/insetref.[Ch]: Added support for varioref and prettyref. + + * src/buffer.h + * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator + and Buffer::inset_iterator. + + * src/menus.C: Added new menus: TOC and Refs. + + * src/insets/insetlabel.C (Edit) Made InsetLabel editable. + + * src/buffer.C (getTocList): New method. + + * src/BufferView2.C (ChangeRefs): New method. + + * src/buffer.C (getLabelList): New method. It replaces the old + getReferenceList. The return type is vector instead of + string. + + * src/insets/insetinclude.C (getLabelList): New method. Replaces + the old getLabel() and GetNumberOfLabels() methods. + * src/insets/insetlabel.C (getLabelList): ditto + * src/mathed/formula.C (getLabelList): ditto + + * src/paragraph.C (String): New method. + + * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten. + Uses the new getTocList() method. + TocSelectCB() now calls to TocUpdateCB() before moving the cursor, + which automatically updates the contents of the browser. + (RefUpdateCB): Use the new getLabelList method. + + * src/lyxfunc.C (Dispatch): Give an error if the label is not found. + + * src/BufferView2.C (gotoLabel) Use the new getLabelList method. + + * src/spellchecker.C: Added using std::reverse; + +2000-05-19 Juergen Vigna + + * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures. + + * src/insets/insettext.C (computeTextRows): small fix for display of + 1 character after a newline. + + * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard + to cont-rows! + +2000-05-18 Juergen Vigna + + * src/insets/insettabular.C (TabularFeatures): fixed update of display + when changing width of column. + + * src/tabular.C (set_row_column_number_info): setting of + autobreak rows if necessary. + +2000-05-17 Jean-Marc Lasgouttes + + * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat() + + * src/vc-backend.*: renamed stat() to status() and vcstat to + vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and + compilation broke. The new name seems more relevant, anyway. + +2000-05-17 Juergen Vigna + + * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets + which was wrong if the removing caused removing of rows! + + * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken. + (pushToken): new function. + + * src/text2.C (CutSelection): fix problem discovered with purify + +2000-05-17 Jean-Marc Lasgouttes + + * src/debug.C (showTags): enlarge the first column, now that we + have 6-digits debug codes. + + * lib/layouts/hollywood.layout: + * lib/tex/hollywood.cls: + * lib/tex/brodway.cls: + * lib/layouts/brodway.layout: more commands and fewer + environments. Preambles moved in the .cls files. Broadway now has + more options on scene numbering and less whitespace (from Garst) + + * src/insets/insetbib.C (getKeys): make sure that we are in the + document directory, in case the bib file is there. + + * src/insets/insetbib.C (Latex): revert bogus change. + +2000-05-16 Juergen Vigna + + * src/insets/insettabular.C (UnlockInsetInInset): Changes to update + the TabularLayout on cursor move. + + * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable + + * src/insets/insettabular.C (Clone): Clone the LyXTabular for + undo-handling. + (getCellXPos): + (draw): fixed cursor position and drawing so that the cursor is + visible when before the tabular-inset. + + * src/insets/insettext.C (init): drawLockedFrame was not initialized + when creating from old insettext. + + * src/tabular.C (Clone): added Clone of text-inset for undo-handling. + +2000-05-15 Jean-Marc Lasgouttes + + * lib/tex/hollywood.cls: better algorithm for page breaks (Garst) + * lib/tex/brodway.cls: ditto + + * lib/layouts/brodway.layout: change alignment of parenthical + layout (Garst) + +2000-05-12 Jean-Marc Lasgouttes + + * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only + versions 0.88 and 0.89 are supported. + +2000-05-15 Juergen Vigna + + * src/insets/insetcollapsable.C (draw): enhancements in drawing and + width calculating. + + * src/insets/insettext.C (computeTextRows): redone completely this + function in a much cleaner way, because of problems when having a + fixed maxWidth. + (draw): added a frame border when the inset is locked. + (SetDrawLockedFrame): this sets if we draw the border or not. + (SetFrameColor): this sets the frame color (default=insetframe). + + * src/insets/lyxinset.h: added x() and y() functions which return + the top_x and top_baseline values. Added a GetFirstLockingInsetOfType + function which is needed to see if we have a locking inset of some + type in this inset (needed for now in insettabular). + + * src/vspace.C (inPixels): the same function also without a BufferView + parameter as so it is easier to use it in some ocasions. + + * src/lyxfunc.C: changed all places where insertInset was used so + that now if it couldn't be inserted it is deleted! + + * src/TabularLayout.C: + * src/TableLayout.C: added support for new tabular-inset! + + * src/BufferView2.C (insertInset): this now returns a bool if the + inset was really inserted!!! + + * src/tabular.C (GetLastCellInRow): + (GetFirstCellInRow): new helper functions. + (Latex): implemented for new tabular class. + (TeXCellPostamble): + (TeXCellPreamble): + (TeXBottomHLine): + (TeXTopHLine): new Latex() helper functions. + +2000-05-12 Juergen Vigna + + * src/mathed/formulamacro.C (Read): + * src/mathed/formula.C (Read): read also the \end_inset here! + +2000-05-10 Dekel Tsur + + * src/mathed/math_write.C (MathParInset::Write): Fixed a bug: + crush when saving formulae with unbalanced parenthesis. + +20000-05-11 Dekel Tsur + + * src/layout.C: Add new keyword "endlabelstring" to layout file + + * src/text.C (GetVisibleRow): Draw endlabel string. + + * lib/layouts/broadway.layout + * lib/layouts/hollywood.layout: Added endlabel for the + Parenthetical layout. + + * lib/layouts/heb-article.layout: Do not use slanted font shape + for Theorem like environments. + + * src/buffer.C (makeLaTeXFile): Always add "american" to + the UsedLanguages list if document language is RTL. + +2000-05-11 Jean-Marc Lasgouttes + + * add addendum to README.OS2 and small patch (from SMiyata) + +2000-05-10 Jean-Marc Lasgouttes + + * many files: correct the calls to ChangeExtension(). + + * src/support/filetools.C (ChangeExtension): remove the no_path + argument, which does not belong there. Use OnlyFileName() instead. + + * src/insets/insetbib.C (Latex): use absolute paths for bibtex + files when LaTeXing a non-nice latex file. + + * src/lyxlookup.C (isDeadEvent): use a switch statement instead of + a chain of "if". Return false when deadkeys are not handled. + + * src/lyx_main.C (LyX): adapted the code for default bindings. + + * src/kbmap.C (defaultKeyBindings): new method. Performs the default + bindings for basic functionality (except deadkeys). + (deadKeyBindings): new method. Performs the bindings of deadkeys. + + * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C + several methods: handle override_x_deadkeys. + + * src/lyxrc.h: remove the "bindings" map, which did not make much + sense anyway. New variable override_x_deadkeys, defaulting to "true". + +2000-05-09 Jean-Marc Lasgouttes + + * src/lyxfont.C (stateText): use a saner method to determine + whether the font is "default". Seems to fix the crash with DEC + cxx. + + * src/Bullet.[Ch] (Bullet): remove const on parameters. + +2000-05-08 Juergen Vigna + + * src/insets/insettabular.C (InsetButtonRelease): Now opens the + TabularLayoutMenu with mouse-button-3 + (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout. + + * src/TabularLayout.C: added this file for having a Layout for + tabular-insets. + +2000-05-05 Juergen Vigna + + * src/insets/insettabular.C (UpdateLocal): resetCursorPos when + recalculating inset-widths. + (TabularFeatures): activated this function so that I can change + tabular-features via menu. + + * src/menus.C (ShowEditMenu): inserted support for insettabular so + that I can test some functions with the Table menu. + +2000-05-05 Lars Gullik Bjønnes + + * src/lyxfont.C (stateText): guard against stupid c++libs. + + * src/tabular.C: add using std::vector + some whitespace changes, + removed som autogenerated code. + + * src/buffer.C (parseSingleLyXformat2Token): stupid bug. + +2000-05-05 Juergen Vigna + + * src/tabular.[Ch]: now using std:vector instead of arrays for all the + row, columns and cellstructures. + +2000-05-05 Lars Gullik Bjønnes + + * lib/lyxrc.example: remove obsolete entries. + + * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix + reading of protected_separator for free_spacing. + +2000-05-05 Jean-Marc Lasgouttes + + * src/text.C (draw): do not display an exclamation mark in the + margin for margin notes. This is confusing, ugly and + uninformative. + + * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use + AMS math' is checked. + + * src/buffer.C (makeLaTeXFile): do not depend on the textclass + name to see whether including the amsmath package is needed. + +2000-05-05 Dekel Tsur + + * src/paragraph.C (validate): Compute UsedLanguages correctly + (don't insert the american language if it doesn't appear in the + document) + + * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars) + The argument of \thanks{} command is considered moving argument + + * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in + moving argument. + +2000-05-04 Dekel Tsur + + * src/text.C (GetVisibleRow): Improved drawing of vertical lines + for appendix/minipage/depth. The lines can be now both in the footnote + frame, and outside the frame. + + * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels + points ("nikud") + +2000-05-05 Juergen Vigna + + * src/table.[Ch]: removed the inset and buffer stuff as this is now + neede only in tabular.[Ch]. + +2000-05-05 Lars Gullik Bjønnes + + * src/insets/insetspecialchar.C (Read): allow command == '~' for + PROTECTED_SEPARATOR + (Write): write '~' for PROTECTED_SEPARATOR + +2000-05-04 Lars Gullik Bjønnes + + * src/lyxparagraph.h: add a friend struct matchIT after the struct + InsetTable. + + * src/mathed/formula.C (drawStr): rename size to siz. + + * src/insets/figinset.C (RestoreForm): rename pflags to piflags, + possibly fix a bug by not changing the pflags = flags to piflags = + flags. + +2000-05-05 Juergen Vigna + + * src/insets/insetbib.C: moved using directive + + * src/ImportNoweb.C: small fix for being able to compile (missing + include cstdlib) + +2000-05-04 Lars Gullik Bjønnes + + * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not + to use clear, since we don't depend on this in the code. Add test + for string::compare + +2000-05-04 Jean-Marc Lasgouttes + + * (various *.C files): add using std::foo directives to please dec + cxx. + + * replace calls to string::clear() to string::erase() (Angus) + + * src/cheaders/cmath: modified to provide std::abs. + +2000-05-04 Juergen Vigna + + * src/insets/insettext.C: Prepared all for inserting of multiple + paragraphs. Still display stuff to do (alignment and other things), + but I would like to use LyXText to do this when we cleaned out the + table-support stuff. + + * src/insets/insettabular.C: Changed lot of stuff and added lots + of functionality still a lot to do. + + * src/tabular.C: Various functions changed name and moved to be + const functions. Added new Read and Write functions and changed + lots of things so it works good with tabular-insets (also removed + some stuff which is not needed anymore * hacks *). + + * src/lyxcursor.h: added operators == and != which just look if + par and pos are (not) equal. + + * src/buffer.C (latexParagraphs): inserted this function to latex + all paragraphs form par to endpar as then I can use this too for + text-insets. + + * src/text2.C (SetLayout): Changed this to use a cursor this is needed + so that I can call this to from text insets with their own cursor. + + * src/buffer.C (makeLaTeXFile): added the output of one \n after the + output off all paragraphs (because of the fix below)! + + * src/paragraph.C (TeXOnePar): removed output of \n when we are in + the very last paragraph (this could be also the last paragraph of an + inset!) + + * src/texrow.h: added rows() call which returns the count-variable. + +2000-05-03 Jose Abilio Oliveira Matos + + * lib/lyxrc.example: fix examples for exporting SGML to HTML. + + * lib/configure.m4: better autodetection of DocBook tools. + +2000-04-28 Lars Gullik Bjønnes + + * src/lyx_main.C (easyParse): use lyxerr instead of cerr. + + * src/lyx_cb.C: add using std::reverse; + + * src/LaTeX.C (run): on error always run deleteFilesOnError before + returning. + + * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some + selected files. Should fix repeated errors from generated files. + +2000-04-27 Dekel Tsur + + * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs + + * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in + the spellchecker popup. + + * lib/lyxrc.example: Removed the \number_inset section + +2000-04-28 Jean-Marc Lasgouttes + + * src/insets/figinset.C (various): Use IsFileReadable() to make + sure that the file actually exist. Relying on ghostscripts errors + is a bad idea since they can lead to X server crashes. + +2000-04-27 Claus Hentschel + + * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to + open under CYGWIN + + * lib/lyxrc.example: smallish typo in description of + \view_dvi_paper_option + +2000-04-26 André Pönitz + + * src/lyxfunc.h: + * src/lyxfunc.C: doImportHelper to factor out common code of the + various import methods. New functions doImportASCIIasLines, + doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb, + doImportLinuxDoc for the format specific parts. + + * buffer.h: + * buffer.C: Dispatch returns now a bool to indicate success + + * lyx_gui.h: + * lyx_gui.C: Add getLyXView() for member access + + * lyx_main.C: Change logic for batch commands: First try + Buffer::Dispatch (possibly without GUI), if that fails, use + LyXFunc::Dispatch + + * lyx_main.C: Add support for --import command line switch. + Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded. + Available Formats: Everything accepted by 'buffer-import ' + +2000-04-27 Lars Gullik Bjønnes + + * src/lyx_gui.C (create_forms): small oneliner from Garst to have + unnumbered parts. + + * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the + documents will be reformatted upon reentry. + +2000-04-27 Juergen Vigna + + * src/CutAndPaste.C (pasteSelection): last paragraph was not returned + correctly only last pos this was a bug. + +2000-04-26 Lars Gullik Bjønnes + + * release of lyx-1.1.5pre1 + +2000-04-26 Jean-Marc Lasgouttes + + * src/insets/insettabular.[Ch]: fix the Clone() declaration. + + * src/menus.C: revert the change of naming (Figure->Graphic...) + from 2000-04-11. It was incomplete and bad. + + * src/LColor.[Ch]: add LColor::depthbar. + * src/text.C (GetVisibleRow): use it. + + * README: update the languages list. + +2000-04-25 Dekel Tsur + + * src/text.C (GetVisibleRow): show the depth of paragraphs using + vertical bars. + +2000-04-26 Lars Gullik Bjønnes + + * README: remove sections that were just wrong. + + * src/text2.C (GetRowNearY): remove currentrow code + + * src/text.C (GetRow): remove currentrow code + + * src/screen.C (Update): rewritten a bit. + (SmallUpdate): removed func + + * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never + used. + (FullRebreak): return bool + (currentrow): remove var + (currentrow_y): ditto + + * src/lyxscreen.h (Draw): change arg to unsigned long + (FitCursor): return bool + (FitManualCursor): ditto + (Smallpdate): remove func + (first): change to unsigned long + (DrawOneRow): change second arg to long (from long &) + (screen_refresh_y): remove var + (scree_refresh_row): ditto + + * src/lyxrow.h: change baseline to usigned int from unsigned + short, this brings some implicit/unsigned issues out in the open. + + * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change + accordingly. + (Dispatch): don't call updateScrollbar after fitCursor. Use update + instead of smallUpdate. + + * src/lyxcursor.h: change y to unsigned long + + * src/buffer.h: don't call updateScrollbar after fitcursor + + * src/buffer.C (parseSingleLyXformat2Token): move variables to + where they are used. Removed "\\direction", this was not present + in 1.1.4 and is already obsolete. Commented out some code that I + believe to never be called. + (runLiterate): don't call updateScrollbar after fitCursor + (runLaTeX): ditto + (buildProgram): ditto + (runChktex): ditto + + * src/WorkArea.h (workWidth): change return val to unsigned + (width): ditto + (height): ditto + (redraw): remove the button redraws + (setScrollbarValue): change for scrollbar + (getScrollbarValue): change for scrollbar + (getScrollbarBounds): change for scrollbar + + * src/WorkArea.C (C_WorkArea_up_cb): removed func + (C_WorkArea_down_cb): removed func + (WorkArea): use fl_add_scrollbar instead of two buttons and a slider. + (resize): change for scrollbar + (setScrollbar): ditto + (setScrollbarBounds): ditto + (setScrollbarIncrements): ditto + (up_cb): removed func + (down_cb): removed func + (scroll_cb): change for scrollbar + (work_area_handler): ditto + + * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar + when FitCursor did something. + (updateScrollbar): some unsigned changes + (downCB): removed func + (scrollUpOnePage): removed func + (scrollDownOnePage): remvoed func + (workAreaMotionNotify): don't call screen->FitCursor but use + fitCursor instead. and bool return val + (workAreaButtonPress): ditto + (workAreaButtonRelease): some unsigned changes + (checkInsetHit): ditto + (workAreaExpose): ditto + (update): parts rewritten, comments about the signed char arg added + (smallUpdate): removed func + (cursorPrevious): call needed updateScrollbar + (cursorNext): ditto + + * src/BufferView2.C (allFloats): don't call updateScrollbar after + fitCursor. + + * src/BufferView.[Ch] (upCB): removed func + (downCB): removed func + (smallUpdate): removed func + +2000-04-25 Lars Gullik Bjønnes + + * src/lyxtext.h src/text.C src/text2.C: removed support for the + currentrow, currentrow_y optimization. This did not help a lot and + if we want to do this kind of optimization we should rather use + cursor.row instead of the currentrow. + + * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in + buffer spacing and klyx spacing support. + +2000-04-25 Dekel Tsur + + * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by + a factor of 50! + +2000-04-26 Juergen Vigna + + * src/insets/figinset.C: fixes to Lars sstream changes! + +2000-04-23 Dekel Tsur + + * A lot of files: Added Ascii(ostream &) methods to all inset + classes. Used when exporting to ASCII. + + * src/buffer.C (writeFileAscii,RoffAsciiTable) + * src/paragraph.C (RoffContTableRows): Use the Ascii() methods + instead of Latex() + + * src/text2.C (ToggleFree): Disabled implicit word selection when + there is a change in the language + + * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug: + no output was generated for end-of-sentence inset. + + * src/insets/lyxinset.h + * src/buffer.C + * src/lyxfunc.C + * src/paragraph.C: Removed the insetnumber code + + * src/text.C (SelectWordWhenUnderCursor): Cleaned the code. + +2000-04-22 Lars Gullik Bjønnes + + * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1, + no_babel and no_epsfig completely from the file. + (parseSingleLyXformat2Token): add handling for per-paragraph + spacing as written by klyx. + + * src/insets/figinset.C: applied patch by Andre. Made it work with + ostringstream too. + +2000-04-20 Juergen Vigna + + * src/insets/insettext.C (cutSelection): + (copySelection): Fixed with selection from right to left. + (draw): now the rows are not recalculated at every draw. + (computeTextRows): for now reset the inset-owner here (this is + important for an undo or copy where the inset-owner is not set + automatically!) + + * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the + motion to the_locking_inset screen->first was forgotten, this was + not important till we got multiline insets. + +2000-04-19 Jean-Marc Lasgouttes + + * src/mathed/formulamacro.C (Latex): remove CHECK comment, since + code seems to be alright (it is code changed by Dekel, and the + intent is indeed that all macros should be defined \protect'ed) + + * NEWS: a bit of reorganisation of the new user-visible features. + +2000-04-19 Juergen Vigna + + * src/insets/insettext.C (init): using a LyXCursor now for cursor + position. Set the inset_owner of the used paragraph so that it knows + that it is inside an inset. Fixed cursor handling with mouse and + cursor keys. Fixed wrong timed inset redraws and lots of other changes + and cleanups to make TextInsets work better. + + * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call. + Changed parameters of various functions and added LockInsetInInset(). + + * src/insets/insettext.C: + + * src/insets/insetcollapsable.h: + * src/insets/insetcollapsable.C: + * src/insets/insetfoot.h: + * src/insets/insetfoot.C: + * src/insets/insetert.h: + * src/insets/insetert.C: cleaned up the code so that it works now + correctly with insettext. + + * src/insets/inset.C: + * src/insets/lyxinset.h: inserted inset_owner and some more changes so + that insets in insets are supported right. + + * src/table.h: + * src/table.C: lots of changes for use with inset tabular (and cleanup) + + * src/paragraph.C: some small fixes + + * src/debug.h: inserted INSETS debug info + + * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset + fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN). + + * src/commandtags.h: + * src/LyXAction.C: insert code for InsetTabular. + + * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if + not Button1MotionMask. + (workAreaButtonRelease): send always a InsetButtonRelease event to + the_locking_inset. + (checkInsetHit): some setCursor fixes (always with insets). + + * src/BufferView2.C (lockInset): returns a bool now and extended for + locking insets inside insets. + (showLockedInsetCursor): it is important to have the cursor always + before the locked inset. + (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset. + + * src/BufferView.h: made lockInset return a bool. + + * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...). + + * src/text2.C (SetCursor): This now has a version with a LyXCursor + that is used also internally but can be called as public to have back + a cursor pos which is not set internally. + (SetCursorIntern): Changed to use above function. + + * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass + +2000-04-19 Lars Gullik Bjønnes + + * ANNOUNCE: + * INSTALL: + * UPGRADING: + * NEWS: updated for prerelease of 1.1.5. Please comment and send + patches for things that should be in or should be changed. + + * src/* [insetfiles]: change "usigned char fragile" to bool + fragile. There was only one point that could that be questioned + and that is commented in formulamacro.C. Grep for "CHECK". + + * src/CutAndPaste.C (getBufferTextClass): unused func, removed. + (DeleteBuffer): take it out of CutAndPaste and make it static. + +2000-04-17 Lars Gullik Bjønnes + + * src/paragraph.C (TeXOnePar): use the new method in Spacing to + output the spacing envir commands. Also the new commands used in + the LaTeX output makes the result better. + + * src/Spacing.C (writeEnvirBegin): new method + (writeEnvirEnd): new method + +2000-04-18 Juergen Vigna + + * src/CutAndPaste.C: made textclass a static member of the class + as otherwise it is not accesed right!!! + +2000-04-17 Dekel Tsur + + * forms/layout_forms.fd + * src/layout_forms.h + * src/layout_forms.C (create_form_form_character) + * src/lyx_cb.C (UserFreeFont) + * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual + documents (in the layout->character popup). + +2000-04-17 Jean-Marc Lasgouttes + + * src/spellchecker.C (create_ispell_pipe): fix a bug where + \spell_command was in fact not honored (from Kevin Atkinson). + + * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when + quitting (Angus) + + * src/lyx_gui.h: make lyxViews private (Angus) + +2000-04-15 Dekel Tsur + + * src/mathed/math_write.C + (MathMatrixInset::Write) Put \protect before \begin{array} and + \end{array} if fragile + (MathParInset::Write): Put \protect before \\ if fragile + +2000-04-15 Lars Gullik Bjønnes + + * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The + initialization if the LyXColorHandler must be done after the + connections to the XServer has been established. + + * src/insets/figinset.C (runqueue): change the grabing a bit. Also + get the background pixel from the lyxColorhandler so that the + figures are rendered with the correct background color. + (NextToken): removed functions. + (GetPSSizes): use ifs >> string instead of NextToken. + + * src/Painter.[Ch]: the color cache moved out of this file. + + * src/ColorHandler.[Ch]: new files. Holds the gc cache for color + and lines. + +2000-04-14 Lars Gullik Bjønnes + + * src/WorkArea.C (work_area_handler): call BufferView::enterView + and Buffer::leaveView when FL_ENTER and FL_LEAVE. + + * src/BufferView.C (enterView): new func + (leaveView): new func + + * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor + when approp. + (leaveView): new func, undefines xterm cursor when approp. + + * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C + (AllowInput): delete the Workarea cursor handling from this func. + + * src/Painter.C (underline): draw a slimer underline in most cases. + + * src/lyx_main.C (error_handler): use extern "C" + +2000-04-12 Lars Gullik Bjønnes + + * src/insets/figinset.C (DocBook): small patch from Jose (jamatos) + sent directly to me. + + * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted + to the list by Dekel. + + * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with + strstream too. + + * src/bufferview_funcs.[Ch]: two new files, moved several of the + methods from lyx_cb.here. + + * src/lyx_cb.C: in addition to the above; removed input_prohibited + it was not used. + +2000-04-11 Lars Gullik Bjønnes + + * src/lyx_cb.[Ch]: made several functions take a BufferView* arg + instead of using current_view directly. + + * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation + + * src/LyXAction.C (init): add the paragraph-spacing command. + + * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING + + * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing + + * src/lyx_cb.C (CurrentState): output a string when the spacing is + different from the documents. + + * src/text.C (SetHeightOfRow): take paragraph spacing into + account, paragraph spacing takes precedence over buffer spacing + (GetVisibleRow): ditto + + * src/paragraph.C (writeFile): output the spacing parameter too. + (validate): set the correct features if spacing is used in the + paragraph. + (Clear): set spacing to default + (MakeSameLayout): spacing too + (HasSameLayout): spacing too + (SetLayout): spacing too + (TeXOnePar): output the spacing commands + + * src/lyxparagraph.h: added a spacing variable for use with + per-paragraph spacing. + + * src/Spacing.h: add a Default spacing and a method to check if + the current spacing is default. also added an operator== + + * src/text2.C (DeleteEmptyParagraphMechanism): added a + RedoParagraphs. + +2000-04-11 Jean-Marc Lasgouttes + + * src/lyxserver.C (callback): fix dispatch of functions + + * src/insets/insetlatexaccent.C (checkContents): turn bogus + printf() into lyxerr call. + + * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of + fonts. + + * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic", + "Table" to "Table Box", "Float" to "Floating Material"; deletes + the "Float" from each of the subitems. + (ShowHelpMenu): add entry for "FAQ" and "TOC". + + * src/support/DebugStream.h: add an #ifdef to work around a gcc + 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I + documented the change so that the workaround can be nuked later. + + * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from + LyX::init(). + + * src/lyxlex_pimpl.C (next): do not re-declare the default value + of arguments. + * src/buffer.C (getLatexName): ditto + (setReadonly): ditto + +2000-04-11 Lars Gullik Bjønnes + + * src/LaTeXFeatures.h: add a const reference to BufferParams, to + avoid some uses of current_view. Added also a bufferParams() + method to get at this. + + * src/lyxtext.h: changed params->buffer and paramters->bparams. + +2000-04-10 Lars Gullik Bjønnes + + * src/lyxparagraph.[Ch]: removed + operator<(LyXParagraph::InsetTable..., added a struct matchIT + with operators used by lower_bound and + upper_bound in InsetTable's + Make struct InsetTable private again. Used matchpos. + +2000-04-08 Dekel Tsur + + * src/lyx_cb.C (DocumentApplyCB): When changing the language of the + document, the language of existing text is changed (unless the + document is multi-lingual) + + * src/buffer.C (ChangeLanguage,isMultiLingual) New methods. + + * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods. + + * A lot of files: A rewrite of the Right-to-Left support. + +2000-04-10 Juergen Vigna + + * src/BufferView2.C (showLockedInsetCursor): small bugfix for + misplaced cursor when inset in inset is locked. + + * src/insets/insettext.C (LocalDispatch): small fix so that a + BREAKLINE is not inserted if we don't permit it with autBreakRows. + + * src/insets/insetfoot.C (GetDrawFont): implemented this as the + footnote font should be decreased in size twice when displaying. + + * src/insets/insettext.C (GetDrawFont): inserted this function as + the drawing-font may differ from the real paragraph font. + + * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking + insets (inset in inset!). + + * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below + function here because we don't want footnotes inside footnotes. + + * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for + Cloned insets. + (init): now set the inset_owner in paragraph.C + (LocalDispatch): added some resetPos() in the right position + (cutSelection): + (copySelection): + (pasteSelection): changed to use the new CutAndPaste-Class. + + * src/insets/lyxinset.h: inserted new function InsertInsetAllowed + which tells if it is allowed to insert another inset inside this one. + + * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for + SwitchLayoutsBetweenClasses. + + * src/text2.C (InsertInset): checking of the new paragraph-function + InsertInsetAllowed. + (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this + is not needed anymore here! + (CutSelection): + (CopySelection): + (PasteSelection): redone (also with #ifdef) so that now this uses + the CutAndPaste-Class. + (SwitchLayoutsBetweenClasses): removed here and implemented in the + CutAndPaste-Class. + + * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste + from/to text/insets. + + * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer + so that the paragraph knows if it is inside an (text)-inset. + (InsertFromMinibuffer): changed return-value to bool as now it + may happen that an inset is not inserted in the paragraph. + (InsertInsetAllowed): this checks if it is allowed to insert an + inset in this paragraph. + (PasteParagraph): + (BreakParagraphConservative): + (BreakParagraph) : small change for the above change of the return + value of InsertFromMinibuffer. + + * src/lyxparagraph.h: added inset_owner and the functions to handle + this (SetInsetOwner(), InInset() and InsertInsetAllowed()). + +2000-04-10 Lars Gullik Bjønnes + + * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more + functions from BufferView to BufferView::Pimpl to ease maintence. + + * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor + correctly. Also use SetCursorIntern instead of SetCursor. + + * src/insets/insetinfo.C (draw): draw InsetInfo notes with the + correct color. + +2000-04-08 Lars Gullik Bjønnes + + * src/WorkArea.C (belowMouse): manually implement below mouse. + + * src/*: Add "explicit" on several constructors, I added probably + some unneeded ones. A couple of changes to code because of this. + + * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the + implementation and private parts from the users of BufferView. Not + quite finished. + + * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the + implementation and private parts from the users of LyXLex. Not + quite finished. + + * src/BufferView_pimpl.[Ch]: new files + + * src/lyxlex_pimpl.[Ch]: new files + + * src/LyXView.[Ch]: some inline functions move out-of-line + +2000-04-04 Jean-Marc Lasgouttes + + * src/lyxparagraph.h: make struct InsetTable public. + + * src/support/lyxstring.h: change lyxstring::difference_type to be + ptrdiff_t. Add std:: modifiers to streams. + + * src/font.C: include the header, for islower() and + isupper(). + +2000-04-03 Lars Gullik Bjønnes + + * src/font.[Ch]: new files. Contains the metric functions for + fonts, takes a LyXFont as parameter. Better separation of concepts. + + * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several + changes because of this. + + * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead + + * src/*: compile with -Winline and move functions that don't + inline out of line. + + * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of + instead of strspn. + +2000-04-02 Lars Gullik Bjønnes + + * src/paragraph.C (GetLabelstring): renamed from GetLabestring. + (various files changed because of this) + + * src/Painter.C (text): fixed the drawing of smallcaps. + + * src/lyxfont.[Ch] (drawText): removed unused member func. + (drawString): ditto + + * src/*.C: added needed "using" statements and "std::" qualifiers. + +2000-03-31 Lars Gullik Bjønnes + + * src/*.h: removed all use of "using" from header files use + qualifier std:: instead. + +2000-04-03 Jean-Marc Lasgouttes + + * src/text.C (Backspace): some additional cleanups (we already + know whether cursor.pos is 0 or not). + + * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since + automake does not provide one). + + * src/bmtable.h: replace C++ comments with C comments. + +2000-04-02 Dekel Tsur + + * src/screen.C (ShowCursor): Change the shape of the cursor if + the current language is not equal to the language of the document. + (If the cursor change its shape unexpectedly, then you've found a bug) + + * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some + bugs [I hope...] + + * src/insets/insetnumber.[Ch]: New files. + + * src/LyXAction.C (init) + * src/lyxfunc.C (dispatch): Add command number-inset-insert + + * lyxrc.example + * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset + + * src/lyxparagraph.h + * src/paragraph.C: Changed insetlist to Vector. + (the vector is kept sorted). + + * src/text.C (GetVisibleRow): Draw selection correctly when there + is both LTR and RTL text. + + * src/paragraph.C (Clone): Use the assignment operator for cloning, + which is much faster. + + * src/text.C (GetVisibleRow and other): Do not draw the last space + in a row if the direction of the last letter is not equal to the + direction of the paragraph. + + * src/lyxfont.C (latexWriteStartChanges): + Check that font language is not equal to basefont language. + (latexWriteEndChanges): ditto + + * src/lyx_cb.C (StyleReset): Don't change the language while using + the font-default command. + + * src/paragraph.C (GetFirstFontSettings): Handle correctly an + empty paragraph before a footnote. + + * src/insets/insetcommand.C (draw): Increase x correctly. + + * src/screen.C (ShowCursor): Change cursor shape if + current language != document language. + + * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState() + +2000-03-31 Juergen Vigna + + * src/paragraph.C (GetInset): commented out text[pos] = ' ' + (Clone): changed mode how the paragraph-data is copied to the + new clone-paragraph. + + * src/lyxfunc.C (Dispatch): fixed small problem when calling + GetInset(pos) with no inset anymore there (in inset UNDO) + + * src/insets/insetcommand.C (draw): small fix as here x is + incremented not as much as width() returns (2 before, 2 behind = 4) + +2000-03-30 Juergen Vigna + + * src/insets/insettext.C (InsetText): small fix in initialize + widthOffset (should not be done in the init() function) + +2000-03-29 Amir Karger + + * lib/examples/it_ItemizeBullets.lyx: translation by + Stefano Mastella + + * Implemented \textasciitilde and fixed a tiny bug in reLyX + +2000-03-29 Juergen Vigna + + * src/insets/insetcollapsable.C (Clone): same as in InsetFoot + + * src/insets/insetfoot.C (Clone): small change as for the below + new init function in the text-inset + + * src/insets/insettext.C (init): new function as I've seen that + clone did not copy the Paragraph-Data! + (LocalDispatch): Added code so that now we have some sort of Undo + functionality (well actually we HAVE Undo ;) + + * src/text.C (Backspace): Small fix for the a | a Backspace problem + +2000-03-24 Dekel Tsur + + * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions + were erased) + +2000-03-22 Lars Gullik Bjønnes + + * src/main.C: added a runtime check that verifies that the xforms + header used when building LyX and the library used when running + LyX match. Exit with a message if they don't match. This is a + version number check only. + + * src/buffer.C (save): Don't allocate memory on the heap for + struct utimbuf times. + + * *: some using changes, use iosfwd instead of the real headers. + + * src/lyxfont.C use char const * instead of string for the static + strings. Rewrite some functions to use sstream. + +2000-03-28 Jean-Marc Lasgouttes + + * src/text.C (Backspace): hopefully fix the dreaded backaspace + bug. + +2000-03-27 Jean-Marc Lasgouttes + + * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal + of Geodesy (from Martin Vermeer) + + * lib/layouts/svjour.inc: include file for the Springer svjour + class. It can be used to support journals other than JoG. + + * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz + Miskiewicz ) + * lib/reLyX/Makefile.am: ditto. + +2000-03-27 Juergen Vigna + + * src/insets/insettext.C: added Cut/Copy/Paste inside insets, + also some modifications with operations on selected text. + + * src/BufferView.C (checkInsetHit): Now hopefully fixed all the + problems with clicking on insets (last famous words ;) + + * src/insets/insetcommand.C (draw): + (width): Changed to have a bit of space before and after the inset so + that the blinking cursor can be seen (otherwise it was hidden) + +2000-03-22 Jean-Marc Lasgouttes + + * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl + would not be added to the link list when an installed gettext (not + part of libc) is found. + +2000-03-24 Juergen Vigna + + * src/insets/insetcollapsable.C (Edit): + * src/mathed/formula.C (InsetButtonRelease): + (InsetButtonPress): fixed for new handling of ButtonPress/Release + handling. + + * src/BufferView.C (workAreaButtonPress): + (workAreaButtonRelease): + (checkInsetHit): Finally fixed the clicking on insets be handled + correctly! + + * src/insets/insetert.C (Edit): inserted this call so that ERT + insets work always with LaTeX-font + +2000-03-21 Kayvan A. Sylvan + + * src/lyx_main.C (easyParse): Removed misplaced gui=false which + caused lyx to startup with no GUI in place, causing in a crash + upon startup when called with arguments. + +2000-03-21 Jean-Marc Lasgouttes + + * src/FontLoader.C: better initialization of dummyXFontStruct. + +2000-03-20 José Abílio Matos + + * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags + for linuxdoc and docbook import and export format options. + + * lib/lyxrc.example Example of default values for the previous flags. + + * src/lyx_cb.C Use those flags instead of the hardwired values for + linuxdoc and docbook export. + + * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added + linuxdoc import. + + * src/menus.C Added menus entries for the new import/exports formats. + +2000-03-09 André Pönitz + + * src/lyxrc.*: Added support for running without Gui + (\use_gui false) + + * src/FontLoader.C: sensible defaults if no fonts are needed + + * src/lyx_cb.C: New function ShowMessage (writes either to the + minibuffer or cout in case of no gui + New function AskOverwrite for common stuff + Consequently various changes to call these functions + + * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false + wild guess at sensible screen resolution when having no gui + + * src/lyxfont.C: no gui, no fonts... set some defaults + +2000-03-20 Jean-Marc Lasgouttes + + * src/LColor.C: made the command inset background a bit lighter. + +2000-03-20 Hartmut Goebel + + * lib/layouts/stdstruct.inc: split into stdtitle.inc and + stdstruct.inc. Koma-Script added some title elements which + otherwise have been listed below "bibliography". This split allows + adding title elements to where they belong. + + * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then + define the additional title elements and then include + stdstruct.inc. + + * many other layout files: changed to include stdtitle.inc just + before stdstruct.inc. + +2000-03-18 Dekel Tsur + + * src/buffer.C: (save) Added the option to store all backup files + in a single directory + + * src/lyxrc.[Ch]: Added variable \backupdir_path + + * lib/lyxrc.example: Added descriptions of recently added variables + + * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a + bibtex inset, not closing the bibtex popup when deleting the inset) + +2000-03-17 Jean-Marc Lasgouttes + + * src/lyx_cb.C: add a couple using directives. + +2000-03-17 José Abílio Matos + * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc + import based on the filename. + + * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc + file would be imported at start, if the filename where of a sgml file. + + * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed. + + * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed. + +2000-03-16 Dekel Tsur + * src/lyxfont.h Replaced the member variable bits.direction by the + member variable lang. Made many changes in other files. + This allows having a multi-lingual document + + * src/lyxfunc.C, src/lyx_cb.C Added a new command "language " + that change the current language to . + Removed the command "font-rtl" + + * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file + format for Hebrew documents) + + * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode" + When auto_mathmode is "true", pressing a digit key in normal mode + will cause entering into mathmode. + If auto_mathmode is "rtl" then this behavior will be active only + when writing right-to-left text. + + * src/text2.C (InsertStringA) The string is inserted using the + current font. + + * src/paragraph.C (GetEndLabel) Gives a correct result for + footnote paragraphs. + + * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug + +2000-03-16 Lars Gullik Bjønnes + + * src/text.C (Backspace): move RemoveParagraph and RemoveRow in + front of PasteParagraph. Never insert a ' '. This should at least + fix some cause for the segfaults that we have been experiencing, + it also fixes backspace behaviour slightly. (Phu!) + + * src/support/lstrings.C (compare_no_case): some change to make it + compile with gcc 2.95.2 and stdlibc++-v3 + + * src/text2.C (MeltFootnoteEnvironment): change type o + first_footnote_par_is_not_empty to bool. + + * src/lyxparagraph.h: make text private. Changes in other files + because of this. + (fitToSize): new function + (setContentsFromPar): new function + (clearContents): new function + (SetChar): new function + + * src/paragraph.C (readSimpleWholeFile): deleted. + + * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold + the file, just use a simple string instead. Also read the file in + a more maintainable manner. + + * src/text2.C (InsertStringA): deleted. + (InsertStringB): deleted. + +2000-03-15 Lars Gullik Bjønnes + + * src/text2.C (DeleteEmptyParagraphMechanism): don't run, + RedoParagraphs from the doublespace handling part, just set status + to NEED_MORE_REFRESH. Also don't update cursor position (should be + done, but perhaps not like this.) + +2000-03-14 Jean-Marc Lasgouttes + + * src/text2.C (InsertStringA): don't forget to insert a META_INSET + character when inserting an inset. + +2000-03-12 Lars Gullik Bjønnes + + * src/bufferparams.C (readLanguage): now takes "default" into + consideration. + + * src/lyx_main.C (LyX): remove the setup of lyxrc. (new) + also initialize the toplevel_keymap with the default bindings from + lyxrc. + + * src/buffer.C (Buffer): remove lyxrc from the parameters. + + * all files using lyxrc: have lyxrc as a real variable and not a + pointer. remove all extern LyXRC * lyxrc. The equiv to this is + done in lyxrc.h. + + * src/lyxrc.C: remove double call to defaultKeyBindings + + * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of + toolbar defauls using lyxlex. Remove enums, structs, functions + related to this. + + * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing + toolbar defaults. Also store default keybindings in a map. + + * src/ToolbarDefaults.[Ch]: New file. This class is used for + storing the toolbar defaults without any xforms dependencies. + + * src/insets/figinset.C: patch posted to list by Andre Poenitz + applied. Changed to use iterators. + +2000-03-11 Kayvan A. Sylvan + + * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for + systems that don't have LINGUAS set to begin with. + +2000-03-10 Lars Gullik Bjønnes + + * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to + the list by Dekel Tsur. + +2000-03-10 Jean-Marc Lasgouttes + + * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage. + * src/insets/form_graphics.C: ditto. + + * src/insets/inseturl.C (Latex): the free_spc argument is not used. + +2000-03-10 Lars Gullik Bjønnes + + * src/bufferparams.C (readLanguage): use the new language map + + * src/intl.C (InitKeyMapper): use the new language map + + * src/lyx_gui.C (create_forms): use the new language map + + * src/language.[Ch]: New files. Used for holding the information + about each language. Now! Use this new language map enhance it and + make it really usable for our needs. + +2000-03-09 Dekel Tsur + + * screen.C (ShowCursor): Removed duplicate code. + (ShowManualCursor): Support for 3 cursor shapes: Bar (default), + L (LTR text in RTL document), and reversed-L (RTL text in LTR document) + + * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin + + * src/lyxtext.h + * src/text.C Added TransformChar method. Used for rendering Arabic + text correctly (change the glyphs of the letter according to the + position in the word) + + * src/buffer.C + * src/paragraph.C + * src/lyxrc.h + * src/lyxrc.C Added lyxrc command {language_command_begin, + language_command_end,language_command_ltr,language_command_rtl, + language_package} which allows the use of either arabtex or Omega + for Arabic + + * src/lyx_gui.C (init) + * src/lyxrc.h + * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows + to use encoding for menu fonts which is different than the encoding + for screen fonts + + * src/buffer.C (makeLaTeXFile): If params.language = "default", + do not load the babel package. + To write an English document with Hebrew/Arabic, change the document + language to "english". + + * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document + (alphaCounter): changed to return char + (loweralphaCounter, hebrewCounter, romanCounter): New functions + + * lib/lyxrc.example Added examples for Hebrew/Arabic + + * src/layout.h + * src/layout.C Added layout command endlabeltype + + * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const + + * src/text.C (GetVisibleRow): Draw a box at the end of proof layout + +2000-03-10 Lars Gullik Bjønnes + + * src/mathed/math_delim.C (search_deco): return a + math_deco_struct* instead of index. + +2000-03-09 Lars Gullik Bjønnes + + * All files with a USE_OSTREAM_ONLY within: removed all code that + was unused when USE_OSTREAM_ONLY is defined. + + * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead + of any less. Removed header and using. + + * src/text.C (GetVisibleRow): draw the string "Page Break + (top/bottom)" on screen when drawing a pagebreak line. + +2000-03-09 Jean-Marc Lasgouttes + + * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs. + + * src/mathed/math_macro.C (draw): do some cast magic. + (Metrics): ditto. + + * src/mathed/math_defs.h: change byte* argument to byte const*. + + * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method. + + * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I + know it is right to return InsetFoot* too, but cxx does not like + it...). + + * src/insets/insetcollapsable.[Ch] (Clone): make const. + + * development/lyx.spec.in: unset LINGUAS to avoid i18n problems. + + * src/mathed/math_delim.C: change == to proper assignment. + +2000-03-09 Juergen Vigna + + * src/insets/insettext.C (setPos): fixed various cursor positioning + problems (via mouse and cursor-keys) + (LocalDispatch): added posibility to add a Ctrl-Enter inside a text + inset (still a small display problem but it works ;) + + * src/insets/insetcollapsable.C (draw): added button_top_y and + button_bottom_y to have correct values for clicking on the inset. + + * src/support/lyxalgo.h: commented out 'using std::less' + +2000-03-08 Juergen Vigna + + * src/insets/insetcollapsable.C (InsetButtonRelease): Now a + Button-Release event closes as it is alos the Release-Event + which opens it. + + * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT + +2000-03-07 Kayvan A. Sylvan + + * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we + can add multiple spaces in Scrap (literate programming) styles... + which, by the way, is how I got hooked on LyX to begin with. + + * src/mathed/formula.C (Write): Added dummy variable to an + inset::Latex() call. + (Latex): Add free_spacing boolean to inset::Latex() + + * src/mathed/formula.h (Latex): Added free_spacing boolean arg. + + * src/insets/lyxinset.h: Changed definition of the inset::Latex() + virtual function to include the free_spacing boolean from + the containing paragraph's style. + + * src/insets/inseturl.C, src/insets/inseturl.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insettext.C, src/insets/insettext.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex): + Added free_spacing boolean and made sure that if in a free_spacing + paragraph, that we output normal space if there is a protected space. + + * src/insets/insetref.C, src/insets/insetref.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetparent.C, src/insets/insetparent.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added + free_spacing boolean arg to match inset.h + + * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/inseterror.C, src/insets/inseterror.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex): + Added free_spacing boolean arg to match inset.h + + * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added + free_spacing boolean arg to match inset.h + + * src/insets/figinset.C, src/insets/figinset.h (Latex): Added + free_spacing boolean arg to match inset.h + + * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to + ignore free_spacing paragraphs. The user's spaces are left + alone. + + * src/text.C (InsertChar): Fixed the free_spacing layout + attribute behavior. Now, if free_spacing is set, you can + add multiple spaces in a paragraph with impunity (and they + get output verbatim). + (SelectSelectedWord): Added dummy argument to inset::Latex() + call. + + * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...) + calls. + + * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing + paragraph layouts now only input a simple space instead. + Special character insets don't make any sense in free-spacing + paragraphs. + + * src/buffer.C (parseSingleLyXformat2Token): Code to convert + hard-spaces in the *input* file to simple spaces if the layout + is free-spacing. This converts old files which had to have + hard-spaces in free-spacing layouts where a simple space was + preferrable. + (writeFileAscii): Added free_spacing check to pass to the newly + reworked inset::Latex(...) methods. The inset::Latex() code + ensures that hard-spaces in free-spacing paragraphs get output + as spaces (rather than "~"). + +2000-03-09 Lars Gullik Bjønnes + + * src/mathed/math_delim.C (draw): draw the empty placeholder + delims with a onoffdash line. + (struct math_deco_compare): struct that holds the "functors" used + for the sort and the binary search in math_deco_table. + (class init_deco_table): class used for initial sort of the + math_deco_table. + (search_deco): use lower_bound to do a binary search in the + math_deco_table. + +2000-03-08 Lars Gullik Bjønnes + + * src/lyxrc.C: a small secret thingie... + + * src/lyxlex.C (printTable): changed to take a ostream as paramter + and to not flush the stream as often as it used to. + + * src/support/lyxalgo.h: new file + (sorted): template function used for checking if a sequence is + sorted or not. Two versions with and without user supplied + compare. Uses same compare as std::sort. + + * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort + it and give warning on lyxerr. + (pushTable): ditto + (struct compare_tags): struct with function operators used for + checking if sorted, sorting and lower_bound. + (search_kw): use lower_bound instead of manually implemented + binary search. + +2000-03-08 Jean-Marc Lasgouttes + + * src/insets/insetcollapsable.h: fix Clone() declaration. + * src/insets/insetfoot.h: ditto. + + * src/insets/lyxinset.h: remove an extra comma at the end of enum. + +2000-03-08 Juergen Vigna + + * src/insets/lyxinset.h: added owner call which tells us if + this inset is inside another inset. Changed also the return-type + of Editable to an enum so it tells clearer what the return-value is. + + * src/insets/insettext.C (computeTextRows): fixed computing of + textinsets which split automatically on more rows. + + * src/insets/insetert.[Ch]: changed this to be of BaseType + InsetCollapsable. + + * src/insets/insetfoot.[Ch]: added footnote inset + + * src/insets/insetcollapsable.[Ch]: added this BaseClass for + collapsable insets (like footnote, ert, ...) + +2000-03-08 Lars Gullik Bjønnes + + * src/lyxdraw.h: remvoe file + + * src/lyxdraw.C: remove file + + * src/insets/insettext.C: added . + +2000-03-07 Lars Gullik Bjønnes + + * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream + (matrix_cb): case MM_OK use string stream + + * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string + stream. + + * src/mathed/math_macro.C (draw): use string stream + (Metrics): use string stream + + * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write + directly to the ostream. + + * src/vspace.C (asString): use string stream. + (asString): use string stream + (asLatexString): use string stream + + * src/lyx_cb.C (UpdateLayoutDocument): use string stream for + setting Spacing::Other. + + * src/LaTeXFeatures.C (getPackages): use string stream instead of + sprintf when creating the stretch vale. + + * src/text2.C (alphaCounter): changed to return a string and to + not use a static variable internally. Also fixed a one-off bug. + (SetCounter): changed the drawing of the labels to use string + streams instead of sprintf. + + * src/support/lyxmanip.h: rewrite the newlineanDepth ostream + manipulator to use a scheme that does not require library support. + This is also the way it is done in the new GNU libstdc++. Should + work with DEC cxx now. + +2000-03-06 Lars Gullik Bjønnes + + * src/mathed/math_inset.h (Write(ostream & os): add a space at the + end. This fixes a bug. + + * src/mathed (all files concerned with file writing): apply the + USE_OSTREAM_ONLY changes to mathed too. + + * src/support/DebugStream.h: make the constructor explicit. + + * src/lyxfont.C (latexWriteStartChanges): small bug related to + count and ostream squashed. + +2000-03-06 Jean-Marc Lasgouttes + + * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h. + + * src/buffer.C (makeLaTeXFile): add a .c_str(), since + ostringstream uses STL strings, and we might not. + + * src/insets/insetspecialchar.C: add using directive. + * src/insets/insettext.C: ditto. + +2000-03-06 Lars Gullik Bjønnes + + * lib/layouts/seminar.layout: feeble attempt at a layout for + seminar.cls, far from completet and could really use some looking + at from people used to write layout files. + + * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to + use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is + a lot nicer and works nicely with ostreams. + + * src/mathed/formula.C (draw): a slightly different solution that + the one posted to the list, but I think this one works too. (font + size wrong in headers.) + + * src/insets/insettext.C (computeTextRows): some fiddling on + Jürgens turf, added some comments that he should read. + + * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never + used and it gave compiler warnings. + RC_SHOW_BANNER + "\\show_banner" added, also to reading and + writing of lyxrc. + + * src/lyx_gui.C (create_forms): do the right thing when + show_banner is true/false. + + * src/lyx_cb.C (TimerCB): no need to close or do anything if + show_banner is false. + + * most file writing files: Now use iostreams to do almost all of + the writing. Also instead of passing string &, we now use + stringstreams. mathed output is still not adapted to iostreams. + This change can be turned off by commenting out all the occurences + of the "#define USE_OSTREAM_ONLY 1" lines. + + * src/WorkArea.C (createPixmap): don't output debug messages. + (WorkArea): don't output debug messages. + + * lib/lyxrc.example: added a comment about the new variable + \show_banner + + * development/Code_rules/Rules: Added some more commente about how + to build class interfaces and on how better encapsulation can be + achieved. + +2000-03-03 Juergen Vigna + + * src/insets/insetert.C (InsetERT): Now ERT-insets break row + automatically with the width of the LyX-Window + + * src/insets/insettext.C (computeTextRows): fixed update bug in + displaying text-insets (scrollvalues where not initialized!) + +2000-03-02 Lars Gullik Bjønnes + + * src/mathed/math_utils.C (MathedLookupBOP): using only res->id == + id in the check of the result from lower_bound is not enough since + lower_bound can return last too, and then res->id will not be a + valid construct. + + * all insets and some code that use them: I have conditionalized + removed the Latex(string & out, ...) this means that only the + Latex(ostream &, ...) will be used. This is a work in progress to + move towards using streams for all output of files. + + * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type + c to 0. + +2000-03-02 Jean-Marc Lasgouttes + + * src/mathed/math_utils.C (MathedLookupBOP): fix the search + routine (this fixes bug where greek letters were surrounded by too + much white space). + + * src/support/filetools.C (findtexfile): change a bit the search + algorithm, to fix bug introduced in 1.1.4. Note that --format is + no longer passed to kpsewhich, we may have to change that later. + + * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent + warning options to avoid problems with X header files (from Angus + Leeming). + * acinclude.m4: regenerated. + +2000-03-02 Juergen Vigna + + * src/insets/insettext.C (WriteParagraphData): Using the + par->writeFile() function for writing paragraph-data. + (Read): Using buffer->parseSingleLyXformat2Token()-function + for parsing paragraph data! + + * src/buffer.C (readLyXformat2): removed all parse data and using + the new parseSingleLyXformat2Token()-function. + (parseSingleLyXformat2Token): added this function to parse (read) + lyx-file-format (this is called also from text-insets now!) + +2000-03-01 Lars Gullik Bjønnes + + * src/paragraph.C (BeginningOfMainBody): initialize previous_char + and temp. + + * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog + directly instead of going through a func. One very bad thing: a + static LyXFindReplace, but I don't know where to place it. + + * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a + string instead of char[]. Also changed to static. + (GetSelectionOrWordAtCursor): changed to static inline + (SetSelectionOverLenChars): ditto. + + * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of + current_view and global variables. both classes has changed names + and LyXFindReplace is not inherited from SearchForm. + + * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the + fl_form_search form. + + * src/lyx_gui.C (create_forms): removed the fl_form_search form. + +2000-03-01 Jean-Marc Lasgouttes + + * lib/bind/*.bind: make sure 'buffer-previous' function is not + bound (from Kayvan). + + * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h. + + * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address. + +2000-03-01 Lars Gullik Bjønnes + + * some things that I should comment but the local pub says head to + swirly... + + * comment out all code that belongs to the Roff code for Ascii + export of tables. (this is unused) + + * src/LyXView.C: use correct type for global variable + current_layout. (LyXTextClass::size_type) + + * some code to get the new insetgraphics closer to working I'd be + grateful for any help. + + * src/BufferView2.C (insertInset): use the return type of + NumberOfLayout properly. (also changes in other files) + + * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to + this as a test. I want to know what breaks because of this. + + * src/BufferView.[Ch] (tripleClick): name change from trippleClick. + +2000-02-29 Lars Gullik Bjønnes + + * lib/layouts/stdlists.inc: changed the lyxlist latex definition + to use a \makebox in the label, this allows proper justification + with out using protected spaces or multiple hfills. Now it is + "label" for left justified, "\hfill label\hfill" for center, and + "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5 + should be changed accordingly. + +2000-02-28 Jean-Marc Lasgouttes + + * src/lyxtext.h: change SetLayout() to take a + LyXTextClass::size_type instead of a char (when there is more than + 127 layouts in a class); also change type of copylayouttype. + * src/text2.C (SetLayout): ditto. + * src/LyXView.C (updateLayoutChoice): ditto. + + * src/LaTeX.C (scanLogFile): errors where the line number was not + given just after the '!'-line were ignored (from Dekel Tsur). + + * lib/lyxrc.example: fix description of \date_insert_format + + * lib/layouts/llncs.layout: new layout, contributed by Martin + Vermeer. + +2000-02-25 Lars Gullik Bjønnes + + * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc + 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in + cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C, + insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C, + BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C, + paragraph.C, text.C, text2.C) + +2000-02-25 Jean-Marc Lasgouttes + + * src/insets/insettext.C (LocalDispatch): remove extra break + statement. + + * src/insets/insetert.[Ch] (Clone): change return value to Inset* + * src/insets/insettext.[Ch] (Clone): change return value to Inset* + + * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier + * src/insets/insettext.[Ch] (GetCursorPos): ditto + + * src/insets/insetbib.h: move InsetBibkey::Holder and + InsetCitation::Holder in public space. + +2000-02-25 Lars Gullik Bjønnes + + * src/insets/insettext.h: small change to get the new files from + Juergen to compile (use "string", not "class string"). + + * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string + const & as parameter to LocalDispatch, use LyXFont const & as + paramter to some other func. This also had impacto on lyxinsets.h + and the two mathed insets. + +2000-02-24 Juergen Vigna + + * src/buffer.C: + * src/commandtags.h: + * src/LyXAction.C: + * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT + + * src/BufferView.h + * src/BufferView.C + * src/BufferView2.C: added/updated code for various inset-functions + + * src/insets/insetert.[Ch]: added implementation of InsetERT + + * src/insets/insettext.[Ch]: added implementation of InsetText + + * src/insets/inset.C (Edit): added "unsigned int button" parameter + (draw): added preliminary code for inset scrolling not finshed yet + + * src/insets/inset.C (LocalDispatch): changed arg parameter to string + as it is in lyxfunc.C now + + * src/insets/lyxinset.h: Added functions for text-insets + +2000-02-22 Lars Gullik Bjønnes + + * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into + BufferView and reimplement the list as a queue put inside its own + class. + + * src/bufferlist.[Ch] (updateInset): remove func, not needed. + + * several files: use the new interface to the "updateinsetlist" + + * src/WorkArea.C (work_area_handler): call BufferView::doubleClick + on doubleclick. + (work_area_handler): call BufferView::trippleClick on trippleclick. + + * src/BufferView.C (doubleClick): new function, selects word on + doubleclick. + (trippleClick): new function, selects line on trippleclick. + +2000-02-22 Allan Rae + + * lib/bind/xemacs.bind: buffer-previous not supported + +2000-02-21 Jean-Marc Lasgouttes + + * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods + as const. + +2000-02-20 Lars Gullik Bjønnes + + * src/bufferlist.C: get rid of current_view from this file + + * src/spellchecker.C: get rid of current_view from this file + + * src/vspace.C: get rid of current_view from this file + (inPixels): added BufferView parameter for this func + (asLatexCommand): added a BufferParams for this func + + * src/text.C src/text2.C: get rid of current_view from these + files. + + * src/lyxfont.C (getFontDirection): move this function here from + text.C + + * src/bufferparams.C (getDocumentDirection): move this function + here from text.C + + * src/paragraph.C (getParDirection): move this function here from + text.C + (getLetterDirection): ditto + +2000-02-18 Lars Gullik Bjønnes + + * WorkArea, Painter, LyXScreen: Fixed the crash that occured on + resize due to wrong pixmap beeing used. Also took the opurtunity + to make the LyXScreen stateless on regard to WorkArea and some + general cleanup in the same files. + +2000-02-17 Lars Gullik Bjønnes + + * src/Makefile.am: add missing direction.h + + * src/PainterBase.h: made the width functions const. + + * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some + missing ones. + + * src/insets/insetcommand.C (draw): draw Editable as buttons. + + * src/insets/insetlatexaccent.C (draw): make the accents draw + better, at present this will only work well with iso8859-1. + + * several files: remove the old drawing code, now we use the new + painter only. + + * several files: remove support for mono_video, reverse_video and + fast selection. + +2000-02-17 Juergen Vigna + + * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to + int ** as we have to return the pointer, otherwise we have only + NULL pointers in the returning function. + +2000-02-16 Jean-Marc Lasgouttes + + * src/LaTeX.C (operator()): quote file name when running latex. + +2000-02-15 Lars Gullik Bjønnes + + * src/toolbar.C (set): use fl_set_object_helper for the tooltop + (bubble tip), this removes our special handling of this. + + * Remove all code that is unused now that we have the new + workarea. (Code that are not active when NEW_WA is defined.) + + * Make the uses of XSync not conditionalized on define USE_XSYNC. + +2000-02-15 Jean-Marc Lasgouttes + + * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a + nonexisting layout; correctly redirect obsoleted layouts. + + * lib/lyxrc.example: document \view_dvi_paper_option + + * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option + variable. + + * src/lyx_cb.C (RunScript): handle $$FName for command names. + (PreviewDVI): handle the view_dvi_paper_option variable. + [Both from Roland Krause] + +2000-02-14 Lars Gullik Bjønnes + + * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int, + char const *, int, LyXFont) + (text(int, int, string, LyXFont)): ditto + + * src/text.C (InsertCharInTable): attempt to fix the double-space + feature in tables too. + (BackspaceInTable): ditto. + (GetVisibleRow): make bottom pagebreak line be a onoff line. + +2000-02-11 Lars Gullik Bjønnes + + * src/text2.C (owner): only complain if owner_ is set and bv != 0 + + * src/BufferView.C (resizeCurrentBuffer): set the owner of the + newly found text in textcache to this. + (buffer): set the owner of the text put into the textcache to 0 + + * src/insets/figinset.C (draw): fixed the drawing of figures with + the new Painter. + + * src/text.C src/mathed/math_cursor.C: nailed and fixed the + drawing of mathframe, hfills, protected space, table lines. I have + now no outstanding drawing problems with the new Painter code. + +2000-02-11 Jean-Marc Lasgouttes + + * src/PainterBase.C (ellipse, circle): do not specify the default + arguments. + + * src/LColor.h: add using directive. + + * src/Painter.[Ch]: change return type of methods from Painter& to + PainterBase&. Add a using directive. + + * src/WorkArea.C: wrap xforms callbacks in C functions + C_WorkArea_xxx. + + * lib/layouts/foils.layout: font fix and simplifications from Carl + Ollivier-Gooch. + +2000-02-10 Lars Gullik Bjønnes + + * a lot of files: The Painter, LColor and WorkArea from the old + devel branch has been ported to lyx-devel. Some new files and a + lot of #ifdeffed code. The new workarea is enabled by default, but + if you want to test the new Painter and LColor you have to compile + with USE_PAINTER defined (do this in config.h f.ex.) There are + still some rought edges, and I'd like some help to clear those + out. It looks stable (loads and displays the Userguide very well). + + +2000-02-10 Jean-Marc Lasgouttes + + * src/buffer.C (pop_tag): revert to the previous implementation + (use a global variable for both loops). + + * lib/kbd/iso8859-1.cdef: fix definition for \"{e}. + + * src/lyxrc.C (LyXRC): change slightly default date format. + + * src/paragraph.C (TeXOnePar): Generate a correct latex file when + there is an English text with a footnote that starts with a Hebrew + paragraph, or vice versa. + (TeXFootnote): ditto. + + * src/text.C (LeftMargin): allow for negative values for + parindent. Thanks to Philip Lehman for testing + this out. + + * src/lyx_gui.C (create_forms): add iso88595 as a possible choice + for input encoding (cyrillic) + +2000-02-08 Jean-Marc Lasgouttes + + * src/lyx_gui.C (create_forms): make combo box taller (from Dekel + Tsur). + + * src/toolbar.C (set): ditto + * src/insets/insetbib.C (create_form_citation_form): ditto + + * lib/CREDITS: added Dekel Tsur. + + * lib/kbd/hebrew.kmap, lib/kbd/null.kmap, + lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new + hebrew supports files from Dekel Tsur. + + * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen + + + * src/lyxrc.C: put \date_insert_format at the right place. + + * src/buffer.C (makeLaTeXFile): fix the handling of + BufferParams::sides when writing out latex files. + + * src/BufferView2.C: add a "using" directive. + + * src/support/lyxsum.C (sum): when we use lyxstring, + ostringstream::str needs an additional .c_str(). + +2000-02-07 Lars Gullik Bjønnes + + * src/support/filetools.C (ChangeExtension): patch from Etienne + applied. + + * src/TextCache.C (show): remove const_cast and make second + parameter non-const LyXText *. + + * src/TextCache.h: use non const LyXText in show. + + * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work + with hebrew. + +2000-02-04 Lars Gullik Bjønnes + + * src/support/lyxsum.C: rework to be more flexible. + + * several places: don't check if a pointer is 0 if you are going + to delete it. + + * src/text.C: remove some dead code. + + * src/insets/figinset.C: remove some dead code + + * src/buffer.C: move the BufferView funcs to BufferView2.C + remove all support for insetlatexdel + remove support for oldpapersize stuff + made some member funcs const + + * src/kbmap.C: use a std::list to store the bindings in. + + * src/BufferView2.C: new file + + * src/kbsequence.[Ch]: new files + + * src/LyXAction.C + others: remove all trace of buffer-previous + + * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we + only have one copy in the binary of this table. + + * hebrew patch: moved some functions from LyXText to more + appropriate places. (LyXParagraph, BufferParams, LyXFont) + + * several files: remove support for XForms older than 0.88 + whitespace changes. + remove some #if 0 #endif code + + * src/TextCache.[Ch]: new file. Holds the textcache. + + * src/BufferView.C: changes to use the new TextCache interface. + (waitForX): remove the now unused code. + + * src/BackStack.h: remove some commented code + + * lib/bind/emacs.bind: remove binding for buffer-previous + +2000-02-03 Lars Gullik Bjønnes + + * applied the hebrew patch. + + * src/lyxrow.h: make sure that all Row variables are initialized. + + * src/text2.C (TextHandleUndo): comment out a delete, this might + introduce a memory leak, but should also help us to not try to + read freed memory. We need to look at this one. + + * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0 + (LyXParagraph): initalize footnotekind. + + * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug + forgot this when applying the patch. Please heed the warnings. + + * src/BufferView.C (buffer): a fix for the buffer-reload problem + (aka. reformat problem) + + * src/bufferlist.C (exists): made const, and use const_iterator + (isLoaded): new func. + (release): use std::find to find the correct buffer. + + * src/bufferlist.h: made getState a const func. + made empty a const func. + made exists a const func. + new func: isLoaded + +2000-02-01 Juergen Vigna + + * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert + + * po/it.po: updated a bit the italian po file and also changed the + 'file nuovo' for newfile to 'filenuovo' without a space, this did + annoy me a lot :) + + * src/lyxrc.C (LyXRC): added support for a default insert_date_format + for the new insert_date command. + + * src/lyxfunc.C (Dispatch): added support for a insert_date function + from jdblair, to insert a date into the current text conforming to + a strftime format (for now only considering the locale-set and not + the document-language). + +2000-01-28 Jean-Marc Lasgouttes + + * src/lyxfont.C (textWidth): hopefully better fix for the Array + Bounds Read error seen by purify. The problem was that islower is + a macros which takes an unsigned char and uses it as an index for + in array of characters properties (and is thus subject to the + above error). + (drawText): ditto. + + * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set + correctly the paper sides radio buttons. + (UpdateDocumentButtons): ditto. + +2000-01-27 Lars Gullik Bjønnes + + * src/kbmap.C (getsym + others): change to return unsigned int, + returning a long can give problems on 64 bit systems. (I assume + that int is 32bit on 64bit systems) + +2000-01-27 Jean-Marc Lasgouttes + + * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by + LyXLookupString to be zero-terminated. Really fixes problems seen + by purify, I think. + +2000-01-27 Lars Gullik Bjønnes + + * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to + write a (char*)0 to the lyxerr stream. + + * src/lastfiles.C: move algorithm before the using statemets. + +2000-01-26 Jean-Marc Lasgouttes + + * src/lastfiles.C: move using directives in global scope (egcs 1.x + complains otherwise). + * src/table.C: ditto + + * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data + directory. + + * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable + that I removed earlier... It is really needed. + + * lib/examples/multicol.lyx: new file, splitted from Extended.lyx. + +2000-01-25 Jean-Marc Lasgouttes + + * INSTALL: update xforms home page URL. + + * lib/configure.m4: fix a bug with unreadable layout files. + + * src/table.C (calculate_width_of_column): add "using std::max" + directive. + +2000-01-25 Lars Gullik Bjønnes + + * several files: marked several lines with "DEL LINE", this is + lines that can be deleted without changing anything. + if () // DEL LINE /* this line is _never_ needed. Delete + checks this anyway */ + delete + + * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY + + * src/DepTable.C (update): add a "+" at the end when the checksum + is different. (debugging string only) + + * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused + the next inset to not be displayed. This should also fix the list + of labels in the "Insert Crossreference" dialog. + +2000-01-24 Lars Gullik Bjønnes + + * src/support/LSubstring.C (LSubstring): set pos to string::npos + when regex was not found. + + * src/support/lstrings.C (lowercase): use handcoded transform always. + (uppercase): ditto + + * src/text.C (Delete): fixed the crash. cursor.par->prev and + old_cursor.par->prev could be 0. + + * several files: changed post inc/dec to pre inc/dec + + * src/lastfiles.C (writeFile): use ostream_iterator and copy to + write the lastfiles to file. + + * src/BufferView.C (buffer): only show TextCache info when debugging + (buffer): ditto + (resizeCurrentBuffer): ditto + (workAreaExpose): ditto + + * lib/kbd/iso8859-7.cdef: changed to new quoting scheme + + * lib/kbd/iso8859-2.cdef: changed to new quoting scheme + + * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT + a bit better by removing the special case for \i and \j. + +2000-01-24 Jean-Marc Lasgouttes + + * src/lyx_main.C (easyParse): remove test for bad comand line + options, since this broke all xforms-related parsing. + + * src/kbmap.C (getsym): set return type to unsigned long, as + declared in header. On an alpha, long is _not_ the same as int. + + * src/support/LOstream.h: add a "using std::flush;" + + * src/insets/figinset.C: ditto. + +2000-01-21 Lars Gullik Bjønnes + + * src/bufferlist.C (write): use blinding fast file copy instead of + "a char at a time", now we are doing it the C++ way. + + * src/insets/figinset.C: get rid of struct pidwaitpit, use a + std::list instead. + (addpidwait): reflect move to std::list + (sigchldchecker): ditto + + * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5 + version also. + + * src/paragraph.C (FirstPhysicalPar): remove assert and comment + that obviously was wrong... + + * src/lyxfont.C (textWidth): have c as char c[2] instead of char + c, this avoids warnings with purify and islower. + + * src/insets/figinset.C: rename struct queue to struct + queue_element and rewrite to use a std::queue. gsqueue is now a + std::queue + (runqueue): reflect move to std::queue + (addwait): ditto + + * src/support/lstrings.h (tostr): specialize for bool, otherwise + we would get "1" "0" instead of "true" "false. Also make the tostr + functions inline. + +2000-01-21 Juergen Vigna + + * src/buffer.C (writeFileAscii): Disabled code for special groff + handling of tabulars till I fix this in table.C + +2000-01-21 Jean-Marc Lasgouttes + + * src/support/mkdir.C (mkdir): change second argument of mkdir to + unsigned long int. + * src/support/lyxlib.h: ditto. + +2000-01-20 Lars Gullik Bjønnes + + * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i' + and 'j' look better. This might fix the "macron" bug that has been + observed. + + * src/support/lstrings.[Ch] (tostr): reimplement all the tostr + functions as one template function. Delete the old versions. + + * src/support/lyxsum.C: move using std::ifstream inside + MODERN_STL_STREAMS + + * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C + and putenv.C + + * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used + + * src/mathed/formula.C: delete #include "bufferlist.h" never used + + * src/insets/figinset.C (InitFigures): use new instead of malloc + to allocate memory for figures and bitmaps. + (DoneFigures): use delete[] instead of free to deallocate memory + for figures and bitmaps. + (runqueue): use new to allocate + (getfigdata): use new/delete[] instead of malloc/free + (RegisterFigure): ditto + + * some files: moved some declarations closer to first use, small + whitespace changes use preincrement instead of postincrement where + it does not make a difference. + + * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a + step on the way to use stl::containers for key maps. + + * src/bufferlist.h: add a typedef for const_iterator and const + versions of begin and end. + + * src/bufferlist.[Ch]: change name of member variable _state to + state_. (avoid reserved names) + (makePup): removed + (getFileNames): returns the filenames of the buffers in a vector. + + * configure.in (ALL_LINGUAS): added ro + + * src/support/putenv.C: new file + + * src/support/mkdir.C: new file + +2000-01-20 Allan Rae + + * lib/layouts/IEEEtran.layout: Added several theorem environments + + * lib/templates/IEEEtran.lyx: Example theorem environments and a + couple of minor additions. + + * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites + (except for those in footnotes of course) + +2000-01-19 Lars Gullik Bjønnes + + * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction. + + * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use + std::sort and std::lower_bound instead of qsort and handwritten + binarysearch. + (struct compara): struct that holds the functors used by std::sort + and std::lower_bound in MathedLookupBOP. + +2000-01-19 Jean-Marc Lasgouttes + + * src/support/LAssert.h: do not do partial specialization. We do + not really need it. + + * src/support/lyxlib.h: note that lyx::getUserName() and + lyx::date() are not in use right now. Should these be suppressed? + + * src/buffer.C (makeLaTeXFile): we do not need the user name here. + (makeLinuxDocFile): do not put date and user name in linuxdoc + headers. + + * src/support/lyxlib.h (kill): change first argument to long int, + since that's what solaris uses. + + * src/support/kill.C (kill): fix declaration to match prototype. + + * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to + actually check whether namespaces are supported. This is not what + it used to do. + + * src/support/lyxsum.C: add a using directive. + +2000-01-17 Lars Gullik Bjønnes + + * src/support/kill.C: if we have namespace support we don't have + to include lyxlib.h. + + * src/support/lyxlib.h: use namespace lyx if supported. + +2000-01-14 Lars Gullik Bjønnes + + * src/support/date.C: new file + + * src/support/chdir.C: new file + + * src/support/getUserName.C: new file + + * src/support/getcwd.C: new file + + * src/support/abort.C: new file + + * src/support/kill.C: new file + + * src/support/lyxlib.h: moved all the functions in this file + insede struct lyx. Added also kill and abort to this struct. This + is a way to avoid the "kill is not defined in ", we make + C++ wrappers for functions that are not ANSI C or ANSI C++. + + * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS + instead of #if __GLIBCPP__. Since lyxsum is now put inside struct + lyx it has been renamed to sum. + +2000-01-14 Jean-Marc Lasgouttes + + * src/text.C: add using directives for std::min and std::max. + +2000-01-13 Jean-Marc Lasgouttes + + * src/texrow.C (getIdFromRow): actually return something useful in + id and pos. Hopefully fixes the bug with positionning of errorbox + insets. + + * src/lyx_main.C (easyParse): output an error and exit if an + incorrect command line option has been given. + + * src/spellchecker.C (ispell_check_word): document a memory leak. + + * src/bufferlist.C (write): fix mismatched allocation/deletion, + where a "struct utimbuf" is allocated with "new" and deleted with + "delete[]". + +2000-01-13 Lars Gullik Bjønnes + + * src/text2.C (CutSelection): don't delete double spaces. + (PasteSelection): ditto + (CopySelection): ditto + + * src/text.C (Backspace): don't delete double spaces. + + * src/lyxlex.C (next): fix a bug that were only present with + conformant std::istream::get to read comment lines, use + std::istream::getline instead. This seems to fix the problem. + +2000-01-12 Lars Gullik Bjønnes + + * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not + allowed to insert space before space" editing problem. Please read + commends at the beginning of the function. Comments about usage + are very welcome. + + * src/text.C (InsertChar): fix for the "not allowed to insert + space before space" editing problem. + + * src/text2.C (DeleteEmptyParagraphMechanism): when + IsEmptyTableRow can only return false this last "else if" will + always be a no-op. Commented out. + + * src/text.C (RedoParagraph): As far as I can understand tmp + cursor is not really needed. + + * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at + present it could only return false anyway. + (several functions): Did something not so smart...added a const + specifier on a lot of methods. + + * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve + and add a tmp->text.resize. The LyXParagraph constructor does the + resize for us. + (BreakParagraphConservative): ditto + + * src/support/path.h (Path): add a define so that the wrong usage + "Path("/tmp") will be flagged as a compilation error: + "`unnamed_Path' undeclared (first use this function)" + +2000-01-12 Jean-Marc Lasgouttes + + * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro, + which was bogus for several reasons. + + * src/LaTeX.C (scanAux): fix the regular expression used to scan + .aux files. + (runBibTeX): ditto. + + * autogen.sh: do not use "type -path" (what's that anyway?). + + * src/support/filetools.C (findtexfile): remove extraneous space + which caused a kpsewhich warning (at least with kpathsea version + 3.0). + +2000-01-11 Lars Gullik Bjønnes + + * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la + + * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la + + * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs + +2000-01-11 Jean-Marc Lasgouttes + + * src/paragraph.C (BreakParagraph): do not reserve space on text + if we don't need to (otherwise, if pos_end < pos, we end up + reserving huge amounts of memory due to bad unsigned karma). + (BreakParagraphConservative): ditto, although I have not seen + evidence the bug can happen here. + + * src/lyxparagraph.h: add a using std::list. + +2000-01-11 Juergen Vigna + + * src/menus.C (MenuDocu): output an Alert if the documentation-file + could not be found. + +2000-01-11 Lars Gullik Bjønnes + + * src/vc-backend.C (doVCCommand): change to be static and take one + more parameter: the path to chdir too be fore executing the command. + (retrive): new function equiv to "co -r" + + * src/bufferlist.C (loadLyXFile): implement the missing parts if + file_not_found_hook is true. + + * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook. + + * src/support/filetools.C (IsFileWriteable): use FileInfo to check + if a file is readwrite,readonly...anything else. + +2000-01-10 Lars Gullik Bjønnes + + * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput + (CreatePostscript): name change from MenuRunDVIPS (or something) + (PreviewPostscript): name change from MenuPreviewPS + (PreviewDVI): name change from MenuPreviewDVI + + * lib/lyxrc.example: added \pdflatex_command, \pdf_mode, + \view_pdf_command., \pdf_to_ps_command + + * lib/configure.m4: added search for PDF viewer, and search for + PDF to PS converter. + (lyxrc.defaults output): add \pdflatex_command, + \view_pdf_command and \pdf_to_ps_command. + + * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview. + + * src/bufferlist.C (write): we don't use blocksize for anything so + I removed it. + +2000-01-10 Jean-Marc Lasgouttes + + * src/support/block.h: disable operator T* (), since it causes + problems with both compilers I tried. See comments in the file. + + * lib/reLyX/configure.in: do not define LYX_DIR. support flag + --with-lyxname. + + * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env. + variable LYX_DIR_10x to LYX_DIR_11x. + + * src/Makefile.am: replace variable LYX_DIR with pkgdatadir. + + * INSTALL: document --with-lyxname. + * NEWS: ditto. + + * configure.in: new configure flag --with-lyxname which allows to + choose the name under which lyx is installed. Default is "lyx", of + course. It used to be possible to do this with --program-suffix, + but the later has in fact a different meaning for autoconf. + + * src/support/lstrings.h (lstrchr): reformat a bit. + + * src/lyxlex.h: include LIstream.h, for Sun CC this time. + * src/mathed/math_defs.h: ditto. + +2000-01-09 Lars Gullik Bjønnes + + * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to + true, decides if we create a backup file or not when saving. New + tag and variable \pdf_mode, defaults to false. New tag and + variable \pdflatex_command, defaults to pdflatex. New tag and + variable \view_pdf_command, defaults to xpdf. New tag and variable + \pdf_to_ps_command, defaults to pdf2ps. + +2000-01-08 Lars Gullik Bjønnes + + * src/bufferlist.C (close): don't call insetUnlock if the buffer + does not have a BufferView. + (unlockInset): ditto + don't access the_locking_inset if the + buffer does not have a BufferView. + + * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in + certain circumstances so that we don't continue a keyboard + operation long after the key was released. Try f.ex. to load a + large document, press PageDown for some seconds and then release + it. Before this change the document would contine to scroll for + some time, with this change it stops imidiatly. + + * src/support/block.h: don't allocate more space than needed. As + long as we don't try to write to the arr[x] in a array_type arr[x] + it is perfectly ok. (if you write to it you might segfault). + added operator value_type*() so that is possible to pass the array + to functions expecting a C-pointer. + + * lib/Makefile.am (dist-hook): don't fail completely if unable to + cvs. + + * intl/*: updated to gettext 0.10.35, tried to add our own + required modifications. Please verify. + + * po/*: updated to gettext 0.10.35, tried to add our own required + modifications. Please verify. + + * src/support/lstrings.C (tostr): go at fixing the problem with + cxx and stringstream. When stringstream is used return + oss.str().c_str() so that problems with lyxstring and basic_string + are avoided. Note that the best solution would be for cxx to use + basic_string all the way, but it is not conformant yet. (it seems) + + * src/lyx_cb.C + other files: moved several global functions to + class BufferView, some have been moved to BufferView.[Ch] others + are still located in lyx_cb.C. Code changes because of this. (part + of "get rid of current_view project".) + + * src/buffer.C + other files: moved several Buffer functions to + class BufferView, the functions are still present in buffer.C. + Code changes because of this. + + * config/lcmessage.m4: updated to most recent. used when creating + acinclude.m4. + + * config/progtest.m4: updated to most recent. used when creating + acinclude.m4. + + * config/gettext.m4: updated to most recent. applied patch for + tmplinguas. + + * config/gettext.m4.patch: new file that shows what changes we + have done to the local copy of gettext.m4. + + * config/libtool.m4: new file, used in creation of acinclude.m4 + + * config/lyxinclude.m4: new file, this is the lyx created m4 + macros, used in making acinclude.m4. + + * autogen.sh: GNU m4 discovered as a separate task not as part of + the lib/configure creation. + Generate acinlucde from files in config. Actually cat + lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it + easier to upgrade .m4 files that really are external. + + * src/Spacing.h: moved using std::istringstream to right after + . This should fix the problem seen with some compilers. + +2000-01-06 Lars Gullik Bjønnes + + * src/lyx_cb.C: began some work to remove the dependency a lot of + functions have on BufferView::text, even if not really needed. + (GetCurrentTextClass): removed this func, it only hid the + current_view. + + * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I + forgot this in last commit. + + * src/Bullet.C (bulletEntry): use static char const *[] for the + tables, becuase of this the return arg had to change to string. + (bulletSize): ditto + (~Bullet): removed unneeded destructor + + * src/BufferView.C (beforeChange): moved from lyx_cb.C + (insetSleep): moved from Buffer + (insetWakeup): moved from Buffer + (insetUnlock): moved from Buffer + + * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset + from Buffer to BufferView. + + * acinclude.m4: include libtool.m4 from libtool 1.3.4. + + * config/ltmain.sh: updated to version 1.3.4 of libtool + + * config/ltconfig: updated to version 1.3.4 of libtool + +2000-01-06 Jean-Marc Lasgouttes + + + * src/buffer.C (pop_tag): fix a dubious for() loop initialization. + Did I get that right? + + * src/lyxlex.h: add a "using" directive or two. + * src/Spacing.h: ditto. + * src/insets/figinset.C: ditto. + * src/support/filetools.C: ditto. + * src/support/lstrings.C: ditto. + * src/BufferView.C: ditto. + * src/bufferlist.C: ditto. + * src/lyx_cb.C: ditto. + * src/lyxlex.C: ditto. + + * NEWS: add some changes for 1.1.4. + +2000-01-06 Lars Gullik Bjønnes + + * src/BufferView.C: first go at a TextCache to speed up switching + between documents. + +2000-01-05 Jean-Marc Lasgouttes + + * lib/examples/ItemizeBullets.lyx: update from Tino Meinen. + * lib/examples/nl_voorbeeld_ruw.lyx: ditto. + * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto. + * lib/examples/nl_opsommingstekens.lyx: new translation from Tino + Meinen. + + * src/mathed/math_defs.h (MathedRowSt): make sure that all + members of the struct are correctly initialized to 0 (detected by + purify) + * src/lyxrc.C (LyXRC): ditto for print_adapt_output. + * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh. + + * src/insets/figinset.C (sigchldchecker): use "delete" to free a + pidwait, since it was allocated with "new". This was potentially + very bad. Thanks to Michael Schmitt for running purify for us. + + +2000-01-04 Jean-Marc Lasgouttes + + * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement. + + * src/lyx_gui_misc.h: add a 'using std::pair;' statement. + +1999-12-30 Allan Rae + + * lib/templates/IEEEtran.lyx: minor change + + * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel), + src/mathed/formula.C (LocalDispatch): askForText changes + + * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we + know when a user has cancelled input. Fixes annoying problems with + inserting labels and version control. + +1999-12-29 Lars Gullik Bjønnes + + * src/support/lstrings.C (tostr): rewritten to use strstream and + stringstream + +1999-12-28 Lars Gullik Bjønnes + + * src/support/filetools.C (IsFileWriteable): use fstream to check + (IsDirWriteable): use fileinfo to check + + * src/support/filetools.h (FilePtr): whole class deleted + + * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream. + + * src/lyxparagraph.h (readSimpleWholeFile): make arg istream + + * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr + + * src/bufferlist.C (write): use ifstream and ofstream instead of + FILE* + + * src/Spacing.h: use istrstream instead of sscanf + + * src/mathed/math_defs.h: change first arg to istream from FILE* + + * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr + + * src/mathed/math_parser.C: have yyis to be an istream + (LexGetArg): use istream (yyis) + (yylex): ditto + (mathed_parse): ditto + (mathed_parser_file): first arg istream instead of FILE*, set yyis + + * src/mathed/formula.C (Read): rewritten to use istream + + * src/mathed/formulamacro.C (Read): rewritten to use istream + + * src/lyxlex.h (~LyXLex): deleted desturctor + (getStream): new function, returns an istream + (getFile): deleted funtion + (IsOK): return is.good(); + + * src/lyxlex.C (LyXLex): delete file and owns_file + (setFile): open an filebuf and assign that to a istream instead of + using FILE* + (setStream): new function, takes an istream as arg. + (setFile): deleted function + (EatLine): rewritten us use istream instead of FILE* + (next): ditto + (nextToken): ditto + + * src/table.C (LyXTable): use istream instead of FILE* + (Read): rewritten to take an istream instead of FILE* + +1999-12-28 Jean-Marc Lasgouttes + + * src/buffer.C (Dispatch): remove an extraneous break statement. + + * src/support/filetools.C (QuoteName): change to do simple + 'quoting'. More work is necessary. Also changed to do nothing + under emx (needs fix too). + (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG. + + * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for + config.h.in to the AC_DEFINE_UNQUOTED() call. + (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv() + needs char * as argument (because Solaris 7 declares it like + that). + + * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION; + remove definition of BZERO. + +1999-12-24 Lars Gullik Bjønnes + + * src/support/LRegex.C: include if HAVE_REGEX_H is + defined, "lyxregex.h" if not. + + * src/support/Makefile.am (noinst_LTLIBRARIES): changed from + pkglib_ to noinst_ + (REGEX): new variable that is set to regex.c lyxregex.h when + AM_CONDITIONAL USE_REGEX is set. + (libsupport_la_SOURCES): add $(REGEX) + + * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from + pkglib_ to noinst_ + + * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from + pkglib_ to noinst_ + + * configure.in: add call to LYX_REGEX + + * acinclude.m4 (LYX_REGEX): checks if we need to use the included + regex or not. Uses a a AM_CONDITIONAL to decide what to compile. + +1999-12-22 Jean-Marc Lasgouttes + + * lib/bind/fi_menus.bind: new file, from + pauli.virtanen@saunalahti.fi. + + * src/buffer.C (getBibkeyList): pass the parameter delim to + InsetInclude::getKeys and InsetBibtex::getKeys. + + * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which + is passed to Buffer::getBibkeyList + + * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it + instead of the hardcoded comma. + + * src/insets/insetbib.C (getKeys): make sure that there are not + leading blanks in bibtex keys. Normal latex does not care, but + harvard.sty seems to dislike blanks at the beginning of citation + keys. In particular, the retturn value of the function is + + * INSTALL: make it clear that libstdc++ is needed and that gcc + 2.7.x probably does not work. + + * src/support/filetools.C (findtexfile): make debug message go to + the LATEX channel + * src/insets/insetbib.C (getKeys): ditto + + * src/debug.C (showTags): make sure that the output is correctly + aligned. + + * configure.in: add a comment for TWO_COLOR_ICON define. + + * acconfig.h: remove all the entries that already defined in + configure.in or acinclude.m4. + + * src/buffer.C (makeLaTeXFile): headers of latex file also changed + to avoid user name, date and copyright. + +1999-12-21 Juergen Vigna + + * src/table.C (Read): Now read bogus row format informations + if the format is < 5 so that afterwards the table can + be read by lyx but without any format-info. Fixed the + crash we experienced when not doing this. + +1999-12-21 Lars Gullik Bjønnes + + * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur + (RedoDrawingOfParagraph): ditto + (RedoParagraphs): ditto + (RemoveTableRow): ditto + + * src/text.C (Fill): rename arg paperwidth -> paper_width + + * src/buffer.C (insertLyXFile): rename var filename -> fname + (writeFile): rename arg filename -> fname + (writeFileAscii): ditto + (makeLaTeXFile): ditto + (makeLinuxDocFile): ditto + (makeDocBookFile): ditto + + * src/LaTeX.C (runMakeIndex): change arg name from file -> f + (runBibTeX): ditto + + * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C + + * src/bmtable.h: add extern "C" on this file when __cplusplus is + defined. + + * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is + compiled by a C compiler not C++. + + * src/layout.h (LyXTextClass): added typedef for const_iterator + (LyXTextClassList): added typedef for const_iterator + member + functions begin and end. + + * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use + iterators to fill the choice_class. + (updateLayoutChoice): rewritten to use iterators to fill the + layoutlist in the toolbar. + + * src/BufferView.h (BufferView::work_area_width): removed unused + variable. + + * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file' + + * src/buffer.C (sgmlOpenTag): drop the use of the static space array + (sgmlCloseTag): ditto + + * src/support/lstrings.h: return type of countChar changed to + unsigned char. + + * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose + what version of this func to use. Also made to return unsigned int. + + * configure.in: call LYX_STD_COUNT + + * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard + conforming std::count. + +1999-12-20 Jean-Marc Lasgouttes + + * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime + and a subscript would give bad display (patch from Dekel Tsur + ). + + * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public. + + * src/spellchecker.C (create_ispell_pipe): use a const_cast to + please sun CC. + + * src/chset.h: add a few 'using' directives + + * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not + triggered when no buffer is active + + * src/layout.C: removed `break' after `return' in switch(), since + it is unreachable. + + * src/lyx_main.C (init): make sure LyX can be ran in place even + when libtool has done its magic with shared libraries. Fix the + test for the case when the system directory has not been found. + + * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path + name for the latex file. + (MenuMakeHTML): ditto + + * src/buffer.h: add an optional boolean argument, which is passed + to ChangeExtension. + +1999-12-20 Allan Rae + + * lib/templates/IEEEtran.lyx: small correction and update. + + * configure.in: Attempted to use LYX_PATH_HEADER + + * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore + + * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after + input from JMarc. Now use preprocessor to find the header. + Also stopped making HAVE_STL_STRING_FWD_H and extended the comments. + (LYX_PATH_HEADER): My, so far, failed attempt to generalize + LYX_STL_STRING_FWD. See comments in file. + +1999-12-19 Asger Alstrup Nielsen + + * The global MiniBuffer * minibuffer variable is dead. + + * The global FD_form_main * fd_form_main variable is dead. + +1999-12-17 Jean-Marc Lasgouttes + + * src/toolbar.C (set): condition #warning on WITH_WARNINGS + + * src/table.h: add the LOstream.h header + * src/debug.h: ditto + + * src/LyXAction.h: change the explaination of the ReadOnly + attribute: is indicates that the function _can_ be used. + + * src/LyXAction.C (init): find-replace _can_ be used in read-only + mode. + +1999-12-16 Jean-Marc Lasgouttes + + * src/lyxfont.C (ascent): Make sure that char is _always_ used as + unsigned. + (descent): ditto + (lbearing): ditto + (rbearing): ditto + + * src/paragraph.C (GetWord): assert on pos>=0 + (GetChar): ditto + + * src/support/lyxstring.C: condition the use of an invariant on + ENABLE_ASSERTIONS + * src/support/lyxstring.h: ditto + + * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS. + Use LAssert.h instead of plain assert(). + + * src/support/lstrings.h: add LAssert.h, in case it is needed. + + * src/lyxfunc.C: do not include LAssert.h, it is not used. + * src/support/filetools.C: ditto + + * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS + is not defined. + + * INSTALL: document the new configure flags + + * configure.in: suppress --with-debug; add --enable-assertions + + * acinclude.m4: various changes in alignment of help strings. + +1999-12-16 Lars Gullik Bjønnes + + * src/kbmap.C: commented out the use of the hash map in kb_map, + beginning of movement to a stl::container. + + * several files: removed code that was not in effect when + MOVE_TEXT was defined. + + * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes + for escaping should not be used. We can discuss if the string + should be enclosed in f.ex. [] instead of "". + + * src/trans_mgr.C (insert): use the new returned value from + encodeString to get deadkeys and keymaps done correctly. + + * src/chset.C (encodeString): changed to return a pair, to tell + what to use if we know the string. + + * src/lyxscreen.h (fillArc): new function. + + * src/FontInfo.C (resize): rewritten to use more std::string like + structore, especially string::replace. + + * src/insets/insetlatexaccent.C (Draw): use fillArc for the + approp. accents. + + * configure.in (chmod +x some scripts): remove config/gcc-hack + +1999-12-15 Jean-Marc Lasgouttes + + * src/buffer.C (writeFile): change once again the top comment in a + .lyx file to point to www.lyx.org and to use LYX_DOCVERSION + instead of an hardcoded version number. + (makeDocBookFile): ditto + + * src/version.h: add new define LYX_DOCVERSION + + * po/de.po: update from Pit Sütterlin + * lib/bind/de_menus.bind: ditto. + + * src/lyxfunc.C (Dispatch): call MenuExport() + * src/buffer.C (Dispatch): ditto + + * src/lyx_cb.C (MenuMakeHTML): new function, moved from + LyXFunc::Dispatch(). + (MenuExport): new function, moved from + LyXFunc::Dispatch(). + + * src/trans_mgr.C (insert): small cleanup + * src/chset.C (loadFile): ditto + + * lib/kbd/iso8859-1.cdef: add missing backslashes + +1999-12-15 Lars Gullik Bjønnes + + * src/insets/insetlatexaccent.C (Lbearing): new function, used to + help with placing the manually drawn accents better. + (Rbearing): ditto + (Draw): x2 and hg changed to float to minimize rounding errors and + help place the accents better. + + * src/lyxfont.C (ascent): fixed faulty static_cast, casting from + unsigned short to char is just wrong...cast the char to unsigned + char instead so that the two values can compare sanely. This + should also make the display of insetlatexaccents better and + perhaps also some other insets. + (descent): ditto + (lbearing): new function + (rbearing): ditto + +1999-12-15 Allan Rae + + * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new + header that provides a wrapper around the very annoying SGI STL header + of the same name. + + * src/support/lyxstring.C, src/LString.h: + removed old SGI-STL-compatability attempts. + + * configure.in: Use LYX_STL_STRING_FWD. + + * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if + stl_string_fwd.h is around and try to determine it's location. + Major improvement over previous SGI STL 3.2 compatability. + Three small problems remain with this function due to my zero + knowledge of autoconf. JMarc and lgb see the comments in the code. + +1999-12-14 Jean-Marc Lasgouttes + + * src/broken_const.h, config/hack-gcc, config/README: removed + + * configure.in: remove --with-gcc-hack option; do not call + LYX_CXX_STL_STACK + + * INSTALL: remove documentation of --with-broken-const and + --with-gcc-hack + + * acconfig.h: remove all trace of BROKEN_CONST define + + * src/buffer.C (makeDocBookFile): update version number in output + file. + (SimpleDocBookOnePar): fix an assert when trying to a character + access beyond string length + [Patch from Jose'] + +1999-12-13 Jean-Marc Lasgouttes + + * po/de.po: fix the Export menu + + * lyx.man: update the description of -dbg + + * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel() + (commandLineHelp): updated + (easyParse): show list of available debug levels if -dbg is passed + without argument. + + * src/Makefile.am: add debug.C + + * src/debug.h: moved some code to debug.C + + * src/debug.C: new file. Contains code to set and show debug + level. + + * src/layout.C: remove 'break' after 'continue' in switch + statements, since these cannot be reached. + +1999-12-13 Allan Rae + + * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash. + (in_word_set): hash() -> math_hash() + + * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support + + * acconfig.h: Added a test for whether we are using exceptions in the + current compilation run. If so USING_EXCEPTIONS is defined. + + * config.in: Check for existance of stl_string_fwd.h + * src/LString.h: If compiling --with-included-string and SGI's + STL version 3.2 is present (see above test) we need to block their + forward declaration of string and supply a __get_c_string(). + However, it turns out this is only necessary if compiling with + exceptions enabled so I've a bit more to add yet. + + * src/insets/figinset.[Ch], src/insets/insetinclude.C, + src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h, + src/support/LRegex.h, src/undo.h: + Shuffle the order of the included files a little to ensure that + LString.h gets included before anything that includes stl_string_fwd.h + + * src/support/lyxstring.C: We need to #include LString.h instead of + lyxstring.h to get the necessary definition of __get_c_string. + (__get_c_string): New function. This is defined static just like SGI's + although why they need to do this I'm not sure. Perhaps it should be + in lstrings.C instead. + + * lib/templates/IEEEtran.lyx: New template file. + +1999-12-12 Lars Gullik Bjønnes + + * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@ + * intl/Makefile.in (MKINSTALLDIRS): ditto + + * src/LyXAction.C (init): changed to hold the LFUN data in a + automatic array in stead of in callso to newFunc, this speeds up + compilation a lot. Also all the memory used by the array is + returned when the init is completed. + + * a lot of files: compiled with -Wold-style-cast, changed most of + the reported offenders to C++ style casts. Did not change the + offenders in C files. + + * src/trans.h (Match): change argument type to unsigned int. + + * src/support/DebugStream.C: fix some types on the streambufs so + that it works on a conforming implementation. + +1999-12-10 Jean-Marc Lasgouttes + + * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence. + + * src/support/lyxstring.C: remove the inline added earlier since + they cause a bunch of unsatisfied symbols when linking with dec + cxx. Cxx likes to have the body of inlines at the place where they + are declared. + + * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid + accessing negative bounds in array. This fixes the crash when + inserting accented characters. + * src/trans.h (Match): ditto + + * src/buffer.C (Dispatch): since this is a void, it should not try + to return anything... + +1999-12-10 Lars Gullik Bjønnes + + * src/buffer.h: removed the two friends from Buffer. Some changes + because of this. Buffer::getFileName and Buffer::setFileName + renamed to Buffer::fileName() and Buffer::fileName(...). + +1999-12-09 Lars Gullik Bjønnes + + * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text + and Buffer::update(short) to BufferView. This move is currently + controlled by a define MOVE_TEXT, this will be removed when all + shows to be ok. This move paves the way for better separation + between buffer contents and buffer view. One side effect is that + the BufferView needs a rebreak when swiching buffers, if we want + to avoid this we can add a cache that holds pointers to LyXText's + that is not currently in use. + + * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by + André Pönitz. + +1999-11-18 André Pönitz + + * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level + + * lyx_main.C: new command line option -x (or --execute) and + -e (or --export). Now direct conversion from .lyx to .tex + (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex') + Unfortunately, X is still needed and the GUI pops up during the + process... + +1999-12-07 Jean-Marc Lasgouttes + + * src/Spacing.C: add a using directive to bring stream stuff into + normal namespace. + * src/paragraph.C: ditto + * src/buffer.C: ditto + + * NEWS: updated a bit the new features of 1.1.3 (took a few things + from Lars' announcement). + + * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial + example files from Tino Meinen. + +1999-12-06 Allan Rae + + * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair. + +1999-12-07 Lars Gullik Bjønnes + + * src/support/lyxstring.C: added a lot of inline for no good + reason + + * src/lyxfont.[Ch]: removed latexWriteStartChanges, and + latexWriteEndChanges, they were not used. + + * src/layout.h (operator<<): output operator for PageSides + + * src/mathed/math_iter.C (my_memcpy): slightly changed. + + * some example files: loaded in LyX 1.0.4 and saved again to update + certain constructs (table format) + + * a lot of files: did the change to use fstream/iostream for all + writing of files. Done with a close look at Andre Poenitz's patch. + + * some files: whitespace changes. + +1999-12-06 Jean-Marc Lasgouttes + + * src/mathed/math_iter.C (my_memcpy): new function. Since the + built-in memcpy() is broken on egcs and gcc 2.95 for alpha + architecture, we provide our own. It is used unconditionnally, but + I do not think this is a performance problem. Thanks to Angus + Leeming for the code (and again to Michal + Jaegermann for finding it the + first time). + (GetInset): use my_memcpy. + (Insert): ditto + (Copy): ditto + + * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure + it is easier to understand, but it uses less TeX-only constructs now. + + * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH + elements contain spaces + + * lib/configure: regenerated + + * lib/configure.m4 (SEARCH_PROG): make it work when the PATH + elements contain spaces; display the list of programs that are + tried. + + * autogen.sh: make sure lib/configure is executable + + * lib/examples/*: rename the tutorial examples to begin with the + two-letters language code. + + * src/lyxfunc.C (getStatus): do not query current font if no + buffer exists. + + * src/lyx_cb.C (RunScript): use QuoteName + (MenuRunDvips): ditto + (PrintApplyCB): ditto + + * src/support/filetools.[Ch] (QuoteName): new function. Add quotes + around argument, so that it works well with the current shell. + Does not work properly with OS/2 shells currently. + + * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName + * src/LyXSendto.C (SendtoApplyCB): ditto + * src/lyxfunc.C (Dispatch): ditto + * src/buffer.C (runLaTeX): ditto + (runLiterate): ditto + (buildProgram): ditto + (runChktex): ditto + * src/lyx_cb.C (RunScript): ditto + (MenuMakeLaTeX): ditto + + * src/buffer.h (getLatexName): new method + + * src/support/filetools.C (MakeLatexName): renamed from SpaceLess + +1999-12-02 Jean-Marc Lasgouttes + + * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm. + * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto + (create_math_panel): ditto + + * src/lyxfunc.C (getStatus): re-activate the code which gets + current font and cursor; add test for export to html. + + * src/lyxrc.C (read): remove unreachable break statements; add a + few "using". + + * src/bmtable.C (fl_set_bmtable_data): add a const_cast. + +1999-12-01 Lars Gullik Bjønnes + + * src/mathed/formula.C (LocalDispatch): fix small whitspace bug + introduced by faulty regex. + * src/buffer.C: ditto + * src/lastfiles.C: ditto + * src/paragraph.C: ditto + * src/table.C: ditto + * src/vspace.C: ditto + * src/insets/figinset.C: ditto + Note: most of these is absolutely harmless, except the one in + src/mathed formula.C. + +1999-11-30 Kayvan A. Sylvan + + * src/ImportNoweb.C (documentclass): fixed bounds for substr + operation, yielding correct results for the reLyX command. + +1999-12-01 Lars Gullik Bjønnes + + * src/support/filetools.C (ExpandPath): removed an over eager + Assert. + (ReplaceEnvironmentPath): ditto + + * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly + shows that we are doing something fishy in our code... + (BubblePost): ditto + (ToolbarCB): ditto + + * src/lyxrc.C (read): use a double switch trick to get more help + from the compiler. (the same trick is used in layout.C) + (write): new function. opens a ofstream and pass that to output + (output): new function, takes a ostream and writes the lyxrc + elemts to it. uses a dummy switch to make sure no elements are + forgotten. + + * src/lyxlex.h: added a struct pushpophelper for use in functions + with more than one exit point. + + * src/lyxlex.[Ch] (GetInteger): made it const + (GetFloat): ditto + (GetBool): ditto + + * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES + + * src/layout.[hC] : LayoutTags splitted into several enums, new + methods created, better error handling cleaner use of lyxlex. Read + the diff. + + * src/bmtable.[Ch]: change some member prototypes because of the + image const changes. + + * commandtags.h, src/LyXAction.C (init): new function: + "preferences-save", saves the lyxrc entries into .lyx/preferences. + This file is not read automatically but you can add \input + preferences to your lyxrc if you want to. We need to discuss how + to handle this. + + * src/LaTeX.C (runBibTeX): use regex to match for the needed lines + in .aux, also remove .bib and .bst files from dependencies when + running bibtex. + + * src/BufferView.C, src/LyXView.C: add const_cast several places + because of changes to images. + + * lib/images/*: same change as for images/* + + * lib/lyxrc.example: Default for accept_compound is false not no. + + * images/*: changed to be const, however I have som misgivings + about this change so it might be changed back. + +1999-11-26 Jean-Marc Lasgouttes + + * lib/configure, po/POTFILES.in: regenerated + + * autogen.sh: autogenerate lib/configure from lib/configure.m4 + + * config/lib_configure.m4: removed + + * lib/configure.m4: new file (was config/lib_configure.m4) + + * configure.in: do not test for rtti, since we do not use it. + +1999-11-26 Lars Gullik Bjønnes + + * src/support/lyxstring.C (lyxstring::Srep): Changed to use a + doubling of allocated space scheme. This makes it faster for large + strings end to use less memory for small strings. xtra rememoved. + + * src/insets/figinset.C (waitalarm): commented out. + (GhostscriptMsg): use static_cast + (GhostscriptMsg): use new instead of malloc to allocate memory for + cmap. also delete the memory after use. + + * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool + + * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks + for changes in bibtex database or style. + (runBibTeX): remove all .bib and .bst files from dep before we + begin. + (run): use scanAuc in when dep file already exist. + + * src/DepTable.C (remove_files_with_extension): new method + (exist): new method + + * src/DepTable.[Ch]: made many of the methods const. + +1999-11-25 Jean-Marc Lasgouttes + + * src/bufferparams.C: make sure that the default textclass is + "article". It used to be the first one by description order, but + now the first one is "docbook". + + * src/lyx_main.C (setDebuggingLevel): change type of argument to + string; call Debug::value. + (easyParse): pass complete argument to setDebuggingLevel(). + + * src/debug.h (value): fix the code that parses debug levels. + + * src/debug.h: add new debug type ACTION, reserved for LyXAction + class. + + * src/LyXAction.C: use Debug::ACTION as debug channel. + + * src/lyxlookup.C: make the debug statements go to Debug::KEY. + + * NEWS: updated for the future 1.1.3 release. + + * src/mathed/symbol_def.h: swap the definitions of \varepsilon and + \epsilon. Now \epsilon shows as red text, and \varepsilon shows as + it should. This is of course a controversial change (since many + people will find that their lyx workscreen is suddenly full of + red), but done for the sake of correctness. + + * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch], + src/mathed/math_root.[Ch] (Clone): return a MathedInset* + + * src/insets/inseterror.h, src/insets/inseturl.h, + src/insets/insetinfo.h, src/insets/figinset.h, + src/mathed/formulamacro.h, src/mathed/math_macro.h + (EditMessage): add a missing const and add _() to make sure that + translation happens + + * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C, + src/insets/insetbib.C, src/support/filetools.C: add `using' + directives for cxx. + + * src/lyxfunc.C (Dispatch): make sure nothing bad happens when + doing 'Insert index of last word' at the beginning of a paragraph. + +1999-11-24 Lars Gullik Bjønnes + + * several files: white-space changes. + + * src/mathed/formula.C: removed IsAlpha and IsDigit + + * src/insets/insetbib.C (getKeys): use findtexfile to look for the + .bib file. use a ifstream instead of FilePtr when parsing the .bib + file for keys. + + * src/insets/figinset.C (GetPSSizes): don't break when + "EndComments" is seen. But break when a boundingbox is read. + + * all classes inherited from Inset: return value of Clone + changed back to Inset *. + + * all classes inherited form MathInset: return value of Clone + changed back to MathedInset *. + + * src/insets/figinset.C (runqueue): use a ofstream to output the + gs/ps file. Might need some setpresicion or setw. However I can + see no problem with the current code. + (runqueue): use sleep instead of the alarm/signal code. I just + can't see the difference. + + * src/paragraph.C (LyXParagraph): reserve space in the new + paragraph and resize the inserted paragraph to just fit. + + * src/lyxfunc.h (operator|=): added operator for func_status. + + * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to + check for readable file. + + * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to + check for readable file. + (MenuMakeLinuxDoc): ditto + (MenuMakeDocBook): ditto + (MenuMakeAscii): ditto + (InsertAsciiFile): split the test for openable and readable + + * src/bmtable.C (draw_bitmaptable): use + fl_state[fl_get_vclass()].depth instead of DefualtScreen. + + * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and + findtexfile from LaTeX to filetools. + + * src/ImportNoweb.C (documentclass): rewrote to use ifstream + instead of FilePtr. Needs to be verified by a literate user. + +1999-11-23 Jean-Marc Lasgouttes + + * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'. + (EditMessage): likewise. + + * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^ + respectively as \textasciitilde and \textasciicircum. + +1999-11-22 Lars Gullik Bjønnes + + * src/support/lyxstring.h: made the methods that take iterators + use const_iterator. + + * src/support/lstrings.C (countChar): use std::cound(itr, itr, val) + (regexMatch): made is use the real regex class. + + * src/support/Makefile.am: changed to use libtool + + * src/support/.cvsignore: added *.lo, .libs and libsupport.la + + * src/mathed/math_defs.h: made the mathaligns be in a enum instead + of defines. + (MathIsInset ++): changed several macros to be inline functions + instead. + + * src/mathed/Makefile.am: changed to use libtool + + * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la + + * src/insets/inset* : Clone changed to const and return type is + the true insettype not just Inset*. + + * src/insets/Makefile.am: changed to use libtool + + * src/insets/.cvsignore: added *.lo, .libs and libinsets.la + + * src/undo.[Ch] : added empty() and changed some of the method + names. + + * src/texrow.[Ch]: rewrote to store texrow's in a std::list. + + * src/lyxparagraph.h: use id() and id(...) instead of getID and + setID use block<> for the bullets array, added const several places. + + * src/lyxfunc.C (getStatus): new function + + * src/lyxfunc.[Ch] : small changes to take advantage of the new + LyXAction, added const to several funtions. + + * src/filedlg.[Ch]: rewrote to store userchache and groupchache in + a std::map, and to store the dir items in a vector. + + * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files + as dependencies. + + * src/LyXView.[Ch] + other files : changed currentView to view. + + * src/LyXAction.[Ch] : ported from the old devel branch. + + * src/.cvsignore: added .libs and a.out + + * configure.in : changes to use libtool. + + * acinclude.m4 : inserted libtool.m4 + + * .cvsignore: added libtool + +1999-11-19 Jean-Marc Lasgouttes + + * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object + file name in insets and mathed directories (otherwise the + dependency is not taken in account under cygwin). + + * src/text2.C (InsertString[AB]): make sure that we do not try to + read characters past the string length. + +1999-11-18 Jean-Marc Lasgouttes + + * lib/doc/LaTeXConfig.lyx.in, + lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty. + + * src/buffer.C (writeFile): Do not add a comment on top of .lyx + file saying who created them and when this heppened; this is + useless and annoys tools like cvs. + + * lib/layouts/g-brief-{en,de}.layout, + lib/templates/g-brief-{en,de}.lyx: new versions of the textclass + from Thomas Hartkens . + + * src/{insets,mathed}/Makefile.am: do not declare an empty + LDFLAGS, so that it can be set at configure time (useful on Irix + for -n32 flag). + + * lib/reLyX/configure.in: make sure that the prefix is set + correctly in LYX_DIR. + +1999-11-18 André Pönitz + + * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to + be used by 'command-sequence' this allows to bind a key to a + sequence of LyX-commands + (Example: 'command-sequence math-insert alpha; math-insert beta;") + + * src/LyXAction.C: add "command-sequence" + + * src/LyXFunction.C: handling of "command-sequence" + + * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const + &cmd, string const &arg) to LyXFunc::Dispatch(string const& s) + + * src/lyxserver.C, src/minibuffer.C: Use this new interface + +1999-11-17 Jean-Marc Lasgouttes + + * src/buffer.C (writeFile): Do not output a comment giving user + and date at the beginning of a .lyx file. This is useless and + annoys cvs anyway; update version number to 1.1. + + * src/Makefile.am (LYX_DIR): add this definition, so that a + default path is hardcoded in LyX. + + * configure.in: Use LYX_GNU_GETTEXT. + + * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of + AM_GNU_GETTEXT with a bug fixed. + + * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx. + + * src/chset.C: add "using std::ifstream;" to please dec cxx. + + * src/lyx_main.C (init), INSTALL.OS2: the environment variable + which is used to point to LyX data is now LYX_DIR_11x. + + * lyx.man: convert to a unix text file; small updates. + +1999-11-15 Lars Gullik Bjønnes + + * src/support/LSubstring.[Ch]: made the second arg of most of the + constructors be a const reference. + + * src/mathed/math_parser.C (LexInitCodes): small bug introduced by + me fixed. + + * src/support/lyxstring.[Ch] (swap): added missing member function + and specialization of swap(str, str); + + * src/menus.C (ShowBufferMenu): to use the new BufferStorage + + * src/bufferlist.[Ch]: use the new BufferStorage class and remove all + trace of the old one. + + * src/undo.[Ch]: made the undostack use std::list to store undo's in + put the member definitions in undo.C. + + * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed + NEW_TEXT and have now only code that was included when this was + defined. + + * src/intl.C (LCombo): use static_cast + (LCombo2): ditto + (DispatchCallback): ditto + + * src/definitions.h: removed whole file + + * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX + + * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef + parsing and stores in a std:map. a regex defines the file format. + removed unneeded members. + + * src/bufferparams.h: added several enums from definitions.h here. + Removed unsused destructor. Changed some types to use proper enum + types. use block to have the temp_bullets and user_defined_bullets + and to make the whole class assignable. + + * src/bufferparams.C (Copy): removed this functions, use a default + assignment instead. + + * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and + isLiterate const. + + * src/buffer.C (readLyXformat2): commend out all that have with + oldpapersize to do. also comment out all that hve to do with + insetlatex and insetlatexdel. + (setOldPaperStuff): commented out + + * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C + + * src/LyXAction.C: remove use of inset-latex-insert + + * src/mathed/math_panel.C (button_cb): use static_cast + + * src/insets/Makefile.am (insets_o_SOURCES): removed + insetlatex.[Ch] + + * src/support/lyxstring.C (helper): use the unsigned long + specifier, UL, instead of a static_cast. + + * src/support/Makefile.am (libsupport_a_SOURCES): added block.h + + * src/support/block.h: new file. to be used as a c-style array in + classes, so that the class can be assignable. + +1999-11-15 Jean-Marc Lasgouttes + + * src/lyx_gui_misc.C (askForText): when fl_show_input() returns + NULL, make sure to return an empty string (it is not possible to + set a string to NULL). + +1999-11-10 Jean-Marc Lasgouttes + + * src/support/LRegex.C: use regex_t instead of re_pattern_buffer. + + * src/support/lyxstring.C (helper): fix bogus cast in assertion. + + * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the + link line, so that Irix users (for example) can set it explicitely to + "-n32". + + * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that + it can be overidden at make time (static or dynamic link, for + example). + + * src/vc-backend.C, src/LaTeXFeatures.h, + src/support/LRegex.C, src/support/LRegex.h: add a few "using" + statements to bring templates to global namespace. + +1999-11-10 Lars Gullik Bjønnes + + * src/support/lyxstring.C (operator[] const): make it standard + conforming. + + * src/minibuffer.C (Init): changed to reflect that more + information is given from the lyxvc and need not be provided here. + + * src/lyxvc.[Ch]: rewrote to use the vc-backend. + + * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch] + + * src/LyXView.C (UpdateTimerCB): use static_cast + (KeyPressMask_raw_callback): ditto + + * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer -> + buffer_, a lot of changes because of this. currentBuffer() -> + buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(), + also changes to other files because of this. + +1999-11-09 Lars Gullik Bjønnes + + * src/vc-backend.[Ch]: new files. The backends for vc handling, + have no support for RCS and partial support for CVS, will be + improved later. + + * src/insets/ several files: changes because of function name + changes in Bufferview and LyXView. + + * src/mathed/math_symbols.C (math_insert_symbol): use static_cast + + * src/support/LSubstring.[Ch]: new files. These implement a + Substring that can be very convenient to use. i.e. is this + possible: + string a = "Mary had a little sheep"; + Substring(a, "sheep") = "lamb"; + a is now "Mary has a little lamb". + + * src/support/LRegex.[Ch]: a regex class that can be used to pick + out patterns and subpatterns of strings. It is used by LSubstring + and also by vc-backend.C + + * src/support/lyxstring.C: went over all the assertions used and + tried to correct the wrong ones and flag which of them is required + by the standard. some bugs found because of this. Also removed a + couple of assertions. + + * src/support/Makefile.am (libsupport_a_SOURCES): added + LSubstring.[Ch] and LRegex.[Ch] + + * src/support/FileInfo.h: have struct stat buf as an object and + not a pointer to one, some changes because of this. + + * src/LaTeXFeatures.C (getTClassPreamble): also use the + information in layout when adding the layouts preamble to the + textclass preamble. + + * src/LaTeXFeatures.h: use a vector to store the layout + usage in. + + * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM + because of bug in OS/2. + +1999-11-08 Jean-Marc Lasgouttes + + * lib/layouts/lyxmacros.inc (lyxcode): set the font with + \verbatim@font instead of \ttfamily, so that it can be redefined. + + * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C, + src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C, + src/layout.h, src/text2.C: add 'using' directive to bring the + STL templates we need from the std:: namespace to the global one. + Needed by DEC cxx in strict ansi mode. + + * src/support/LIstream.h,src/support/LOstream.h, + src/support/lyxstring.h,src/table.h, + src/lyxlookup.h: do not include in header + files. This should be done in the .C files only. + + * development/lyx.spec.in: WHATSNEW has been renamed to NEWS + (from Kayvan). + + +1999-11-05 Jean-Marc Lasgouttes + + * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update + from Kayvan to fix the tth invokation. + + * development/lyx.spec.in: updates from Kayvan to reflect the + changes of file names. + +1999-11-05 Lars Gullik Bjønnes + + * src/text2.C (InsertStringB): use std::copy + (InsertStringA): use std::copy + + * src/bufferlist.C: use a vector to store the buffers in. This is + an internal change and should not affect any other thing. + + * src/BufferView.C (waitForX): use XSync instead of the lengthy + stuff in waitForX. + + * src/text.C (Fill): fix potential bug, one off bug. + +1999-11-04 Lars Gullik Bjønnes + + * src/Makefile.am (lyx_main.o): add more files it depends on. + + * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order. + + * src/support/lyxstring.C: use size_t for the reference count, + size, reserved memory and xtra. + (internal_compare): new private member function. Now the compare + functions should work for std::strings that have embedded '\0' + characters. + (compare): all compare functions rewritten to use + internal_compare. + +1999-11-03 Lars Gullik Bjønnes + + * src/support/lyxstring.C (compare): pass c_str() + (compare): pass c_str + (compare): pass c_str + +1999-11-03 Jean-Marc Lasgouttes + + * src/support/DebugStream.C: was not included correctly. + + * lib/configure: forgot to re-generate it :( I'll make this file + auto generated soon. + +1999-11-03 Lars Gullik Bjønnes + + * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x + is used. + + * src/support/lyxstring.C: some changes from length() to rep->sz. + avoids a function call. + + * src/support/filetools.C (SpaceLess): yet another version of the + algorithm...now per Jean-Marc's suggestions. + +1999-11-02 Lars Gullik Bjønnes + + * src/layout.C (less_textclass_desc): functor for use in sorting + of textclasses. + (LyXTextClass::Read): sort the textclasses after reading. + + * src/support/filetools.C (SpaceLess): new version of the + SpaceLess functions. What problems does this one give? Please + report. + + * images/banner_bw.xbm: made the arrays unsigned char * + +1999-11-02 Jean-Marc Lasgouttes + + * src/support/lyxstring.C (find): remove bogus assertion in the + two versions of find where this has not been done yet. + + * src/support/lyxlib.h: add missing int return type to + lyx::chdir(). + + * src/menus.C (ShowFileMenu): disable exporting to html if no + html export command is present. + + * config/lib_configure.m4: add a test for an HTML converter. The + programs checked for are, in this order: tth, latex2html and + hevea. + + * lib/configure: generated from config/lib_configure.m4. + + * src/lyxfunc.C (Dispatch): update and improve the execution of an + html converter. The parameters are now passed through $$FName and + $$OutName, instead of standard input/output. + + * src/lyxrc.{C,h}: rename \tth_command to \html_command. + + * lib/lyxrc.example: update description of \html_command. + add "quotes" around \screen_font_xxx font setting examples to help + people who use fonts with spaces in their names. + +1999-11-02 Lars Gullik Bjønnes + + * Distribution files: updates for v1.1.2 + + * src/support/lyxstring.C (find): remove bogus assert and return + npos for the same condition. + +1999-11-01 Lars Gullik Bjønnes + + * added patch for OS/2 from SMiyata. + +1999-10-29 Lars Gullik Bjønnes + + * src/text2.C (CutSelection): make space_wrapped a bool + (CutSelection): dont declare int i until we have to. + (alphaCounter): return a char const *. + +1999-10-28 Jean-Marc Lasgouttes + + * src/support/syscall.C (Systemcalls::kill): + src/support/filetools.C (PutEnv, PutEnvPath): + src/lyx_cb.C (addNewlineAndDepth): + src/FontInfo.C (FontInfo::resize): condition some #warning + directives with WITH_WARNINGS. + + +1999-10-28 Lars Gullik Bjønnes + + * src/layout.[Ch] + several files: access to class variables + limited and made accessor functions instead a lot of code changed + becuase of this. Also instead of returning pointers often a const + reference is returned instead. + + * src/form1.C (create_form_Figure): added a couple fo "no-c-format" + + * src/Makefile.am (dist-hook): added used to remove the CVS from + cheaders upon creating a dist + (EXTRA_DIST): added cheaders + + * src/support/lstrings.C (tostr(char)): fix it to handle param as + a character not as a small integer. + + * src/support/lyxstring.C (find): removed Assert and added i >= + rep->sz to the first if. + +1999-10-27 Lars Gullik Bjønnes + + * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C + src/LyXView.C src/buffer.C src/bufferparams.C + src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C + src/text2.C src/insets/insetinclude.C: + lyxlayout renamed to textclasslist. + + * src/layout.C: some lyxerr changes. + + * src/layout.[Ch] (LyXLayout::Read): changed second paramter to + LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY + (LyXLayoutList): removed all traces of this class. + (LyXTextClass::Read): rewrote LT_STYLE + (LyXTextClass::hasLayout): new function + (LyXTextClass::GetLayout): rewritten to return an iterator + has + both const and nonconst version. + (LyXTextClass::delete_layout): new function. + (LyXTextClassList::Style): bug fix. do the right thing if layout + is to big. + (LyXTextClassList::NumberOfLayout): new acces to layoutlist. + (LyXTextClassList::NameOfLayout): ditto + (LyXTextClassList::Load): ditto + + * src/buffer.C (makeLaTeXFile): new access to layoutlist + + * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist + + * src/LyXAction.C (LookupFunc): added a workaround for sun + compiler, on the other hand...we don't know if the current code + compiles on sun at all... + + * src/support/filetools.C (CleanupPath): subst fix + + * src/insets/insetbib.C (delDatabase): subst fix, this looks + _really_ weird. + + * src/support/filetools.C (PutEnvPath): subst fix, how come nobody + complained about this one? + + * src/insets/insetinclude.C (Latex): subst fix + + * src/insets/insetbib.C (getKeys): subst fix + + * src/LyXSendto.C (SendtoApplyCB): subst fix + + * src/lyx_main.C (init): subst fix + + * src/layout.C (Read): subst fix + + * src/lyx_sendfax_main.C (button_send): subst fix + + * src/buffer.C (RoffAsciiTable): subst fix + + * src/lyx_cb.C (MenuFax): subst fix + (PrintApplyCB): subst fix + +1999-10-26 Juergen Vigna + + * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0 + + (Read): Cleaned up this code so now we read only format vestion >= 5 + +1999-10-26 Lars Gullik Bjønnes + + * src/support/filetools.C (PutEnvPath): subst fix for EMX, how + come nobody has complained about this one? + + * src/insets/insetinclude.C (Latex): subst fix + + * src/insets/insetbib.C (getKeys): subst fix + + * src/lyx_main.C (init): subst fix + + * src/layout.C (Read): subst fix + + * src/buffer.C (RoffAsciiTable): subst fix + + * src/lyx_cb.C (MenuFax): subst fix. + + * src/layout.[hC] + some other files: rewrote to use + std::container to store textclasses and layouts in. + Simplified, removed a lot of code. Make all classes + assignable. Further simplifications and review of type + use still to be one. + + * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from + lastfiles to create the lastfiles partr of the menu. + + * src/lastfiles.[Ch]: rewritten to use deque to store the + lastfiles in. Uses fstream for reading and writing. Simplifies + code. + + * src/support/syscall.C: remove explicit cast. + + * src/BufferView.C (CursorToggleCB): removed code snippets that + were commented out. + use explicat C++ style casts instead of C style casts. also use + u_vdata instea of passing pointers in longs. + + * src/PaperLayout.C: removed code snippets that were commented out. + + * src/lyx_gui_misc.C: removed code snippets that were commented out. + + * src/lyx_main.C: removed code snippets that wer commented out. + + * src/paragraph.C: removed code snippets that were commented out. + + * src/lyxvc.C (logClose): use static_cast + (logUpdate): ditto + (viewLog): remove explicit cast to void* + (showLog): removed old commented code + + * src/menus.C: use static_cast instead of C style casts. use + u_vdata instead of u_ldata. remove explicit cast to (long) for + pointers. Removed old code that was commented out. + + * src/insets/inset.C: removed old commented func + + * src/insets/insetref.C (InsetRef): removed old code that had been + commented out for a long time. + (Edit): ditto + (escape): removed C style cast + + * src/insets/insetlatexaccent.C (Draw): removed old commented code + + * src/insets/insetlatex.C (Draw): removed old commented code + (Read): rewritten to use string + + * src/insets/insetlabel.C (escape): removed C style cast + + * src/insets/insetindex.h: removed vdata and ldata from FD_index_form + + * src/insets/insetindex.C: use static_cast and u_vdata, removed + old commented code. + + * src/insets/insetinclude.h: removed a couple of stupid bools + + * src/insets/insetinclude.C (include_cb): use static_cast and u_data. + (Clone): remove C style cast + (getKeys): changed list to lst because of std::list + + * src/insets/inseterror.C (Draw): removed som old commented code. + + * src/insets/insetcommand.C (Draw): removed some old commented code. + + * src/insets/insetbib.C (bibitem_cb): removed code that has been + commented out forever. + (bibitem_cb): use static_cast instead of C style cast + use of vdata changed to u_vdata. + + * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data + parameter. + (CloseUrlCB): use static_cast instead of C style cast. + (CloseUrlCB): added a fl_free form...it seemed to be missing. + + * src/insets/insetinfo.C (Edit): pass object in u_vdata instead + (C_InsetInfo_CloseInfoCB): forward the ob parameter + (CloseInfoCB): static_cast from ob->u_vdata instead. + (Edit): removed bogus arg from fl_set_object_shortcut, set to 1 + instead. + + * src/insets/inseterror.C (Edit): pass object in u_vdata instead + (C_InsetError_CloseErrorCB): forward the ob parameter + (CloseErrorCB): static_cast from ob->u_vdata instead. + + * src/vspace.h: include LString.h since we use string in this class. + + * src/vspace.C (lyx_advance): changed name from advance because of + nameclash with stl. And since we cannot use namespaces yet...I + used a lyx_ prefix instead. Expect this to change when we begin + using namespaces. + + * src/BufferView.[Ch] (BufferView::~BufferView): removed + + * src/BackStack.h: rewrote to use std::stack. made BackStackItem + and removed now defunct constructor and deconstructor. + + * src/BufferView.h: have backstack as a object not as a pointer. + removed initialization from constructor. added include for BackStack + + * development/lyx.spec.in (%build): add CFLAGS also. + + * src/screen.C (drawFrame): removed another warning. + +1999-10-25 Jean-Marc Lasgouttes + + * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to + OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2, + README and ANNOUNCE a bit for the next release. More work is + needed, of course. + + * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made + unbreakable if we are in freespacing mode (LyX-Code), but not in + latex mode. + +1999-10-25 Lars Gullik Bjønnes + + * src/BackStack.h: fixed initialization order in constructor + + * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in + + * acinclude.m4 (VERSION): new rules for when a version is + development, added also a variable for prerelease. + (warnings): we set with_warnings=yes for prereleases + (lyx_opt): prereleases compile with same optimization as development + (CXXFLAGS): only use pedantic if we are a development version + + * src/BufferView.C (restorePosition): don't do anything if the + backstack is empty. + + * src/BackStack.h: added member empty, use this to test if there + is anything to pop... + +1999-10-25 Juergen Vigna + + * forms/form1.fd + + * forms/layout_forms.fd + + * forms/latexoptions.fd + + * lyx.fd: changed for various form resize issues + + * src/mathed/math_panel.C + + * src/insets/inseterror.C + + * src/insets/insetinfo.C + + * src/insets/inseturl.C + + * src/insets/inseturl.h + + * src/LaTeXLog.C + + * src/LyXSendto.C + + * src/PaperLayout.C + + * src/ParagraphExtra.C + + * src/TableLayout.C + + * src/form1.C + + * src/layout_forms.C + + * src/lyx.C + + * src/lyx_cb.C + + * src/lyx_gui.C + + * src/lyxfr0.C + + * src/lyxfunc.C + + * src/lyxvc.C + + * src/menus.C: fixed various resize issues. So now forms can be + resized savely or not be resized at all. + + * forms/form_url.fd + + * src/insets/form_url.[Ch]: added because it's cleaner and easier + to modify IMO. + + * src/insets/Makefile.am: added files form_url.[Ch] + +1999-10-25 Jean-Marc Lasgouttes + + * INSTALL: it is now possible to compile LyX with digital C++ 6.1 + (and presumably 6.2). + + * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc, + menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around + remaining static member callbacks. + + * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer + messages. + + * src/support/lyxstring.h: declare struct Srep as friend of + lyxstring, since DEC cxx complains otherwise. + +1999-10-24 Lars Gullik Bjønnes + +1999-10-24 Lars Gullik Bjønnes + + * src/LaTeX.C (run): made run_bibtex also depend on files with + extension ".bst" + (runBibTeX): added scans for "\\bibstyle", now also ".bst" files + are put into the dependency file. + + * src/spellchecker.C (create_ispell_pipe): removed old #warning, + the code has shown itself to work + (create_ispell_pipe): removed another warning, added a comment + instead. + + * src/minibuffer.C (ExecutingCB): removed code that has been + commented out a long time + + * src/lyxfunc.C (processKeyEvent): removed some very old commented + out code + a warning. + + * src/support/lyxstring.h: comment out the three private + operators, when compiling with string ansi conforming compilers + they make problems. + + * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be + unsigned char *. + (pixmapFromBitmapData): change type of bdata to be unsigned char * + (pixmapFromBitmapData): add a reinterpret_cast in the call to + XCreateImage + + * src/mathed/math_panel.h: change 6th arg to AddBitmap to be + unsigned char * + + * src/mathed/math_panel.C (create_math_panel): remove explicit + casts + + * src/bmtable.h: change last paramter to fl_set_bmtable_data to be + unsigned char *. + + * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char * + (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call + to XCreatePixmapFromBitmapData + (fl_set_bmtable_data): change the last argument to be unsigned + char * + (fl_set_bmtable_file): change bdata to unsinged char *, change bw + and bh to be unsigned int, remove explicit casts in call to + XReadBitmapFileData. + + * images/arrows.xbm: made the arrays unsigned char * + * images/varsz.xbm: ditto + * images/misc.xbm: ditto + * images/greek.xbm: ditto + * images/dots.xbm: ditto + * images/brel.xbm: ditto + * images/bop.xbm: ditto + + * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in + + * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed. + (LYX_PROG_CXX): added -pedantic to g++ compile options when + with-warnings, removed the __STRING_ANSI__ hack, seems to not be + needed. + (LYX_CXX_CHEADERS): added to the test. + +1999-10-23 Lars Gullik Bjønnes + + * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append. + + * src/support/lyxstring.C (append): fixed something that must be a + bug, rep->assign was used instead of rep->append. + + * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h + and LOstream.h + + * src/lyxfunc.C (processKeyEvent): removed faulty line that made + lyx insert double chars. Fix spotted by Kayvan. + +1999-10-23 Asger Alstrup Nielsen + + * Fixed the tth support. I messed up with the Emacs patch apply feature + and omitted the changes in lyxrc.C. + +1999-10-22 Juergen Vigna + + * src/insets/figinset.C (CallbackFig): Just changed the defines a bit. + + * src/lyx_cb.C (MenuInsertRef) + + * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that + the form cannot be resized under it limits (fixes a segfault) + + * src/lyx.C (create_form_form_ref) + + * forms/lyx.fd: Changed Gravity on name input field so that it is + resized correctly. + +1999-10-22 Jean-Marc Lasgouttes + + * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers + and . + + * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks + whether provides the latest standard features, or if we + have an oldstyle library (like in egcs). + (LYX_CXX_STL_STRING): fix the test. + + * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the + code on MODERN_STL_STREAM. + + * src/support/lyxstring.h: use L{I,O}stream.h. + + * src/support/L{I,O}stream.h: new files, designed to setup + correctly streams for our use + - includes the right header depending on STL capabilities + - puts std::ostream and std::endl (for LOStream.h) or + std::istream (LIStream.h) in toplevel namespace. + +1999-10-22 Lars Gullik Bjønnes + + * src/LaTeX.C (run): added a check in 0 sumchange so that if it + was a bib file that had been changed we ensure that bibtex is run. + (runBibTeX): enhanced to extract the names of the bib files and + getting their absolute path and enter them into the dep file. + (findtexfile): static func that is used to look for tex-files, + checks for absolute patchs and tries also with kpsewhich. + Alternative ways of finding the correct files are wanted. Will + probably be moved. + (do_popen): function that runs a command using popen and returns + the whole output of that command in a string. Should be moved to + somewhere else. + + * src/DepTable.[Ch] (extchanged): new function that returns true if a + file with extension ext has changed. + + * src/insets/figinset.C: added ifdef guards around the fl_free + code that jug commented out. Now it is commented out when + compiling with XForms == 0.89. + + * src/support/lyxstring.C: moved the definition of lyxstring::Srep + to lyxstring.C, and only keep a forward declaration in + lyxstring.h. Simplifies the header file a bit and should help a + bit on compile time too. Also changes to Srep will not mandate a + recompile of code just using string. + (~lyxstring): definition moved here since it uses srep. + (size): definition moved here since it uses srep. + + * src/support/lyxstring.h: removed a couple of "inline" that should + not be there. + +1999-10-21 Jean-Marc Lasgouttes + + * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass + the 'ob' argument. + +1999-10-21 Juergen Vigna + + * src/table.C (SetPWidth): Just a small fix so the alignment is not + set to left if I just remove the width entry (or it is empty). + + * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong + paragraph when having dummy paragraphs. + +1999-10-20 Juergen Vigna + + * src/insets/figinset.C: just commented some fl_free_form calls + and added warnings so that this calls should be activated later + again. This avoids for now a segfault, but we have a memory leak! + + * src/lyxfunc.C (processKeyEvent) (Dispatch): changed + 'const char * argument' to 'string argument', this should + fix some Asserts() in lyxstring.C. + + * src/lyxfunc.h: Removed the function argAsString(const char *) + as it is not used anymore. + +1999-10-20 Lars Gullik Bjønnes + + * src/support/lyxstring.C (getline): reads now _all_ chars. uses + get instead of >> + + * src/Literate.h: some funcs moved from public to private to make + interface clearer. Unneeded args removed. + + * src/Literate.C (scanLiterateLogFile): rewritten to use iostream + instead of lyxlex. + (scanBuildLogFile): ditto + + * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into + normal TeX Error. Still room for improvement. + + * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed. + + * src/buffer.C (insertErrors): changes to make the error + desctription show properly. + + * src/LaTeX.C (deplog): removed the test for file in lyx doc dir. + could never happen + + * src/support/lyxstring.C (helper): changed to use + sizeof(object->rep->ref). + (operator>>): changed to use a pointer instead. + + * src/support/lyxstring.h: changed const reference & to value_type + const & lets see if that helps. + +1999-10-19 Lars Gullik Bjønnes + + * Makefile.am (rpmdist): fixed to have non static package and + verison. + + * src/support/lyxstring.C: removed the compilation guards + + * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things + a bit clearer. + + * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for + conditional compile of lyxstring.Ch + + * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a + stupid check, but it is a lot better than the bastring hack. + (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING + + * several files: changed string::erase into string::clear. Not + really needed. + + * src/chset.C (encodeString): use a char temporary instead + + * src/table.C (TexEndOfCell): added tostr around + column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1 + (TexEndOfCell): ditto + (TexEndOfCell): ditto + (TexEndOfCell): ditto + (DocBookEndOfCell): ditto + (DocBookEndOfCell): ditto + (DocBookEndOfCell): ditto + (DocBookEndOfCell): ditto + + * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1 + + * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count + + * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret + (MenuBuildProg): added tostr around ret + (MenuRunChktex): added tostr around ret + (DocumentApplyCB): added tostr around ret + + * src/chset.C (encodeString): added tostr around t->ic + + * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth + (makeLaTeXFile): added tostr around tocdepth + (makeLaTeXFile): added tostr around ftcound - 1 + + * src/insets/insetbib.C (setCounter): added tostr around counter. + + * src/support/lyxstring.h: added an operator+=(int) to catch more + mistakes. + + * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers. + (lyxstring): We DON'T allow NULL pointers. + +1999-10-19 Jean-Marc Lasgouttes + + * src/mathed/math_macro.C (MathMacroArgument::Write, + MathMacroTemplate::WriteDef): add tostr() around macro arg numbers + when writing them out. + + * src/LString.C: remove, since it is not used anymore. + + * src/support/lyxstring.C: condition the content to + USE_INCLUDED_STRING macro. + + * src/mathed/math_symbols.C, src/support/lstrings.C, + src/support/lyxstring.C: add `using' directive to specify what + we need in . I do not think that we need to + conditionalize this, but any thought is appreciated. + + * many files: change all callback functions to "C" linkage + functions to please strict C++ compilers like DEC cxx 6.1 in mode + strict_ansi. Those who were static are now global. + The case of callbacks which are static class members is + trickier, since we have to make C wrappers around them (see + InsetError, InsetInfo and InsetUrl). The same holds for friends. I + did not finish this yet, since it defeats the purpose of + encapsulation, and I am not sure what the best route is. + +1999-10-19 Juergen Vigna + + * src/support/lyxstring.C (lyxstring): we permit to have a null + pointer as assignment value and just don't assign it. + + * src/vspace.C (nextToken): corrected this function substituting + find_first(_not)_of with find_last_of. + + * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB) + (TableOptCloseCB) (TableSpeCloseCB): + inserted fl_set_focus call for problem with fl_hide_form() in + xforms-0.89. + +1999-10-19 Jean-Marc Lasgouttes + + * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a + string. + +1999-10-18 Jean-Marc Lasgouttes + + * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses + LyXLex::next() and not eatline() to get its argument. + +1999-10-17 Lars Gullik Bjønnes + + * src/DepTable.[Ch]: rewritten to store the dependencies in a map + instead, use fstreams for io of the depfile, removed unneeded + functions and variables. + + * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a + vector instead, removed all functions and variables that is not in + use. + +1999-10-16 Lars Gullik Bjønnes + + * src/buffer.C (insertErrors): use new interface to TeXError + + * Makefile.am (rpmdist): added a rpmdist target + + * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as + per Kayvan's instructions. + +1999-10-15 Jean-Marc Lasgouttes + + * src/Makefile.am: add a definition for localedir, so that locales + are found after installation (Kayvan) + +1999-10-14 Lars Gullik Bjønnes + + * development/.cvsignore: new file. + +1999-10-14 Jean-Marc Lasgouttes + + * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the + C++ compiler provides wrappers for C headers and use our alternate + version otherwise. + + * configure.in: use LYX_CXX_CHEADERS. + + * src/cheader/: new directory, populated with cname headers from + libstdc++-2.8.1. They are a bit old, but probably good enough for + what we want (support compilers who lack them). + + * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support + from includes. It turns out is was stupid. + +1999-10-14 Lars Gullik Bjønnes + + * lib/Makefile.am (install-data-local): forgot a ';' + (install-data-local): forgot a '\' + (libinstalldirs): needed after all. reintroduced. + +1999-10-13 Lars Gullik Bjønnes + + * configure.in (AC_OUTPUT): added lyx.spec + + * development/lyx.spec: removed file + + * development/lyx.spec.in: new file + + * po/*.po: merged with lyx.pot becuase of make distcheck + + * lib/Makefile.am (dist-hook): added dist-hook so that + documentation files will be included when doing a make + dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run. + (pkgdata_SCRIPTS): added configure.cmd for now, we can use som + conditional later. + more: tried to make install do the right thing, exclude CVS dirs + etc. + + * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that + Path would fit in more nicely. + + * all files that used to use pathstack: uses now Path instead. + This change was a lot easier than expected. + + * src/support/path.h: new file + + * src/support/Makefile.am (libsupport_a_SOURCES): added path.h + + * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch] + + * src/support/lyxstring.C (getline): Default arg was given for + para 3. removed. + + * Configure.cmd: removed file + +1999-10-13 Jean-Marc Lasgouttes + + * src/support/DebugStream.[Ch]: remove the explicit std:: before + streams classes and types, add the proper 'using' statements when + MODERN_STL is defined. + + * src/debug.h: move the << operator definition after the inclusion + of DebugStream.h + + * src/support/filetools.C: include "LAssert.h", which is needed + later. + + * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support + to includes. + + * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h: + include "debug.h" to define a proper ostream. + +1999-10-12 Asger Alstrup Nielsen + + * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)" + method to the SystemCall class which can kill a process, but it's + not fully implemented yet. + + * src/*.C: Changed Systemcalls::Startscript() to startscript() + + * src/support/FileInfo.h: Better documentation + + * src/lyxfunc.C: Added support for buffer-export html + + * src/menus.C: Added Export->As HTML... + + * lib/bind/*.bind: Added short-cut for buffer-export html + + * src/lyxrc.*: Added support for new \tth_command + + * lib/lyxrc.example: Added stuff for new \tth_command + +1999-10-12 Lars Gullik Bjønnes + + * lib/Makefile.am (IMAGES): removed images/README + (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it + installes in correct place. Check permisions is installed + correctly. + + * src/LaTeX.C: some no-op changes moved declaration of some + variables around. + + * src/LaTeX.h (LATEX_H): changed include guard name + +1999-10-12 Jean-Marc Lasgouttes + + * lib/reLyX/Makefile.am: install noweb2lyx. + + * lib/Makefile.am: install configure. + + * lib/reLyX/configure.in: declare a config aux dir; set package + name to lyx (not sure what the best solution is); generate noweb2lyx. + + * lib/layouts/egs.layout: fix the bibliography layout. + +1999-10-08 Jürgen Vigna + + * src/support/filetools.C (FileOpenSearch): Fixed a bug where + when in the PATH was something like /usr/bin;;/bin (note: the ;;) + it returned without continuing to search the path. + +1999-10-07 Lars Gullik Bjønnes + + * src/insets/insetquotes.C (Draw): Simplified a gread deal. This + also fixes a bug. It is not allowed to do tricks with std::strings + like: string a("hei"); &a[e]; this will not give what you + think... Any reason for the complexity in this func? + +1999-10-06 Asger Alstrup Nielsen + + * Updated README and INSTALL a bit, mostly to check that my + CVS rights are correctly set up. + +1999-10-06 Lars Gullik Bjønnes + + * src/support/lyxstring.C (helper): removed bogus Assert. strlen + does not allow '\0' chars but lyxstring and std::string does. + +1999-10-05 Lars Gullik Bjønnes + + * autogen.sh (AUTOCONF): let the autogen script create the + POTFILES.in file too. POTFILES.in should perhaps now not be + included in the cvs module. + + * some more files changed to use C++ includes instead of C ones. + + * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended + not assigned. + (Reread): added tostr to nlink. buggy output otherwise. + (Reread): added a string() around szMode when assigning to Buffer, + without this I got a log of garbled info strings. + + * acconfig.h: commented out the PTR_AS_INT macros. They should not + be needed. + + * I have added several ostream & operator<<(ostream &, some_type) + functions. This has been done to avoid casting and warnings when + outputting enums to lyxerr. This as thus eliminated a lot of + explicit casts and has made the code clearer. Among the enums + affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of + mathed enums, some font enum the Debug::type enum. + + * src/support/lyxstring.h (clear): missing method. equivalent of + erase(0, npos). + + * all files that contained "stderr": rewrote constructs that used + stderr to use lyxerr instead. (except bmtable) + + * src/support/DebugStream.h (level): and the passed t with + Debug::ANY to avoid spurious bits set. + + * src/debug.h (Debug::type value): made it accept strings of the + type INFO,INIT,KEY. + + * configure.in (Check for programs): Added a check for kpsewhich, + the latex generation will use this later to better the dicovery of + all used files. + + * src/BufferView.C (create_view): we don't need to cast this to + (void*) that is done automatically. + (WorkAreaButtonPress): removed some dead code. + +1999-10-05 Jean-Marc Lasgouttes + + * src/minibuffer.C (Init): make sure that the "Welcome to LyX!" + is not overwritten when translated (David Sua'rez de Lis). + + * lib/CREDITS: Added David Sua'rez de Lis + + * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX. + + * src/bufferparams.C (BufferParams): default input encoding is now + "latin1" + + * acinclude.m4 (cross_compiling): comment out macro + LYX_GXX_STRENGTH_REDUCE. + + * acconfig.h: make sure that const is not defined (to empty) when + we are compiling C++. Remove commented out code using SIZEOF_xx + macros. + + * configure.in : move the test for const and inline as late as + possible so that these C tests do not interefere with C++ ones. + Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness + has not been proven. + +1999-10-04 Jean-Marc Lasgouttes + + * src/table.C (getDocBookAlign): remove bad default value for + isColumn parameter. + + * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles + shortcut. + (ShowFileMenu2): ditto. + + * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list + of files to ignore. + +1999-10-04 Lars Gullik Bjønnes + + * Most files: finished the change from the old error code to use + DebugStream for all lyxerr debugging. Only minor changes remain + (e.g. the setting of debug levels using strings instead of number) + +1999-10-02 Lars Gullik Bjønnes + + * src/layout.C (Add): Changed to use compare_no_case instead of + strcasecmp. + + * src/FontInfo.C: changed loop variable type too string::size_type. + +1999-10-01 Lars Gullik Bjønnes + + * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and + set ETAGS_ARGS to --c++ + +1999-09-30 Lars Gullik Bjønnes + + * src/table.C (DocBookEndOfCell): commented out two unused variables + + * src/paragraph.C: commented out four unused variables. + + * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i + insed a if clause with type string::size_type. + + * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to + string::size_type. + + * src/lyxfunc.C (Dispatch): use string::size_type as loop variable. + + * src/lyx_cb.C (ReplaceWord): use string::size_type as loop + variable, also changed loop to go from 0 to lenght + 1, instead of + -1 to length. This should be correct. + + * src/LaTeX.C (scanError): use string::size_type as loop variable + type. + + * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines + (l.896) since y_tmp and row was not used anyway. + + * src/insets/insetref.C (escape): use string::size_type as loop + variable type. + + * src/insets/insetquotes.C (Width): use string::size_type as loop + variable type. + (Draw): use string::size_type as loop variable type. + + * src/insets/insetlatexaccent.C (checkContents): use + string::size_type as loop variable type. + + * src/insets/insetlabel.C (escape): use string::size_type as loop + variable type. + + * src/insets/insetinfo.C: added an extern for current_view. + + * src/insets/insetcommand.C (scanCommand): use string::size_type + as loop variable type. + + * most files: removed the RCS tags. With them we had to recompile + a lot of files after a simple cvs commit. Also we have never used + them for anything meaningful. + + * most files: tags-query-replace NULL 0. As adviced several plases + we now use "0" instead of "NULL" in our code. + + * src/support/filetools.C (SpaceLess): use string::size_type as + loop variable type. + +1999-09-29 Lars Gullik Bjønnes + + * src/paragraph.C: fixed up some more string stuff. + +1999-09-28 Lars Gullik Bjønnes + + * src/support/filetools.h: make modestr a std::string. + + * src/filetools.C (GetEnv): made ch really const. + + * src/lyxlib.h: removed the Maximum and Minimum inline functions, + made code that used these use max/min from instead. + + * changed several c library include files to their equivalent c++ + library include files. All is not changed yet. + + * created a support subdir in src, put lyxstring and lstrings + there + the extra files atexit, fileblock, strerror. Created + Makefile.am. edited configure.in and src/Makefile.am to use this + new subdir. More files moved to support. + + * imported som of the functions from repository lyx, filetools + + * ran tags-query-replace on LString -> string, corrected the bogus + cases. Tried to make use of lstrings.[hC], debugged a lot. There + is still some errors in there. This is errors where too much or + too litle get deleted from strings (string::erase, string::substr, + string::replace), there can also be some off by one errors, or + just plain wrong use of functions from lstrings. Viewing of quotes + is wrong. + + * LyX is now running fairly well with string, but there are + certainly some bugs yet (see above) also string is quite different + from LString among others in that it does not allow null pointers + passed in and will abort if it gets any. + + * Added the revtex4 files I forgot when setting up the repository. + +1999-09-27 Lars Gullik Bjønnes + + * All over: Tried to clean everything up so that only the files + that we really need are included in the cvs repository. + * Switched to use automake. + * Generaton of reLyX is not perfect, LYX_DIR does not get substituted. + * Install has not been checked. + +1999-09-22 Lars Gullik Bjønnes + + * po/pt.po: Three errors: + l.533 and l.538 format specification error + l. 402 duplicate entry, I just deleted it. diff --git a/boost/ChangeLog b/boost/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/config/ChangeLog b/config/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/development/ChangeLog b/development/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/forms/ChangeLog b/forms/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/images/ChangeLog b/images/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/lib/ChangeLog b/lib/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/sigc++/ChangeLog b/sigc++/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/ChangeLog b/src/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/cheaders/ChangeLog b/src/cheaders/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/frontends/ChangeLog b/src/frontends/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/frontends/gnome/ChangeLog b/src/frontends/gnome/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/frontends/kde/ChangeLog b/src/frontends/kde/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/frontends/support/ChangeLog b/src/frontends/support/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/frontends/xforms/ChangeLog b/src/frontends/xforms/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/graphics/ChangeLog b/src/graphics/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/insets/ChangeLog b/src/insets/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/mathed/ChangeLog b/src/mathed/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/support/ChangeLog b/src/support/ChangeLog new file mode 100644 index 0000000000..e69de29bb2 diff --git a/src/version.h b/src/version.h index fb0ddbb42d..078d4208cc 100644 --- a/src/version.h +++ b/src/version.h @@ -1,8 +1,8 @@ /* Version and release date definition */ /// -#define LYX_VERSION "1.1.6cvs" +#define LYX_VERSION "1.2.0cvs" /// -#define LYX_RELEASE "Wed, Jan 3, 2001" +#define LYX_RELEASE "Thu, Jan 11, 2001" /* This version string is intended to be used in files created by LyX */ /// -#define LYX_DOCVERSION "LyX 1.1" +#define LYX_DOCVERSION "LyX 1.2" diff --git a/src/xtl/ChangeLog b/src/xtl/ChangeLog new file mode 100644 index 0000000000..e69de29bb2