anne/lyx_mirror
1
0
Fork 0
mirror of https://git.lyx.org/repos/lyx.git synced 2024-12-26 22:17:41 +00:00
Code Issues Actions Packages Projects Releases Wiki Activity
0691ed7ea9
lyx_mirror/ChangeLog
Jean-Marc Lasgouttes 0691ed7ea9 Fix class switching bug 
git-svn-id: svn://svn.lyx.org/lyx/lyx-devel/trunk@1307 a592a061-630c-0410-9148-cb99ea01b6c8
2001-01-09 14:30:35 +00:00

13273 lines
437 KiB
Plaintext
Raw Blame History

2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix
class switching; do not do anything if class has not been changed.
2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
* lib/build-listerrors: Exit if literate-article doesn't appear in
textclass.lst
2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/combox.h (getline): small fix for sun CC 6.0
* src/combox.C (input_cb): ditto.
* src/spellchecker.C (sigchldhandler): ditto.
* src/lyx_main.C (init): do not query for creation of user
directory when running without a GUI.
2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
* src/mathed/formula.C (LocalDispatch): Toggle font properties.
2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
* BufferView2.C (open_new_inset): Added 2nd argument.
(getParentText, getParentLanguage): New methods.
* src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and
LFUN_INSET_TABULAR for RTL text.
* src/tabular.C (Latex): Put \R{} around RTL cells.
* src/text2.C (InsertInset): Change cursor position for highly
editable insets.
* src/frontends/xforms/FormTabularCreate.C (apply): Create the
tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...)
* src/insets/insettabular.C (LocalDispatch): When dispatching
LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
locked, then the insettext of the new cell will be locked.
(moveLeft, moveRight): Fixed for RTL tabulars.
(moveNextCell, movePrevCell): Ditto.
(isRightToLeft): New method.
* src/insets/insettext.C (LocalDispatch): Fixed handling of
non-dispatched function in the locking inset.
(Edit): If the inset is empty set the language of the current font
to the language to the surronding text (this code was moved from
LocalDispatch to allow the user to change the languaeg before
inserting text).
(moveRight, moveLeft): Fixed for RTL text.
(checkAndActivateInset): Fixed.
* src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate
the tooltip.
(set): ditto.
* src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL
around some ispell code.
* src/lyxcursor.[Ch]: add proper constructor, to avoid tons of
Unitialized Memory Read in purify.
* lib/examples/nl_splash.lyx: update from Tino Meinen.
2001-01-04 Dekel Tsur <dekelts@tau.ac.il>
* src/frontends/xforms/FormDocument.C (FormDocument::build):
Disable class_->choice_doc_class and language_->choice_language to
allow using the class/language combox with keyboard.
2001-01-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/snprintf.c (va_copy): only define va_copy if undefined
2001-01-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxvc.C (showLog): give the tempfile a mask
* src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
branch on !rename
* src/support/filetools.C (IsDirWriteable): give the tempfile a
mask and unlink the tempfile after use.
2001-01-04 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (resetPos): an extra scroll, but we
really should redo all this scrolling code!
(TabularFeatures): unlock the_locking_inset before add/del rows/colums.
* src/text.C (GetVisibleRow): check that y/h values are good otherwise
change them.
* src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
(pasteSelection): pay attention to multicolumn cells.
(calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_panel.C (deco_cb): check the decoration index is
valid.
* src/frontends/xforms/FormPreferences.C (feedback): apply
formatting to the translated string, not to the original one.
(printWarning): ditto.
* src/gettext.C (_): translate empty string with empty string.
* src/frontends/xforms/FormCopyright.C (build): use _() instead of
N_().
* NEWS: small update
* UPGRADING: mention that tabular format has been changed.
2001-01-03 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (InsetButtonPress): look for button==2
and do Clipboard Paste!
* src/insets/insettext.C (SetText): added function.
* src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
new LFUN_PASTESELECTION.
* src/insets/insettext.C (draw): don't clear if top_x changes.
* src/insets/insettabular.C (draw): clear only if the inset didn't
change in the draw routine.
* src/insets/insettext.C (width): make the width dependant on the
textWidth too.
* src/text.C (draw): comment out the UpdateInset call.
* src/screen.C (DrawOneRow):
(DrawFromTo): check for bv->text->status not text->status.
* src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
dimensions of ascent-descent for the whole row.
* src/insets/insettext.C (draw): check also for need_update == INIT.
2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* Makefile.am (EXTRA_DIST): add autogen.sh
2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
* development/OS2/quick_fix.patch:
* lib/configure.cmd: update OS/2 support files.
2001-01-02 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (pasteSelection): rewritten correctly.
* src/tabular.C (TeXTopHLine):
(TeXBottomHLine): fixed Lars new code.
* src/insets/insettext.C (LocalDispatch): added support for math_greek.
* src/mathed/math_symbols.C (math_insert_greek): removed current_view
from this function and added a BufferView * parameter.
* src/mathed/math_symbols.C (math_insert_symbol): ditto
2000-12-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/version.h: set to pre3
2000-12-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/Makefile.am (lyx_SOURCES): added Floating.C
* src/Floating.h: moved all the inlines to Floating.C
* src/Floating.C: new file
2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormPreferences.C (feedback): fix
description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
2000-12-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/FileInfo.h: move unistd.h to after sys/types.h and
sys/stat.h.
* src/support/FileInfo.C: don't include sys/types. and sys/stat.h
* src/mathed/math_inset.h: move LString.h to be included first
* src/insets/insetfloat.C: adjust for change in private variable names
* src/frontends/xforms/xform_helpers.h : don't include config.h
* src/frontends/xforms/xform_helpers.C: adjust the order of
includes, some whitespace changes.
* src/trans.C (Load): constify filename and res
* src/text2.C (SetCounter): call Floating::name()
* src/screen.C: change to not use owner from WorkArea, but from
text instead.
* src/lyxfunc.C: adjust because of changes in Intl.
* src/intl.h: make trans a object instead of pointer, inlucd
trans_mgr.h in this file.
(getTrans): return a reference to TransManager
* src/intl.C: don't include trans_mgr.h here
modify calls to trans to work on object instead of on pointer
* src/WorkArea.h: add using for Signal1
comment out forward decl of BufferView.
add signal scrollCB
remove class variable owner_ and getter method for this.
* src/WorkArea.C: don't include BufferView.h
(WorkArea): change to not take a BufferView.h, use signals
instead.
(scroll_cb): emit signal
* src/LaTeXFeatures.C: include Floatlist.h
(getPackages): only load float.sty when needed
(getMacros): prepare for outputting the correct code to preamble.
* src/Floating.h: make all variables private + rename to var_.
(Floating): default ctor
(Floating): complex ctor to set a complete Floating
(type): getter
(placement): getter
(name): getter
(builtin): getter
* src/FloatList.C (FloatList): use Floating's constructor
(begin): new method
(end): ditto
(newFloat): call type()
(defaultPlacement): call placement()
(operator): new operator
* src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
(scrollUp): call pimpl's scrollCB
(scrollDown): ditto
(pasteClipboard): constify clip
* src/BufferView2.C (insertLyXFile): constify fname, fi and c.
(insertErrors): constify desctext, errortext, msgtxt and errorrow
(open_new_inset): delete some commented code.
* src/BufferView.[Ch] (enterView): comment out
(leaveView): ditto
(scrollCB): ditto
(workAreaMotionNotify): ditto
(workAreaButtonPress): ditto
(doubleClick): ditto
(tripleClick): ditto
(workAreaButtonRelease): ditto
(workAreaExpose): ditto
* config/lyxinclude.m4 (cross_compiling): small stuff to be able
to compile with cvs gcc (2.97).
2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
* lib/ui/default.ui: menu structure cleanup.
* lib/languages: add description of entries.
2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/ExternalTemplate.C (readTemplates): change debug
messages a bit.
(readTemplate): use lyxlex.printError to report read errors.
(readFormat): ditto.
* src/insets/insetexternal.C (Read): suppress debug message when
not needed.
2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
* src/insets/insetinclude.C (Ascii): New method. Currently
supports only verbatim input.
2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/bind/fi_menus.bind: update from Pauli Virtanen.
2000-12-22 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (InsetButtonPress): do nothing if we
have a selection and button == 3.
(UpdateLocal): if what == INIT clear selection if existent!
(InsetButtonPress): don't activate the cell inset on button==3
(Edit): ditto
(LocalDispatch): move curor up/down if exiting an inset which this
keys.
2000-12-20 Juergen Vigna <jug@sad.it>
* src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
calling for the math-panel (do not unlock the math-inset if locked)!
* src/text.C (GetVisibleRow): fixed drawing of depth lines inside
text-insets (with x-offset).
* src/tabular.C (TeXCellPreamble): fixed wrong output of special
alignment of multicolumn-cells.
2000-12-19 Juergen Vigna <jug@sad.it>
* src/lyxfunc.C (Dispatch):
* src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
for insettext.
2000-12-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/WorkArea.C (work_area_handler): simplify the key/keysym
handling for XForms 0.89, this might have rendered some cases
unusable. I have at least deadkeys, accent-xxx and KP_x working.
Please report proplems.
* src/lyxfunc.C (processKeySym): make the self-insert handling
work as it should
2000-12-18 Baruch Even <baruch.even@writeme.com>
* src/LaTeX.C (deplog): fix spelling errors
* src/text2.C (CutSelection): ditto
* src/lyxfunc.C (Dispatch): ditto
2000-12-18 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lib/layouts/stdlayouts.inc: only allow align Center for Caption
* src/mathed/math_inset.C (MathMatrixInset): initialize v_align
and h_align in default init.
adjust calls to MathedRowSt
* src/mathed/math_iter.C: adjust calls to MathedRowSt
* src/mathed/math_iter.h (getAD): ditto
* src/mathed/math_defs.h (class MathedRowSt): remove friends, add
methods setBaseline, ascent, descent
(class MathMatrixInset): remove method GetAlign, change h_align
from char* to string
* src/lyxfunc.C (processKeySym): discover the correct argument if
the action is LFUN_SELFINSERT
2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
* src/mathed/math_cursor.C (Interpret) Suppress a debug message
in normal run.
2000-12-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/copy.C: don't include filetools.h
* lib/images: revert to old banner, drop the cucumber.
2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
* src/converter.C (Formats::View): Change the current directory to
the directory of the file.
2000-12-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/kbsequence.C (addkey): also clear sequence and modifiers if
length == 0
* src/BufferView2.C (theLockingInset): return 0 if text is 0
2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
* Many files: Fix RTL support for insettext.
2000-12-11 John Levon <moz@compsoc.man.ac.uk>
* README: add mention of broken ghostscript versions, remove
reference to non-existent BUGS file
2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
* src/support/lstrings.C (compare_no_case): small fix. When passed
length, should use it in the size comparison.
2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insetexternal.C (getScreenLabel): Return a default
value if the template label is empty.
* src/lyxlookup.C: do not condition on FL_REVISION.
* forms/sp_form.fd:
* src/sp_form.C: fix the font size of some text entries
* src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
after TOC when there is no TOC.
* src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
bind file if it has not been done yet.
(read): remove local bindFile variable. Try to fix the handling of
RC_BIND and RC_BINDFILE.
* src/lyx_main.C (init): use readBindFileIfNeeded().
* lib/languages: Change description of german to "German (new
spelling)".
2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormInset.C (createInset): activate "Ok",
"Apply" buttons if arg is non-zero.
* src/lyxfunc.C (Dispatch): enable citation to be inserted without
launching the popup if sufficient info is passed to
LFUN_CITATION_CREATE.
2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
* src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
labels (disabled in 1.1.6).
* src/lyxrc.[Ch]: New variable label_init_length
* mathed/formula.C (LocalDispatch): Preserve the label when
changing from display math to eqnarray (however, the label
do not appear at the first line, as one might expects, but at the
second line).
(LocalDispatch): When inserting a label to a formula which already
have a label, the old label is used as default value.
Also, if the label is changed, then all references to the label
are changed.
* src/mathed/math_iter.C (setLabel): Allow to set the label
even if it is empty. This is needed to allow deletion of a label
in an eqnarray.
* src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
refernces only if the old label appears once in the document.
2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
* lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
<gehlert@Rcs1.urz.tu-dresden.de>
* src/frontends/xforms/FormBase.C: comment out debug.h
* src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
code in xform_helpers instead.
(d-tor): comment out "delete dialog;" and so prevent a crash on exit.
* src/frontends/xforms/FormPreferences.C: use AddName() in more places.
Use N_(), rather than _() when creating strings to pass to browseFile()
because browseFile calls gettext() itself now.
* src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
display the filename correctly.
2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
* src/converter.C (Move): New method. Used to move file or files
from temp dir to the output dir. (this fixes the bug that
exporting linuxdoc/docbook document to html would not move all
html file from temp directory).
* src/support/filetools.C (DirList): Fixed.
* src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
* src/converter.C (Add): Remove $$i when setting latex_command.
* src/text.C (IsBoundary): Return false when pos = 0.
2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
* lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
need to empty the fields to turn off use of the geometry package!
2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
(Buffer const &), not a (BufferParams const &) and so fix a crash
caused by using current_view before it had been initialised. Not
the best way to do this, but much easier than changing
Inset::Clone(Buffer const &) to Inset::Clone().
* src/CutAndPaste.C:
* src/tabular.C: changed call to CopyIntoMinibuffer().
2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/ui/default.ui: put TOC at the beginning of the TOC menu.
* src/lyxfunc.C (getStatus): disable insertion of floats in a
tabular.
2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
changed filter for screen fonts input filter from int to float
* src/frontends/xforms/input_validators.c: removed.
* src/frontends/xforms/input_validators.C: new file. Can now call C++
functions from within the filter functions.
* src/frontends/xforms/input_validators.[Ch]
(fl_unsigned_float_filter): new filter function.
* src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
confused now! And if you think I'm going to do this in
./forms/fdfix.sh with its "sed -e" declarations, then think again!
2000-12-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
* src/WorkArea.C (work_area_handler): don't handle button requests
if xbutton.button == 0
2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
It creates a lot of interesting problems.
2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Menubar_pimpl.C (openByName): check that
the menu exists in the current menubar before opening it.
* src/MenuBackend.C (hasSubmenu): new method.
* src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
action value by offsetting actions by a large constant (so that
bogs choice result will be less than this constant).
* lib/bind/fi_menus.bind: more cleanup to menus.
* lib/bind/sciword.bind: ditto.
* lib/bind/xemacs.bind: ditto.
* lib/bind/emacs.bind: ditto.
* lib/bind/pt_menus.bind: ditto.
* lib/bind/hu_menus.bind: ditto.
* src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
* INSTALL: update PROBLEMS section.
* src/lyxlookup.h: remove condition on xforms version, since we
should not include it if not appropriate.
2000-12-05 John Levon <moz@compsoc.man.ac.uk>
* src/LColor.C: "latex text" -> "latex inset" (from
Angus Leeming)
* src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
* src/frontends/kde/FormTabularCreate.C:
* src/frontends/kde/citationdlg.C:
* src/frontends/kde/copyrightdlg.C:
* src/frontends/kde/paradlg.C:
* src/frontends/kde/paraextradlg.C:
* src/frontends/kde/parageneraldlg.C:
* src/frontends/kde/printdlg.C:
* src/frontends/kde/refdlg.C:
* src/frontends/kde/tabcreatedlg.C:
* src/frontends/kde/tocdlg.C:
* src/frontends/kde/urldlg.C: add necessary headers
(from Angus Leeming)
* src/frontends/kde/dlg/emptytable.C:
* src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
default parameters (from Angus Leeming)
* src/frontends/kde/dlg/moc/.cvsignore:
* src/frontends/kde/dlg/.cvsignore:
* src/frontends/kde/moc/.cvsignore: fix the library name
(from Angus Leeming)
* src/frontends/kde/paradlg.C:
* src/frontends/kde/parageneraldlg.C:
* src/frontends/kde/dlg/para.dlg:
* src/frontends/kde/dlg/paradlgdata.C: added accelerators
* src/frontends/kde/dlg/README: clarified qtarch version
* src/frontends/kde/dlg/Makefile.am: removed the
dlg rules as they created spontaneous rebuilds
(not a good idea as it requires qtarch)
2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
fixlevel along with xforms version.
* src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
xforms version is strictly less than 0.89.5.
* src/lyx_gui.C (LyXGUI): ditto.
* src/LyXView.C (show): ditto.
2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
* src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
movement in inset in RTL text.
(checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
(workAreaButtonRelease): Do not open a float when there is a selection.
* src/insets/insettext.C (cx): Fixed for insets in RTL text.
* src/spellchecker.C (RunSpellChecker): Open all floats before
spellchecking.
* src/text.C (InsertChar): Consider "," as a part of a number
(for LTR numbers in RTL text code).
(IsBoundary): Fixed (and simplified).
(InsertChar): Recalculate cursor boundary.
(Backspace): Ditto.
2000-12-04 John Levon <moz@compsoc.man.ac.uk>
* src/spellchecker.C: fix figures with pspell enabled
* src/insets/figinset.C: workaround for gs hang xforms bug
2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/bind/??_menus.bind: comment out the entries corresponding to
real menus. They should be eventually removed, but I'll let the
language maintainers do that.
2000-12-04 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/parageneraldlg.C:
* src/frontends/kde/parageneraldlg.h: don't use
a derived class for SpaceAbove/Below
* src/frontends/kde/dlg/README: add some info
* src/frontends/kde/dlg/*: update data files, update
dialog files.
* src/frontends/kde/dlg/moc/Makefile.am: add
${FRONTEND_INCLUDES}
2000-12-04 John Levon <moz@compsoc.man.ac.uk>
* configure.in: add new KDE Makefiles
* src/vspace.h: return GlueLength not a normal one
* src/support/lstrings.h:
* src/support/lstrings.C: add isStrUnsignedInt(),
strToUnsignedInt()
* src/frontends/kde/*: big reorganisation, update
FormParagraph, add FormTabCreate
2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
* lib/ui/default.ui: small grammatical change.
* src/frontends/xforms/xform_macros.h: removed.
* src/frontends/xforms/FormBase.C:
* src/frontends/xforms/FormPreferences.C:
* src/frontends/xforms/Makefile.am: changes associated with removing
xform_macros.h. Should make Lars' debugging a little easier.
* src/frontends/xforms/FormPreferences.C:
* src/frontends/xforms/FormPreferences.h:
* src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
longer use X11 color name database. HSV and RGB dials/sliders.
Please let this be the end of this!
2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
* Several files: Allow compilation when the compiler doesn't
support namespaces.
2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
* lyx.man:
* src/lyx_main.C (commandLineHelp, easyParse): documented remaining
command line options.
2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
FL_MENU_BUTTON for items in menu bar. Not sure what difference it
makes, anyway.
2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormRef.C (updateBrowser):
* src/frontends/xforms/forms/form_ref.fd: try clicking on
different insets with the sort key active. Now apply this patch!
2000-11-29 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/xforms/FormPrint.C: set to valid()
when we update from the passed parameters.
2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
* src/LColor.C (getFromGUIName): internationalise the comparison.
* src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
FormPreferences choice.
* src/frontends/xforms/FormPreferences.C: some additional Color safety.
Should be redundant.
2000-11-29 John Levon <moz@compsoc.man.ac.uk>
* src/lyxrc.C: more detail for the printer program config
dialog.
* src/LColor.C: ert->latex text. LColor needs a big revamp
but will have to wait till after 1.1.6
* src/buffer.C: bring up a dialog if we load a document
with an un-installed text class, rather than just complain
on the console.
2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
* src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
the browser form for a combox in a tabbed folder. Bug fix courtesy of
Steve Lamont <spl@ncmir.ucsd.edu>.
* src/frontends/xforms/FormDocument.C (build):
* src/frontends/xforms/FormPreferences.C (Language::build):
pass tabfolders to Combox::add() in order to use this work around.
* src/frontends/xforms/FormCitation.C (connect): remove max size
limitation.
(update): sort list of bibliography keys.
* src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
setSize): removed.
No max size limitation. Same popup for new and existing insets. Fixes
bugs reported by Rob Lahaye.
* src/frontends/xforms/FormCitation.C (c-tor):
* src/frontends/xforms/FormCopyright.C (c-tor):
* src/frontends/xforms/FormError.C (c-tor):
* src/frontends/xforms/FormGraphics.C (c-tor):
* src/frontends/xforms/FormIndex.C (c-tor):
* src/frontends/xforms/FormRef.C (c-tor):
* src/frontends/xforms/FormToc.C (c-tor):
* src/frontends/xforms/FormUrl.C (c-tor):
use correct policy for ButtonController.
* src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
call a little.
* src/frontends/xforms/forms/form_citation.fd: some resizing changes.
* src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
Some resizing changes.
2000-11-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* configure.in: fix typo
* lib/languages: add ukraninian and change no to no_NO
* src/lyxfont.[Ch] (setGUISize): comment out setGUISize
* src/bufferview_funcs.C (FontSize): use setLyXSize
2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
* acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
to check for systems where mkstemp() is available but not declared
in headers. The new autoconf macro lyx_CHECK_DECL can be used
to check for declarations in headers.
2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
* forms/bibforms.fd: tiny fix to get it to run with fdesign.
* forms/makefile: added bibforms.fd, include_form.fd.
Removed lyx_sendfax.fd.
* src/LaTeXLog.C (ShowLatexLog):
* src/LyXAction.C (init):
* src/bufferparams.C (readLanguage): altered messages as suggested by
John Levon.
* src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
Dialogs::redrawGUI.
* src/credits.C: made fd_form_credits non-static, so that it can be
redrawn should the xforms colors be re-mapped.
* src/spellchecker.C ditto fd_form_spell_options.
* src/filedlg.[Ch] (redraw):
* src/intl.[Ch] (redraw):
* src/lyxfr0.[Ch] (redraw):
* src/insets/figinset.[Ch] (redraw):
* src/insets/insetexternal.[Ch] (redraw):
new methods, connected to Dialogs::redrawGUI.
* src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
to be connected to Dialogs::redrawGUI.
* src/frontends/xforms/FormCitation.C (build):
* src/frontends/xforms/FormCopyright.C (build):
* src/frontends/xforms/FormError.C (build):
* src/frontends/xforms/FormGraphics.C (build):
* src/frontends/xforms/FormIndex.C (build):
* src/frontends/xforms/FormTabularCreate.[Ch] (update):
* src/frontends/xforms/FormToc.C (build):
* src/frontends/xforms/FormUrl.C (build):
use the ButtonController correctly.
* src/frontends/xforms/FormCopyright.C (build):
* src/frontends/xforms/forms/form_copyright.fd: moved the text out of
the .fd file and into build().
* src/frontends/xforms/FormPreferences.C: tiny clean-up.
* src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
* src/frontends/xforms/forms/form_citation.fd:
* src/frontends/xforms/forms/form_copyright.fd:
* src/frontends/xforms/forms/form_error.fd:
* src/frontends/xforms/forms/form_graphics.fd:
* src/frontends/xforms/forms/form_index.fd:
* src/frontends/xforms/forms/form_toc.fd:
* src/frontends/xforms/forms/form_url.fd:
renamed some of the objects. Named others explicitly for the first time.
Added Restore and Apply buttons where appropriate.
* src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
used.
2000-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/version.h: try the pre2 again
2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
* src/frontends/kde/FormParagraph.C: added using directive.
* src/frontends/kde/paradlg.C: added config.h and using directive.
* src/frontends/kde/paradlg.h: added std::qualifier.
* src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
2000-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* configure.in (AC_OUTPUT): don't output src/xtl/Makefile
* src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
2000-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/version.h: set back to 1.1.6cvs
2000-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/version.h: set to 1.1.6pre2
2000-11-20 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
* src/frontends/gnome/Makefile.am: updated list of XForms object files
2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
* src/LColor.C (init):
* src/lyxrc.C (getDescription): changed some comments as suggested by
John Levon.
* src/frontends/xforms/FormBase.[Ch]: modified to connect and
disconnect the redrawGUI signal in best-practice fashion.
* src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
long_opts_tab to reflect the change in name of this tabfolder, as
suggested by John Levon.
(connect, disconnect): new methods. Don't do much at present other than
ensuring that we can't resize the dialog. This just makes xforms go
crazy.
(lots of methods in Colors): made void rather than bool. The idea is
to have an isOk() function that keeps track of whether any input is
genuinely invalid and should therefore block Save, Apply.
Easier to manipulate the counters rapidly.
(Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
compiler will like this code. Much cleaner way of doing things.
* src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
* src/frontends/xforms/forms/form_preferences.fd: used normal counters
rather than simple counters, following suggestion by John Levon.
* src/frontends/xforms/forms/form_print.fd: used labelframe rather
than engraved frame + text.
* src/frontends/xforms/forms/makefile: removed spurious command.
2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
* src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
array.
* src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
ReadOnly|NoBuffer.
* src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
* src/frontends/xforms/FormPreferences.C: re-formatted so that I can
see what Lars has changed and what is just white space!
Now used X directly to ascertain the RGB color associated with the
color name.
Replaced the RGB sliders with HSV equivalent. Should be more intuitive
to use.
Added some sort capability.
The X11 color name database input is only displayed if the database
isn't found in the standard place.
Got rid of struct compare_converter; it wasn't used.
Probably some other stuff that I've forgotten.
* src/frontends/xforms/FormPreferences.h: changed the names of some
methods in the Colors struct. Added a couple of structs to help sort
colors by name and by RGBColor.
* src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
functions into a new class RWInfo.
* src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
The dialog is now almost navigable using the keyboard. Unfortunately,
the cursor has to be inside a browser for it to be activated. There is
no visual feedback for the key shortcuts to the arrow keys (use
Alt-appropriate arrow key, Alt-x).
* src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
around a lot.
* src/support/filetools.[Ch]: moved out ReadableFile etc and into
xform_helpers.[Ch]. See above.
2000-11-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
* src/screen.C (setCursorColor): new method. Sets the color of the
cursor.
(ShowManualCursor): call it.
Constify some local variables.
* src/LColor.[Ch] (LColor): add entry for cursor
* lib/configure(.m4) (word_to_latex_command): add quotes, removes
a warning.
2000-11-19 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (draw): fixed text border redraw problem.
(calculate_dimensions_of_cells): try to boost up when inserting chars.
2000-11-15 Rob Lahaye <lahaye@postech.edu>
* lib/ui/default.ui: OptItem used for Fax entry
2000-11-17 Matej Cepl <cepl@bigfoot.com>
* lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
2000-11-15 John Levon <moz@compsoc.man.ac.uk>
* src/vspace.C (nextToken): fix so it can handle length phrases like
"10mm+-20mm", "40inplus16mmminus10cm" etc.
2000-11-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/xforms/FormPreferences.C: constify several variables
(BrowserLyX): rewrite to not need the choice variable
(Modify): rewrite to not need the choide variable
(compare_converter): make operator const
* src/lyxrc.C (output): be a bit nicer og os usage, and try to
correct the writing of \set_color
(getDescription): return a const string
* src/kbsequence.[Ch] (addkey): remove dead code
* src/Painter.C (text): remove some commented code
2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
* src/ColorHandler.[Ch]: removed some header files from .h file.
Included LColor.h in .C file.
* src/LColor.[Ch]: made class copyable so that I could create a
system_lcolor instance.
* src/Painter.h: removed LColor.h.
* src/lyx_gui.C (create_forms): used AddName.
* src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
of user preferences/lyxrc file.
* src/lyxrc.C (output): output changes to lcolor.
* src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
NamedColor.
Moved class xformColor to files xform_helpers.[Ch]. These files,
Color.[Ch], could now be moved into src if they would be useful to
other GUIs.
* src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
Also moved FormPreferences::browseFile here as it can be used by any
xform dialog with a "Browse" button. FormGraphics is a perfect example.
* src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
ReadableFile): changed the FormPreferences methods a little and moved
them here as they'll be useful elsewhere also.
* src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
Removed some header files and used forward declarations instead.
Better commenting.
Removed some methods as they'll be useful elsewhere (see above).
* src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
Can also now modify the LyX LColors. However, for reasons that I don't
yet understand, it appears that we can use
LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
present. The problem appears to lie in ColorHandler, because I can
change the color using LColor.SetColor(). Similarly, when reading in a
preferences file with some set_color instances, I'll get a warning
like: Color sea green is undefined or may not be redefined
Bad lyxrc set_color for sea green
Once the buffer is loaded, however, I can happily change to this color.
Finally, it appears that I have to set the color of "inset frame"
explicitly, or it oscillates from "black" to "indian red" with each
successive "Apply".
2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
* ANNOUNCE: corrected a spelling mistake.
* src/tabular.C (OldFormatRead): variable "h" was set but never used.
Removed.
2000-11-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
* lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
distdir.
* src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
match the requirements from the standard better. This is required
to work with gnu libstdc++-v3
* src/frontends/xforms/FormPreferences.C: add explict pair
arguments to browse calls. include support/lyxmanip.h remvoe
extern fmt. whitespace changes. reorder variables in
FormPreferences.h, to match initalizaton order.
* several files: constify more local variables.
* src/buffer.C: remove some commented functions.
* src/DepTable.C (remove_files_with_extension): temporary
work around for gcc 2.97
* src/filedlg.C (find): ditto
* src/Variables.C (set): ditto
* src/LyXAction.C (searchActionArg): ditto
(retrieveActionArg): ditto
* configure.in: check for mktemp too
* UPGRADING: prepare for 1.1.6
* Makefile.am (lgbtags): add backup tags for when etags are
different than usual.
* ANNOUNCE: prepare for 1.1.6
* src/support/tempname.C (make_tempfile): new function, wrapper
around mkstemp and mktemp. Only mkstemp has been tested.
(tempName): call it.
2000-11-14 Rob Lahaye <lahaye@postech.edu>
* default.ui: capitalized some menu items to improve shortcuts.
2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormPreferences.C (ok): use AddName().
* src/frontends/xforms/Dialogs.C: add "using" directive.
2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
* src/filedlg.C (Select): highlight suggested file in browser, if
it is present.
* src/frontends/xforms/FormPreferences.[Ch]: re-written so that
each tab folder is encapsulated in its own class.
The Language keymaps are now chosen using a text input and a
browser button, rather than a Combox.
All the browser buttons are now functional, although LyXFileDlg
still needs to be modified to make it straighhtforward to return a
directory if that is what is desired.
* src/frontends/xforms/forms/form_preferences.fd: use text input
and browse button to input the Language keymaps. Add a few
callbacks for the browse buttons.
2000-11-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/tempname.C (tempName): small changes to make it
safer. remove the '.' before XXXXXX
* src/support/filetools.C (TmpFileName): remove func
(GetCWD): ditto
* src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
* src/frontends/xforms/FormUrl.C (FormUrl): ditto
* src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
* src/frontends/xforms/FormTabular.C (FormTabular): ditto
* src/frontends/xforms/FormInset.h (FormInset): remove default for bp
(FormCommand): ditto
* src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
call the bp
* src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
for bp (this fixes a reproducible hard crash)
* src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
call the bp
* src/frontends/xforms/FormBase.h: make bp_ private
(FormBaseBI): remove default for bp
(FormBaseBD): ditto
* src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
is safe enough.
* src/frontends/xforms/Color.C (RGBColor): made several vars
const, changed initialization of j to allow it to be const
(HSVColor): similar
* several files: added const to local variables.
* src/lyx_cb.C: removed several function prototypes and moved them
to lyx_cb.h
(MenuWrite):
(MenuWriteAs):
(UpdateLayoutPreamble):
(MenuLayoutSave):
(MenuInsertLabel): add BufferView as arguemnt
(LayoutsCB): make tmp const
* src/layout_forms.h: regenerated
* src/debug.C: add Debug::FILES
(showLevel) (showTags): translate the desc
* src/debug.h: add FILES as debug target
* src/bufferlist.C: use current_view as an interim measure becuase
of added arguments to MenuWrite and MenuWriteAs
* forms/layout_forms.h.patch: make the patch more correct and more appalyable
* config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
string.
(LYX_PROG_CXX): change 2.97 rules to include the -f.. that
libstdc++ is compiled with.
2000-11-13 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
* lib/layouts/docbook-book.layout
* lib/layouts/docbook.layout
* lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
those paragraphs are expresse as SGML comments <!-- -->.
* src/LaTeXFeatures.h
* src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
parameter, this allows to express all the include files as relative
paths to the master buffer. The verbatim insert works as the other
include file modes.
* src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
is a SGML comment.
(MakeLinuxdocFile) (MakeDocBookFile): included files are relative
to master path.
(MakeDocBookFile): top_element is always written. Some clean up, as
sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
* src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
(DocBook) added close tag to inlinegraphics trick for verbatim. Now
a reference is written instead of the name.
(Validate): use the relative path for the filename.
* src/insets/insetlabel.C (DocBook): write end tag, for XML
compatibility.
* src/support/filetools.h
* src/support/filetools.C (IsSGMLFilename): added.
(BasePath): added.
2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
* development/OS2/quick_fix.patch:
* lib/configure.cmd:
* README.OS2: quick update to the OS/2 port.
2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/converter.C: add "using" directive.
* src/frontends/xforms/FormPreferences.C: add "using" directive.
(compare_converter): add "int" as return type.
* src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
too.
2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
* src/lyx_gui.C (create_forms): map the xform colours, should a
mapping exist. Ie, call XformColor::read().
* src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
and struct HSV as HSVColor.
(XformColor::read, XformColor::write) : new methods that
input/output any changes to the cform GUI colors.
* src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
included.
* src/frontends/xforms/FormPreferences.C Lots of little changes
associated with the changed name of the RGB and HSV structs. Can
now save changes to xforms GUI to file. Commented out
FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
used currently anyway.
2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
* src/converter.C: A lot of changes:
- It is no longer possible to choose between two or more ways to
export to some format (the new code uses only the shortest path).
However, it is still possible to choose between pdflatex/ps2pdf
for creating a PDF file, by defining two PDF formats: pdf & pdf2.
- Added several methods that makes the FormPreferences code simpler.
- Changed the tokens $$FName and $$OutName to $$i and $$o.
* src/exporter.C (Export): lyxrc.use_pdf is set before
makeLaTeXFile is called. This works but not very nice.
* src/frontends/xforms/FormPreferences.C: The formats/converters
tabs are now fully functional.
* src/buffer.C (getTocList): Add numbers to the captions.
* lib/lyxrc.example: Removed fax section
* src/support/rename.C (rename): Delete the old file if lyx::copy
is called.
2000-11-13 Rob Lahaye <lahaye@postech.edu>
* lib/ui/default.ui: minor polishing.
2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Color.C: include <algorithm> and <cmath>
headers.
* lib/Makefile.am (DOCINST): do not install everything in the
documentation directory.
2000-11-10 John Levon <moz@compsoc.man.ac.uk>
* src/bufferlist.C (newFile): set the filename to the constructed
newfileXX.lyx
* src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
constructed "newfileXX.lyx" name to the dialog
* src/frontends/DialogBase.h: make update() non-abstract so
KDE doesn't need to implement two update methods for every form
* src/frontends/kde/Makefile.am: add missing xforms objects
to compile again
* src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/Color.[Ch]: new files, defining the color
structs RGB and HSV. May not be the best place for these files.
Perhaps move them into src ?
* src/frontends/xforms/Makefile.am: added new files.
* src/frontends/xforms/forms/form_preferences.fd:
* src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
replaced all instances of "colour" with "color"!
* src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
slightly yet again.
* src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
tab. Can now alter the colors of the xform's GUI on the fly. With
the aid of a single static Signal (see below), can "Apply" these
changes to all currently open dialogs. (Well, to all of the NEW
dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
subsequently opened dialogs will, of course, also have the new
color scheme. Cannot yet save (or load) the choices to file, so
they are lost when exiting LyX.
* src/frontends/Dialogs.h:
* src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
Used to trigger a redraw of any dialogs connected to it because,
for example, the GUI colours have been re-mapped.
* src/frontends/xforms/FormBase.[Ch]:
* src/frontends/xforms/FormDocument.[Ch]:
* src/frontends/xforms/FormParagraph.[Ch]:
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
method, to be connected to Dialogs::redrawGUI. Method must be
virtual, because dialogs with tabbed folders need to redraw the
forms of each tab folder.
* src/LyXView.C (d-tor):
* src/frontends/xforms/FormBase.C (d-tor): connected
Dialogs::redrawGUI signal to redraw().
* src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
removed Assert, because it is identical to that in FormBase.
2000-11-10 Rob Lahaye <lahaye@postech.edu>
* lib/ui/default.ui: minor polishing.
2000-11-10 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (resizeLyXText): check !cache[bv]
(deleteLyXText): ditto
* src/insets/insettabular.C (InsetButtonPress): don't clear the
selection on mouse-button-3.
* src/insets/insettabular.h: new function clearSelection(), use this
functions inside insettabular.C.
* src/insets/insettabular.C (TabularFeatures): clear the selection
on remove_row/column.
* src/insets/inset.C (scroll): fixed some scroll stuff.
* src/insets/insettabular.C (draw): fixed another minor draw problem.
2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/CREDITS: add Yves Bastide
2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
* config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
check whether C library functions are in the global namespace.
* configure.in: calls it.
* src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
#ifndef __GLIBCPP__.
2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
* src/frontends/xforms/FormPreferences.C (updateLanguage): Check
iterators to prevent crash.
2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
* src/converter.h (getprettyname, getFromToPrettyname): new methods.
* src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
shortcut for xforms CB to the preemptive or post-handler function.
* src/frontends/xforms/forms/form_preferences.fd (form_preferences):
removed the HIDDEN_TIMER as it's no longer used.
Various other small changes.
* src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
preemptive handler to obtain feedback, rather than the post-handler.
(ColoursLoadBrowser): find "black" and "white" based on RGB values
rather than name.
Formats tab is now complete. Converters tab is nearly so.
2000-11-09 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (~InsetText):
(clear):
(Read):
(SetParagraphData): set cache.second to 0 after deleting it!
(getLyXText): check if cache.second is not 0 if finding it.
2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
lyxlex to parse the rgb.txt file.
* src/lyxlex.[Ch]:
* src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
replace the default '#' comment character.
* src/support/tempname.C: add "using" directive
* src/frontends/ButtonPolicies.C: ditto.
* src/support/filetools.C (DirList): add an explicit cast to avoid
a compile error (probably not the right fix)
2000-11-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/filetools.C (DirList): implement using system functions
* src/support/tempname.C: new file
* src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
* src/insets/insetexternal.C (InsetExternal): use lyx::tempName
* src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
lyx::tempName
* src/frontends/xforms/ButtonController.C: new file
* src/os2_defines.h: remove getcwd define
* src/lyxvc.C: include support/lyxlib.h
(showLog): use lyx::tempName
* src/lyx_cb.C: comment out includes that we don't need
(AutoSave): use lyx::tempName
* src/filedlg.C: include support/lyxlib.h
(Reread): use lyx::getcwd
* src/converter.C: include support/filetools.h
(add_options): change to static inline, make tail const
(Add): make old_viewer const
(GetAllFormats): make it a const method, use const_iterator
(enable): make static inline
(SplitFormat): make using_format const
* src/LaTeX.C (run): use lyx::getcwd
* configure.in: check for mkstemp as well
2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/converter.[Ch] (GetAllCommands): new method.
* src/support/filetools.[Ch] (DirList): new method.
* src/frontends/xforms/FormPreferences.C: started (just!) adding
functionality to the converters tab.
The formats tab is now nearly complete.
The kbmap choices in Languages tab now display the contents of
system_lyxdir/kbd/*.kmap in readable form.
* src/frontends/xforms/FormPreferences.h: made struct RGB private.
Moved some variables into the class.
* src/frontends/xforms/forms/form_preferences.fd: Revert colour of
inactive tab folder to FL_COL1. Haven't yet worked out how to change
colour of active folder to lighter grey instead. Any takers?
(form_colours): added an "Apply" button.
(form_converters): added a "Flags" input field.
(form_formats): added a "Shortcut" input field. Note that we can't use
names such as "input_shortcut" as this buggers up the sed script stuff.
2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/LaTeXLog.C:
* src/LyXSendto.C:
* src/credits.C:
* src/filedlg.C:
* src/intl.C:
* src/lyx_cb.C:
* src/lyx_sendfax_main.C:
* src/lyxfr0.C:
* src/lyxvc.C:
* src/spellchecker.C:
* src/insets/figinset.C:
* src/insets/insetbib.C:
* src/insets/insetexternal.C:
* src/insets/insetinclude.C:
* src/insets/insetinfo.C:
* src/mathed/math_panel.C:
use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
all "daughter" dialogs now have identical "feel".
2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
used (and was only used in one place prior to this patch. Incorrectly!)
* src/frontends/xforms/FormDocument.C: changed some instances of
FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
sense. Also added fl_set_input_return() for class_->input_doc_extra and
for options_->input_float_placement. This fixes a bug reported by
Rob Lahaye.
* src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
functionality into d-tor.
* src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
input of numerals also.
* src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
fl_set_form_atclose(). Can now close dialog from window manager,
fixing a bug reported by Rob Lahaye.
2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
are no longer dark. Haven't yet worked out how to lighten the colour of
the active tabfolder. Any ideas anybody?
Adjusted Colours tab a little.
Added Shortcut field to converters tab. Note that we can't create an
fdesign label like "input_shortcut" as this buggers up the sed-script
stuff.
* src/frontends/xforms/FormPreferences.[Ch]:
(feedback): fixed crash due to to ob=0.
(LanguagesXXX): the kbmap choices now contain the files
sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
be replaced by an input with a file browse button, but since the browse
buttons don'y yet work, this'll do for the moment.
(FormatsXXX): think that this is now nearly fully functional.
Some points/questions though:
1. Does "Apply" remove formats if no longer present?
2. I think that the browser should list the GUI names rather than the
format names.
3. Must ensure that we can't delete Formats used by an existing
Converter.
* src/support/filetools.[Ch] (DirList): new function. Not at all sure
if this is the best way to do this.
2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
* lib/configure.m4 (latex_to_html_command): avoid spaces around =
for variable assignment.
2000-11-07 Rob Lahaye <lahaye@postech.edu>
* src/lib/ui/default.ui: added sub/superscripts to menu as
Insert->Special characters and cleaned-up the file a bit
2000-11-07 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormPreferences.C (feedback): make sure
ob isn't 0 before using it. See comments in function.
* src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
* src/frontends/xforms/form_*.C: regenerated
2000-11-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
* config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
compiling with gcc-2.96
2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/lyxstring.C: add a couple "using" directives.
* src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
a .c_str() here too for good measure.
* src/Spacing.C (set): ditto.
* src/lyxfunc.C (Dispatch): ditto.
* src/insets/insettabular.C (copySelection): change .str() to
.str().c_str() to fix problems with lyxstring.
* src/support/filetools.C (GetFileContents): ditto.
* src/buffer.C (asciiParagraph): ditto.
* src/paragraph.C (String): ditto.
* lib/bind/fi_menus.bind: change symbol-insert to math-insert.
* lib/bind/sciword.bind: ditto.
* src/LyXAction.C (init): remove "symbol-insert" function, which
shared LFUN_INSERT_MATH with "math-insert".
* lib/configure.m4: == is not a valid operator for command test.
* src/lyxrc.C: add using directive.
* src/converter.h: add std:: qualifier.
2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
* src/converter.[Ch] and other files: Change the Format class to a
real class, and create two instances: formats and system_format.
* src/lyxrc.C (output): Output the difference between formats and
system_formats.
* src/frontends/xforms/FormPreferences.C (input): Simplify.
(buildFormats): Insert formats into browser.
(inputFormats): Made the browser and add button functional.
(applyFormats): Update formats from format_vec.
* src/converter.C: Changed all (*it). to it->
(Format::dummy): New method.
(Format::importer): New format flag.
(Formats::GetAllFormats): New method.
(Formats::Add): Delete format from the map if prettyname is empty.
(Converter::Convert): Print an error message if moving the file fails.
(Converter::GetReachableTo): New method
* src/MenuBackend.[Ch]: Add support for importformats tag.
* src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
* lib/configure.m4: Add word->tex and ps->fax converters.
* lib/ui/default.ui: Use ImportFormats on file->import menu.
Return fax to file menu.
* NEWS: Updated.
2000-11-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
(operator!): ditto
* src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
the use of FileInfo
* src/lyxfunc.C (processKeyEvent): removed
* src/bufferlist.C (emergencyWrite): removed the out commented
emergency write code.
* src/Makefile.am (lyx_main.o): add dep for commandtags.h
* src/LyXView.[Ch]: remove the outcommented raw_callback code
* many files: change formatting to be a bit more uniform for
if,while,for,switch statements, remove some parantesis not needed.
2000-11-03 John Levon <moz@compsoc.man.ac.uk>
* config/kde.m4: make config more robust when KDEDIR is set
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
not returned a pixmap for "math-insert".
* src/LyXAction.C (init): sort the entries a bit.
2000-11-03 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.h: added fixed number to update codes so
that update is only in one direction.
* src/insets/insettabular.C (UpdateLocal): modified a bit don't think
it matters.
* src/insets/insettext.C (InsetButtonPress): set the_locking_inset
before call to edit because of redraw.
* src/insets/insetcollapsable.C (draw): fixed clearing too much.
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/ui/default.ui: Populate "edit_float" menu
* src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
* src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
"floats-operate". The name is ugly (and the func also), but this
is just a band-aid until we switch to new insets.
2000-11-03 Rob Lahaye <lahaye@postech.edu>
* lib/ui/default.ui: update again the menu layout (fix some
shortcuts).
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/MenuBackend.h (fulllabel): new method.
* src/MenuBackend.C (checkShortcuts): new method. Checks whether
the menu shortcuts of a menu are unique and whether they
correspond to a letter of the label.
(expand): call checkShortcuts when debugging.
2000-11-03 Andre Poenitz <poenitz@HTWM.De>
* src/insets/insettext.C (InsetButtonPress): shut off warning.
2000-11-02 Lior Silberman <lior@Princeton.EDU>
* lib/examples/*.lyx : '\language default' => '\language english'
* lib/examples/it_splash.lyx : except where it should be italian
* lib/templates/*.lyx : the same
* doc/*.lyx* : the same
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/bind/menus.bind: remove the Layout menu entries, which I
somehow forgot earlier.
2000-11-03 Rob Lahaye <lahaye@postech.edu>
* lib/ui/old-default.ui: keep the old one here for reference (to
be deleted later).
* lib/ui/default.ui: update the menu layout
2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormCitation.C: made use of ButtonController.
Can now Apply to different insets without closing the dialog.
* src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
Can't actually DO anything with them yet, but I'd like a little
feedback.
* src/frontends/xforms/input_validators.[ch]
(fl_lowercase_filter): new.
2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
* src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
of MATH_CODE. This fixes a bug with math-macros in RTL text.
* src/text.C (PrepareToPrint): Show math-macros block aligned.
2000-11-02 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
on char insertion as it has already be updated by bv->updateInset().
* src/insets/insettabular.C (UpdateInsetInInset): update the inset
if an inset inside was updated.
* lib/configure.cmd: commented out fax-search code
2000-11-01 Yves Bastide <stid@acm.org>
* src/tabular.C (OldFormatRead): set tabular language to the
document's one.
2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
class names with non-letter characters (from Yves Bastide).
* lib/ui/default.ui: change Item to OptItem in import menu.
Comment out fax stuff.
* lib/configure.m4: comment out fax-related stuff.
2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
useful xforms helper functions. At present contains only formatted().
Input a string and it returns it with line breaks so that in fits
inside the label.
* src/frontends/xforms/Makefile.am: add new files.
* src/lyxrc.[Ch] (getDescription): new name for getFeedback.
* src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
punctuation.
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/forms/form_preferences.fd: No new functionality
but lots of little clean ups. Removed enum State. Make use of
formatted(). Constify lots of methods. Perhaps best of all: removed
requirement for that horrible reinterpret_cast from pointer to long in
feedbackPost().
2000-11-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
conditionalize build on xforms < 0.89
* src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
* src/lyxfunc.C (getStatus): commenout LFUN_FAX
* src/LyXAction.C (init): comment out fax
* src/lyxrc.h: comment out the fax enums
comment out the fax variables
* src/commandtags.h: comment out LFUN_FAX
* src/lyxrc.C: disable fax variables.
(read): disable parsing of fax variables
(output): disable writing of fax variables
(getFeedback): now description for fax variables
* src/lyxfunc.C: comment out MenuFax
(Dispatch): disable LFUN_FAX
* src/lyx_cb.C (MenuFax): comment out
* src/WorkArea.C: add <cctype>
(work_area_handler): better key handling, should be ok now.
for accented chars + etc
* src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
lyx_sendfax.h and lyx_sendfax_man.C
* src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
(show): don't call InitLyXLookup when using xforms 0.89
2000-11-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/trans.C (AddDeadkey): better fix, the other one could crash...
* src/support/filetools.C (GetFileContents): close to dummy change
2000-10-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/trans.C (AddDeadkey): workaround stupid compilers.
2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormDocument.C (class_update): fix setting
of two-sided document.
2000-10-31 Juergen Vigna <jug@sad.it>
* src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
* src/insets/insettabular.C (ActivateCellInset): passed the wrong
xposition to the Edit call.
2000-10-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/trans.C (AddDeadkey): cast explicitly to char.
2000-10-30 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/tabular.C (AsciiBottomHLine): simplify?
(AsciiTopHLine): simplify?
(print_n_chars): simplify
(DocBook): remove most of the << endl; we should flush the stream
as seldom as possible.
(Latex): ditto
(TeXBottomHLine): ditto
(TeXTopHLine): ditto
(Write): formatting
(write_attribute): try a templified version.
(set_row_column_number_info): lesson scope of variables
* src/support/lstrings.h (tostr): new specialization of tostr
* src/trans.C (AddDeadkey): slightly cleaner fix.
2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
* src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
'%%' in Toc menu labels.
(add_toc2): ditto
* src/insets/insetlatexaccent.C (draw): Correct rendering when
font_norm is iso10646-1.
* src/font.C (ascent): Fixed for 16bit fonts
(descent,lbearing,rbearing): ditto
2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
* src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
(getFeedback): new static method.
* src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
Now use combox rather than choice to display languages.
Feedback is now output using a new timer callback mechanism, identical
to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/minibuffer.C: fix for older compilers
2000-10-30 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (InsertInset): fixed this as the cursor
has to be Left of the inset otherwise LyXText won't find it!
* src/BufferView2.C (open_new_inset): delete the inset if it can
not be inserted.
2000-10-30 Rob Lahaye <lahaye@postech.edu>
* lyx.man: fix typo.
2000-10-29 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCitation.h
* src/frontends/gnome/FormCopyright.C
* src/frontends/gnome/FormCopyright.h
* src/frontends/gnome/FormError.C
* src/frontends/gnome/FormError.h
* src/frontends/gnome/FormIndex.C
* src/frontends/gnome/FormIndex.h
* src/frontends/gnome/FormPrint.C
* src/frontends/gnome/FormPrint.h
* src/frontends/gnome/FormRef.C
* src/frontends/gnome/FormRef.h
* src/frontends/gnome/FormToc.C
* src/frontends/gnome/FormToc.h
* src/frontends/gnome/FormUrl.C
* src/frontends/gnome/FormUrl.h
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/mainapp.C
* src/frontends/gnome/mainapp.h
* src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
changing update() to updateSlot() where appropriate
2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/forms/form_preferences.fd: added a Languagues
tab.
2000-10-28 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (draw): fixed drawing bug.
* src/insets/insettext.C (clear):
(Read):
(SetParagraphData): clearing the TEXT buffers when deleting the
paragraphs used by it.
* src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
* src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
2000-10-27 Juergen Vigna <jug@sad.it>
* src/tabular.C (~LyXTabular): removed not needed anymore.
* src/tabular.h: changed rowofcell and columnofcell to vector<int>
(from Andre).
2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/Dialogs.h: remove hideTabular signal as it is no
longer used.
* src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
size.
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/forms/form_preferences.fd: lots and lots!
Reorganised as modules based on tabs. Much easier to follow the
flow and to add new tabs. Added warning and feedback messages.
Added new tabs.
2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/tabular.h (DocBook): add std:: qualifier.
2000-10-26 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
* src/buffer.h (SimpleDocBookOnePar): becomes public and const.
* src/buffer.C (SimpleDocBookOnePar): this method goes const.
* insettabular.h
* insettabular.C (DocBook): uses the tabular methods to export
docbook
* src/insets/insettext.h
* src/insets/insettext.C (DocBook): Implemented export for docbooc.
2000-10-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/ButtonPolicies.h (operator<<): reinsert for State
and SMInput
* src/lyxfunc.C (MenuNew): lessen the scope of fname
moved misplaced AllowInput two lines up.
* src/buffer.C (readFile): compare float with float, not with int
2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/minibuffer.C: add "using SigC::slot" statement.
2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/forms/README: updated section about make.
* src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
Tidied some forms up, made two of form_tabular's tabs more
self-consistent, fixed Jean-Marc's size problem in form_preferences,
fixed translation problem with "Column".
2000-10-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/minibuffer.h: use Timeout instead of the xforms timer
object.
(setTimer) rewrite for the Timeout, change to unsigned arg
(set): change to unsigned timer arg
(TimerCB): remove
* src/minibuffer.C (TimerCB): removed func
(C_MiniBuffer_TimerCB): removed func
(C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
(peek_event): use a switch statement
(add): don't use fl_add_timer.
(Set): rewrite to use the Timeout
(Init): ditto
* src/Timeout.[Ch] (setType): return a Timeout &
(setTimeout): ditto, change to unsigned arg for timeout
2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
* src/mathed/formula.C (mathed_string_width): Use string instead
of a constant size char array.
2000-10-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/ButtonPolicies.h: remove the LOstream and remove
the two recently added operator<< for SMInput and State.
* src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
SMI_TOTAL to int.
(OkCancelPolicy): ditto
(OkCancelReadOnlyPolicy): ditto
(NoRepeatedApplyReadOnlyPolicy): ditto
(OkApplyCancelReadOnlyPolicy): ditto
(OkApplyCancelPolicy): ditto
(NoRepeatedApplyPolicy): ditto
2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
add the usual std:: qualifiers.
2000-10-25 Juergen Vigna <jug@sad.it>
* src/screen.C (ShowManualCursor): fixed another uint -> int problem.
2000-10-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/filetools.C (MakeRelPath): change some types to
string::size_type
* src/frontends/ButtonPolicies.h (operator<<): new operator for
ButtonPolicy::SMInput and ButtonPolicy::State.
* src/FontLoader.C (reset): small cleanup
(unload): small cleanup
* src/FontInfo.C (getFontname): initialize error to 10000.0
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/forms/form_preferences.fd: added spell checker,
TeX encoding and default paper size sections.
2000-10-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/xforms/FormTabularCreate.C: add missing #pragma
implementation
* src/frontends/xforms/FormError.C (disconnect): use erase() to
make the message_ empty.
(FormError): don't initialize message_ in initializer list.
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/kbd/latvian.kmap: new file from Janne P<>nk<6E>l<EFBFBD> (epa@iki.fi)
2000-10-24 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/*data.[Ch]: _("") is not
allowed
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
* src/buffer.C: removed redundant using directive.
* src/frontends/DialogBase.h: revert to original definition of
update().
* src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
stuff into two classes, one for each dialog, requires a new
element in the dialogs vector, FormTabularCreate.
* src/frontends/xforms/FormXXX.[Ch] (update): revert to original
definition.
* src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
method. Continues Allan's idea, but means that derived classes
don't need to worry about "update or hide?".
* src/frontends/xforms/FormError.C (showInset): add connection
again ;-)
* src/frontends/xforms/FormTabular.[Ch]: split into two classes,
one for each dialog. FormTabular now contains main tabular dialog
only.
* src/frontends/xforms/FormTabularCreate.[Ch]:
* src/frontends/xforms/forms/form_tabular_create.fd: the create
dialog.
* src/frontends/xforms/FormGraphics.[Ch]:
* src/frontends/xforms/forms/form_graphics.fd
* src/frontends/xforms/FormTabular.[Ch]:
* src/frontends/xforms/forms/form_tabular.fd: made daughter
classes of FormInset.
* src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
* src/frontends/xforms/Makefile.am:
* src/frontends/xforms/forms/makefile: added new files.
* src/insets/insettabular.[Ch]: removed (Dialogs *) member
variable. added Signal0 hide signal, in keeping with other GUI-I
insets.
* src/support/lstrings.h: removed redundant std:: qualifier as
it's already declared in Lsstream.h.
2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
open a new display.
(runqueue): ditto.
2000-10-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/tabular.C (Ascii): minimize scope of cell.
* src/BufferView2.C (nextWord): return string() instead of 0;
2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/converter.h: add a std:: qualifier
2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
* src/importer.[Ch]: New files. Used for importing files into LyX.
* src/lyxfunc.C (doImport): Use the new Importer class.
* src/converter.h: Add shortcut member to the Format class.
Used for holding the menu shortcut.
* src/converter.C and other files: Made a distinction between
format name and format extension. New formats can be defined using
the \format lyxrc tag.
Added two new converter flags: latex and disable.
2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/lyxlib.h: unify namespace/struct implementation.
Remove extra declarations.
* src/support/chdir.C (chdir): remove version taking char const *
argument.
* src/support/rename.C: ditto.
* src/support/lyxsum.C: ditto.
2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormBase.[Ch]:
* src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
read the xforms manual to discover that fl_set_form_minsize()/maxsize()
work only for the next call to fl_show_form(). The correct place to set
them, therefore is in connect() immediately BEFORE fl_show_form(). Now
done. FormBase also stores minw_, minh_ itself. All dialogs derived
from FormBase have the minimum size set; no more stupid crashes with
tabbed folders etc.
2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/ui/default.ui: fix shortcut for Insert->Include File.
2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
* src/support/lyxlib.h: changed second argument of mkdir to
unsigned long int (unsigned int would probably have been enough,
but...). Removed <sys/types.h> header.
* src/support/mkdir.C (mkdir): ditto.
* NEWS: update.
2000-10-19 Juergen Vigna <jug@sad.it>
* src/lyxfunc.C (MenuNew): small fix (form John)
* src/screen.C (Update): removed unneeded code.
* src/tabular.C (Ascii): refixed int != uint bug!
* src/support/lyxlib.h: added sys/types.h include for now permits
compiling, but I don't like this!
2000-10-18 Juergen Vigna <jug@sad.it>
* src/text2.C (ClearSelection): if we clear the selection we need
more refresh so set the status apropriately
* src/insets/insettext.C (draw): hopefully finally fixed draw
problems!
2000-10-12 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (draw): another small fix and make a block
so that variables are localized.
2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
* src/support/lstrings.C (lowercase, uppercase):
use explicit casts to remove compiler warnings.
* src/support/LRegex.C (Impl):
* src/support/StrPool.C (add):
* src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
(AddPath, MakeDisplayPath):
* src/support/lstrings.C (prefixIs, subst):
use correct type to remove compiler warnings.
* src/support/lstrings.[Ch] (countChar): returns string::size_type.
* src/support/lyxlib.h:
* src/support/mkdir.C (mkdir): change parameter to mode_t for
portability and to remove compiler warning with DEC cxx.
* src/support/FileInfo.[Ch] (flagRWX): ditto.
2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/minibuffer.C (peek_event): retun 1 when there has been a
mouseclick in the minibuffer.
* NEWS: updated.
2000-10-17 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/xforms/FormParagraph.C: more space above/below
fixes
2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
* src/lyxfunc.C (Dispatch): Call to showState() after insertion of
a char only if real_current_font was changed.
2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* NEWS: update somewhat for 1.1.6
* lib/ui/default.ui: clean up.
2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
* lib/CREDITS: clean up
2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
* src/combox.[Ch] (select): changed argument back to int
* src/combox.C (peek_event): removed num_bytes as it is declared but
never referenced.
* src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
modified calls to Combox::select() to remove warnings about type
conversion.
* src/insets/insetbutton.C (width): explicit cast to remove warning
about type conversion.
* src/insets/insetcite.C (getScreenLabel): use string::size_type not
size_t.
* src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
sel_pos_end, refering to cursor position are changed to
LyXParagraph::size_type.
* src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
consistent with LyXCursor::pos().
(inset_pos): changed to LyXParagraph::size_type for same reason.
* src/insets/insettext.C (resizeLyXText): changed some temporary
variables refing to cursor position to LyXParagraph::size_type.
2000-10-16 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/<various>: The Great Renaming,
add FormParagraph
2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_macro.C (MathMacroTemplate): initialize args to
0 when there are no arguments.
2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
* src/insets/insetbib.C: re-introduce current_view as a temporary fix
to segfaults when pressing Ok in InsetBibtex dialog.
2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
* forms/layout_forms.fd:
* src/layout_forms.C (create_form_form_character): small change to use
labelframe rather than engraved frame + text
* src/lyx_gui.C (create_forms): initialise choice_language with some
arbitrary value to prevent segfault when dialog is shown.
2000-10-16 Baruch Even <baruch.even@writeme.com>
* src/converter.C (runLaTeX, scanLog): Added a warning when there
is no resulting file. This pertains only to LaTeX output.
2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
* src/text.C (Backspace): Make sure that the row of the cursor is
rebreaked.
* src/lyxfunc.C (Dispatch): Call to showState() after insertion of
a char.
* src/lyx_gui.C (init): Prevent a crash when only one font from
menu/popup fonts is not found.
* lib/lyxrc.example: Add an example for binding a key for language
switching.
2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
* src/converter.C (GetReachable): Changed the returned type to
vector<FormatPair>
(IsReachable): New method
* src/MenuBackend.C (expand): Handle formats that appear more
than once
2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/support/Makefile.am
(libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
not in SOURCES.
* lib/CREDITS: add Garst Reese.
* src/support/snprintf.h: add extern "C" {} around the definitions.
* src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
* src/combox.[Ch]:
* src/frontends/xforms/FormDocument.C:
* src/frontends/xforms/Menubar_pimpl.C: small changes so that they
compile without "conversion to integral type of smaller size"
warnings.
2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
* src/text.C (GetColumnNearX): Fixed disabled code.
2000-10-13 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* configure.in (CPPFLAGS): add snprintf and vsnprintf to
AC_CHECK_FUNCS
* src/support/snprintf.[ch]: new files
2000-10-13 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/formprintdialog.C: add
file browser for selecting postscript output
* src/frontends/kde/formprintdialogdata.C:
* src/frontends/kde/formprintdialogdata.h: re-generate
correctly
2000-10-13 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/gnome/Makefile.am:
* src/frontends/kde/Makefile.am: FormCommand.C
disappeared from xforms
* src/frontends/kde/FormCitation.C:
* src/frontends/kde/FormIndex.C: read-only
correctness
2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/lyxfunctional.h (void_class_fun_t): fix name of
constructor.
* src/bufferlist.C: add using directive.
2000-10-13 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxfunctional.h: version of class_fun for void
returns added, const versions of back_inseter_fun and compare_fun
added.
2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormInset.C (showInset): fix typo.
2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* ChangeLog: cleanup.
* lib/CREDITS: update to add all the contributors we've forgotten.
I have obviously missed some, so tell me whether there were
errors.
2000-10-13 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCitation.h
* src/frontends/gnome/FormError.C
* src/frontends/gnome/FormIndex.C
* src/frontends/gnome/FormRef.C
* src/frontends/gnome/FormRef.h
* src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCopyright.C
* src/frontends/gnome/FormError.C
* src/frontends/gnome/FormIndex.C
* src/frontends/gnome/FormRef.C
* src/frontends/gnome/FormToc.C
* src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
appropriate.
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
fill the menus.
2000-10-11 Baruch Even <baruch.even@writeme.com>
* src/minibuffer.h:
* src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
to convey its real action.
* src/minibuffer.C (peek_event): Added action when mouse clicks to
clear the minibuffer and prepare to enter a command.
* src/mathed/formula.C (LocalDispatch): Changed to conform with
the rename from ExecCommand to PrepareForCommand.
* src/lyxfunc.C (Dispatch): ditto.
2000-10-11 Baruch Even <baruch.even@writeme.com>
* src/buffer.C (writeFile): Added test for errors on writing, this
catches all errors and not only file system full errors as intended.
2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
* src/lyx_gui.C (create_forms): better fix for crash with
translated interface.
2000-10-12 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/Makefile.am:
* src/frontends/kde/FormCopyright.C:
* src/frontends/kde/formcopyrightdialog.C:
* src/frontends/kde/formcopyrightdialog.h:
* src/frontends/kde/formcopyrightdialogdata.C:
* src/frontends/kde/formcopyrightdialogdata.h:
* src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
* src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
copyright to use qtarch
2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
* src/encoding.C (read): Fixed bug that caused an error message at
the end of the file.
* po/Makefile.in.in: Fixed rule for ext_l10n.h
* lib/lyxrc.example: Fixed hebrew example.
2000-10-13 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormPreferences.C (input): reworking the
checking
(build, update, apply): New inputs in various tabfolders
* src/frontends/xforms/FormToc.C: use new button policy.
* src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
dialogs that either can't use any existing policy or where it just
doesn't care.
* src/frontends/xforms/FormTabular.h: removed copyright notice that
said it was mine.
* src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
added a bool parameter which is ignored.
* src/buffer.C (setReadonly):
* src/BufferView_pimpl.C (buffer):
* src/frontends/kde/FormCopyright.h (update):
* src/frontends/kde/FormCitation.[Ch] (update):
* src/frontends/kde/FormIndex.[Ch] (update):
* src/frontends/kde/FormPrint.[Ch] (update):
* src/frontends/kde/FormRef.[Ch] (update):
* src/frontends/kde/FormToc.[Ch] (update):
* src/frontends/kde/FormUrl.[Ch] (update):
* src/frontends/gnome/FormCopyright.h (update):
* src/frontends/gnome/FormCitation.[Ch] (update):
* src/frontends/gnome/FormError.[Ch] (update):
* src/frontends/gnome/FormIndex.[Ch] (update):
* src/frontends/gnome/FormPrint.[Ch] (update):
* src/frontends/gnome/FormRef.h (update):
* src/frontends/gnome/FormToc.[Ch] (update):
* src/frontends/gnome/FormUrl.[Ch] (update):
* src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
to updateBufferDependent and DialogBase
* src/frontends/xforms/FormCitation.[hC]:
* src/frontends/xforms/FormDocument.[hC]: also removed restore()
* src/frontends/xforms/FormError.[Ch]:
* src/frontends/xforms/FormGraphics.[Ch]:
* src/frontends/xforms/FormIndex.[Ch]:
* src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
and fixed readOnly handling.
* src/frontends/xforms/FormPrint.[Ch]:
* src/frontends/xforms/FormRef.[Ch]:
* src/frontends/xforms/FormTabular.[Ch]:
* src/frontends/xforms/FormToc.[Ch]:
* src/frontends/xforms/FormUrl.[Ch]:
* src/frontends/xforms/FormInset.[Ch]:
* src/frontends/xforms/FormBase.[hC]: modifications to use the new
form of updateBufferDependent.
* src/frontends/xforms/FormBase.C (hide): only call disconnect()
if form()->visible just in case someone does stuff to the form in a
derived class.
* src/frontends/DialogBase.h (enum): removed enum since we can now use
the buttoncontroller for everything the enum used to be used for.
(update) It would seem we need to force all dialogs to use a bool
parameter or have two update functions. I chose to go with one.
I did try removing update() from here and FormBase and defining the
appropriate update signatures in FormBaseB[DI] but then ran into the
problem of the update() call in FormBase::show(). Whatever I did
to get around that would require another function and that just
got more confusing. Hence the decision to make everyone have an
update(bool). An alternative might have been to override show() in
FormBaseB[DI] and that would allow the different and appropriate
update signatures.
* src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
true == buffer change occurred. I decided against using a default
template parameter since not all compilers support that at present.
2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
army knife" by removing functionality.
(clearStore): removed. All such housekeeping on hide()ing the dialog
is to be carried out by overloaded disconnect() methods.
(dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
superceded by Baruch's neat test (FormGraphics) to update an existing
dialog if a new signal is recieved rather than block all new signals
until it is closed.
(cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
only to Inset dialogs.
(FormBaseBI, FormBaseBD): new classes derived from FormBase for
"Buffer Independent" and "Buffer Dependent" dialogs respectively.
* src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
* src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
as a base class to all inset dialogs. Used solely to connect/disconnect
the Inset::hide signal and to define what action to take on receipt of
a UpdateBufferDependent signal.
(FormCommand): now derived from FormInset.
* src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
disconnect().
* src/frontends/xforms/FormCopyright.[Ch]:
* src/frontends/xforms/FormPreferences.[Ch]:
now derived from FormBaseBI.
* src/frontends/xforms/FormDocument.[Ch]:
* src/frontends/xforms/FormParagraph.[Ch]:
* src/frontends/xforms/FormPrint.[Ch]:
now derived from FormBaseBD.
* src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
* src/frontends/xforms/FormCitation.[Ch]:
* src/frontends/xforms/FormError.[Ch]:
* src/frontends/xforms/FormRef.[Ch]:
* src/frontends/xforms/FormToc.[Ch]:
(clearStore): reworked as disconnect().
* src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
FormInset.[Ch].
2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/converter.C (runLaTeX): constify buffer argument
(scanLog): ditto.
* src/frontends/support/Makefile.am (INCLUDES): fix.
* src/buffer.h: add std:: qualifier
* src/insets/figinset.C (addpidwait): ditto
* src/MenuBackend.C: ditto
* src/buffer.C: ditto
* src/bufferlist.C: ditto
* src/layout.C: ditto
* src/lyxfunc.C: ditto
2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxtext.h (bidi_level): change return type to
LyXParagraph::size_type.
* src/lyxparagraph.h: change size_type to
TextContainer::difference_type. This should really be
TextContainer::size_type, but we need currently to support signed
values.
2000-10-11 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/FormError.h
* src/frontends/gnome/FormRef.C
* src/frontends/gnome/FormRef.h
* src/frontends/gnome/FormError.C
* src/frontends/gnome/Makefile.am
* src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
to Gnome frontend. Both dialogs use "action" area.
2000-10-12 Baruch Even <baruch.even@writeme.com>
* src/graphics/GraphicsCacheItem_pimpl.C:
* src/graphics/Renderer.C:
* src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
It now compiles.
2000-10-12 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (draw): fixed drawing bug (specifically
visible when selecting).
* development/Code_rules/Rules: fixed some typos.
2000-10-09 Baruch Even <baruch.even@writeme.com>
* src/filedlg.C (GroupCache::find): de-inlined the function, makes
compiling on egcs 1.1.2 possible.
* src/filedlg.C (comp_direntry::operator() ): ditto.
2000-08-31 Baruch Even <baruch.even@writeme.com>
* src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
Buffer parameter.
* src/frontends/xforms/FormGraphics.C: Changed the dialog to be
transient it now only gets freed when the object is destructed.
2000-08-24 Baruch Even <baruch.even@writeme.com>
* src/frontends/FormGraphics.h:
* src/frontends/FormGraphics.C: Changed to use ButtonController and
ButtonPolicies.
2000-08-20 Baruch Even <baruch.even@writeme.com>
* src/insets/insetgraphics.C:
(draw): Added messages to the drawn rectangle to report status.
(updateInset): Disabled the use of the inline graphics,
(draw): ditto.
2000-08-17 Baruch Even <baruch.even@writeme.com>
* src/frontends/support: Directory added for the support of GUII LyX.
* src/frontends/support/LyXImage.h:
* src/frontends/support/LyXImage.C: Base class for GUII holding of
images.
* src/frontends/support/LyXImage_X.h:
* src/frontends/support/LyXImage_X.C: Implementation of the Xlib
version of LyXImage, this uses the Xlib Pixmap.
* src/PainterBase.h:
* src/PainterBase.C:
* src/Painter.h:
* src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
replacement to Pixmap.
* src/insets/insetgraphics.h:
* src/insets/insetgraphics.C:
* src/graphics/GraphicsCacheItem.h:
* src/graphics/GraphicsCacheItem.C:
* src/graphics/GraphicsCacheItem_pimpl.h:
* src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
instead of Pixmap.
* src/graphics/GraphicsCacheItem.h:
* src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
another copy of the object.
* src/insets/insetgraphics.C (Clone): Changed to create a second copy
of cacheHandle, this fixed a bug that sent LyX crashing.
* src/graphics/XPM_Renderer.h:
* src/graphics/XPM_Renderer.C:
* src/graphics/EPS_Renderer.h:
* src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2000-10-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxfunc.C (processKeySym): only handle the
lockinginset/inset stuff if we have a buffer and text loaded...
* lib/Makefile.am (EXTRA_DIST): add encodings and languages
2000-10-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxfunctional.h: add operator= that takes a reference
* src/lyxserver.C (mkfifo): make first arg const
* src/layout.h: renamed name(...) to setName(...) to work around
bugs in egcs.
* src/buffer.C (setFileName): had to change name of function to
work around bugs in egcs. (renamed from fileName)
2000-10-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/translator.h: move helper template classes to
lyxfunctional.h, include "support/lyxfunctional.h"
* src/support/lyxmanip.h: add delaration of fmt
* src/support/lyxfunctional.h: new file
(class_fun_t): new template class
(class_fun): helper template function
(back_insert_fun_iterator): new template class
(back_inserter_fun): helper template function
(compare_memfun_t): new template class
(compare_memfun): helper template function
(equal_1st_in_pair): moved here from translator
(equal_2nd_in_pair): moved here from translator
* src/support/fmt.C: new file
(fmt): new func, can be used for a printf substitute when still
using iostreams ex. lyxerr << fmt("Hello %s", "J<>rgen") << endl;
* src/support/StrPool.C: add some comments
* src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
lyxfunctional.h
* src/insets/figinset.C (addpidwait): use std::copy with
ostream_iterator to fill the pidwaitlist
* src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
* src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
c_str()
* src/frontends/xforms/Menubar_pimpl.C: make several file scope
variables static
* src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
* src/frontends/xforms/FormDocument.C (build): remove c_str()
(class_update): ditto
(BulletPanel): ditto
(CheckChoiceClass): move initialization of tc and tct
* src/tabular.C: remove current_view
(OldFormatRead): similar to right below [istream::ignore]
* src/lyxlex_pimpl.C (next): add code for faster skipping of
chars, unfortunately this is buggy on gcc 2.95.2, so currently
unused [istream::ignore]
* src/lyxfunc.C: include "support/lyxfunctional.h"
(getInsetByCode): use std::find_if and compare_memfun
* src/lyxfont.C (stateText): remove c_str()
* src/lyx_main.C (setDebuggingLevel): make static
(commandLineHelp): make static
* src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
Screen* together with fl_get_display() and fl_screen
* src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
togheter with fl_get_display() and fl_screen
(create_forms): remove c_str()
* src/layout.C: include "support/lyxfunctional.h"
(hasLayout): use std::find_if and compare_memfun
(GetLayout): use std::find_if and comapre_memfun
(delete_layout): use std::remove_if and compare_memfun
(NumberOfClass): use std:.find_if and compare_memfun
* src/gettext.h: change for the new functions
* src/gettext.C: new file, make _(char const * str) and _(string
const & str) real functions.
* src/font.C (width): rewrite slightly to avoid one extra variable
* src/debug.C: initialize Debug::ANY here
* src/commandtags.h: update number comments
* src/combox.h (get): make const func
(empty): make const
(getline): make const
* src/combox.C (input_cb): handle case where fl_get_input can
return NULL
* src/bufferlist.C: add <functional>, "support/lyxmanip.h",
"support/lyxfunctional.h", remove current_view variable.
(resize): use std::for_each with std::mem_fun
(getFileNames): use std::copy with back_inserter_fun
(getBuffer): change arg type to unsigned int
(emergencyWriteAll): call emergencyWrite with std::for_each and
class_fun.
(emergencyWrite): new method, the for loop in emergencyWriteAll
has been unrolled.
(exists): use std::find_if with compare_memfun
(getBuffer): use std::find_if and compare_memfun
* src/buffer.h: add typedefs for iterator_category, value_type
difference_type, pointer and reference for inset_iterator
add postfix ++ for inset_iterator
make inset_iterator::getPos() const
* src/buffer.C: added support/lyxmanip.h
(readFile): use lyxerr << fmt instead of printf
(makeLaTeXFile): use std::copy to write out encodings
* src/Painter.C (text): rewrite slightly to avoid extra font variable
* src/MenuBackend.C (read): remove c_str(), as well as strdup and
free and the char * temp.
(hasMenu): use std::find_if and compare_memfun
(getMenu): ditto
* src/Makefile.am (lyx_SOURCES): added gettext.C
* src/LyXAction.C (retrieveActionArg): clear the arg, use
string::insert small change to avoid temporary
* src/LColor.C (getGUIName): remove c_str()
* several files: change all occurrences of fl_display to
fl_get_display()
* config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
that -pedantic is not used for gcc 2.97 (cvs gcc)
* boost/Makefile.am: begin slowly to prepare for a real boost lib
2000-10-11 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormPreferences.C (input): template path must be
a readable directory. It doesn't need to be writeable.
(build, delete, update, apply): New inputs in the various tabfolders
* src/frontends/xforms/forms/form_preferences.fd:
* src/frontends/xforms/FormPreferences.h: New tabfolder and added
several new entries to existing folders. Shuffled some existing stuff
around.
* src/frontends/xforms/forms/form_print.fd:
* src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
Should probably rework PrinterParams as well. Note that the switch to
collated is effectively the same as !unsorted so changing PrinterParams
will require a lot of fiddly changes to reverse the existing logic.
* src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
* src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2000-10-10 Allan Rae <rae@lyx.org>
* src/lyxrc.[Ch]:
* src/lyxfunc.C (Dispatch):
* src/lyx_gui.C:
* src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
member of LyXRC
* src/lyxrc.C (output): Only write the differences between system lyxrc
and the users settings.
* src/lyx_main.C:
* src/lyxrc.[Ch]: commented out noncopyable so I can keep a
system_lyxrc.
I'll rewrite this later, after 1.1.6 probably, to keep a single
LyXRC but two instances of a LyXRCStruct.
2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/Makefile.am (pkgdata_DATA): add encoding and languages
* src/tabular.h: add a few std:: qualifiers.
* src/encoding.C: add using directive.
* src/language.C: ditto.
* src/insets/insetquotes.C (Validate): use languages->lang()
instead of only language.
2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
* lib/languages: New file.
* lib/encodings: New file.
* src/language.C (Languages): New class.
(read): New method. Reads the languages from the 'languages' file.
* src/encoding.C (Encodings): New class.
(read): New method. Reads the encodings from the 'encodings' file.
* src/lyx_main.C (init): Call to LyXSetStyle() after languages
initialization.
* src/bufferparams.h and a lot of files: Deleted the member language,
and renamed language_info to language
* src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
* src/lyxfont.C (latexWriteStartChanges): ditto.
* src/paragraph.C (validate,TeXOnePar): ditto.
* src/lyxfont.C (update): Restored deleted code.
* src/frontends/xforms/FormDocument.C (build): Made the combox taller
2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
* src/BufferView_pimpl.C (buffer): cleaned up a little.
* src/insets/figinset.[Ch]:
* src/insets/insetinclude.[Ch]:
* src/insets/insetinclude.[Ch]:
* src/insets/insetparent.[Ch]:
* src/insets/insetref.[Ch]:
* src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
* src/insets/*.[Ch]:
* src/mathed/formula.[Ch]:
* src/mathed/formulamacro.C (Clone): passed Buffer const &.
* src/buffer.C (parseSingleLyXformat2Token, readInset):
* src/lyx_cb.C (FigureApplyCB):
* src/lyxfunc.C (getStatus, Dispatch):
* src/frontends/xforms/FormTabular.C: use modified c-tors to some
insets.
* src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
* src/converter.[Ch] (Formats::View):
* src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
* src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
*current_view->buffer(). This will change later, but this patch is way
big enough already!
2000-10-09 Juergen Vigna <jug@sad.it>
* src/text.C (GetRow): small fix.
* src/BufferView_pimpl.C (cursorPrevious):
(cursorNext): added LyXText parameter to function.
* src/insets/insettabular.C (LocalDispatch): activate cell inset on
keypress depending on cursor position.
2000-10-06 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (Ascii): finally call right ascii-function.
(copySelection): redone this function and also copy ascii representa-
tion to clipboard.
* src/tabular.C (Ascii):
(AsciiPrintCell):
(AsciiBottomHLine):
(AsciiTopHLine):
(print_n_chars): new functions to realize the ascii export of tabulars.
2000-10-05 Juergen Vigna <jug@sad.it>
* src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
if we don't have a buffer.
2000-10-10 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
with closing dialog. It seems that nested tabfolders require hiding
of inner tabfolders before hiding the dialog itself. Actually all I
did was hide the active outer folder.
* src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
unless there really is a buffer. hideBufferDependent is called
instead.
* po/Makefile.in.in (POTFILES.in): one little tweak to ensure
POTFILES.in stays in $(srcdir).
2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
* lib/lyxrc.example: Few changes.
2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
* src/BufferView_pimpl.C (buffer): only need one the
updateBufferDependent signal to be emitted once! Moved to the end of
the method to allow bv_->text to be updated first.
* src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
and hSignal_ with Dialogs * and BufferDependency variables.
New Buffer * parent_, initialised when the dialog is launched. Used to
check whether to update() or hide() dialog in the new, private
updateOrHide() method that is connected to the updateBufferDependent
signal. Daughter classes dictate what to do using the
ChangedBufferAction enum, passed to the c-tor.
* src/frontends/xforms/FormCitation.C:
* src/frontends/xforms/FormCommand.C:
* src/frontends/xforms/FormCopyright.C:
* src/frontends/xforms/FormDocument.C:
* src/frontends/xforms/FormError.C:
* src/frontends/xforms/FormIndex.C:
* src/frontends/xforms/FormPreferences.C:
* src/frontends/xforms/FormPrint.C:
* src/frontends/xforms/FormRef.C:
* src/frontends/xforms/FormToc.C:
* src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
c-tor.
* src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
ChangedBufferAction enum.
* src/frontends/xforms/FormParagraph.[Ch]
* src/frontends/xforms/forms/form_paragraph.fd: now derived from
FormBase.
2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/bind/cua.bind: fix a bit.
* lib/bind/emacs.bind: ditto.
* lib/bind/menus.bind: remove real menu entries from there.
* src/spellchecker.C: make sure we only include strings.h when
_AIX is defined.
2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
* src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
function. It enlarges the maximum number of pup when needed.
(add_toc2): Open a new menu if maximum number of items per menu has
reached.
2000-10-05 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/FormPrint.C: fix error reporting
* src/frontends/xforms/FormDocument.C: fix compiler
warnings
* lib/.cvsignore: add Literate.nw
2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
* buffer.C
* bufferview_funcs.[Ch]
* lyxfont.[Ch]
* text.C
* text2.C: Add support for numbers in RTL text.
2000-10-06 Allan Rae <rae@lyx.org>
* po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
to be gettext.m4 friendly again. ext_l10n.h is now
generated into $top_srcdir instead of $top_builddir
so that lyx.pot will be built correctly -- without
duplicate parsing of ext_l10n.h.
2000-10-04 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/FormCitation.C: make the dialog
behave more sensibly
2000-10-03 John Levon <moz@compsoc.man.ac.uk>
* config/kde.m4: fix consecutive ./configure runs,
look for qtarch, fix library order
* src/frontends/kde/Makefile.am: tidy up,
add Print dialog, add .dlg dependencies
* src/frontends/kde/FormPrint.C:
* src/frontends/kde/FormPrint.h:
* src/frontends/kde/formprintdialog.C:
* src/frontends/kde/formprintdialog.h:
* src/frontends/kde/formprintdialogdata.C:
* src/frontends/kde/formprintdialogdata.h:
* src/frontends/kde/dlg/formprintdialog.dlg: add
print dialog
* src/frontends/kde/dlg/README: Added explanatory readme
* src/frontends/kde/dlg/checkinitorder.pl: small perl
script to double-check qtarch's output
* src/frontends/kde/formindexdialog.C:
* src/frontends/kde/formindexdialogdata.C:
* src/frontends/kde/formindexdialogdata.h:
* src/frontends/kde/dlg/formindexdialog.dlg: update
for qtarch, minor fixes
2000-10-05 Allan Rae <rae@lyx.org>
* src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
dialogs when switching buffers update them instead. It's up to each
dialog to decide if it should still be visible or not.
update() should return a bool to control visiblity within show().
Or perhaps better to set a member variable and use that to control
visibility.
* lib/build-listerrors: create an empty "listerrors" file just to stop
make trying to regenerate it all the time if you don't have noweb
installed.
* .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
* po/Makefile.in.in (ext_l10n.h): added a rule to build
$(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
is built before src/ and ext_l10n.h isn't actually needed to build lyx.
(POTFILES.in): added a rule to build POTFILES.in. It is also now safe
to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
* autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
* src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
deleting buffer. Closes all buffer-dependent dialogs.
* src/frontends/xforms/FormBase.[Ch] (input): modified to pass
FL_OBJECT * also.
* src/frontends/xforms/FormCitation.[Ch]:
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/FormPrint.[Ch]:
* src/frontends/xforms/FormRef.[Ch]:
* src/frontends/xforms/FormUrl.[Ch]: ditto
* src/frontends/xforms/FormDocument.[Ch]:
* src/frontends/xforms/forms/form_document.C.patch:
* src/frontends/xforms/forms/form_document.fd: all input callbacks now
pass through a single input() function.
2000-10-04 John Levon <moz@compsoc.man.ac.uk>
* lib/build-listerrors: return status as OK
2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
* lib/lyxrc.example: Updated to new export code
2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
LexAlpha.
* src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
character.
* lib/layouts/amsart.layout: include lyxmacros.inc, so that
LyX-Code is defined.
* lib/layouts/amsbook.layout: ditto.
* boost/Makefile.am: fix typo.
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
Menu::expand.
(add_lastfiles): removed.
(add_documents): removed.
(add_formats): removed.
* src/frontends/Menubar.C: remove useless "using" directive.
* src/MenuBackend.h: add a new MenuItem constructor.
* src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
xforms frontend.
2000-10-04 Allan Rae <rae@lyx.org>
* lib/Makefile.am (listerrors):
* lib/build-listerrors: make $builddir != $srcdir compiles work again.
I haven't got notangle installed so Kayvan please test. The output
should end up in $builddir. This also allows people who don't have
noweb installed to complete the make process without error.
* src/frontends/xforms/FormCommand.[Ch] (showInset):
* src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
by JMarc's picky compiler.
2000-10-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insettabular.C (setPos): change for loop to not use
sequencing operator. Please check this J<>rgen.
* src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
instead of 'c'
* src/insets/insetcite.C (getScreenLabel): ditto
* src/support/filetools.C (QuoteName): ditto
(ChangeExtension): ditto
* src/BufferView_pimpl.C (scrollCB): make heigt int
* src/BufferView2.C (insertInset): comment out unused arg
* boost/Makefile.am (EXTRADIST): new variable
2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
* src/exporter.C (IsExportable): Fixed
* lib/configure.m4: Small fix
2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
* src/insets/insetbutton.C (width): Changed to work with no GUI.
* src/insets/insetbib.C (bibitemWidest): ditto.
* src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2000-10-03 Juergen Vigna <jug@sad.it>
* src/BufferView2.C (theLockingInset): removed const because of
Agnus's compile problems.
* src/insets/insettext.C (LocalDispatch): set the language of the
surronding paragraph on inserting the first character.
* various files: changed use of BufferView::the_locking_inset.
* src/BufferView2.C (theLockingInset):
(theLockingInset): new functions.
* src/BufferView.h: removed the_locking_inset.
* src/lyxtext.h: added the_locking_inset
* src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
* src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
* src/mathed/formula.C (IsMacro): declared but not referenced; removed.
* src/mathed/math_cursor.C (IsAlpha): ditto.
* src/mathed/math_inset.C (strnew): ditto.
* src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
(IMetrics): cxp set but never used; removed.
* src/insets/figinset.C (InitFigures): removed redundant for loop, now
that the variable in question has been removed also!
* src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
using the Buffer * passed to Latex(), using the BufferView * passed to
bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
* src/insets/insetinclude.C: use the Buffer * passed to Latex(),
Linuxdoc() and DocBook() rather than the stored Buffer * master.
* src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
* src/buffer.C (readInset): used new InsetBibtex c-tor
* (getBibkeyList): used new InsetBibtex::getKeys
2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
* lib/configure.m4
* lib/build-listerrors
* src/converter.C
* src/exporter.C: Add literate programming support to the export code
* src/buffer.C
* src/lyx_cb.C: Remove old literate code.
* src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
variables.
* src/lyxfunc.C (getStatus): Use Exporter::IsExportable
* src/converter.C (View, Convert): Use QuoteName.
* src/insets/figinset.C (Preview): Use Formats::View.
* lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (Dispatch): move declaration of text variable at
the top of the function, because compaq cxx complains that the
"goto exit_with_message" when the function is disabled bypasses
its initialization.
(MenuNew): try a better fix for the generation of new file names.
This time, I used AddName() instead of AddPath(), hoping Juergen
will be happier :)
2000-10-03 Allan Rae <rae@lyx.org>
* src/frontends/xforms/forms/form_preferences.fd:
* src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
nested tabfolders has begun. The old "Miscellaneous" was renamed as
"Look and Feel"->"General" but will need to be split up further into
general output and general input tabs. Current plan is for four outer
tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
stuff; "Inputs" for input and import configuration; "Outputs" for
output and export configuration; and one more whatever is left over
called "General". The leftovers at present look like being which
viewers to use, spellchecker, language support and might be better
named "Support". I've put "Paths" in "Inputs" for the moment as this
seems reasonable for now at least.
One problem remains: X error kills LyX when you close Preferences.
2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
qualifier from form()
* src/frontends/xforms/FormCitation.[Ch]:
* src/frontends/xforms/FormCopyright.[Ch]:
* src/frontends/xforms/FormDocument.[Ch]:
* src/frontends/xforms/FormError.[Ch]:
* src/frontends/xforms/FormIndex.[Ch]:
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/FormPrint.[Ch]:
* src/frontends/xforms/FormRef.[Ch]:
* src/frontends/xforms/FormToc.[Ch]:
* src/frontends/xforms/FormUrl.[Ch]: ditto.
* src/frontends/xforms/FormCitation.[Ch]:
* src/frontends/xforms/FormIndex.[Ch]:
* src/frontends/xforms/FormRef.[Ch]:
* src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
with Allan's naming policy
* src/frontends/xforms/FormCitation.C: some static casts to remove
compiler warnings.
2000-10-02 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (LocalDispatch): fixed selection code,
now you can type or do stuff inside the table-cell also when in dummy
position, fixed visible cursor.
* src/insets/insettext.C (Edit): fixing cursor-view position.
* src/lyxfunc.C (Dispatch): use * text variable so that it can
be used for equal functions in lyxfunc and insettext.
* src/text.C (GetVisibleRow): fixed a small clear_area bug.
2000-10-02 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/gnome/FormCitation.h:
* src/frontends/gnome/FormCopyright.h:
* src/frontends/gnome/FormIndex.h:
* src/frontends/gnome/FormPrint.h:
* src/frontends/gnome/FormToc.h:
* src/frontends/gnome/FormUrl.h:
* src/frontends/kde/FormCitation.h:
* src/frontends/kde/FormCopyright.h:
* src/frontends/kde/FormIndex.h:
* src/frontends/kde/FormRef.h:
* src/frontends/kde/FormToc.h:
* src/frontends/kde/FormUrl.h: fix remaining users of
support/utility.hpp
2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (linuxDocHandleFootnote): remove const modifier
from depth argument.
(DocBookHandleCaption): ditto.
(DocBookHandleFootnote): ditto.
(SimpleDocBookOnePar): ditto.
* src/frontends/xforms/FormDocument.h (form): remove extra
FormDocument:: qualifier.
* sigc++/macros/basic_signal.h.m4: remove erroneous virtual
destructor.
* sigc++/handle.h: ditto.
* src/lyx_gui_misc.C: add "using" directive.
* src/cheaders/cstddef: new file, needed by the boost library (for
compaq cxx).
2000-10-02 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (SetFont): better support.
* src/insets/insettabular.C (draw): fixed drawing of single cell.
* src/screen.C (DrawOneRow): some uint refixes!
2000-10-02 Allan Rae <rae@lyx.org>
* boost/.cvsignore: ignore Makefile as well
* src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
* src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
Left this one out by accident.
* src/frontends/xforms/FormBase.h (restore): default to calling
update() since that will restore the original/currently-applied values.
Any input() triggered error messages will require the derived classes
to redefine restore().
* src/frontends/xforms/FormDocument.C: initialize a few variables to
avoid a segfault. combo_doc_class is the main concern.
2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
* Simplify build-listerrors in view of GUI-less export ability!
2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
* src/lyx_main.C (easyParse): Disable gui when exporting
* src/insets/figinset.C:
* src/LaTeX.C
* src/converter.C
* src/lyx_gui_misc.C
* src/tabular.C: Changes to allow no-gui.
2000-10-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/utility.hpp: removed file
* src/support/block.h: removed file
* src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
and utility.hpp
* src/mathed/formula.C: add support/lyxlib.h
* src/mathed/formulamacro.C: ditto
* src/bufferparams.h: use boost/array.hpp instead of support/block.h
* src/lyxparagraph.h: ditto
* src/Makefile.am (BOOST_INCLUDES): the boost include dir
* src/frontends/Makefile.am (INCLUDES): ditto
* src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
* src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
* src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
* src/graphics/Makefile.am (BOOST_INCLUDES): ditto
* src/insets/Makefile.am (BOOST_INCLUDES): ditto
* src/mathed/Makefile.am (BOOST_INCLUDES): ditto
* src/BufferView.h: use boost/utility.hpp
* src/LColor.h: ditto
* src/LaTeX.h: ditto
* src/LyXAction.h: ditto
* src/LyXView.h: ditto
* src/bufferlist.h: ditto
* src/lastfiles.h: ditto
* src/layout.h: ditto
* src/lyx_gui.h: ditto
* src/lyx_main.h: ditto
* src/lyxlex.h: ditto
* src/lyxrc.h: ditto
* src/frontends/ButtonPolicies.h: ditto
* src/frontends/Dialogs.h: ditto
* src/frontends/xforms/FormBase.h: ditto
* src/frontends/xforms/FormGraphics.h: ditto
* src/frontends/xforms/FormParagraph.h: ditto
* src/frontends/xforms/FormTabular.h: ditto
* src/graphics/GraphicsCache.h: ditto
* src/graphics/Renderer.h: ditto
* src/insets/ExternalTemplate.h: ditto
* src/insets/insetcommand.h: ditto
* src/support/path.h: ditto
* config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
and introduce clause for 2.97.
* boost/libs/README: new file
* boost/boost/utility.hpp: new file
* boost/boost/config.hpp: new file
* boost/boost/array.hpp: new file
* boost/Makefile.am: new file
* boost/.cvsignore: new file
* configure.in (AC_OUTPUT): add boost/Makefile
* Makefile.am (SUBDIRS): add boost
2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
* src/support/lstrings.C (suffixIs): Fixed.
2000-10-01 Allan Rae <rae@lyx.org>
* src/PrinterParams.h: moved things around to avoid the "can't
inline call" warning.
* src/frontends/xforms/RadioButtonGroup.h: turned a comment
into doc++ documentation.
* src/frontends/xforms/FormCommand.[Ch]: support button policy
* src/frontends/xforms/FormRef.C: make use of button controller
* src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
cleaned up button controller usage.
* src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
* src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
use the button controller
* src/frontends/xforms/forms/*.fd: and associated generated files
updated to reflect changes to FormBase. Some other FormXxxx files
also got minor updates to reflect changes to FormBase.
* src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
(hide): made virtual.
(input): return a bool. true == valid input
(RestoreCB, restore): new
(CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
Changes to allow derived dialogs to use a ButtonController and
make sense when doing so: OK button calls ok() and so on.
* src/frontends/xforms/ButtonController.h (class ButtonController):
Switch from template implementation to taking Policy parameter.
Allows FormBase to provide a ButtonController for any dialog.
* src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
Probably should rename connect and disconnect.
(apply): use the radio button groups
(form): needed by FormBase
(build): setup the radio button groups
2000-09-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* several files: type changes to reduce the number of warnings and
to unify type hangling a bit. Still much to do.
2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/images/*: rename a bunch of icons to match Dekel converter
changes.
* src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
last parameter.
* src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
* sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
virtual destructor
* sigc++/handle.h: ditto for class Handle.
2000-09-27 John Levon <moz@compsoc.man.ac.uk>
* config/kde.m4: make Qt fail immediately if Qt2 is picked up
2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
* src/intl.C (InitKeyMapper): Correct the value of n due to the
removal of the "default" language.
* src/combox.h (getline): Check that sel > 0
2000-09-29 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
* lib/examples/docbook_example.lyx
* lib/examples/docbook_article.lyx: file renamed to avoid confusion.
* lib/layouts/docbook-book.layout: new docbook book layout.
* lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
* lib/layouts/manpage.layout: Same as above. Style SubSection removed.
* src/insets/figinset.C (DocBook):fixed small typo.
* src/insets/insetinclude.C (DocBook): new export for verbatim type.
* src/insets/insetinclude.h: string include_label doesn't need to be
mutable.
2000-09-29 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
Allow derived type to control connection and disconnection from signals
of its choice if desired.
2000-09-28 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (update): fixed cursor setting when
the_locking_inset changed.
(draw): made this a bit cleaner.
(InsetButtonPress): fixed!
* various files: added LyXText Parameter to fitCursor call.
* src/BufferView.C (fitCursor): added LyXText parameter.
* src/insets/insettabular.C (draw): small draw fix.
* src/tabular.C: right setting of left/right celllines.
* src/tabular.[Ch]: fixed various types in funcions and structures.
* src/insets/insettabular.C: ditto
* src/frontends/xforms/FormTabular.C: ditto
2000-09-28 Allan Rae <rae@lyx.org>
* src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
that the #ifdef's had been applied to part of what should have been
a complete condition. It's possible there are other tests that
were specific to tables that are also wrong now that InsetTabular is
being used. Now we need to fix the output of '\n' after a table in a
float for the same reason as the original condition:
"don't insert this if we would be adding it before or after a table
in a float. This little trick is needed in order to allow use of
tables in \subfigures or \subtables."
Juergen can you check this?
2000-09-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insettext.C (Ascii): return numer of '\n' in the text
output to the ostream.
* several files: fixed types based on warnings from cxx
2000-09-26 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/Makefile.am: fix rule for
formindexdialogdata_moc.C
* src/.cvsignore: add ext_l10n.h to ignore
* acconfig.h: stop messing with __STRICT_ANSI__
* config/gnome.m4: remove option to set -ansi
* config/kde.m4: remove option to set -ansi
* config/lyxinclude.m4: don't set -ansi
2000-09-27 Juergen Vigna <jug@sad.it>
* various files: remove "default" language check.
* src/insets/insetquotes.C: removed use of current_view.
* src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
the one should have red ears by now!
* src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
in more then one paragraph. Fixed cursor-movement/selection.
* src/frontends/xforms/FormParagraph.C: disable pagebreaks for
paragraphs inside a text inset.
* src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
text-inset if this owner is an inset.
2000-09-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/Bullet.h: changed type of font, character and size to int
* src/buffer.C (asciiParagraph): remove actcell and fname1.
* src/insets/inseturl.[Ch]:
* src/insets/insetref.[Ch]:
* src/insets/insetlabel.[Ch]: add linelen to Ascii
2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
* src/buffer.C (readFile): block-if statement rearranged to minimise
bloat. Patch does not reverse Jean-Marc's change ;-)
* src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
Class rewritten to store pointers to hide/update signals directly,
rather than Dialogs *. Also defined an enum to ease use. All xforms
forms can now be derived from this class.
* src/frontends/xforms/FormCommand.[Ch]
* src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
* src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
out of header file.
* src/frontends/xforms/forms/form_citation.fd
* src/frontends/xforms/forms/form_copyright.fd
* src/frontends/xforms/forms/form_error.fd
* src/frontends/xforms/forms/form_index.fd
* src/frontends/xforms/forms/form_ref.fd
* src/frontends/xforms/forms/form_toc.fd
* src/frontends/xforms/forms/form_url.fd: remamed callbacks
* src/frontends/xforms/forms/makefile: small change to work with DEC sh.
* src/insets/insetfoot.C: removed redundent using directive.
2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/layouts/siamltex.layout: new textclass for SIAM journals,
from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
* src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
created in the constructors in different groups. Then set() just
have to show the groups as needed. This fixes the redraw problems
(and is how the old menu code worked).
* src/support/lyxlib.h: declare the methods as static when we do
not have namespaces.
2000-09-26 Juergen Vigna <jug@sad.it>
* src/buffer.C (asciiParagraph): new function.
(writeFileAscii): new function with parameter ostream.
(writeFileAscii): use now asciiParagraph.
* various inset files: added the linelen parameter to the Ascii-func.
* src/tabular.C (Write): fixed error in writing file introduced by
the last changes from Lars.
* lib/bind/menus.bind: removed not supported functions.
* src/insets/insettext.C (Ascii): implemented this function.
* src/insets/lyxinset.h (Ascii): added linelen parameter.
* src/tabular.C (write_attribute[int,string,bool]): new functions.
(Write): use of the write_attribute functions.
* src/bufferlist.C (close): fixed reasking question!
2000-09-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/unlink.C src/support/remove.C src/support/mkdir.C:
new files use the everwhere possible.
* several files:
* src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
src/log_form.C src/lyx.C:
regenerated
* src/buffer.C (runLaTeX): remove func
* src/PaperLayout.C: removed file
* src/ParagraphExtra.C: likewise
* src/bullet_forms.C: likewise
* src/bullet_forms.h: likewise
* src/bullet_forms_cb.C: likewise
* src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
bullet_forms_cb.C
* several files: remove all traces of the old fd_form_paragraph,
and functions belonging to that.
* several files: remove all traces of the old fd_form_document,
and functions belonging to that.
* several files: constify local variables were possible.
* several files: remove all code that was dead when NEW_EXPORT was
defined
* several files: removed string::c_str in as many places as
possible.
* forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
(e): be a bit more outspoken when patching
(updatesrc): only move files if changed.
* forms/layout_forms.h.patch: regenerated
* forms/layout_forms.fd: remove form_document and form_paragraph
and form_quotes and form_paper and form_table_options and
form_paragraph_extra
* forms/form1.fd: remove form_table
* forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
the fdui->... rewrite. Update some comments to xforms 0.88
* forms/bullet_forms.C.patch: removed file
* forms/bullet_forms.fd: likewise
* forms/bullet_forms.h.patch: likewise
* development/Code_rules/Rules: added a section on switch
statements. Updated some comment to xforms 0.88.
2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (readFile): make sure that the whole version number
is read after \lyxformat (even when it contains a comma)
* lib/ui/default.ui: change shortcut of math menu to M-a.
2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/vspace.C (nextToken): use isStrDbl() to check for proper
double values.
* src/LyXView.C (updateWindowTitle): show the full files name in
window title, limited to 30 characters.
* src/support/lyxstring.C (lyxstring): fix it correctly this time.
When a number of characters has been given, we should not assume
that the string is 0-terminated.
* src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
calls (fixes some memory leaks)
* src/intl.[Ch]: add a destructor for Intl, in order to delete the
trans member on exit.
2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/converter.C (GetReachable): fix typo.
* src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
understand ',' instead of '.'.
(GetInteger): rewrite to use strToInt().
2000-09-26 Juergen Vigna <jug@sad.it>
* src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
better visibility and error-message on wrong VSpace input.
* src/language.C (initL): added english again.
2000-09-25 Juergen Vigna <jug@sad.it>
* src/frontends/kde/Dialogs.C (Dialogs):
* src/frontends/gnome/Dialogs.C (Dialogs):
* src/frontends/kde/Makefile.am:
* src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
* src/frontends/xforms/forms/makefile: added form_paragraph.fd.
* src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
* src/frontends/xforms/Makefile.am: added files for FormParagraph.
* src/frontends/xforms/FormParagraph.C:
* src/frontends/xforms/FormParagraph.h:
* src/frontends/xforms/form_paragraph.C:
* src/frontends/xforms/form_paragraph.h:
* src/frontends/xforms/forms/form_paragraph.fd: new files for the new
paragraph layout.
* src/lyxfunc.C (Dispatch): call the new layout paragraph.
* src/tabular.C (OldFormatRead): forgot to delete the temporary
Paragraph-Data after use.
* src/insets/insettext.C (LocalDispatch): don't set the layout on
non breakable paragraphs.
2000-09-25 Garst R. Reese <reese@isn.net>
* src/language.C (initL): added missing language_country codes.
2000-09-25 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (InsetText):
(deleteLyXText): remove the not released LyXText structure!
2000-09-24 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/mainapp.C
* src/frontends/gnome/mainapp.h: added support for keyboard
accelerators
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCitation.h
* src/frontends/gnome/Makefile.am
* src/frontends/gnome/pixbutton.h: completed the rewrite of
FormCitation to use "action area" in mainapp window
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
large TOC.
2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
* src/mathed/formula.C (MathFuncInset::Metrics): Use default
width/descent/ascent values if name is empty.
(mathed_string_height): Use std::max.
2000-09-25 Allan Rae <rae@lyx.org>
* src/frontends/xforms/forms/form_preferences.fd: resize to stop
segfault. This will be completely redesigned soon.
* sigc++: updated libsigc++. Fixes struct timespec bug.
* development/tools/makeLyXsigc.sh: .cvsignore addition
2000-09-23 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* several files: removed almost all traces of the old table
(tabular) code.
* src/TableLayout.C: removed file
2000-09-22 Juergen Vigna <jug@sad.it>
* src/frontends/kde/Dialogs.C: added credits forms.
* src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
* src/frontends/gnome/Dialogs.C: added some forms.
* src/spellchecker.C (init_spell_checker): set language in pspell code
(RunSpellChecker): some modifications for setting language string.
* src/language.[Ch]: added language_country code.
2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/Dialogs.h: added new signal showError.
Rearranged existing signals in some sort of alphabetical order.
* src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
FormError.[Ch], form_error.[Ch]
* src/frontends/xforms/forms/makefile: added new file form_error.fd
* src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
* src/frontends/xforms/FormBase.[Ch]: new base class for xforms
dialogs. I think that this can be used as the base to all these
dialogs.
* src/frontends/xforms/FormError.[Ch]
* src/frontends/xforms/forms/form_error.fd: new files. Xforms
implementation of InsetError dialog.
* src/insets/inseterror.[Ch]: rendered GUI-independent.
* src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
* src/frontends/kde/Makefile.am: ditto
2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
* src/mathed/math_cursor.[Ch]: Removed class members macroln and
macrobf. This fixes a bug of invisible text.
2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/doc/LaTeXConfig.lyx.in: updated.
* src/language.C (initL): remove language "francais" and change a
bit the names of the two other french variations.
* src/support/lyxstring.C (lyxstring): do not apply strlen() on a
string that may not be 0-terminated.
2000-09-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2000-09-20 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormIndex.C
* src/frontends/gnome/FormToc.C
* src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
the variable initialization to shut up the warnings
2000-09-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/table.[Ch]: deleted files
* src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
second arg.
2000-09-18 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
problems with selection. Inserted new LFUN_PASTESELECTION.
(InsetButtonPress): inserted handling of middle mouse-button paste.
* src/spellchecker.C: changed word to word.c_str().
2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
* src/Makefile.am: Add sources to lyx_SOURCES so they will be
included in the ``make dist'' tarball.
2000-09-15 Juergen Vigna <jug@sad.it>
* src/CutAndPaste.C (cutSelection): small fix return the right
end position after cut inside one paragraph only.
* src/insets/insettext.C (resizeLyXText): only reset the cursor if
we are locked as otherwise we don't have a valid cursor position!
* src/insets/figinset.C (draw): small bugfix but why is this needed???
2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/kde/FormRef.C: added using directive.
* src/frontends/kde/FormToc.C: ditto
* src/frontends/kde/formtocdialog.h: changed endl to std::endl.
* src/frontends/kde/FormRef.h: removed trailing comma from enums.
2000-09-19 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
Toc, ViewFormats, UpdateFormats, and ExportFormats.
* src/frontends/gnome/mainapp.C
* src/frontends/gnome/mainapp.h: support for menu update used
by Toc menu.
* src/frontends/gnome/mainapp.C
* src/frontends/gnome/mainapp.h: support for "action" area in the
main window. This area is used by small simple dialogs, such as
FormUrl.
* src/frontends/gnome/FormIndex.C
* src/frontends/gnome/FormIndex.h
* src/frontends/gnome/FormUrl.C
* src/frontends/gnome/FormUrl.h: rewrite to use main window action
area
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCitation.h: rewrite to use main window
action area. Only "Insert new citation" is implemented.
2000-09-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/buffer.C (Dispatch): fix call to Dispatch
* src/insets/insetref.C (Edit): likewise
* src/insets/insetparent.C (Edit): likewise
* src/insets/insetinclude.C (include_cb): likewise
* src/frontends/xforms/FormUrl.C (apply): likewise
* src/frontends/xforms/FormToc.C (apply): likewise
* src/frontends/xforms/FormRef.C (apply): likewise
* src/frontends/xforms/FormIndex.C (apply): likewise
* src/frontends/xforms/FormCitation.C (apply): likewise
* src/lyxserver.C (callback): likewise
* src/lyxfunc.C (processKeySym): likewise
(Dispatch): likewise
(Dispatch): likewise
* src/lyx_cb.C (LayoutsCB): likewise
* Makefile.am (sourcedoc): small change
2000-09-18 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/main.C (main): Don't make an empty GUIRunTime object. all
methods are static. constify a bit remove unneded using + headers.
* src/tabular.C: some more const to local vars move some loop vars
* src/spellchecker.C: added some c_str after some word for pspell
* src/frontends/GUIRunTime.h: add new static method setDefaults
* src/frontends/xforms/GUIRunTime.C (setDefaults):
* src/frontends/kde/GUIRunTime.C (setDefaults):
* src/frontends/gnome/GUIRunTime.C (setDefaults): new method
* src/mathed/math_cursor.C (MacroModeClose): don't call SetName
with strnew in arg, use correct emptystring when calling SetName.
* several files: remove all commented code with relation to
HAVE_SSTREAM beeing false. We now only support stringstream and
not strstream.
2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C: construct correctly the automatic new file
names.
* src/text2.C (IsStringInText): change type of variable i to shut
off a warning.
* src/support/sstream.h: do not use namespaces if the compiler
does not support them.
2000-09-15 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCitation.h
* src/frontends/gnome/diainsertcitation_interface.c
* src/frontends/gnome/dialogs/diainsertcitation.glade: adds
regexp support to FormCitation [Gnome].
2000-09-15 John Levon <moz@compsoc.man.ac.uk>
* acconfig.h
* configure.in: remove unused KDE/GTKGUI define
* src/frontends/kde/FormRef.C
* src/frontends/kde/FormRef.h
* src/frontends/kde/formrefdialog.C
* src/frontends/kde/formrefdialog.h: double click will
go to reference, now it is possible to change a cross-ref
after the fact
* src/frontends/kde/FormToc.C
* src/frontends/kde/FormToc.h
* src/frontends/kde/formtocdialog.C
* src/frontends/kde/formtocdialog.h: add a depth
slider
* src/frontends/kde/Makefile.am: add QtLyXView.h
to the sources list
2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/kde/FormCitation.h: added some using directives.
* src/frontends/kde/FormToc.h: corrected definition of doTree.
* src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
cerr.
* src/mathed/math_defs.h: redefine SetAlign to use string rather
than char *.
2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (pop_tag): revert for the second time a change by
Lars, who seems to really hate having non-local loop variables :)
* src/Lsstream.h: add "using" statements.
* src/support/copy.C (copy): add a bunch of std:: qualifiers
* src/buffer.C (writeFile): ditto
2000-09-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/buffer.C (writeFile): try to fix the locale modified format
number to always be as we want it.
* src/WorkArea.C (work_area_handler): try to workaround the bugs
in XForms 0.89. C-space is now working again.
* src/Lsstream.h src/support/sstream.h: new files.
* also commented out all cases where strstream were used.
* src/Bullet.h (c_str): remove method.
* remove all stuff that is irrelevant when NEW_MENUBAR is defined
* a lot of files: get rid of "char const *" and "char *" is as
many places as possible. We only want to use them in interaction
with system of other libraries, not inside lyx.
* a lot of files: return const object is not of pod type. This
helps ensure that temporary objects is not modified. And fits well
with "programming by contract".
* configure.in: check for the locale header too
* Makefile.am (sourcedoc): new tag for generation of doc++
documentation
2000-09-14 Juergen Vigna <jug@sad.it>
* src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
callback to check which combo called it and do the right action.
* src/combox.C (combo_cb): added combo * to the callbacks.
(Hide): moved call of callback after Ungrab of the pointer.
* src/intl.h: removed LCombo2 function.
* src/intl.C (LCombo): added Combox * to call and removed LCombo2
function as this can now be handled in one function.
* src/combox.h: added Combox * to callback prototype.
* src/frontends/xforms/Toolbar_pimpl.C:
* src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2000-09-14 Garst Reese <reese@isn.net>
* lib/tex/hollywood.cls changed length of parenthicals to 1.5in
moved usepackage{xxx}'s to beginning of file. Changed left margin
to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
underlining from title. Thanks to John Culleton for useful suggestions.
2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxlex_pimpl.C (setFile): change error message to debug
message.
2000-09-13 Juergen Vigna <jug@sad.it>
* src/frontends/xforms/FormDocument.C: implemented choice_class
as combox and give callback to combo_language so OK/Apply is activated
on change.
* src/bufferlist.C (newFile): small fix so already named files
(via an open call) are not requested to be named again on the
first save!
2000-09-13 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/Makefile.am
* src/frontends/kde/FormRef.C
* src/frontends/kde/FormRef.h
* src/frontends/kde/formrefdialog.C
* src/frontends/kde/formrefdialog.h: implement
cross-ref dialog
2000-09-13 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/formtocdialog.C
* src/frontends/kde/formtocdialog.h
* src/frontends/kde/FormToc.C
* src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2000-09-11 John Levon <moz@compsoc.man.ac.uk>
* src/frontends/kde/FormCitation.C: fix thinko
where we didn't always display the reference text
properly
* src/frontends/kde/formurldialog.C
* src/frontends/kde/formurldialog.h
* src/frontends/kde/FormUrl.C
* src/frontends/kde/FormUrl.h: minor cleanups
* src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
* src/frontends/kde/Makefile.am
* src/frontends/kde/FormToc.C
* src/frontends/kde/FormToc.h
* src/frontends/kde/FormCitation.C
* src/frontends/kde/FormCitation.h
* src/frontends/kde/FormIndex.C
* src/frontends/kde/FormIndex.h
* src/frontends/kde/formtocdialog.C
* src/frontends/kde/formtocdialog.h
* src/frontends/kde/formcitationdialog.C
* src/frontends/kde/formcitationdialog.h
* src/frontends/kde/formindexdialog.C
* src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2000-09-12 Juergen Vigna <jug@sad.it>
* src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
static strings.
2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
not cerr.
2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
* src/converter.C (Add, Convert): Added support for converter flags:
needaux, resultdir, resultfile.
(Convert): Added new parameter view_file.
(dvips_options): Fixed letter paper option.
* src/exporter.C (Export, BufferExtension): Added support for Docbook.
(Export, GetExportableFormats, GetViewableFormats): Added support
for Ascii.
* src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
directory!
(easyParse): Fixed to work with new export code.
* src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
directories.
* lyx-devel-export/lib/configure.m4: Changed flags of tth.
* lib/bind/*.bind: Replaced
buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2000-09-11 Juergen Vigna <jug@sad.it>
* src/lyx_gui.C (runTime): uses global guiruntime variable.
* src/main.C (main): now GUII defines global guiruntime!
* src/frontends/gnome/GUIRunTime.C (initApplication):
* src/frontends/kde/GUIRunTime.C (initApplication):
* src/frontends/xforms/GUIRunTime.C (initApplication):
* src/frontends/GUIRunTime.h: added new function initApplication.
* src/spellchecker.C (sc_accept_word): change to add_to_session.
* src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2000-09-08 Juergen Vigna <jug@sad.it>
* src/lyx_gui.C (create_forms): don't display the "default" entry as
we have already "Reset".
* src/language.C (initL): inserted "default" language and made this
THE default language (and not american!)
* src/paragraph.C: inserted handling of "default" language!
* src/lyxfont.C: ditto
* src/text.C: ditto
* src/paragraph.C: output the \\par only if we have a following
paragraph otherwise it's not needed.
2000-09-05 Juergen Vigna <jug@sad.it>
* config/pspell.m4: added entry to lyx-flags
* src/spellchecker.C: modified version from Kevin for using pspell
2000-09-01 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/Makefile.am
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCitation.h
* src/frontends/gnome/diainsertcitation_callbacks.c
* src/frontends/gnome/diainsertcitation_callbacks.h
* src/frontends/gnome/diainsertcitation_interface.c
* src/frontends/gnome/diainsertcitation_interface.h
* src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
dialog for Gnome frontend
* src/main.C: Gnome libraries require keeping application name
and its version as strings
* src/frontends/gnome/mainapp.C: Change the name of the main window
from GnomeLyX to PACKAGE
2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/Liason.C: add "using: declaration.
2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
* src/mathed/math_macro.C (Metrics): Set the size of the template
* src/mathed/formulamacro.C (Latex): Fixed the returned value
2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
* src/converter.C (add_options): New function.
(SetViewer): Change $$FName into '$$FName'.
(View): Add options when running xdvi
(Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
(Convert): The 3rd parameter is now the desired filename. Converts
calls to lyx::rename if necessary.
Add options when running dvips.
(dvi_papersize,dvips_options): New methods.
* src/exporter.C (Export): Use getLatexName() instead of fileName().
* src/frontends/Liason.C (printBuffer): Removed duplicate code by
using a call to Converter::dvips_options.
Fixed to work with nex export code.
* src/support/copy.C
* src/support/rename.C: New files
* src/support/syscall.h
* src/support/syscall.C: Added Starttype SystemDontWait.
* lib/ui/default.ui: Changed to work with new export code
* lib/configure.m4: Changed to work with new export code
* src/encoding.C: Changed latex name for iso8859_7 encoding.
2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
* src/frontends/xforms/Menubar_pimpl.C: added two using directives
so that code compiles with DEC cxx.
* src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
to work correctly! Also now supports the additional elements
neeeded by natbib.
2000-09-01 Allan Rae <rae@lyx.org>
* src/frontends/ButtonPolicies.C: renamed all the references to
PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
* src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
since it's a const not a type.
* src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2000-08-31 Juergen Vigna <jug@sad.it>
* src/insets/figinset.C: Various changes to look if the filename has
an extension and if not add it for inline previewing.
2000-08-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/ButtonPolicies.h: add a Button AllButtons.
make buttonStatus and isReadOnly be const methods. (also reflect
this in derived classes.)
* src/frontends/ButtonPolicies.C: remove sum_ and bogus_
(nextState): change to be static inline, pass the StateMachine as
a const reference
(PreferencesPolicy): remove casts
(OkCancelPolicy): remvoe casts
(OkCancelReadOnlyPolicy): remove casts
(NoRepeatedApplyReadOnlyPolicy): remove casts
(OkApplyCancelReadOnlyPolicy): remove casts
(OkApplyCancelPolicy): remove casts
(NoRepeatedApplyPolicy): remove casts
2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
* src/converter.C: added some using directives
* src/frontends/ButtonPolicies.C: changes to overcome
"need lvalue" error with DEC c++
* src/frontends/xforms/FormDocument.C (c-tor): use C callback
to WMHideCB for DEC c++
* src/frontends/xforms/Menubar_pimpl.C: added using directive
* src/frontends/xforms/forms/form_document.C.patch: use C callback
to BulletBMTableCB for DEC c++
2000-08-31 Allan Rae <rae@lyx.org>
* src/lyx_gui.C (create_forms): build combo_language2 which is part of
character dialog separately from old document dialogs combo_language.
Stops a segfault.
2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
* src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
Removed LFUN_REF_CREATE.
* src/MenuBackend.C: Added new tags: toc and references
* src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
(add_lastfiles, add_documents, add_formats): Removed the unused smn
parameter.
(add_toc, add_references): New methods.
(create_submenu): Handle correctly the case when there is a
seperator after optional menu items.
* src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
(dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
(dispatch): New code for LFUN_GOTO_PARAGRAPH.
* src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
* src/converter.[Ch]: New file for converting between different
formats.
* src/export.[Ch]: New file for exporting a LyX file to different
formats.
* src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
RunDocBook, MenuExport.
* src/lyxfunc.C (Dispatch): Use the Exporter::Export and
Exporter::Preview methods if NEW_EXPORT is defined.
* src/buffer.C (Dispatch): Use Exporter::Export.
* src/lyxrc.C: Added new tags: \converter and \viewer.
* src/commandtags.h
* src/LyXAction.C: Define new lyx-function: buffer-update.
Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
when NEW_EXPORT is defined.
* src/MenuBackend.C: Added new tags: updateformats and viewformats.
* src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
* lib/ui/default.ui: Added submenus "view" and "update" to the
"file" menu.
* src/filetools.C (GetExtension): New function.
* src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2000-08-29 Allan Rae <rae@lyx.org>
* lib/bind/xemacs.bind: update a binding due to Juergen's recent work
* src/frontends/xforms/FormDocument.C (checkReadOnly): new function
(EnableDocumentLayout): removed
(DisableDocumentLayout): removed
(build): make use of ButtonController's read-only handling to
de/activate various objects. Replaces both of the above functions.
* src/frontends/xforms/ButtonController.h (readWrite): was read_write
(readOnly): was read_only
(refresh): fixed dumb mistakes with read_only_ handling
* src/frontends/xforms/forms/form_document.fd:
* src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
tabbed dialogs so the tabs look more like tabs and so its easier to
work out which is the current tab.
* src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
segfault with form_table
* src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2000-08-28 Juergen Vigna <jug@sad.it>
* acconfig.h: added USE_PSPELL.
* src/config.h.in: added USE_PSPELL.
* autogen.sh: added pspell.m4
* config/pspell.m4: new file.
* src/spellchecker.C: implemented support for pspell libary.
2000-08-25 Juergen Vigna <jug@sad.it>
* src/LyXAction.C (init): renamed LFUN_TABLE to
LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
* src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
* src/lyxscreen.h: add force_clear variable and fuction to force
a clear area when redrawing in LyXText.
* src/text.C (GetVisibleRow): look if the screen forces a redraw.
2000-08-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* some whitespace and comment changes.
* src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
* src/buffer.C: up te LYX_FORMAT to 2.17
2000-08-23 Juergen Vigna <jug@sad.it>
* src/BufferView_pimpl.C (tripleClick): disable this when in a
locking_inset.
* src/insets/insettabular.C (pasteSelection): delete the insets
LyXText as it is not valid anymore.
(copySelection): new function.
(pasteSelection): new function.
(cutSelection): new function.
(LocalDispatch): implemented cut/copy/paste of cell selections.
* src/insets/insettext.C (resizeLyXText): don't need resize if I still
don't have a LyXText.
* src/LyXAction.C (init): a NEW_TABULAR define too much.
* src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
NEW_TABULAR define.
2000-08-22 Juergen Vigna <jug@sad.it>
* src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
ifdef form_table out if NEW_TABULAR.
2000-08-21 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
(draw): fixed draw position so that the cursor is positioned in the
right place.
(InsetMotionNotify): hide/show cursor so the position is updated.
(GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
using cellstart() function where it should be used.
* src/insets/insettext.C (draw): ditto.
* src/tabular.C: fixed initialization of some missing variables and
made BoxType into an enum.
2000-08-22 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
stock menu item using action numerical value, not its string
representation.
2000-08-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
* src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
* src/frontends/xforms/GUIRunTime.C: new file
* src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
* src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
* src/frontends/kde/GUIRunTime.C: new file
* src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
* src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
* src/frontends/gnome/GUIRunTime.C: new file
* src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
GUIRunTime.C
* src/frontends/GUIRunTime.h: removed constructor and destructor,
small change to documetentation.
* src/frontends/GUIRunTime.C: removed file
* src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
* src/lyxparagraph.h: enable NEW_TABULAR as default
* src/lyxfunc.C (processKeySym): remove some commented code
* src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
NEW_TABULAR around the fd_form_table_options.
* src/lyx_gui.C (runTime): call the static member function as
GUIRunTime::runTime().
2000-08-21 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
policy here also.
2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
* src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2000-08-21 Allan Rae <rae@lyx.org>
* src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
keep Garst happy ;-)
* src/frontends/xforms/FormPreferences.C (build): use setOK
* src/frontends/xforms/FormDocument.C (build): use setOK
(FormDocument): use the appropriate policy.
2000-08-21 Allan Rae <rae@lyx.org>
* src/frontends/xforms/ButtonController.h (class ButtonController): Allow
automatic [de]activation of arbitrary objects when in a read-only state.
* src/frontends/ButtonPolicies.h: More documentation
(isReadOnly): added to support the above.
* src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2000-08-18 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (getStatus): changed to return func_status.
* src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
display toggle menu entries if they are.
* src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
new document layout now.
* src/lyxfunc.C: ditto
* src/lyx_gui_misc.C: ditto
* src/lyx_gui.C: ditto
* lib/ui/default.ui: removed paper and quotes layout as they are now
all in the document layout tabbed folder.
* src/frontends/xforms/forms/form_document.fd: added Restore
button and callbacks for all inputs for Allan's ButtonPolicy.
* src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
(CheckChoiceClass): added missing params setting on class change.
(UpdateLayoutDocument): added for updating the layout on params.
(build): forgot to RETURN_ALWAYS input_doc_spacing.
(FormDocument): Implemented Allan's ButtonPolicy with the
PreferencesPolicy.
2000-08-17 Allan Rae <rae@lyx.org>
* src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
so we can at least see the credits again.
* src/frontends/xforms/FormPreferences.C: Used the appropriate button
controller calls for the appropriate callbacks. Note that since Ok
calls apply followed by cancel, and apply isn't a valid input for the
APPLIED state, the bc_ calls have to be made in the static callback not
within each of the real callbacks.
* src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
(setOk): renamed from setOkay()
2000-08-17 Juergen Vigna <jug@sad.it>
* src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
in the implementation part.
(composeUIInfo): don't show optional menu-items.
* src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
* src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
* src/bufferview_funcs.C (CurrentState): fixed to show also the
text-state when in a text-inset.
* src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2000-08-17 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/FormIndex.C
* src/frontends/gnome/FormIndex.h
* src/frontends/gnome/FormToc.C
* src/frontends/gnome/FormToc.h
* src/frontends/gnome/dialogs
* src/frontends/gnome/diatoc_callbacks.c
* src/frontends/gnome/diatoc_callbacks.h
* src/frontends/gnome/diainsertindex_callbacks.h
* src/frontends/gnome/diainsertindex_callbacks.c
* src/frontends/gnome/diainsertindex_interface.c
* src/frontends/gnome/diainsertindex_interface.h
* src/frontends/gnome/diatoc_interface.h
* src/frontends/gnome/diatoc_interface.c
* src/frontends/gnome/Makefile.am: Table of Contents and
Insert Index dialogs implementation for Gnome frontend
* src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
* src/frontends/gnome/Menubar_pimpl.C: remove historical comments
* src/frontends/gnome/diainserturl_interface.c: make the dialog
resizable
2000-08-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
destructor. Don't definde if you don't need it
(processEvents): made static, non-blocking events processing for
xforms.
(runTime): static method. event loop for xforms
* similar as above for kde and gnome.
* src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
new Pimpl is correct
(runTime): new method calss the real frontends runtime func.
* src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2000-08-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2000-08-16 Juergen Vigna <jug@sad.it>
* src/lyx_gui.C (runTime): added GUII RunTime support.
* src/frontends/Makefile.am:
* src/frontends/GUIRunTime.[Ch]:
* src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
* src/frontends/kde/GUIRunTime_pimpl.[Ch]:
* src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
* src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
* src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
as this is already set in ${FRONTEND_INCLUDE} if needed.
* configure.in (CPPFLAGS): setting the include dir for the frontend
directory and don't set FRONTEND=xforms for now as this is executed
always.
2000-08-16 John Levon (moz@compsoc.man.ac.uk)
* src/frontends/kde/Makefile.am:
* src/frontends/kde/FormUrl.C:
* src/frontends/kde/FormUrl.h:
* src/frontends/kde/formurldialog.h:
* src/frontends/kde/formurldialog.C: Add KDE URL dialog
2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
* src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2000-08-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/BufferView_pimpl.C (workAreaKeyPress): enable the
processKeySym
2000-08-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/WorkArea.C (work_area_handler): more work to get te
FL_KEYBOARD to work with xforms 0.88 too, please test.
* src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
* src/frontends/ButtonPolicies.C: make gcc happy when compiling with
-pedantic
2000-08-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/Timeout.h: remove Qt::emit hack.
* several files: changes to allo doc++ compilation
* src/lyxfunc.C (processKeySym): new method
(processKeyEvent): comment out if FL_REVISION < 89
* src/WorkArea.C: change some debugging levels.
(WorkArea): set wantkey to FL_KEY_ALL
(work_area_handler): enable the FL_KEYBOARD clause, this enables
clearer code and the use of compose with XForms 0.89. Change to
use signals instead of calling methods in bufferview directly.
* src/Painter.C: change some debugging levels.
* src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
if FL_REVISION < 89
* src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
(workAreaKeyPress): new method
2000-08-14 Juergen Vigna <jug@sad.it>
* src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
* config/kde.m4: addes some features
* src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
include missing xforms dialogs.
* src/Timeout.h: a hack to be able to compile with qt/kde.
* sigc++/.cvsignore: added acinclude.m4
* lib/.cvsignore: added listerros
* src/frontends/Makefile.am: modified for now to ALWAYS compile the
xforms tree as objects are needed for other frontends.
* src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
linking with not yet implemented xforms objects.
* src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2000-08-14 Baruch Even <baruch.even@writeme.com>
* src/frontends/xforms/FormGraphics.h:
* src/frontends/xforms/FormGraphics.C:
* src/frontends/xforms/RadioButtonGroup.h:
* src/frontends/xforms/RadioButtonGroup.C:
* src/insets/insetgraphics.h:
* src/insets/insetgraphics.C:
* src/insets/insetgraphicsParams.h:
* src/insets/insetgraphicsParams.C: Changed indentation to use tabs
instead of spaces, and various other indentation issues to make the
sources more consistent.
2000-08-14 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/dialogs/diaprint.glade
* src/frontends/gnome/FormPrint.C
* src/frontends/gnome/FormPrint.h
* src/frontends/gnome/diaprint_callbacks.c
* src/frontends/gnome/diaprint_callbacks.h
* src/frontends/gnome/diaprint_interface.c
* src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
implementation
* src/frontends/gnome/dialogs/diainserturl.glade
* src/frontends/gnome/FormUrl.C
* src/frontends/gnome/FormUrl.h
* src/frontends/gnome/diainserturl_callbacks.c
* src/frontends/gnome/diainserturl_callbacks.h
* src/frontends/gnome/diainserturl_interface.c
* src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
Gnome implementation
* src/frontends/gnome/Dialogs.C
* src/frontends/gnome/Makefile.am: added Print, Insert Url and
all other dialogs. Copy all unimplemented dialogs from Xforms
frontend
* src/frontends/gnome/support.c
* src/frontends/gnome/support.h: support files generated by Glade
* autogen.sh
* configure.in
* config/gnome.m4: Gnome configuration scripts
* config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
configure --help message
* src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
only if there are no events pendling in Gnome/Gtk. This enhances
the performance of menus.
2000-08-14 Allan Rae <rae@lyx.org>
* lib/Makefile.am: listerrors cleaning
* lib/listerrors: removed -- generated file
* acinclude.m4: ditto
* sigc++/acinclude.m4: ditto
* src/frontends/xforms/forms/form_citation.fd:
* src/frontends/xforms/FormCitation.C (setSize): Made the form a more
manageable size.
* src/frontends/xforms/forms/makefile: I renamed the `install` target
`updatesrc` and now we have a `test` target that does what `updatesrc`
used to do. I didn't like having an install target that wasn't related
to the dist.
* src/frontends/xforms/Form*.[hC]: Removed the free() member functions
on all except FormGraphics. This may yet happen. Followed by a major
cleanup including using FL_TRANSIENT for most of the dialogs. More
changes to come when the ButtonController below is introduced.
* src/frontends/xforms/ButtonController.h: New file for managing up to
four buttons on a dialog according to an externally defined policy.
* src/frontends/xforms/Makefile.am: added above
* src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
Apply and Cancel/Close buttons and everything in between and beyond.
* src/frontends/Makefile.am: added above.
* src/frontends/xforms/forms/form_preferences.fd:
* src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
and removed variable 'status' as a result. Fixed the set_minsize thing.
Use the new screen-font-update after checking screen fonts were changed
Added a "Restore" button to restore the original lyxrc values while
editing. This restores everything not just the last input changed.
That's still a tricky one. As is the "LyX: this shouldn't happen..."
* src/LyXAction.C: screen-font-update added for updating buffers after
screen font settings have been changed.
* src/commandtags.h: ditto
* src/lyxfunc.C: ditto
* forms/lyx.fd: removed screen fonts dialog.
* src/lyx_gui.C: ditto
* src/menus.[Ch]: ditto
* src/lyx.[Ch]: ditto
* src/lyx_cb.C: ditto + code from here moved to make
screen-font-update. And people wonder why progress on GUII is
slow. Look at how scattered this stuff was! It takes forever
just find it all.
* forms/fdfix.sh: Fixup the spacing after commas.
* forms/makefile: Remove date from generated files. Fewer clashes now.
* forms/bullet_forms.C.patch: included someones handwritten changes
* src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
once I've discovered why LyXRC was made noncopyable.
* src/lyx_main.C: ditto
2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/forms/fdfix.sh:
* src/frontends/xforms/forms/fdfixh.sed:
* src/frontends/xforms/forms/fdfixc.sed: New file from Angus
* src/frontends/xforms/Form*.[hC]:
* src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
provide a destructor for the struct FD_form_xxxx. Another version of
the set_[max|min]size workaround and a few other cleanups. Actually,
Angus' patch from 20000809.
2000-08-13 Baruch Even <baruch.even@writeme.com>
* src/insets/insetgraphics.C (Clone): Added several fields that needed
copying.
2000-08-11 Juergen Vigna <jug@sad.it>
* src/insets/insetgraphics.C (InsetGraphics): changing init
order because of warnings.
* src/frontends/xforms/forms/makefile: adding patching .C with
.C.patch files.
* src/frontends/xforms/forms/fdfix.sh: changing patching file .c
from .C.patch to .c.patch
* src/frontends/xforms/FormCommand.C (FormCommand): changing init
order because of warning.
* src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
* src/frontends/Liason.C (setMinibuffer): new helper function
* src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
* src/lyxfunc.C (Dispatch): calling new Document-Layout
* lib/ui/default.ui: commented out PaperLayout entry
* src/frontends/xforms/form_document.[Ch]: new added files
* src/frontends/xforms/FormDocument.[Ch]: ditto
* src/frontends/xforms/forms/form_document.fd: ditto
* src/frontends/xforms/forms/form_document.C.patch: ditto
2000-08-10 Juergen Vigna <jug@sad.it>
* src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
(InsetGraphics): initialized cacheHandle to 0.
(draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2000-08-10 Baruch Even <baruch.even@writeme.com>
* src/graphics/GraphicsCache.h:
* src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
correctly as a cache.
* src/graphics/GraphicsCacheItem.h:
* src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
reference counting.
* src/graphics/GraphicsCacheItem_pimpl.h:
* src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
GraphicsCacheItem.
* src/insets/insetgraphics.h:
* src/insets/insetgraphics.C: Changed from using a signal notification
to polling when image is not loaded.
2000-08-10 Allan Rae <rae@lyx.org>
* development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
that there are two functions that have to been taken out of line by
hand and aren't taken care of in the script. (Just a reminder note)
* sigc++/macros/*.h.m4: Updated as above.
2000-08-09 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (draw): small fix for clearing rectangle.
* src/insets/insettabular.C: make drawing of single cell smarter.
2000-08-09 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
implementation: new files
* src/frontends/gnome/mainapp.C
* src/frontends/gnome/mainapp.h: Gnome main window (temporary
implementation)
* src/main.C: create Gnome main window
* src/frontends/xforms/Menubar_pimpl.h
* src/frontends/Menubar.C
* src/frontends/Menubar.h: added method Menubar::update that calls
Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
* src/LyXView.C: calls Menubar::update to update the state
of menu items
* src/frontends/gnome/Makefile.am: added new files
* src/frontends/Makefile.am: added frontend compiler options
2000-08-08 Juergen Vigna <jug@sad.it>
* src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
* src/bufferlist.C (close):
* src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
documents if exiting without saving.
* src/buffer.C (save): use removeAutosaveFile()
* src/support/filetools.C (removeAutosaveFile): new function.
* src/lyx_cb.C (MenuWrite): returns a bool now.
(MenuWriteAs): check if file could really be saved and revert to the
old name if not.
(MenuWriteAs): removing old autosavefile if existant.
* src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
before Goto toggle declaration, because of compiler warning.
* src/frontends/xforms/FormRef.C: forgot include of <algorithm>
* src/lyxfunc.C (MenuNew): small fix.
* src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
* src/bufferlist.C (newFile):
* src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
* src/lyxrc.C: added new_ask_filename tag
2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/lyx.fd: removed code pertaining to form_ref
* src/lyx.[Ch]: ditto
* src/lyx_cb.C: ditto
* src/lyx_gui.C: ditto
* src/lyx_gui_misc.C: ditto
* src/BufferView_pimpl.C (restorePosition): update buffer only
if file has changed
* src/commandtags.h (LFUN_REFTOGGLE): removed
(LFUN_INSERT_REF): renamed LFUN_REF_INSERT
(LFUN_REFGOTO): renamed LFUN_REF_GOTO
(LFUN_REFBACK): renamed LFUN_REF_BACK
* src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
* src/menus.C: ditto
* src/lyxfunc.C (Dispatch): ditto.
InsertRef dialog is now GUI-independent.
* src/texrow.C: added using std::endl;
* src/insets/insetref.[Ch]: strip out large amounts of code.
The inset is now a container and this functionality is now
managed by a new FormRef dialog
* src/frontends/Dialogs.h (showRef, createRef): new signals
* src/frontends/xforms/FormIndex.[Ch],
src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
when setting dialog's min/max size
* src/frontends/xforms/FormIndex.[Ch]: ditto
* src/frontends/xforms/FormRef.[Ch],
src/frontends/xforms/forms/form_ref.fd: new xforms
implementation of an InsetRef dialog
* src/graphics/GraphicsCache.[Ch]: small changes to compile with
DEC cxx
* src/graphics/XPM_Renderer.C (isImageFormatOK):
ios::nocreate is not part of the standard. Removed.
2000-08-07 Baruch Even <baruch.even@writeme.com>
* src/graphics/Renderer.h:
* src/graphics/Renderer.C: Added base class for rendering of different
image formats into Pixmaps.
* src/graphics/XPM_Renderer.h:
* src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
in a different class.
* src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
easily add support for other formats.
* src/insets/figinset.C: plugged a leak of an X resource.
2000-08-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/CutAndPaste.[Ch]: make all metods static.
* development/Code_rules/Rules: more work, added section on
Exceptions, and a References section.
* a lot of header files: work to make doc++ able to generate the
source documentation, some workarounds of doc++ problems. Doc++ is
now able to generate the documentation.
2000-08-07 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (recomputeTextInsets): removed function
* src/tabular.C (SetWidthOfMulticolCell):
(SetWidthOfCell):
(calculate_width_of_column_NMC): fixed return value so that it really
only returns true if the column-width has changed (there where
problems with muliticolumn-cells in this column).
2000-08-04 Juergen Vigna <jug@sad.it>
* src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
also on the scrollstatus of the inset.
(workAreaMotionNotify): ditto.
* src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2000-08-01 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (resetPos): scroll tabular automatically.
* src/commandtags.h:
* src/LyXAction.C (init):
* src/insets/inset.C (LocalDispatch): added support for
LFUN_SCROLL_INSET.
* src/insets/inset.C (scroll): new functions.
* src/insets/insettext.C (removeNewlines): new function.
(SetAutoBreakRows): removes forced newlines in the text of the
paragraph if autoBreakRows is set to false.
* src/tabular.C (Latex): generates a parbox around the cell contents
if needed.
* src/frontends/xforms/FormTabular.C (local_update): removed
the radio_useparbox button.
* src/tabular.C (UseParbox): new function
2000-08-06 Baruch Even <baruch.even@writeme.com>
* src/graphics/GraphicsCache.h:
* src/graphics/GraphicsCache.C:
* src/graphics/GraphicsCacheItem.h:
* src/graphics/GraphicsCacheItem.C: Made them to actually do something
usefull.
* src/insets/insetgraphics.h:
* src/insets/insetgraphics.C: Added the use of the GraphicsCache
and the drawing of the inline image.
* src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
loaded into the wrong position.
* src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
launched.
2000-08-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/translator.h: move all typedefs to public section
* src/support/filetools.C (MakeLatexName): return string const
(QuoteName): ditto
(TmpFileName): ditto
(FileOpenSearch): ditto
(FileSearch): ditto
(LibFileSearch): ditto
(i18nLibFileSearch): ditto
(GetEnv): ditto
(GetEnvPath): ditto
(CreateTmpDir): ditto
(CreateBufferTmpDir): ditto
(CreateLyXTmpDir): ditto
(GetCWD): ditto
(OnlyPath): ditto
(MakeAbsPath): ditto
(AddName): ditto
(OnlyFilename): ditto
(ExpandPath): ditto
(NormalizePath): ditto
(CleanupPath): ditto
(GetFileContents): ditto
(ReplaceEnvironmentPath): ditto
(MakeRelPath): ditto
(AddPath): ditto
(ChangeExtension): ditto
(MakeDisplayPath): ditto
(do_popen): return cmdret const
(findtexfile): return string const
* src/support/DebugStream.h: add some /// to please doc++
* src/frontends/DialogBase.h (endif): add some /// to please doc++
* src/texrow.C (same_rownumber): functor to use with find_if
(getIdFromRow): rewritten to use find_if and to not update the
positions. return true if row is found
(increasePos): new method, use to update positions
* src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
* src/lyxlex_pimpl.C (verifyTable): new method
(pushTable): use it
(Pimpl): use it
(GetString): return string const
(pushTable): rewrite to use std::stack
(popTable): ditto
(setFile): better check
(setStream): ditto
* src/lyxlex.h: make LyXLex noncopyable
* src/lyxlex.C (text): return char const * const
(GetString): return string const
(getLongString): return string const
* src/lyx_gui_misc.C (askForText): return pair<...> const
* src/lastfiles.[Ch] (operator): return string const
* src/buffer.C (parseSingleLyXformat2Token): pass string to
istringstream not char const *.
move token.end() out of loop.
(readFile): move initializaton of token
* src/BufferView2.C (insertErrors): run texrow.increasePos if
getIdFromRow is successful.
* lib/bind/emacs.bind: don't include menus bind
* development/Code_rules/Rules: the beginnings of making this
better and covering more of the unwritten rules that we have.
* development/Code_rules/Recommendations: a couple of wording
changes.
2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/strerror.c: remove C++ comment.
2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
* src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
LFUN_INDEX_INSERT_LAST
* src/texrow.C (getIdFromRow): changed from const_iterator to
iterator, allowing code to compile with DEC cxx
* src/frontends/xforms/FormCitation.[Ch]: made vector<string>
stores part of the class, as suggested by Allan. Will allow
multiple LyXViews.
(apply): test to apply uses InsetCommandParams operator!=
* src/frontends/xforms/FormIndex.C: moved set_minsize into build
(apply): test to apply uses InsetCommandParams operator!=
* src/frontends/xforms/FormToc.[Ch]: made vector<string>
stores part of the class.
(update): removed limits on min/max size.
* src/frontends/xforms/FormUrl.C: moved set_minsize into build
(apply): test to apply uses InsetCommandParams operator!=
* src/insets/insetcommand.[Ch] InsetCommand made noncopyable
(Read, Write, scanCommand, getCommand): moved functionality
into InsetCommandParams.
(Clone): removed
(getScreenLabel): made pure virtual
new InsetCommandParams operators== and !=
* src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
c-tors based on InsetCommandParams. Removed others.
* src/insets/insetinclude.[Ch]: ditto
* src/insets/insetlabel.[Ch]: ditto
* src/insets/insetparent.[Ch]: ditto
* src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
* src/buffer.C (parseSingleLyXformat2Token, readInset): all
insets derived from InsetCommand created using similar c-tors
based on InsetCommandParams
* src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
* src/menus.C (ShowRefsMenu): ditto
* src/paragraph.C (Clone): ditto
* src/text2.C (SetCounter): ditto
* src/lyxfunc.C (Dispatch) ditto
Also recreated old InsetIndex behaviour exactly. Can now
index-insert at the start of a paragraph and index-insert-last
without launching the pop-up.
2000-08-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lib/lyxrc.example: mark te pdf options as non functional.
* src/support/lstrings.C (strToInt): move initalization of tmpstr
(isStrDbl): move tmpstr.end() out of loop.
(strToDbl): move intialization of tmpstr
(lowercase): return string const and move tmp.end() out of loop.
(uppercase): return string const and move tmp.edn() out of loop.
(prefixIs): add assertion
(suffixIs): ditto
(contains): ditto
(contains): ditto
(contains): ditto
(containsOnly): ditto
(containsOnly): ditto
(containsOnly): ditto
(countChar): make last arg char not char const
(token): return string const
(subst): return string const, move tmp.end() out of loop.
(subst): return string const, add assertion
(strip): return string const
(frontStrip): return string const, add assertion
(frontStrip): return string const
(split): ditto
(split): ditto
(rsplit): ditto
* src/support/lstrings.C: add inclde "LAssert.h"
(isStrInt): move tmpstr.end() out of loop.
* src/frontends/xforms/Toolbar_pimpl.C (activate): move
toollist.end() out of loop.
(deactivate): move toollist.end() out of loop.
(update): move toollist.end() out of loop.
(updateLayoutList): move tc.end() out of loop.
(add): move toollist.end() out of loop.
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
md.end() out of loop.
* src/texrow.h: make getIdFromRow const, make rowlist mutable.
* src/texrow.C (getIdFromRow): make const, more rowlist.end() out
of loop.
* src/paragraph.C (Erase): move fontlist.end() out of loop.
(Erase): move insetlist.end() out of loop.
* src/lyx_sendfax_main.C: make show_logfile static and to take a
ref to const string as first arg. Move initialization of some
variables, whitespace changes.
* src/kbmap.C (defkey): move table.end() out of loop.
(kb_keymap): move table.end() out of loop.
(findbinding): move table.end() out of loop.
* src/MenuBackend.C (hasMenu): move end() out of loop.
(getMenu): move end() out of loop.
(getMenu): move menulist_.end() out of loop.
* src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
* src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
out of loop.
* src/LColor.C (getFromGUIName): move infotab.end() out of loop.
(getFromLyXName): move infotab.end() out of loop.
* config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
-fvtable-thunks -ffunction-sections -fdata-sections
2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
* src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
FORMS_H_LOCATION.
2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
* src/frontends/xforms/FormCitation.[Ch],
src/frontends/xforms/FormIndex.[Ch],
src/frontends/xforms/FormToc.[Ch],
src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
* src/commandtags.h: renamed, created some flags for citation
and index
* src/lyx_gui_misc.C: stripped out old FD_index_form code
* src/lyxfunc.C (dispatch): use signals to insert index entry
* src/frontends/Dialogs.h: new signal createIndex
* src/frontends/xforms/FormCommand.[Ch],
src/frontends/xforms/FormCitation.[Ch],
src/frontends/xforms/FormToc.[Ch],
src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
* src/insets/insetindex.[Ch]: GUI-independent
* src/frontends/xforms/FormIndex.[Ch],
* src/frontends/xforms/forms/form_index.fd: xforms implementation
of the Index dialog
2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
* src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2000-08-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insetref.C (Latex): rewrite so that there is now
question that a initialization is requested.
* src/insets/insetcommand.h: reenable the hide signal
2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
fix handling of shortcuts (many bugs :)
(add_lastfiles): ditto.
* lib/ui/default.ui: fix a few shortcuts.
2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
* Makefile.am: Fix ``rpmdist'' target to return the exit
status of the ``rpm'' command, instead of the last command in
the chain (the ``rm lyx.xpm'' command, which always returns
success).
2000-08-02 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
* src/frontends/xforms/FormCitation.C (FormCitation): ditto
* src/frontends/xforms/FormToc.C (FormToc): ditto
* src/frontends/xforms/Makefile.am: A few forgotten files
* src/frontends/xforms/FormCommand.C (showInset): The rest of the
Signals-not-copyable-problem Lars' started commenting out.
* src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2000-08-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insetcommand.h: Signals is not copyable so anoter
scheme for automatic hiding of forms must be used.
* src/frontends/xforms/FormCitation.h: don't inerit from
noncopyable, FormCommand already does that.
* src/frontends/xforms/FormToc.h: ditto
* src/frontends/xforms/FormUrl.h: ditto
* src/frontends/xforms/FormCitation.C: add include <algorithm>
2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
* src/insets/insetcommand.h (hide): new SigC::Signal0
(d-tor) new virtual destructor emits hide signal
* src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
* src/insets/inseturl.[Ch] (hide, d-tor): ditto
* src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
LOF and LOT. Inset is now GUI-independent
* src/insets/insetloa.[Ch]: redundant
* src/insets/insetlof.[Ch]: ditto
* src/insets/insetlot.[Ch]: ditto
* src/frontends/xforms/forms/form_url.fd: tweaked!
* src/frontends/xforms/forms/form_citation.fd: ditto
* src/frontends/xforms/FormCommand.[Ch]: new base class to those
dialogs dealing with InsetCommand insets
* src/frontends/xforms/FormCitation.[Ch]: now makes use of
FormCommand base class
* src/frontends/xforms/FormUrl.[Ch]: ditto
* src/frontends/xforms/forms/form_toc.fd: Xforms implementation
of the TOC dialog
* src/frontends/xforms/FormToc.[Ch]: ditto
* src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
passed a generic InsetCommand pointer
* src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
* src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
and modified InsetTOC class
* src/buffer.C: ditto
* forms/lyx.fd: strip out old FD_form_toc code
* src/lyx_gui_misc.C: ditto
* src/lyx_gui.C: ditto
* src/lyx_cb.C: ditto
* src/lyx.[Ch]: ditto
2000-08-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/utility.hpp: tr -d '\r'
2000-08-01 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.h: removed initFeatures() as it's not needed.
* src/commandtags.h:
* src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
LFUN_TABULAR_FEATURES.
* src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
LFUN_LAYOUT_TABULAR.
* src/insets/insettabular.C (getStatus): implemented helper function.
* lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2000-07-31 Juergen Vigna <jug@sad.it>
* src/text.C (draw): fixed screen update problem for text-insets.
* src/text2.C (SetParagrpah): call an update of the inset-owner when
something changed probably this has to be added in various other
functions too.
* src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2000-07-31 Baruch Even <baruch.even@writeme.com>
* src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
templates to satisfy compaq cxx.
2000-07-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/translator.h (equal_1st_in_pair::operator()): take
const ref pair_type as arg.
(equal_2nd_in_pair::operator()): ditto
(Translator::~Translator): remove empty d-tor.
* src/graphics/GraphicsCache.C: move include config.h to top, also
put initialization of GraphicsCache::singleton here.
(~GraphicsCache): move here
(addFile): take const ref as arg
(removeFile): ditto
* src/lyxlex_pimpl.C (setFile): comment in old behaviour
* src/BufferView2.C (insertLyXFile): change te with/without header
check slightly.
2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormGraphics.C (apply): add some
static_cast. Not very nice, but required by compaq cxx.
* src/frontends/xforms/RadioButtonGroup.h: include header
<utility> instead of <pair.h>
* src/insets/insetgraphicsParams.C: add using directive.
(readResize): change return type to void.
(readOrigin): ditto.
* src/lyxfunc.C (getStatus): add missing break for build-program
function; add test for Literate for export functions.
* lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
entries in Options menu.
2000-07-31 Baruch Even <baruch.even@writeme.com>
* src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
protect against auto-allocation; release icon when needed.
2000-07-31 Matej Cepl <CeplM@seznam.cz>
* lib/kbd/czech.kmap: new file. standard Czech keyboard as found
on usual typewriter.
* lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
earlier czech.kmap), useful only for programming.
2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormCitation.h: fix conditioning around
#pragma.
2000-07-31 Juergen Vigna <jug@sad.it>
* src/frontends/xforms/FormTabular.C (local_update): changed
radio_linebreaks to radio_useparbox and added radio_useminipage.
* src/tabular.C: made support for using minipages/parboxes.
* src/bufferlist.C (QwriteAll): small fix for asking for save.
* src/insets/insetgraphics.C (draw): just draw the inset so that the
cursor is visible.
(descent): so the cursor is in the middle.
(width): bit smaller box.
* src/insets/insetgraphics.h: added display() function.
2000-07-31 Baruch Even <baruch.even@writeme.com>
* src/frontends/Dialogs.h: Added showGraphics signals.
* src/frontends/xforms/forms/form_graphics.fd: Added file, the
xforms form definition of the graphics dialog.
* src/frontends/xforms/FormGraphics.h:
* src/frontends/xforms/FormGraphics.C: Added files, the
GUIndependent code of InsetGraphics
* src/insets/insetgraphics.h:
* src/insets/insetgraphics.C: Major writing to make it work.
* src/insets/insetgraphicsParams.h:
* src/insets/insetgraphicsParams.C: Added files, parameter passing
struct between InsetGraphics and GUI.
* src/LaTeXFeatures.h:
* src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
support for graphicx package.
* src/buffer.C (parseSingleLyXformat2Token): Fixed read support
for the graphics inset.
* src/support/translator.h: Added file, used in
InsetGraphicsParams. this is a template to translate between two
types.
* src/frontends/xforms/RadioButtonGroup.h:
* src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
way to easily control a radio button group.
2000-07-28 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (LocalDispatch):
(TabularFeatures): added support for lyx-functions of tabular features.
(cellstart): refixed this function after someone wrongly changed it.
* src/commandtags.h:
* src/LyXAction.C (init): added support for tabular-features
2000-07-28 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormPreferences.C (build): Setup input return
checking. NOTE: It seems that pressing ESC to cancel the dialog also
triggers the callback for input checking. As a result we sometimes get
"LyX: This shouldn't happen..." printed to cerr.
(input): Started using status variable since I only free() on
destruction. Some input checking for paths and font sizes.
* src/frontends/xforms/FormPreferences.h: Use status to control
activation of Ok and Apply
* src/frontends/xforms/forms/form_preferences.fd: Setup input return
callback. Also resized to stop segfaults with 0.88. The problem is
that xforms-0.88 requires the folder to be wide enough to fit all the
tabs. If it isn't it causes all sorts of problems.
* src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
* src/frontends/xforms/forms/README: Reflect reality.
* src/frontends/xforms/forms/fdfix.sh: Clean up comments
* src/frontends/xforms/forms/makefile: ditto.
* src/commandtags.h: Get access to new Preferences dialog
* src/LyXAction.C: ditto
* src/lyxfunc.C: ditto
* lib/ui/default.ui: ditto
2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
* src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
few files.
* src/frontends/xforms/form_url.[Ch]: added.
2000-07-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insetbib.h: fixed bug in previous commit
* src/frontends/xforms/FormUrl.h: ditto
* src/frontends/xforms/FormPrint.h: ditto
* src/frontends/xforms/FormPreferences.h: ditto
* src/frontends/xforms/FormCopyright.h: ditto
* src/frontends/xforms/FormCitation.C: ditto
* src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
private copyconstructor and private default contructor
* src/support/Makefile.am: add utility.hpp
* src/support/utility.hpp: new file from boost
* src/insets/insetbib.h: set owner in clone
* src/frontends/xforms/FormCitation.C: added missing include
algorithm
* src/insets/form_url.[Ch]: removed
2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
* development/lyx.spec.in
* Makefile.am: Fix buglet for LyX RPM generation resulting from
file/directory re-organization.
2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
* src/insets/insetcommand.[Ch]: moved the string data and
associated manipulation methods into a new stand-alone class
InsetCommandParams. This class has two additional methods
getAsString() and setFromString() allowing the contents to be
moved around as a single string.
(addContents) method removed.
(setContents) method no longer virtual.
* src/buffer.C (readInset): made use of new InsetCitation,
InsetUrl constructors based on InsetCommandParams.
* src/commandtags.h: add LFUN_INSERT_URL
* src/lyxfunc.C (Dispatch): changed to accomadate GUI-
independent InsetUrl and use InsetCommandParams to extract
string info and create new Insets.
* src/frontends/Dialogs.h: add signals showUrl, createUrl.
* src/frontends/xforms/FormCitation.C (apply): uses
InsetCommandParams.
* src/frontends/xforms/form_url.C
* src/frontends/xforms/form_url.h
* src/frontends/xforms/FormUrl.h
* src/frontends/xforms/FormUrl.C
* src/frontends/xforms/forms/form_url.fd: new files
* src/insets/insetcite.[Ch]: removed unused constructors.
* src/insets/insetinclude.[Ch]: no longer store filename
* src/insets/inseturl.[Ch]: GUI-independent.
2000-07-26 Juergen Vigna <jug@sad.it>
* renamed frontend from gtk to gnome as it is that what is realized
and did the necessary changes in the files.
2000-07-26 Marko Vendelin <markov@ioc.ee>
* autogen.sh
* configure.in: cleaning up gnome configuration scripts
2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
shortcuts syndrom by redrawing them explicitely (a better solution
would be appreciated).
* src/lyxfunc.C (getStatus): fix crash when functions are disabled.
* src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
the button.
* src/lyx_cb.C (MenuExport): change html export to do the right
thing depending of the document type (instead of having
html-linuxdoc and html-docbook).
* src/lyxfunc.C (getStatus): update for html
* lib/ui/default.ui: simplify due to the above change.
* src/menus.C (ShowFileMenu): update too (in case we need it).
* src/MenuBackend.C (read): if a menu is defined twice, add the
new entries to the exiting one.
2000-07-26 Juergen Vigna <jug@sad.it>
* src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
* src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
and return a bool if it did actual save the file.
(AutoSave): don't autosave a unnamed doc.
* src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
check if this is an UNNAMED new file and react to it.
(newFile): set buffer to unnamed and change to not mark a new
buffer dirty if I didn't do anything with it.
* src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2000-07-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/frontends/Menubar.h: make "struct Pimpl;" public + the
friend as per Angus's patch posted to lyx-devel.
* src/ext_l10n.h: updated
* src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
gettext on the style string right before inserting them into the
combox.
* autogen.sh: add code to extract style strings form layout files,
not good enough yet.
* src/frontends/gtk/.cvsignore: add MAKEFILE
* src/MenuBackend.C (read): run the label strings through gettext
before storing them in the containers.
* src/ext_l10n.h: new file
* autogen.sh : generate the ext_l10n.h file here
2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
arguments.
* lib/ui/default.ui: fix a couple of typos.
* config/gnome/gtk.m4: added (and added to the list of files in
autogen.sh).
* src/insets/insetinclude.C (unique_id): fix when we are using
lyxstring instead of basic_string<>.
* src/insets/insettext.C (LocalDispatch): ditto.
* src/support/filetools.C: ditto.
* lib/configure.m4: create the ui/ directory if necessary.
* src/LyXView.[Ch] (updateToolbar): new method.
* src/BufferView_pimpl.C (buffer): update the toolbar when
opening/closing buffer.
2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/LyXAction.C (getActionName): enhance to return also the name
and options of pseudo-actions.
(init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
* lib/ui/default.ui: use OptItem in the vc submenu (intented just
as an example of what is possible). Used in File->Build too (more
useful) and in the import/export menus (to mimick the complicated
handling of linuxdoc and friends). Try to update all the entries.
* src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
optional entries.
* src/MenuBackend.C (read): Parse the new OptItem tag.
* src/MenuBackend.h: Add a new optional_ data member (used if the
entry should be omitted when the lyxfunc is disabled).
* src/frontends/xforms/Menubar_pimpl.C (string_width): new
function, used as a shortcut.
(create_submenu): align correctly the shortcuts on the widest
entry.
* src/MenuBackend.h: MenuItem.label() only returns the label of
the menu without shortcut; new method shortcut().
2000-07-14 Marko Vendelin <markov@ioc.ee>
* src/frontends/gtk/Dialogs.C:
* src/frontends/gtk/FormCopyright.C:
* src/frontends/gtk/FormCopyright.h:
* src/frontends/gtk/Makefile.am: added these source-files for the
Gtk/Gnome support of the Copyright-Dialog.
* src/main.C: added Gnome::Main initialization if using
Gtk/Gnome frontend-GUI.
* src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
frontend-GUI.
* config/gnome/aclocal-include.m4
* config/gnome/compiler-flags.m4
* config/gnome/curses.m4
* config/gnome/gnome--.m4
* config/gnome/gnome-bonobo-check.m4
* config/gnome/gnome-common.m4
* config/gnome/gnome-fileutils.m4
* config/gnome/gnome-ghttp-check.m4
* config/gnome/gnome-gnorba-check.m4
* config/gnome/gnome-guile-checks.m4
* config/gnome/gnome-libgtop-check.m4
* config/gnome/gnome-objc-checks.m4
* config/gnome/gnome-orbit-check.m4
* config/gnome/gnome-print-check.m4
* config/gnome/gnome-pthread-check.m4
* config/gnome/gnome-support.m4
* config/gnome/gnome-undelfs.m4
* config/gnome/gnome-vfs.m4
* config/gnome/gnome-x-checks.m4
* config/gnome/gnome-xml-check.m4
* config/gnome/gnome.m4
* config/gnome/gperf-check.m4
* config/gnome/gtk--.m4
* config/gnome/linger.m4
* config/gnome/need-declaration.m4: added configuration scripts
for Gtk/Gnome frontend-GUI
* configure.in: added support for the --with-frontend=gtk option
* autogen.sh: added config/gnome/* to list of config-files
* acconfig.h: added define for GTKGUI-support
* config/lyxinclude.m4: added --with-frontend[=value] option value
for Gtk/Gnome frontend-GUI support.
2000-07-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
can be used.
(suffixIs): ditto
* src/paragraph.C (GetChar): remove non-const version
* src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
(search_kw): use it.
* src/lyx_main.C (init): if "preferences" exist, read that instead
of "lyxrc".
(ReadRcFile): return bool if the file could be read ok.
(ReadUIFile): add a check to see if lex file is set ok.
* src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
bastring can be used instead of lyxstring (still uses the old code
if std::string is good enough or if lyxstring is used.)
* src/encoding.C: make the arrays static, move ininle functions
here
* src/encoding.h: from here.
* src/buffer.C: have last_isnet_read as a file scope variable for now.
(parseSingleLyXformat2Token): move inset parsing to separate method
(readInset): new private method
* src/Variables.h: remove virtual from get().
* src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
access to NEW_INSETS and NEW_TABULAR
* src/MenuBackend.h: remove superfluous forward declaration of
MenuItem. Add documentations tags "///", remove empty MenuItem
destructor, remove private default contructor.
* src/MenuBackend.C (MenuItem): remove unneeded copy contructor
(add): return *this
(read): more string mlabel and mname to where they are used
(read): remove unused variables mlabel and mname
(defaults): unconditional clear, make menusetup take advantage of
add returning Menu &.
* src/LyXView.h: define NEW_MENUBAR as default
* src/LyXAction.C: include lyxparagraph.h temporary to get access
to NEW_INSETS and NEW_TABULAR.
(init): commetn out some funcs that is obsolete when NEW_INSETS is
defined. Change some of the "xxxx-inset-insert" functions names to
"xxxx-insert".
* several files: more enahncements to NEW_INSETS and the resulting
LyXParagraph code.
* lib/lyxrc.example (\date_insert_format): move to misc section
* config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
bastring and use AC_CACHE_CHECK.
(LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
the system have the newest methods. uses AC_CACHE_CHECK
(LYX_CXX_MUTABLE): use AC_CACHE_CHECK
(LYX_CXX_PARTIAL): use AC_CACHE_CHECK
(LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
* configure.in: add LYX_CXX_GOOD_STD_STRING
* acinclude.m4: recreated
2000-07-24 Amir Karger <karger@lyx.org>
* README: add Hebrew, Arabic kmaps
* ANNOUNCE: typo
2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (writeFileAscii): Define actcell as an int instead
of int*.
2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* Lot of files: add pragma interface/implementation.
* src/lyx_main.C (ReadUFile): new method. Read the UI file.
* lib/ui/default.ui: new file (ans new directory). Contains the
default menu and toolbar.
* src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
global space. Toolbars are now read (as menus) in ui files.
* src/debug.C: change Debug::TOOLBAR to Debug::GUI.
* src/lyxfunc.C (getStatus): do not exit immediately if a command
is disabled because the document is read-only. We want to have the
toggle state of the function anyway.
(getStatus): add code for LFUN_VC* functions (mimicking what is
done in old-style menus)
* src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
* src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
* src/BufferView_pimpl.C: ditto.
* src/lyxfunc.C: ditto.
* src/LyXView.h: add a define NEW_MENUBAR (commented out by
default). This replaces old-style menus by new ones.
* src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
MenuItem. Contain the data structure of a menu.
* src/insets/insettext.C: use LyXView::setLayout instead of
accessing directly the toolbar combox.
* src/lyxfunc.C (Dispatch): ditto.
* src/LyXView.C (setLayout): new method, which just calls
Toolbar::setLayout().
(updateLayoutChoice): move part of this method in Toolbar.
* src/toolbar.[Ch]: removed.
* src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
implementation the toolbar.
* src/frontend/Toolbar.[Ch]: new files. The abstract interface of
the toolbar. It might make sense to merge it with ToolbarDefaults
later.
(setLayout): new function.
(updateLayoutList): ditto.
(openLayoutList): ditto.
* src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
xforms implementation of the toolbar.
(get_toolbar_func): comment out, since I do not
know what it is good for.
* src/ToolbarDefaults.h: Add the ItemType enum.
* src/support/StrPool.[Ch]: new class. Acts as a reference holder
for a list of allocated C strings. Used in Menubar xforms
implementation to avoid memory leaks.
* src/support/lstrings.[Ch] (uppercase): new version taking and
returning a char.
(lowercase): ditto.
* lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
* lib/bind/emacs.bind: ditto.
2000-07-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/toolbar.h: include commandtags.h instead of lyxfunc.h,
forward decl of LyXView.
* src/toolbar.C (toolbarItem): moved from toolbar.h
(toolbarItem::clean): ditto
(toolbarItem::~toolbarItem): ditto
(toolbarItem::operator): ditto
* src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
* src/paragraph.h: control the NEW_TABULAR define from here
* src/buffer.C: remove define USE_PARSE_FUNCTION, change
USE_TABULAR_INSETS to NEW_TABULAR
* src/ToolbarDefaults.C: add include "lyxlex.h"
* files using the old table/tabular: use NEW_TABULAR to control
compilation of old tabular stuff.
* src/paragraph.C (SimpleTeXOnePar): NEW_INSETS:<3A>move some #ifdef
to correct place.
* src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS:<3A>fix the
planemet in reading of old style floats, fix the \end_deeper
problem when reading old style floats.
2000-07-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
* lib/bind/sciword.bind: updated.
2000-07-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
layout write problem
2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/Makefile.am (INCLUDES): remove image directory from include
path.
* src/bullet_forms.C (create_form_form_bullet): small cleanup.
* src/bullet_forms_cb.C (BulletPanelCB): ditto.
* src/LyXView.C (create_form_form_main): read the application icon
from the disk.
* lib/images/*.xpm: change the icons to use transparent color for
background.
* src/toolbar.C (update): change the color of the button when it
is toggled on.
2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
setting explicitely the minibuffer.
* src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
* src/LyXView.C (showState): new function. Shows font information
in minibuffer and update toolbar state.
(LyXView): call Toolbar::update after creating the
view.
* src/toolbar.C: change toollist to be a vector instead of a
linked list.
(BubbleTimerCB): get help string directly from the callback
argument of the corresponding icon (which is the action)
(set): remove unnecessary ugliness.
(update): new function. update the icons (depressed, disabled)
depending of the status of the corresponding action.
* src/toolbar.h: remove help in toolbarItem
2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
* src/Painter.C (text): Added code for using symbol glyphs from
iso10646 fonts. Currently diabled.
* src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
symbol_encoding.
* src/language.C (initL): Fixed encodings for esperanto,lsorbian,
magyar,turkish and usorbian.
* src/paragraph.C (isMultiLingual): Made more efficient.
* src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
keyboard.
* src/mathed/math_symbols.C (math_insert_greek): Changed to use
LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
Also changed the prototype to "bool math_insert_greek(char)".
2000-07-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lots of files: apply the NEW_INSETS on all code that will not be
needed when we move to use the new insets. Enable the define in
lyxparagrah.h to try it.
* src/insets/insettabular.C (cellstart): change to be a static
inline function
(InsetTabular): initialize buffer in the initializer list.
2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormPrint.[Ch] : moved #include
form_print.h out of the header file. Replaced with forward
declarations of the relevant struct.
* src/frontends/xforms/FormPreferences.[Ch] : ditto for
form_preferences.h.
* src/commandtags.h: do not include "debug.h" which does not
belong there. #include it in some other places because of this
change.
2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insetcaption.C: add a couple "using" directives.
* src/toolbar.C (add): get the help text directly from lyxaction.
(getPixmap): nuked.
(setPixmap): new function. Loads from disk and sets a pixmap on a
botton; the name of the pixmap file is derived from the command
name.
* src/toolbar.h: remove members isBitmap and pixmap from
toobarItem struct.
* lib/images/*.xbm *_bw.xpm: remove (not used any more).
* lib/images/: move many files from images/banner.xpm.
* src/lyx_gui.C (create_forms): read banner pixmap from file.
* src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
* src/toolbar.C: ditto.
* configure.in: ditto.
* INSTALL: document.
* src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
the spellchecker popup is closed from the WM.
2000-07-19 Juergen Vigna <jug@sad.it>
* src/insets/insetfloat.C (Write): small fix because we use the
insetname for the type now!
2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/forms/form_citation.fd: object sizes are
now set here
* src/frontends/Dialogs.h: removed hideCitation signal
* src/insets/insetcite.h: added hide signal
* src/insets/insetcite.C (~InsetCitation): emits new signal
(getScreenLabel): "intelligent" label should now fit on the screen!
* src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
* src/frontends/xforms/FormCitation.C (showInset): connects
hide() to the inset's hide signal
(show): modified to use fl_set_object_position rather than
fl_set_object_geometry wherever possible
2000-07-18 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/lyxinset.h: add caption code
* src/insets/insetfloat.C (type): new method
* src/insets/insetcaption.C (Write): new method
(Read): new method
(LyxCode): new method
* src/text2.C (SetCounter): revert J<>rgens code, but use his idea
to get it right together with using the FloatList.
* src/commandtags.h: add LFUN_INSET_CAPTION
* src/lyxfunc.C (Dispatch): handle it
* src/buffer.C (parseSingleLyXformat2Token): add code to read a
caption inset.
* src/Variables.[Ch]: make expand take a const reference, remove
the destructor, some whitespace changes.
* src/LyXAction.C (init): add caption-inset-insert
* src/FloatList.C (FloatList): update the default floats a bit.
2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/Variables.[Ch]: new files. Intended to be used for language
specific strings (like \chaptername) and filename substitution in
commands.
* src/trans.C (AddDeadkey): replace keyword "all" with "native" in
kmap files.
* lib/kbd/american.kmap: update
* src/trans_mgr.C (normalkey): do not test allowAccent anymore.
* src/bufferparams.[Ch]: remove member allowAccents.
* src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
* src/LaTeXLog.C: use the log_form.h header.
* src/lyx_gui.C: ditto.
* src/lyx_gui_misc.C: ditto.
* src/lyxvc.h: ditto.
* forms/log_form.fd: new file, created from latexoptions.fd. I
kept the log popup and nuked the options form.
* src/{la,}texoptions.[Ch]: removed.
* src/lyx_cb.C (LaTeXOptions): ditto
* src/lyx_gui.C (create_forms): do not handle the
fd_latex_options form.
2000-07-18 Juergen Vigna <jug@sad.it>
* src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
name of the inset so that it can be requested outside (text2.C).
* src/text2.C (SetCounter): modified so it sees insetfloat for caption
labels.
2000-07-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/formula.h (ConvertFont): constify
* src/mathed/formula.C (Read): add warning if \end_inset is not
found on expected place.
* src/insets/lyxinset.h (ConvertFont): consify
* src/insets/insetquotes.C (ConvertFont): constify
* src/insets/insetquotes.h: ditto
* src/insets/insetinfo.h: add labelfont
* src/insets/insetinfo.C (InsetInfo): set the labelfont
(ascent): use labelfont
(descent): likewise
(width): likewise
(draw): likewise
(Write): make .lyx file a bit nicer
* src/insets/insetfloat.C (Write): simplify somewhat...
(Read): add warning if arg is not found
* src/insets/insetcollapsable.C: add using std::max
(Read): move string token and add warning in arg is not found
(draw): use std::max to get the right ty
(getMaxWidth): simplify by using std::max
* src/insets/insetsection.h: new file
* src/insets/insetsection.C: new file
* src/insets/insetcaption.h: new file
* src/insets/insetcaption.C: new file
* src/insets/inset.C (ConvertFont): constify signature
* src/insets/Makefile.am (libinsets_la_SOURCES): add
insetcaption.[Ch] and insetsection.[Ch]
* src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
uses to use LABEL_COUNTER_CHAPTER instead.
* src/text2.C (SetCounter): here
* src/counters.h: new file
* src/counters.C: new file
* src/Sectioning.h: new file
* src/Sectioning.C: new file
* src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
not always in "."!
* src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
the last argument.
2000-07-17 Juergen Vigna <jug@sad.it>
* src/tabular.C (Validate): check if array-package is needed.
(SetVAlignment): added support for vertical alignment.
(SetLTFoot): better support for longtable header/footers
(Latex): modified to support added features.
* src/LaTeXFeatures.[Ch]: added array-package.
2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
* src/lyx_gui.C (LyXGUI): make sure that the height is large
enough.
2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
* configure.in: do not forget to put a space after -isystem.
2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
* lib/kbd/arabic.kmap: a few fixes.
2000-07-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* some whitespace chagnes to a number of files.
* src/support/DebugStream.h: change to make it easier for
doc++ to parse correctly.
* src/support/lyxstring.h: ditto
* src/mathed/math_utils.C (compara): change to have only one
operator()
(MathedLookupBOP): change because of the above.
* src/mathed/math_delim.C (math_deco_compare): change to have only
one operator()
(search_deco): change becasue of the above.
* src/insets/insettabular.C (DrawCellSelection): use std::swap
instead of manually coded one.
* src/insets/insetquotes.C (Read): read the \end_inset too
* src/insets/insetlatex.h: remove file
* src/insets/insetlatex.C: remove file
* src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
constructor
(InsetPrintIndex): remove destructor
* src/insets/insetinclude.h: remove default constructor
* src/insets/insetfloat.C: work to make it work better
* src/insets/inseterror.[Ch] (InsetError): remove default constructor
* src/insets/insetcite.h (InsetCitation): remove default constructor
* src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
* src/text.C (GetColumnNearX): comment out some currently unused code.
* src/paragraph.C (writeFile): move some initializations closer to
first use.
(CutIntoMinibuffer): small change to use new matchIT operator
(Erase): ditto
(Erase): ditto
(InsertChar): ditto
(InsertInset): ditto
(GetInset): ditto
(GetInset): ditto
(InsetIterator): ditto
(Erase): small change to use new matchFT operator
(InsertChar): ditto
(GetFontSettings): ditto
(HighestFontInRange): ditto
(SetFont): ditto
* src/lyxparagraph.h: some chars changed to value_type
(matchIT): because of some stronger checking (perhaps too strong)
in SGI STL, the two operator() unified to one.
(matchFT): ditto
* src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
* src/buffer.C (parseSingleLyXformat2Token): static string to hold
the last inset read added
(parseSingleLyXformat2Token): some more (future) compability code added
(parseSingleLyXformat2Token): warning about solitary \end_inset added
(parseSingleLyXformat2Token): set last_inset_read
(parseSingleLyXformat2Token): more code to read new "Float" correctly
(parseSingleLyXformat2Token): don't double intializw string next_token
* src/TextCache.C (text_fits::operator()): add const's to the signature
(has_buffer::operator()): ditto
* src/Floating.h: add some comments on the class
* src/FloatList.[Ch] (typeExist): new method
(getType): ditto
* src/BackStack.h: added default constructor, wanted by Gcc.
2000-07-14 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
* src/frontends/xforms/forms/form_tabular.fd: updated a bit.
* src/insets/insettabular.C (resizeLyXText): need this to be able to
do a redraw when the window is resized!
(LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
* src/insets/insettext.C (resizeLyXText): added function to correctly
being able to resize the LyXWindow.
* src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/Dialogs.h (hideCitation) : new signal to prevent
crashes when closing dialog to a deleted inset.
* src/insets/insetcite.[Ch] (Edit) : the return of this former
method! Now similar to other insets.
2000-07-13 Juergen Vigna <jug@sad.it>
* src/text.C (GetVisibleRow): fixed clearing of rows with insets!
* lib/examples/Literate.lyx: small patch!
* src/insets/insetbib.C (Read): added this function because of wrong
Write (without [begin|end]_inset).
2000-07-11 Juergen Vigna <jug@sad.it>
* src/BufferView2.C (open_new_inset): changed to a bool returnvalue
as the insertInset could not be good!
* src/screen.C (ToggleSelection): fixed toggle selection bug as
the bool param should not be last.
2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* sigc++/configure.in: fix bug in threading-related code (Yes, I
did submit that to Karl).
* configure.in: use -isystem instead of -I for X headers. This
fixes a problem on solaris with a recent gcc;
put the front-end code after the X detection code;
configure in sigc++ before lib/
* src/lyx_main.C (commandLineHelp): remove -display from command
line help.
2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
* lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
Also put in Makefile rules for building the ``listerrors''
program for parsing errors from literate programs written in LyX.
* lib/build-listerrors: Added small shell script as part of compile
process. This builds a working ``listerrors'' binary if noweb is
installed and either 1) the VNC X server is installed on the machine,
or 2) the user is compiling from within a GUI. The existence of a GUI
is necessary to use the ``lyx --export'' feature for now. This
hack can be removed once ``lyx --export'' no longer requires a GUI to
function.
2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
* lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
now passed back correctly from gcc and placed "under" error
buttons in a Literate LyX source.
2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (GetColumnNearX): Better behavior when a RTL
paragraph is ended by LTR text.
* src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
Ditto
2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
* src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
true when clipboard is empty.
2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
* text.C (Backspace): Prevent rebreaking of a row if it is the last
row of the paragraph.
(SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
to prevent calculation of bidi tables
2000-07-07 Juergen Vigna <jug@sad.it>
* src/screen.C (ToggleSelection): added y_offset and x_offset
parameters.
* src/insets/insettext.C (InsetMotionNotify): fixed selection with
mouse.
* src/text.C (GetVisibleRow): fixed selection drawing in insets.
* src/insets/insettext.C: fixed Layout-Display!
2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* configure.in: add check for strings.h header.
* src/spellchecker.C: include <strings.h> in order to have a
definition for bzero().
2000-07-07 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (draw): set the status of the bv->text to
CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
* src/screen.C (DrawOneRow):
(DrawFromTo): redraw the actual row if something has changed in it
while drawing.
* src/text.C (draw): call an update of the toplevel-inset if something
has changed inside while drawing.
* src/lyxtext.h: added CHANGED_IN_DRAW status.
2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
* src/insets/insetbib.[Ch] (callback) new method, moving callback
processing inside class.
* src/insets/insetindex.[Ch] (callback) new method, moving callback
processing inside class.
* src/insets/insetindex.h new struct Holder, consistent with other
insets.
* src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
citation dialog from main code and placed it in src/frontends/xforms.
Dialog launched through signals instead of callbacks
2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
* lyx.man: update the options description.
2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
* src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
handle neg values, set min width to 590, add doc about -display
2000-07-05 Juergen Vigna <jug@sad.it>
* src/insets/lyxinset.h: changed Painter & in ascent(), descent()
calls to BufferView *.
* src/insets/insettext.C (checkAndActivateInset): small fix non
HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
* src/insets/insetcommand.C (Read): Fixed as insets should read till
their \end_inset token!
2000-07-04 edscott <edscott@imp.mx>
* src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
lib/lyxrc.example: added option \wheel_jump
2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
* src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
remove support for -width,-height,-xpos and -ypos.
2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
* src/encoding.[Ch]: New files.
* src/painter.C (text(int,int,XChar2b const *,...)): New method.
(text): Call to the underline() method only when needed.
* src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
* src/buffer.C (makeLaTeXFile): Compute automatically the input
encoding(s) for the document.
* src/bufferparams.C (BufferParams): Changed default value of
inputenc to "auto".
* src/language.C (newLang): Removed.
(items[]): Added encoding information for all defined languages.
* src/lyx_gui.C (create_forms): Added "auto" option to the input
encoding choice button.
* src/lyxrc.h (font_norm_type): New member variable.
(set_font_norm_type): New method.
* src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
paragraphs with different encodings.
* src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
(TransformChar): Changed to work correctly with Arabic points.
(draw): Added support for drawing Arabic points.
(draw): Removed code for drawing underbars (this is done by
the Painter!)
* src/support/textutils.h (IsPrintableNonspace): New function.
* src/BufferView_pimpl.h: Added "using SigC::Object".
* src/LyXView.h: ditto.
* src/insets/insetinclude.h (include_label): Changed to mutable.
2000-07-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/math_iter.h: remove empty destructor
* src/mathed/math_cursor.h: remove empty destructor
* src/insets/lyxinset.h: add THEOREM_CODE
* src/insets/insettheorem.[Ch]: new files
* src/insets/insetminipage.C: (InsertInset): remove
* src/insets/insetmarginal.C: inherit from InsetFootLike instead
of InsetCollapsable
(InsertInset): remove
* src/insets/insetlist.C: (InsertList): remove
* src/insets/insetfootlike.[Ch]: new files
* src/insets/insetfoot.C: inherit from InsetFootLike instead of
InsetCollapsable.
(Write): remove
(InsertInset): ditto
* src/insets/insetert.C: remove include Painter.h, reindent
(InsertInset): move to header
* src/insets/insetcollapsable.h: remove explicit from default
contructor, remove empty destructor, add InsertInset
* src/insets/insetcollapsable.C (InsertInset): new func
* src/insets/Makefile.am (libinsets_la_SOURCES): add new files
* src/vspace.h: add explicit to constructor
* src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
\textcompwordmark, please test this.
* src/lyxrc.C: set ascii_linelen to 65 by default
* src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
* src/commandtags.h: add LFUN_INSET_THEOREM
* src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
(makeLinuxDocFile): remove _some_ of the nice logic
(makeDocBookFile): ditto
* src/Painter.[Ch]: (~Painter): removed
* src/LyXAction.C (init): entry for insettheorem added
* src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
enum
(deplog): code to detect files generated by LaTeX, needs testing
(deptex): removed
2000-07-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2000-07-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/LaTeX.C (deplog): Add a check for files that are going to be
created by the first latex run, part of the project to remove the
all_files array.
* src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
contents to the extension list.
2000-07-04 Juergen Vigna <jug@sad.it>
* src/text.C (NextBreakPoint): added support for needFullRow()
* src/insets/lyxinset.h: added needFullRow()
* src/insets/insetcollapsable.C: redone now this uses a text-inset
and isn't one.
* src/insets/insettext.C: lots of changes for update!
2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
* src/LaTeXFeatures.h: add a missing std:: qualifier.
2000-07-02 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
* src/insets/insetinclude.C (InsetInclude): fixed
initialization of include_label.
(unique_id): now returns a string.
2000-07-01 Jos<6F> Ab<41>lio Matos <jamatos@fep.up.pt>
* src/LaTeXFeatures.h: new member IncludedFiles, for
a map of key, included file name.
* src/LaTeXFeatures.C (getIncludedFiles): returns a string
with the included files for inclusion in SGML preamble,
i. e., linuxdoc and docbook.
* src/buffer.h:
* src/buffer.C (makeLinuxDocFile): takes two new arguments,
nice (is the generated linuxdoc code to be exported?), that
allows to remove column, and only_body that will be true for
slave documents. Insets are allowed inside SGML font type.
New handling of the SGML preamble for included files.
(makeDocBookFile): the same for docbook.
* src/insets/insetinclude.h:
* src/insets/insetinclude.C (Validate): keeps a list of included files.
(Linuxdoc):
(DocBook): new export methods.
* src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
and makeDocBookFile.
* src/lyx_main.C (easyParse): accept linuxdoc and docbook as
formats to export with command line argument -x.
2000-06-29 Juergen Vigna <jug@sad.it>
* src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
* src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
region could already been cleared by an inset!
2000-06-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/BufferView_pimpl.h: remove member variables lyx_focus and
work_area_focus
* src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
and lyx_focus
(cursorToggle): remove special handling of lyx focus.
2000-06-28 Juergen Vigna <jug@sad.it>
* src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
insetHeight.
2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insetindex.C (Edit): add a callback when popup is
closed by the WM.
* src/insets/insettext.C (LocalDispatch):
* src/insets/insetmarginal.h:
* src/insets/insetlist.h:
* src/insets/insetfoot.h:
* src/insets/insetfloat.h:
* src/insets/insetert.h: add a missing std:: qualifier.
2000-06-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxsum.C (sum): '\0' teminate file read when using
strstream.
* src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
* src/insets/insettext.C (Read): remove tmptok unused variable
(LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
(InsertInset): change for new InsetInset code
* src/insets/insettext.h: add TEXT inline method
* src/insets/insettext.C: remove TEXT macro
* src/insets/insetmarginal.C (Write): new method
(Latex): change output slightly
* src/insets/insetfoot.C (Write): new method
(Latex): change output slightly (don't use endl when no need)
* src/insets/insetert.C (Write): new method
* src/insets/insetcollapsable.h: make button_length, button_top_y
and button_bottm_y protected.
* src/insets/insetcollapsable.C (Write): simplify code by using
tostr. Also do not output the float name, the children class
should to that to get control over own arguments
* src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
src/insets/insetminipage.[Ch]:
new files
* src/insets/Makefile.am (libinsets_la_SOURCES): add new files
* src/lyxfunc.C (Dispatch): cases for new insets/commands
* src/Makefile.am (lyx_SOURCES): add the new files
* src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
* src/commandtags.h: ditto
* src/LaTeXFeatures.h: add a std::set of used floattypes
* src/LaTeXFeatures.C (getPackages): add basic support for float.sty
* src/FloatList.[Ch] src/Floating.h: new files
* src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
InsertInset.
* src/lyx_cb.C (TableApplyCB): ditto
* src/text.C: ditto
* src/text2.C: ditto
* src/buffer.C (SimpleLinuxDocOnePar): ditto
(parseSingleLyXformat2Token): ditto + add code for
backwards compability for old float styles + add code for new insets
* src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
method
(InsertInset(size_type, Inset *, LyXFont)): new method
(InsetChar(size_type, char)): changed to use the other InsetChar
with a LyXFont(ALL_INHERIT).
(InsetInset(size_type, Inset*)): changed to use InsetChar to
insert the META_INSET.
* sigc++/thread.cc (Privete<int>::operator int&): move definition
out of line.
* sigc++/thread.h (Threads): from here
* sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
definition out of line
* sigc++/scope.h: from here
2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxrc.C (read): make sure the .kmap files exist when a keymap
is specified (adapted from a patch from edscott <edscott@imp.mx>).
* Makefile.am (bindist): new target.
* INSTALL: add instructions for doing a binary distribution.
* development/tools/README.bin.example: update a bit.
2000-06-26 Lior Silberman <slior@math.huji.ac.il>
* src/lyxrc.C:
* lib/lyxrc.example: new lyxrc tag \set_color.
* src/lyxfunc.C (Dispatch):
* src/commandtags.h:
* src/LyXAction.C: new lyxfunc "set-color".
* src/LColor.[Ch] (setColor): new method to set colors from a lyxname
and an x11name given as strings.
* src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
cache when a color is changed.
2000-06-26 Juergen Vigna <jug@sad.it>
* src/lyxrow.C (width): added this functions and variable.
* src/insets/insetcite.C (create_form_citation_form): some Gravity
changes.
* src/text.C (SetHeightOfRow): fixed calcualting of width.
2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* images/undo_bw.xpm: new icon.
* images/redo_bw.xpm: ditto.
* configure.in (INSTALL_SCRIPT): change value to
${INSTALL} to avoid failures of install-script target.
* lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
* src/BufferView.h: add a magic "friend" declaration to please
compaq cxx.
2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
* forms/cite.fd: modified to allow resizing without messing
up the dialog.
* src/insetcite.C: Uses code from cite.fd almost without
tweaking. ;-)
User can now resize dialog in the x-direction.
Resizing the dialog in the y-direction is prevented, as the
code does this intelligently already.
2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* INSTALL: remove obsolete entry in "problems" section.
* lib/examples/sl_*.lyx: update of the slovenian examples.
* src/support/FileInfo.[Ch] (getBlockSize): remove.
2000-06-23 Juergen Vigna <jug@sad.it>
* src/lyxtext.h: added a 'cleared' flag to draw() function.
* src/buffer.C (resize): delete the LyXText of textinsets.
* src/paragraph.C (SetInsetOwner): set the owner in the insets too.
* src/insets/lyxinset.h: added another parameter 'cleared' to
the draw() function.
* src/lyxfunc.C (processKeyEvent): move cursor to the right of the
unlocking inset in inset.
2000-06-22 Juergen Vigna <jug@sad.it>
* src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
of insets and moved first to LyXText.
* src/mathed/formulamacro.[Ch]:
* src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2000-06-21 Juergen Vigna <jug@sad.it>
* src/text.C (GetVisibleRow): look if I should clear the area or not
using Inset::doClearArea() function.
* src/insets/lyxinset.h: added doClearArea() function and
modified draw(Painter &, ...) to draw(BufferView *, ...)
* src/text2.C (UpdateInset): return bool insted of int
2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyx_gui.C (create_forms): Add "Reset" option to the language
combox in the character popup
* src/lyx_cb.C (UserFreeFont): Add argument to the method:
BufferParams const & params
2000-06-20 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (SetParagraphData): set insetowner on
2- paragraphs.
2000-06-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/Timeout.[Ch]: Change to use signals instead of callbacks.
* src/LyXView.h (struct FD_form_main): remove, LyXView inherits
from SigC::Object
(form_main_): remove
* src/LyXView.C (LyXView_AutosaveTimerCB): remove
(create_form_form_main): remove FD_form_main stuff, connect to
autosave_timeout signal
* src/LyXView.[Ch] (getMainForm): remove
(UpdateTimerCB): remove
* src/BufferView_pimpl.h: inherit from SigC::Object
* src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
signal instead of callback
* src/BufferView.[Ch] (cursorToggleCB): remove
2000-06-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/BufferView_pimpl.C: changes because of the one below
* src/screen.[Ch]: Made the lyxscreen take LyXText as argument
instead of storing a pointer to a LyXText.
* src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyxparagraph.h
* src/paragraph.C: Changed fontlist to a sorted vector.
2000-06-19 Juergen Vigna <jug@sad.it>
* src/BufferView.h: added screen() function.
* src/insets/insettext.C (LocalDispatch): some selection code
fixed.
* src/vspace.C (nextToken): use stringfunctions instead of sscanf.
* src/insets/insettext.C (SetParagraphData):
(Read):
(InsetText): fixes for multiple paragraphs.
2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
* development/lyx.spec.in: Call configure with ``--without-warnings''
to work around a bug with the Makefiles when doing ``make lyxrpm''.
This should be fine, however, since we generally don't want to be
verbose when making an RPM.
2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
* lib/scripts/fig2pstex.py: New file
2000-06-16 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (UpdateLocal):
* src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
(LocalDispatch): Changed all functions to use LyXText.
2000-06-15 Juergen Vigna <jug@sad.it>
* src/text.C (SetHeightOfRow): call inset::update before requesting
any width/height.
* src/insets/insettext.C (update):
* src/insets/insettabular.C (update): added implementation
* src/insets/lyxinset.h: added update function
2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text.C (SelectNextWord): protect against null pointers with
old-style string streams. (fix from Paul Theo Gonciari
<gptheo@yahoo.com>)
* src/cite.[Ch]: remove erroneous files.
* lib/configure.m4: update the list of created directories.
* src/lyxrow.C: include <config.h>
* src/lyxcursor.C: ditto.
2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/examples/decimal.lyx: new example file from Mike.
* src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
to find template definitions (from Dekel)
* src/frontends/.cvsignore: add a few things.
* src/frontends/xforms/input_validators.[ch]: remove C++ comments.
* src/Timeout.C (TimeOut): remove default argument.
* src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
"C" linkage.
* src/insets/ExternalTemplate.C: add a "using" directive.
* src/lyx_main.h: remove the act_ struct, which seems unused
anyway.
2000-06-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* LyX Developers Meeting: All files changed, due to random C++ (by
coincidence) code generator script.
- external inset (cool!)
- initial online editing of preferences
- insettabular breaks insettext(s contents)
- cleanup
- some DocBook fixes
- example files update
- other cool stuff, create a diff and look for yourself.
2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
* src/insets/insettext.C (computeTextRows): if the maxWidth is
-1 this is a non-line-breaking textinset.
* src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
if there is no width set.
2000-06-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* Lots of files: Merged the dialogbase branch.
2000-06-09 Allan Rae <rae@lyx.org>
* src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
and the Dispatch methods that used it.
* src/frontends/Liason.[Ch]: replaced with a Liason namespace for
access to functions formerly kept in Dispatch.
2000-05-19 Allan Rae <rae@lyx.org>
* src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
made to_page and count_copies integers again. from_page remains a
string however because I want to allow entry of a print range like
"1,4,22-25" using this field.
* src/LyXAction.C: added action info and commands for buffer-print-xtl
and printer-params-get. These aren't useful from the minibuffer but
could be used by a script/LyXServer app provided it passes a suitable
auto_mem_buffer. I guess I should take a look at how the LyXServer
works and make it support xtl buffers.
* sigc++/: updated to libsigc++-1.0.1
* src/xtl/: updated to xtl-1.3.pl.11
* forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
those changes done to the files in src/ are actually recreated when
they get regenerated. Please don't ever accept a patch that changes a
dialog unless that patch includes the changes to the corresponding *.fd
file.
* src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
stringOnlyContains, renamed it and generalised it.
* lots-of-files: Rolled the "rae" branch over into the "dialogbase"
branch. Removed the remaining old form_print code.
2000-04-26 Allan Rae <rae@lyx.org>
* ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
trap I was trying to fix with the ID: fields in src/xtl/ :-)
2000-04-25 Allan Rae <rae@lyx.org>
* src/xtl/: Updated to incorporate Angus's two patches as well as mine
against a base of xtl-1.3.pl.4
* development/tools/lxtl.sh: fixed a couple of silly typos and now
filter the Id: entries so they still show the xtl version number
they are based on.
* src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
into the src/xtl code. Patch still pending with Jos<6F> (XTL)
2000-04-24 Allan Rae <rae@lyx.org>
* src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
both more generic and much safer. Use the new template functions.
* src/buffer.[Ch] (Dispatch): ditto.
* src/frontends/xforms/FormPrint.C (update): Use new template functions
and mem buffer more intelligently. Also a little general cleanup.
(apply): ditto.
* configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
* development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
* src/xtl/Makefile.am: ditto.
* src/xtl/.cvsignore: ditto.
* src/Makefile.am: ditto.
* src/PrinterParams.h: Removed the macros member functions. Added a
testInvariant member function. A bit of tidying up and commenting.
Included Angus's idea for fixing operation with egcs-1.1.2.
* src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
cool expansion of XTL's mem_buffer to support automatic memory
management within the buffer itself. Removed the various macros and
replaced them with template functions that use either auto_mem_buffer
or mem_buffer depending on a #define. The mem_buffer support will
disappear as soon as the auto_mem_buffer is confirmed to be good on
other platforms/compilers. That is, it's there so you've got something
to compare against.
* src/xtl/objio.h: Changes to support auto_mem_buffer. This has
effectively forked XTL. However I expect Jos<6F> will include my code
into the next major release. Also fixed a memory leak.
* src/xtl/text.h: ditto.
* src/xtl/xdr.h: ditto.
* src/xtl/giop.h: ditto.
2000-04-16 Allan Rae <rae@lyx.org>
* acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
by autogen.sh and removed by maintainer-clean anyway.
* .cvsignore, sigc++/.cvsignore: Support the above.
* sigc++/.cvsignore: Forgot that retbind.h was generated.
* src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
* src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
macros, renamed static callback-target member functions to suit new
scheme and made them public.
* src/frontends/xforms/forms/form_print.fd: ditto.
* src/frontends/xforms/forms/form_copyright.fd: ditto.
* src/support/lxtl.h: small cleanup to use typedef instead of #define
for gui_format.
* src/xtl/: New directory containing a minimal distribution of XTL.
This is XTL-1.3.pl.4.
* development/tools/lxtl.sh: A script to generate the above mini-dist.
2000-04-15 Allan Rae <rae@lyx.org>
* development/tools/makeLyXsigc.sh: Remove the library version numbers
* sigc++/: Updated to libsigc++-1.0.0
2000-04-14 Allan Rae <rae@lyx.org>
* src/frontends/xforms/xform_macros.h: Remove specific macros and just
use the generic ones in future. I'll modify my conversion script.
* src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
* src/lyx_gui_misc.[Ch]: Removed references to form_print.
(CloseAllBufferRelatedDialogs): Renamed.
(updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
* src/frontends/xforms/FormCopyright.C: Use the specific macros instead
of the generic ones. These are the same ones my conversion script
generates.
* src/PrinterParams.h: Allow you to print a range of odd or even pages.
* src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
* src/buffer.C (Dispatch): ditto
* src/LyXView.C (LyXView): Use new signals instead of old hard coded
functions for updating and hiding buffer dependent dialogs.
* src/BufferView.C (buffer): ditto
* src/buffer.C (setReadonly): ditto
* src/lyxfunc.C (CloseBuffer): ditto
* src/buffer.h: Take setReadonly() out of line so I don't have to include
Dialogs.h, and hence all the SigC stuff, into every file that includes
buffer.h. We also don't need to include lyx_gui_misc.h in everything.
* src/BufferView2.C: reduce the number of headers included by buffer.h
2000-04-11 Allan Rae <rae@lyx.org>
* src/frontends/xforms/xform_macros.h: A small collection of macros
for building C callbacks.
* src/frontends/xforms/Makefile.am: Added above file.
* src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
scheme again. This time it should work for JMarc. If this is
successful I'll revise my conversion script to automate some of this.
The static member functions in the class also have to be public for
this scheme will work. If the scheme works (it's almost identical to
the way BufferView::cursorToggleCB is handled so it should work) then
FormCopyright and FormPrint will be ready for inclusion into the main
trunk immediately after 1.1.5 is released -- provided we're prepared
for complaints about lame compilers not handling XTL.
* src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2000-04-07 Allan Rae <rae@lyx.org>
* config/lyxinclude.m4: A bit more tidying up (Angus)
* src/LString.h: JMarc's <string> header fix
* src/PrinterParams.h: Used string for most data to remove some
ugly code in the Print dialog and avoid even uglier code when
appending the ints to a string for output.
* src/buffer.C (Dispatch): Added a couple of braces to fix an error
and moved "default:" back to the end of switch statement. Cleaned
up the printing so it uses the right function calls and so the
"print to file" option actually puts the file in the right directory.
* src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
* src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
and Ok+Apply button control into a separate method: input (Angus).
(input) Cleaned it up and improved it to be very thorough now.
(All CB) static_cast used instead of C style cast (Angus). This will
probably change again once we've worked out how to keep gcc-2.8.1 happy
with real C callbacks.
(update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
ignore some of the bool settings and has random numbers instead. Needs
some more investigation. Added other input length checks and checking
of file and printer names.
* src/frontends/xforms/FormPrint.h: Removed pragma statement so it
would link (Angus). Seems the old code doesn't compile with the pragma
statement either. Separated callback entries from internal methods.
* src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2000-03-17 Allan Rae <rae@lyx.org>
* src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
need it? Maybe it could go in Dialogs instead? I could make it a
LFUN but you'd have to call Dispatch(int, int, char*) with dummy
values to get the bool return value.
(Dispatch): New overloaded method for xtl support.
* src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
extern "C" callback instead of static member functions. Hopefully,
JMarc will be able to compile this. I haven't changed
forms/form_copyright.fd yet. Breaking one of my own rules already.
* src/commandtags.h: New xtl-based LFUN's no description in LyXAction
because they aren't useful from the minibuffer. Maybe a LyXServer
might want a help message though?
* src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
* config/lyxinclude.m4: Changes to g++ flags to suit compiling with
xtl which needs both rtti and exceptions.
* src/support/Makefile.am:
* src/support/lxtl.h: New file. Some helper macros for using XTL.
* src/frontends/xforms/input_validators.[ch]: input filters and
validators. These conrol what keys are valid in input boxes.
Use them and write some more. Much better idea than waiting till
after the user has pressed Ok to say that the input fields don't make
sense.
* src/frontends/xforms/Makefile.am:
* src/frontends/xforms/forms/form_print.fd:
* src/frontends/xforms/forms/makefile:
* src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
new scheme. Still have to make sure I haven't missed anything from
the current implementation.
* src/Makefile.am, src/PrinterParams.h: New data store.
* other files: Added a couple of copyright notices.
2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insetbib.h: move Holder struct in public space.
* src/frontends/include/DialogBase.h: use SigC:: only when
SIGC_CXX_NAMESPACES is defined.
* src/frontends/include/Dialogs.h: ditto.
* sigc++/Makefile.am (%.h): use the autodected GNU m4.
* src/frontends/xforms/FormCopyright.[Ch]: do not
mention SigC:: explicitely.
2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
deals with testing KDE in main configure.in
* configure.in: ditto.
2000-02-22 Allan Rae <rae@lyx.org>
* Lots of files: Merged from HEAD
* All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
* autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
* sigc++/: new minidist.
2000-02-14 Allan Rae <rae@lyx.org>
* development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2000-02-08 Juergen Vigna <jug@sad.it>
* src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
file for the buildin GUI builder of KDevelop of the copyright-dialog.
* src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
for this port and so it is much easier for other people to port
dialogs in a common development environment.
* src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
the QT/KDE implementation.
* src/frontends/kde/Dialogs.C:
* src/frontends/kde/FormCopyright.C:
* src/frontends/kde/FormCopyright.h:
* src/frontends/kde/Makefile.am:
* src/frontends/kde/formcopyrightdialog.C:
* src/frontends/kde/formcopyrightdialog.h:
* src/frontends/kde/formcopyrightdialogdata.C: added this source-files
for the kde support of the Copyright-Dialog.
* src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
subdir-substitution instead of hardcoded 'xforms' as we now have also
the kde subdir.
* src/frontends/include/DialogBase.h (Object): just commented the
label after #endif (nasty warning and I don't like warnings ;)
* src/main.C (main): added KApplication initialization if using
KDE frontend-GUI.
* src/lyx_gui.C (runTime): added support for multiple toolkit support.
For now only the KDE event-loop is added if frontend==kde.
* src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
* configure.in: added support for the --with-frontend[=value] option
* autogen.sh: added kde.m4 file to list of config-files
* acconfig.h: added define for KDEGUI-support
* config/kde.m4: added configuration functions for KDE-port
* config/lyxinclude.m4: added --with-frontend[=value] option with
support for xforms and KDE.
2000-02-08 Allan Rae <rae@lyx.org>
* all Makefile.am: Fixed up so the make targets dist, distclean,
install and uninstall all work even if builddir != srcdir. Still
have a new sigc++ minidist update to come.
* config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2000-02-01 Allan Rae <rae@lyx.org>
* config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
Many mods to get builddir != srcdir working.
* sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
for building on NT and so we can do the builddir != srcdir stuff.
2000-01-30 Allan Rae <rae@lyx.org>
* sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
This will stay in "rae" branch. We probably don't really need it in
the main trunk as anyone who wants to help programming it should get
a full library installed also. So they can check both included and
system supplied library compilation.
* sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
Added a 'mini' distribution of libsigc++. If you feel the urge to
change something in these directories - Resist it. If you can't
resist the urge then you should modify the following script and rebuild
the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
all happen. Still uses a hacked version of libsigc++'s configure.in.
I'm quite happy with the results. I'm not sure the extra work to turn
the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
worth the trouble and would probably lead to extra maintenance
headaches.
I haven't tested the following important make targets: install, dist.
Not ready for prime time but very close. Maybe 1.1.5.
* development/tools/makeLyXsigc.sh: A shell script to automatically
generate our mini-dist of libsigc++. It can only be used with a CVS
checkout of libsigc++ not a tarball distribution. It's well commented.
This will end up as part of the libsigc++ distribution so other apps
can easily have an included mini-dist. If someone makes mods to the
sigc++ subpackage without modifying this script to generate those
changes I'll be very upset!
* src/frontends/: Started the gui/system indep structure.
* src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
to access the gui-indep dialogs are in this class. Much improved
design compared to previous revision. Lars, please refrain from
moving this header into src/ like you did with Popups.h last time.
* src/frontends/include/DialogBase.h: Abstract base class for dialogs.
* src/frontends/xforms/: Started the gui-indep system with a single
dialog: FormCopyright. Initial testing of use of libsigc++ was very
successful.
* src/frontends/xforms/forms: Repository for the xforms .fd files.
Here you'll find a very useful makefile and automated fdfix.sh that
makes updating dailogs a no-brainer -- provided you follow the rules
set out in the README. I'm thinking about adding another script to
automatically generate skeleton code for a new dialog given just the
name of the dialog.
* src/commandtags.h, src/lyxfunc.C, src/menus.C:
* src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
Made FormCopyright gui-indep and added a lyxfunc to get to it.
2000-06-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/LSubstring.C (operator): simplify
* src/lyxtext.h: removed bparams, use buffer_->params instead
* src/lyxrow.h: make Row a real class, move all variables to
private and use accessors.
* src/lyxparagraph.h (getParLanguage):<3A>add BufferParamas as
arguament.
(isRightToLeftPar): ditto
(ChangeLanguage): ditto
(isMultiLingual): ditto
(String): ditto
(TeXOnePar): ditto
(SimpleTeXOnePar): ditto
(TeXEnvironment): ditto
(GetEndLabel): ditto
(SetLayout): ditto
(SetOnlyLayout): ditto
(BreakParagraph): ditto
(BreakParagraphConservative): ditto
(GetFontSettings): ditto
(getFont): ditto
(CopyIntoMinibuffer): ditto
(CutIntoMinibuffer): ditto
(PasteParagraph): ditto
(SetPExtraType): ditto
(UnsetPExtraType): ditto
(DocBookContTableRows): ditto
(SimpleDocBookOneTablePar): ditto
(TeXDeeper): ditto
(TeXFootnote): ditto
(SimpleTeXOneTablePar): ditto
(TeXContTableRows): ditto
(SimpleTeXSpecialChars): ditto
* src/lyxcursor.h: make LyXCursor a real class, move all variables
to private and use accessors.
* src/lyx_cb.C: remove char updatetimer, and all code that uses
this, we did not use it anymore and has not been for ages. Just a
waste of cpu cycles.
* src/language.h: make Language a real class, move all variables
to private and use accessors.
* src/BufferView_pimpl.C (Pimpl): use new timer code.
(create_view): remove
(update): some changes for new timer
(cursorToggle): use new timer
(beforeChange): change for new timer
* src/BufferView.h (cursorToggleCB): removed last paramter because
of new timer code.
* src/BufferView.C (C_BufferView_CursorToggleCB): removed
(cursorToggleCB): change because of new timer code
* lib/CREDITS: updated own mailaddress
2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/filetools.C (PutEnv): fix the code in case neither
putenv() nor setenv() have been found.
* INSTALL: mention the install-strip Makefile target.
* src/LyXAction.C (init): make LFUN_BUILDPROG available in
read-only documents.
2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/configure.in (VERSION): avoid using a previously
generated reLyX wrapper to find out $prefix.
* lib/examples/eu_adibide_lyx-atua.lyx:
* lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
translation of the Tutorial (Dooteo)
2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
* forms/cite.fd: new citation dialog
* src/insetcite.[Ch]: the new citation dialog is moved into
its own files.
* src/insetbib.C: InsetBibtex::getKeys() uses STL containers
(Dekel).
* src/insets/insetcommand.h: data members made private.
2000-06-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* LyX 1.1.5 released
2000-06-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/version.h (LYX_RELEASE): to 1.1.5
* src/spellchecker.C (RunSpellChecker): return false if the
spellchecker dies upon creation.
2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
* NEWS: update.
* lib/CREDITS: update entry for Martin Vermeer.
2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (draw): Draw foreign language bars at the bottom of
the row instead of at the baseline.
* lib/examples/Minipage.lyx: Use the new multi-lingual support.
2000-06-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lib/bind/de_menus.bind: updated
2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
* forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
* src/menus.C (Limit_string_length): New function
(ShowTocMenu): Limit the number of items/length of items in the
LOT/LOF/LOA menus.
* src/paragraph.C (String): Correct result for a paragraph inside
a footnote.
2000-06-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/bufferlist.C (close): test of buf->getuser() == NULL
2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
* src/BufferView2.C (removeAutoInsets): Fix a bug:
Do not call to SetCursor when the paragraph is a closed footnote!
2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
* src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
label is changed.
* src/text.C (SetCursor): Made the computation of cursor_vpos safer.
2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
* forms/lyx.fd
* src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
reference popup, that activates the reference-back action
* src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
* src/menus.C (Add_to_refs_menu): Limit the size of each item in
the menus. Also fixed a bug.
* src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
the math panels when switching buffers (unless new buffer is readonly).
* src/BufferView.C (NoSavedPositions)
* src/BufferView_pimpl.C (NoSavedPositions): New methods
2000-06-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
less of dvi dirty or not.
* src/trans_mgr.[Ch] (insert): change first parameter to string
const &.
* src/chset.[Ch] (encodeString): add const to first parameter
2000-05-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxstring.C (begin): fix a "shared" string bug. use
rep->get_own_copy()
(end): ditto
* src/LaTeX.C (deplog): better searching for dependency files in
the latex log. Uses now regexps.
* lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
instead of the box hack or \hfill.
2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (doImportHelper): do not create the file before
doing the actual import.
(doImportASCIIasLines): create a new file before doing the insert.
(doImportASCIIasParagraphs): ditto.
* lib/lyxrc.example: remove mention of non-existing commands
* lyx.man: remove mention of color-related switches.
* src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
* src/lyx_gui.C: remove all the color-related ressources, which
are not used anymore.
* src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
name.
2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyxrc.C (read): Add a missing break in the switch
2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
* src/text2.C (InsertStringA): Fix a bug with insertion into table
* src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
text is Hebrew.
2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (draw): draw bars under foreign language words.
* src/LColor.[Ch]: add LColor::language
2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyxcursor.h (boundary): New member variable
* src/text.C (IsBoundary): New methods
* src/text.C: Use the above for currect cursor movement when there
is both RTL & LTR text.
* src/text2.C: ditto
* src/bufferview_funcs.C (ToggleAndShow): ditto
2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text.C (DeleteLineForward): set selection to true to avoid
that DeleteEmptyParagraphMechanism does some magic. This is how it
is done in all other functions, and seems reasonable.
(DeleteWordForward): do not jump over non-word stuff, since
CursorRightOneWord() already does it.
Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
DeleteWordBackward, since they seem safe to me (since selection is
set to "true") DeleteEmptyParagraphMechanism does nothing.
2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_main.C (easyParse): simplify the code by factoring the
part that removes parameters from the command line.
(LyX): check wether wrong command line options have been given.
2000-05-29 Lior Silberman <slior@math.huji.ac.il>
* src/lyx_main.C : add support for specifying user LyX
directory via command line option -userdir.
2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
* src/menus.C (Add_to_toc_menu): Limit the number of popups, and
the number of items per popup.
(Add_to_refs_menu): Ditto.
2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxparagraph.h: renamed ClearParagraph() to
StripLeadingSpaces() and moved it to paragraph.C. We pass the
textclass as parameter, and do nothing if free_spacing is
true. This fixes part of the line-delete-forward problems.
* src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
(pasteSelection): ditto.
(SwitchLayoutsBetweenClasses): more translatable strings.
* src/text2.C (CutSelection): use StripLeadingSpaces.
(PasteSelection): ditto.
(DeleteEmptyParagraphMechanism): ditto.
2000-05-26 Juergen Vigna <jug@sad.it>
* src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
is not needed in tabular insets.
* src/insets/insettabular.C (TabularFeatures): added missing features.
* src/tabular.C (DeleteColumn):
(AppendColumn):
(AppendRow): implemented this functions
(cellsturct::operator=): clone the inset too;
2000-05-23 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (LocalDispatch): better selection support
when having multicolumn-cells.
2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
* lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/ColorHandler.C (getGCForeground): put more test into _()
* lib/examples/eu_splash.lyx: new file (Basque translation) from
Dooteo.
* config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
get the version.
2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
there are no labels, or when buffer is readonly.
* src/menus.C (ShowRefsMenu) disable appropriate menu items when
there are no labels, buffer is SGML, or when buffer is readonly.
2000-05-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/LColor.C (LColor): change a couple of grey40 to grey60
(LColor): rewore initalization to make compiles go some magnitude
faster.
(getGUIName): don't use gettext until we need the string.
2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
* src/Bullet.[Ch]: Fixed a small bug.
2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
* src/paragraph.C (String): Several fixes/improvements
* src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
2000-05-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/paragraph.C (String): give more correct output.
2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyxfont.C (stateText) Do not output the language if it is
eqaul to the language of the document.
* src/paragraph.C (TeXOnePar): Do not put language switch commands
between two paragraphs with the same language.
* src/paragraph.C (getParLanguage) Return a correct answer for an
empty dummy paragraph.
* src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
menus.
* src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
layout menu.
* src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
the menus/popup, if requested fonts are unavailable.
2000-05-22 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (LocalDispatch): added some more cursor
movement support (Up/Down/Tab/Shift-Tab).
(LocalDispatch): added also preliminari cursor-selection.
* src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
* src/paragraph.C (PasteParagraph): Hopefully now right!
2000-05-22 Garst R. Reese <reese@isn.net>
* layouts/hollywood.layout, broadway.layout : move Dialogue to top
of list, change all references to Environment to Command
* tex/hollywood.cls : rewrite environments as commands, add
\uppercase to interiorshot and exteriorshot to force uppecase.
* tex/broadway.cls : rewrite environments as commands. Tweak
whitespace.
2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/menus.C (Add_to_toc_menu): fix the code which limits the
size of items: use a constant intead of the hardcoded 40, and more
importantly do not remove the %m and %x tags added at the end.
(Add_to_refs_menu): use vector::size_type instead of
unsigned int as basic types for the variables. _Please_ do not
assume that size_t is equal to unsigned int. On an alpha, this is
unsigned long, which is _not_ the same.
* src/language.C (initL): remove language "hungarian", since it
seems that "magyar" is better.
2000-05-22 Juergen Vigna <jug@sad.it>
* src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
* src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
end markers!
* src/paragraph.C (PasteParagraph): Possibly a memory leak as
next was deleted but not set to 0.
2000-05-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/language.C (initL): change the initialization of languages
so that compiles goes _fast_.
* src/menus.C (Add_to_toc_menu): limit the line length in TOC to
40 chars.
* src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
2000-05-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* release 1.1.5pre3
2000-05-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/WorkArea.C (request_clipboard_cb): give "C" linkage.
2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
* src/commandtags.h
* src/LyXAction.C
* src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
and LFUN_LOAVIEW
* src/insets/insetlo*.[Ch]: Made editable
2000-05-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (SetSelection): call BufferView::stuffClipboard with
the current selection.
* src/BufferView_pimpl.C (stuffClipboard): new method
* src/BufferView.C (stuffClipboard): new method
* src/paragraph.C (String): new method
* src/LColor.C (getFromLyXName): return LColor::inherit instead of
LColor::ignore when lyxname is not found.
* src/BufferView.C (pasteSelection): new method
* src/BufferView_pimpl.C (pasteSelection): new method
* src/lyxfunc.C (Dispatch): use the new clipboard functions.
* src/WorkArea.C (request_clipboard_cb): new static function
(getClipboard): new method
(putClipboard): new method
2000-05-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* LyX 1.1.5pre2 released
2000-05-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/vspace.C (operator=): removed
(operator=): removed
* src/lyx_gui_misc.C (askForText): manually set the type in make_pair
* src/layout.C (NumberOfClass): manually set the type in make_pair
(NumberOfLayout): ditto
* src/language.C: use the Language constructor for ignore_lang
* src/language.h: add constructors to struct Language
* src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
* src/text2.C (SetCursorIntern): comment out #warning
* src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
* src/mathed/math_iter.h: initialize sx and sw to 0
2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
* forms/lyx.fd: Redesign of form_ref
* src/LaTeXFeatures.[Ch]
* src/buffer.C
* src/lyx_cb.C
* src/menus.C
* src/insets/insetref.[Ch]: Added support for varioref and prettyref.
* src/buffer.h
* src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
and Buffer::inset_iterator.
* src/menus.C: Added new menus: TOC and Refs.
* src/insets/insetlabel.C (Edit) Made InsetLabel editable.
* src/buffer.C (getTocList): New method.
* src/BufferView2.C (ChangeRefs): New method.
* src/buffer.C (getLabelList): New method. It replaces the old
getReferenceList. The return type is vector<string> instead of
string.
* src/insets/insetinclude.C (getLabelList): New method. Replaces
the old getLabel() and GetNumberOfLabels() methods.
* src/insets/insetlabel.C (getLabelList): ditto
* src/mathed/formula.C (getLabelList): ditto
* src/paragraph.C (String): New method.
* src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
Uses the new getTocList() method.
TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
which automatically updates the contents of the browser.
(RefUpdateCB): Use the new getLabelList method.
* src/lyxfunc.C (Dispatch): Give an error if the label is not found.
* src/BufferView2.C (gotoLabel) Use the new getLabelList method.
* src/spellchecker.C: Added using std::reverse;
2000-05-19 Juergen Vigna <jug@sad.it>
* src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
* src/insets/insettext.C (computeTextRows): small fix for display of
1 character after a newline.
* src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
to cont-rows!
2000-05-18 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (TabularFeatures): fixed update of display
when changing width of column.
* src/tabular.C (set_row_column_number_info): setting of
autobreak rows if necessary.
2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
* src/vc-backend.*: renamed stat() to status() and vcstat to
vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
compilation broke. The new name seems more relevant, anyway.
2000-05-17 Juergen Vigna <jug@sad.it>
* src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
which was wrong if the removing caused removing of rows!
* src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
(pushToken): new function.
* src/text2.C (CutSelection): fix problem discovered with purify
2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/debug.C (showTags): enlarge the first column, now that we
have 6-digits debug codes.
* lib/layouts/hollywood.layout:
* lib/tex/hollywood.cls:
* lib/tex/brodway.cls:
* lib/layouts/brodway.layout: more commands and fewer
environments. Preambles moved in the .cls files. Broadway now has
more options on scene numbering and less whitespace (from Garst)
* src/insets/insetbib.C (getKeys): make sure that we are in the
document directory, in case the bib file is there.
* src/insets/insetbib.C (Latex): revert bogus change.
2000-05-16 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (UnlockInsetInInset): Changes to update
the TabularLayout on cursor move.
* src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
* src/insets/insettabular.C (Clone): Clone the LyXTabular for
undo-handling.
(getCellXPos):
(draw): fixed cursor position and drawing so that the cursor is
visible when before the tabular-inset.
* src/insets/insettext.C (init): drawLockedFrame was not initialized
when creating from old insettext.
* src/tabular.C (Clone): added Clone of text-inset for undo-handling.
2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
* lib/tex/brodway.cls: ditto
* lib/layouts/brodway.layout: change alignment of parenthical
layout (Garst)
2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
versions 0.88 and 0.89 are supported.
2000-05-15 Juergen Vigna <jug@sad.it>
* src/insets/insetcollapsable.C (draw): enhancements in drawing and
width calculating.
* src/insets/insettext.C (computeTextRows): redone completely this
function in a much cleaner way, because of problems when having a
fixed maxWidth.
(draw): added a frame border when the inset is locked.
(SetDrawLockedFrame): this sets if we draw the border or not.
(SetFrameColor): this sets the frame color (default=insetframe).
* src/insets/lyxinset.h: added x() and y() functions which return
the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
function which is needed to see if we have a locking inset of some
type in this inset (needed for now in insettabular).
* src/vspace.C (inPixels): the same function also without a BufferView
parameter as so it is easier to use it in some ocasions.
* src/lyxfunc.C: changed all places where insertInset was used so
that now if it couldn't be inserted it is deleted!
* src/TabularLayout.C:
* src/TableLayout.C: added support for new tabular-inset!
* src/BufferView2.C (insertInset): this now returns a bool if the
inset was really inserted!!!
* src/tabular.C (GetLastCellInRow):
(GetFirstCellInRow): new helper functions.
(Latex): implemented for new tabular class.
(TeXCellPostamble):
(TeXCellPreamble):
(TeXBottomHLine):
(TeXTopHLine): new Latex() helper functions.
2000-05-12 Juergen Vigna <jug@sad.it>
* src/mathed/formulamacro.C (Read):
* src/mathed/formula.C (Read): read also the \end_inset here!
2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
* src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
crush when saving formulae with unbalanced parenthesis.
20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
* src/layout.C: Add new keyword "endlabelstring" to layout file
* src/text.C (GetVisibleRow): Draw endlabel string.
* lib/layouts/broadway.layout
* lib/layouts/hollywood.layout: Added endlabel for the
Parenthetical layout.
* lib/layouts/heb-article.layout: Do not use slanted font shape
for Theorem like environments.
* src/buffer.C (makeLaTeXFile): Always add "american" to
the UsedLanguages list if document language is RTL.
2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* add addendum to README.OS2 and small patch (from SMiyata)
2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* many files: correct the calls to ChangeExtension().
* src/support/filetools.C (ChangeExtension): remove the no_path
argument, which does not belong there. Use OnlyFileName() instead.
* src/insets/insetbib.C (Latex): use absolute paths for bibtex
files when LaTeXing a non-nice latex file.
* src/lyxlookup.C (isDeadEvent): use a switch statement instead of
a chain of "if". Return false when deadkeys are not handled.
* src/lyx_main.C (LyX): adapted the code for default bindings.
* src/kbmap.C (defaultKeyBindings): new method. Performs the default
bindings for basic functionality (except deadkeys).
(deadKeyBindings): new method. Performs the bindings of deadkeys.
* src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
several methods: handle override_x_deadkeys.
* src/lyxrc.h: remove the "bindings" map, which did not make much
sense anyway. New variable override_x_deadkeys, defaulting to "true".
2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfont.C (stateText): use a saner method to determine
whether the font is "default". Seems to fix the crash with DEC
cxx.
* src/Bullet.[Ch] (Bullet): remove const on parameters.
2000-05-08 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (InsetButtonRelease): Now opens the
TabularLayoutMenu with mouse-button-3
(LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
* src/TabularLayout.C: added this file for having a Layout for
tabular-insets.
2000-05-05 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (UpdateLocal): resetCursorPos when
recalculating inset-widths.
(TabularFeatures): activated this function so that I can change
tabular-features via menu.
* src/menus.C (ShowEditMenu): inserted support for insettabular so
that I can test some functions with the Table menu.
2000-05-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxfont.C (stateText): guard against stupid c++libs.
* src/tabular.C: add using std::vector
some whitespace changes, + removed som autogenerated code.
* src/buffer.C (parseSingleLyXformat2Token): stupid bug.
2000-05-05 Juergen Vigna <jug@sad.it>
* src/tabular.[Ch]: now using std:vector instead of arrays for all the
row, columns and cellstructures.
2000-05-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lib/lyxrc.example: remove obsolete entries.
* src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
reading of protected_separator for free_spacing.
2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text.C (draw): do not display an exclamation mark in the
margin for margin notes. This is confusing, ugly and
uninformative.
* src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
AMS math' is checked.
* src/buffer.C (makeLaTeXFile): do not depend on the textclass
name to see whether including the amsmath package is needed.
2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
* src/paragraph.C (validate): Compute UsedLanguages correctly
(don't insert the american language if it doesn't appear in the
document)
* src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
The argument of \thanks{} command is considered moving argument
* src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
moving argument.
2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (GetVisibleRow): Improved drawing of vertical lines
for appendix/minipage/depth. The lines can be now both in the footnote
frame, and outside the frame.
* src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
points ("nikud")
2000-05-05 Juergen Vigna <jug@sad.it>
* src/table.[Ch]: removed the inset and buffer stuff as this is now
neede only in tabular.[Ch].
2000-05-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insetspecialchar.C (Read): allow command == '~' for
PROTECTED_SEPARATOR
(Write): write '~' for PROTECTED_SEPARATOR
2000-05-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxparagraph.h: add a friend struct matchIT after the struct
InsetTable.
* src/mathed/formula.C (drawStr): rename size to siz.
* src/insets/figinset.C (RestoreForm): rename pflags to piflags,
possibly fix a bug by not changing the pflags = flags to piflags =
flags.
2000-05-05 Juergen Vigna <jug@sad.it>
* src/insets/insetbib.C: moved using directive
* src/ImportNoweb.C: small fix for being able to compile (missing
include cstdlib)
2000-05-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
to use clear, since we don't depend on this in the code. Add test
for string::compare
2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* (various *.C files): add using std::foo directives to please dec
cxx.
* replace calls to string::clear() to string::erase() (Angus)
* src/cheaders/cmath: modified to provide std::abs.
2000-05-04 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C: Prepared all for inserting of multiple
paragraphs. Still display stuff to do (alignment and other things),
but I would like to use LyXText to do this when we cleaned out the
table-support stuff.
* src/insets/insettabular.C: Changed lot of stuff and added lots
of functionality still a lot to do.
* src/tabular.C: Various functions changed name and moved to be
const functions. Added new Read and Write functions and changed
lots of things so it works good with tabular-insets (also removed
some stuff which is not needed anymore * hacks *).
* src/lyxcursor.h: added operators == and != which just look if
par and pos are (not) equal.
* src/buffer.C (latexParagraphs): inserted this function to latex
all paragraphs form par to endpar as then I can use this too for
text-insets.
* src/text2.C (SetLayout): Changed this to use a cursor this is needed
so that I can call this to from text insets with their own cursor.
* src/buffer.C (makeLaTeXFile): added the output of one \n after the
output off all paragraphs (because of the fix below)!
* src/paragraph.C (TeXOnePar): removed output of \n when we are in
the very last paragraph (this could be also the last paragraph of an
inset!)
* src/texrow.h: added rows() call which returns the count-variable.
2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
* lib/lyxrc.example: fix examples for exporting SGML to HTML.
* lib/configure.m4: better autodetection of DocBook tools.
2000-04-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_main.C (easyParse): use lyxerr instead of cerr.
* src/lyx_cb.C: add using std::reverse;
* src/LaTeX.C (run): on error always run deleteFilesOnError before
returning.
* src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
selected files. Should fix repeated errors from generated files.
2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
* src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
the spellchecker popup.
* lib/lyxrc.example: Removed the \number_inset section
2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/figinset.C (various): Use IsFileReadable() to make
sure that the file actually exist. Relying on ghostscripts errors
is a bad idea since they can lead to X server crashes.
2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
* intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
open under CYGWIN
* lib/lyxrc.example: smallish typo in description of
\view_dvi_paper_option
2000-04-26 Andr<64> P<>nitz <poenitz@mathematik.tu-chemnitz.de>
* src/lyxfunc.h:
* src/lyxfunc.C: doImportHelper to factor out common code of the
various import methods. New functions doImportASCIIasLines,
doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
doImportLinuxDoc for the format specific parts.
* buffer.h:
* buffer.C: Dispatch returns now a bool to indicate success
* lyx_gui.h:
* lyx_gui.C: Add getLyXView() for member access
* lyx_main.C: Change logic for batch commands: First try
Buffer::Dispatch (possibly without GUI), if that fails, use
LyXFunc::Dispatch
* lyx_main.C: Add support for --import command line switch.
Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
Available Formats: Everything accepted by 'buffer-import <format>'
2000-04-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_gui.C (create_forms): small oneliner from Garst to have
unnumbered parts.
* src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
documents will be reformatted upon reentry.
2000-04-27 Juergen Vigna <jug@sad.it>
* src/CutAndPaste.C (pasteSelection): last paragraph was not returned
correctly only last pos this was a bug.
2000-04-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* release of lyx-1.1.5pre1
2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insettabular.[Ch]: fix the Clone() declaration.
* src/menus.C: revert the change of naming (Figure->Graphic...)
from 2000-04-11. It was incomplete and bad.
* src/LColor.[Ch]: add LColor::depthbar.
* src/text.C (GetVisibleRow): use it.
* README: update the languages list.
2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (GetVisibleRow): show the depth of paragraphs using
vertical bars.
2000-04-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* README: remove sections that were just wrong.
* src/text2.C (GetRowNearY): remove currentrow code
* src/text.C (GetRow): remove currentrow code
* src/screen.C (Update): rewritten a bit.
(SmallUpdate): removed func
* src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
used.
(FullRebreak): return bool
(currentrow): remove var
(currentrow_y): ditto
* src/lyxscreen.h (Draw): change arg to unsigned long
(FitCursor): return bool
(FitManualCursor): ditto
(Smallpdate): remove func
(first): change to unsigned long
(DrawOneRow): change second arg to long (from long &)
(screen_refresh_y): remove var
(scree_refresh_row): ditto
* src/lyxrow.h: change baseline to usigned int from unsigned
short, this brings some implicit/unsigned issues out in the open.
* src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
accordingly.
(Dispatch): don't call updateScrollbar after fitCursor. Use update
instead of smallUpdate.
* src/lyxcursor.h: change y to unsigned long
* src/buffer.h: don't call updateScrollbar after fitcursor
* src/buffer.C (parseSingleLyXformat2Token): move variables to
where they are used. Removed "\\direction", this was not present
in 1.1.4 and is already obsolete. Commented out some code that I
believe to never be called.
(runLiterate): don't call updateScrollbar after fitCursor
(runLaTeX): ditto
(buildProgram): ditto
(runChktex): ditto
* src/WorkArea.h (workWidth): change return val to unsigned
(width): ditto
(height): ditto
(redraw): remove the button redraws
(setScrollbarValue): change for scrollbar
(getScrollbarValue): change for scrollbar
(getScrollbarBounds): change for scrollbar
* src/WorkArea.C (C_WorkArea_up_cb): removed func
(C_WorkArea_down_cb): removed func
(WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
(resize): change for scrollbar
(setScrollbar): ditto
(setScrollbarBounds): ditto
(setScrollbarIncrements): ditto
(up_cb): removed func
(down_cb): removed func
(scroll_cb): change for scrollbar
(work_area_handler): ditto
* src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
when FitCursor did something.
(updateScrollbar): some unsigned changes
(downCB): removed func
(scrollUpOnePage): removed func
(scrollDownOnePage): remvoed func
(workAreaMotionNotify): don't call screen->FitCursor but use
fitCursor instead. and bool return val
(workAreaButtonPress): ditto
(workAreaButtonRelease): some unsigned changes
(checkInsetHit): ditto
(workAreaExpose): ditto
(update): parts rewritten, comments about the signed char arg added
(smallUpdate): removed func
(cursorPrevious): call needed updateScrollbar
(cursorNext): ditto
* src/BufferView2.C (allFloats): don't call updateScrollbar after
fitCursor.
* src/BufferView.[Ch] (upCB): removed func
(downCB): removed func
(smallUpdate): removed func
2000-04-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxtext.h src/text.C src/text2.C: removed support for the
currentrow, currentrow_y optimization. This did not help a lot and
if we want to do this kind of optimization we should rather use
cursor.row instead of the currentrow.
* src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
buffer spacing and klyx spacing support.
2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
* src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
a factor of 50!
2000-04-26 Juergen Vigna <jug@sad.it>
* src/insets/figinset.C: fixes to Lars sstream changes!
2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
* A lot of files: Added Ascii(ostream &) methods to all inset
classes. Used when exporting to ASCII.
* src/buffer.C (writeFileAscii,RoffAsciiTable)
* src/paragraph.C (RoffContTableRows): Use the Ascii() methods
instead of Latex()
* src/text2.C (ToggleFree): Disabled implicit word selection when
there is a change in the language
* src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
no output was generated for end-of-sentence inset.
* src/insets/lyxinset.h
* src/buffer.C
* src/lyxfunc.C
* src/paragraph.C: Removed the insetnumber code
* src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
2000-04-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
no_babel and no_epsfig completely from the file.
(parseSingleLyXformat2Token): add handling for per-paragraph
spacing as written by klyx.
* src/insets/figinset.C: applied patch by Andre. Made it work with
ostringstream too.
2000-04-20 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (cutSelection):
(copySelection): Fixed with selection from right to left.
(draw): now the rows are not recalculated at every draw.
(computeTextRows): for now reset the inset-owner here (this is
important for an undo or copy where the inset-owner is not set
automatically!)
* src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
motion to the_locking_inset screen->first was forgotten, this was
not important till we got multiline insets.
2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/formulamacro.C (Latex): remove CHECK comment, since
code seems to be alright (it is code changed by Dekel, and the
intent is indeed that all macros should be defined \protect'ed)
* NEWS: a bit of reorganisation of the new user-visible features.
2000-04-19 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (init): using a LyXCursor now for cursor
position. Set the inset_owner of the used paragraph so that it knows
that it is inside an inset. Fixed cursor handling with mouse and
cursor keys. Fixed wrong timed inset redraws and lots of other changes
and cleanups to make TextInsets work better.
* src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
Changed parameters of various functions and added LockInsetInInset().
* src/insets/insettext.C:
* src/insets/insetcollapsable.h:
* src/insets/insetcollapsable.C:
* src/insets/insetfoot.h:
* src/insets/insetfoot.C:
* src/insets/insetert.h:
* src/insets/insetert.C: cleaned up the code so that it works now
correctly with insettext.
* src/insets/inset.C:
* src/insets/lyxinset.h: inserted inset_owner and some more changes so
that insets in insets are supported right.
* src/table.h:
* src/table.C: lots of changes for use with inset tabular (and cleanup)
* src/paragraph.C: some small fixes
* src/debug.h: inserted INSETS debug info
* src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
* src/commandtags.h:
* src/LyXAction.C: insert code for InsetTabular.
* src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
not Button1MotionMask.
(workAreaButtonRelease): send always a InsetButtonRelease event to
the_locking_inset.
(checkInsetHit): some setCursor fixes (always with insets).
* src/BufferView2.C (lockInset): returns a bool now and extended for
locking insets inside insets.
(showLockedInsetCursor): it is important to have the cursor always
before the locked inset.
(fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
* src/BufferView.h: made lockInset return a bool.
* src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
* src/text2.C (SetCursor): This now has a version with a LyXCursor
that is used also internally but can be called as public to have back
a cursor pos which is not set internally.
(SetCursorIntern): Changed to use above function.
* src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
2000-04-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* ANNOUNCE:
* INSTALL:
* UPGRADING:
* NEWS: updated for prerelease of 1.1.5. Please comment and send
patches for things that should be in or should be changed.
* src/* [insetfiles]: change "usigned char fragile" to bool
fragile. There was only one point that could that be questioned
and that is commented in formulamacro.C. Grep for "CHECK".
* src/CutAndPaste.C (getBufferTextClass): unused func, removed.
(DeleteBuffer): take it out of CutAndPaste and make it static.
2000-04-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/paragraph.C (TeXOnePar): use the new method in Spacing to
output the spacing envir commands. Also the new commands used in
the LaTeX output makes the result better.
* src/Spacing.C (writeEnvirBegin): new method
(writeEnvirEnd): new method
2000-04-18 Juergen Vigna <jug@sad.it>
* src/CutAndPaste.C: made textclass a static member of the class
as otherwise it is not accesed right!!!
2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
* forms/layout_forms.fd
* src/layout_forms.h
* src/layout_forms.C (create_form_form_character)
* src/lyx_cb.C (UserFreeFont)
* src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
documents (in the layout->character popup).
2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/spellchecker.C (create_ispell_pipe): fix a bug where
\spell_command was in fact not honored (from Kevin Atkinson).
* src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
quitting (Angus)
* src/lyx_gui.h: make lyxViews private (Angus)
2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
* src/mathed/math_write.C
(MathMatrixInset::Write) Put \protect before \begin{array} and
\end{array} if fragile
(MathParInset::Write): Put \protect before \\ if fragile
2000-04-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
initialization if the LyXColorHandler must be done after the
connections to the XServer has been established.
* src/insets/figinset.C (runqueue): change the grabing a bit. Also
get the background pixel from the lyxColorhandler so that the
figures are rendered with the correct background color.
(NextToken): removed functions.
(GetPSSizes): use ifs >> string instead of NextToken.
* src/Painter.[Ch]: the color cache moved out of this file.
* src/ColorHandler.[Ch]: new files. Holds the gc cache for color
and lines.
2000-04-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/WorkArea.C (work_area_handler): call BufferView::enterView
and Buffer::leaveView when FL_ENTER and FL_LEAVE.
* src/BufferView.C (enterView): new func
(leaveView): new func
* src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
when approp.
(leaveView): new func, undefines xterm cursor when approp.
* src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
(AllowInput): delete the Workarea cursor handling from this func.
* src/Painter.C (underline): draw a slimer underline in most cases.
* src/lyx_main.C (error_handler): use extern "C"
2000-04-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
sent directly to me.
* src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
to the list by Dekel.
* src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
strstream too.
* src/bufferview_funcs.[Ch]: two new files, moved several of the
methods from lyx_cb.here.
* src/lyx_cb.C: in addition to the above; removed input_prohibited
it was not used.
2000-04-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_cb.[Ch]: made several functions take a BufferView* arg
instead of using current_view directly.
* src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
* src/LyXAction.C (init): add the paragraph-spacing command.
* src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
* src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
* src/lyx_cb.C (CurrentState): output a string when the spacing is
different from the documents.
* src/text.C (SetHeightOfRow): take paragraph spacing into
account, paragraph spacing takes precedence over buffer spacing
(GetVisibleRow): ditto
* src/paragraph.C (writeFile): output the spacing parameter too.
(validate): set the correct features if spacing is used in the
paragraph.
(Clear): set spacing to default
(MakeSameLayout): spacing too
(HasSameLayout): spacing too
(SetLayout): spacing too
(TeXOnePar): output the spacing commands
* src/lyxparagraph.h: added a spacing variable for use with
per-paragraph spacing.
* src/Spacing.h: add a Default spacing and a method to check if
the current spacing is default. also added an operator==
* src/text2.C (DeleteEmptyParagraphMechanism): added a
RedoParagraphs.
2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxserver.C (callback): fix dispatch of functions
* src/insets/insetlatexaccent.C (checkContents): turn bogus
printf() into lyxerr call.
* src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
fonts.
* src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
"Table" to "Table Box", "Float" to "Floating Material"; deletes
the "Float" from each of the subitems.
(ShowHelpMenu): add entry for "FAQ" and "TOC".
* src/support/DebugStream.h: add an #ifdef to work around a gcc
2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
documented the change so that the workaround can be nuked later.
* src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
LyX::init().
* src/lyxlex_pimpl.C (next): do not re-declare the default value
of arguments.
* src/buffer.C (getLatexName): ditto
(setReadonly): ditto
2000-04-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/LaTeXFeatures.h: add a const reference to BufferParams, to
avoid some uses of current_view. Added also a bufferParams()
method to get at this.
* src/lyxtext.h: changed params->buffer and paramters->bparams.
2000-04-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxparagraph.[Ch]: removed
operator<(LyXParagraph::InsetTable..., added a struct matchIT
with operators used by lower_bound and
upper_bound in InsetTable's
Make struct InsetTable private again. Used matchpos.
2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyx_cb.C (DocumentApplyCB): When changing the language of the
document, the language of existing text is changed (unless the
document is multi-lingual)
* src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
* src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
* A lot of files: A rewrite of the Right-to-Left support.
2000-04-10 Juergen Vigna <jug@sad.it>
* src/BufferView2.C (showLockedInsetCursor): small bugfix for
misplaced cursor when inset in inset is locked.
* src/insets/insettext.C (LocalDispatch): small fix so that a
BREAKLINE is not inserted if we don't permit it with autBreakRows.
* src/insets/insetfoot.C (GetDrawFont): implemented this as the
footnote font should be decreased in size twice when displaying.
* src/insets/insettext.C (GetDrawFont): inserted this function as
the drawing-font may differ from the real paragraph font.
* src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
insets (inset in inset!).
* src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
function here because we don't want footnotes inside footnotes.
* src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
Cloned insets.
(init): now set the inset_owner in paragraph.C
(LocalDispatch): added some resetPos() in the right position
(cutSelection):
(copySelection):
(pasteSelection): changed to use the new CutAndPaste-Class.
* src/insets/lyxinset.h: inserted new function InsertInsetAllowed
which tells if it is allowed to insert another inset inside this one.
* src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
SwitchLayoutsBetweenClasses.
* src/text2.C (InsertInset): checking of the new paragraph-function
InsertInsetAllowed.
(DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
is not needed anymore here!
(CutSelection):
(CopySelection):
(PasteSelection): redone (also with #ifdef) so that now this uses
the CutAndPaste-Class.
(SwitchLayoutsBetweenClasses): removed here and implemented in the
CutAndPaste-Class.
* src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
from/to text/insets.
* src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
so that the paragraph knows if it is inside an (text)-inset.
(InsertFromMinibuffer): changed return-value to bool as now it
may happen that an inset is not inserted in the paragraph.
(InsertInsetAllowed): this checks if it is allowed to insert an
inset in this paragraph.
(PasteParagraph):
(BreakParagraphConservative):
(BreakParagraph) : small change for the above change of the return
value of InsertFromMinibuffer.
* src/lyxparagraph.h: added inset_owner and the functions to handle
this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
2000-04-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
functions from BufferView to BufferView::Pimpl to ease maintence.
* src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
correctly. Also use SetCursorIntern instead of SetCursor.
* src/insets/insetinfo.C (draw): draw InsetInfo notes with the
correct color.
2000-04-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/WorkArea.C (belowMouse): manually implement below mouse.
* src/*: Add "explicit" on several constructors, I added probably
some unneeded ones. A couple of changes to code because of this.
* src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
implementation and private parts from the users of BufferView. Not
quite finished.
* src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
implementation and private parts from the users of LyXLex. Not
quite finished.
* src/BufferView_pimpl.[Ch]: new files
* src/lyxlex_pimpl.[Ch]: new files
* src/LyXView.[Ch]: some inline functions move out-of-line
2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxparagraph.h: make struct InsetTable public.
* src/support/lyxstring.h: change lyxstring::difference_type to be
ptrdiff_t. Add std:: modifiers to streams.
* src/font.C: include the <cctype> header, for islower() and
isupper().
2000-04-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/font.[Ch]: new files. Contains the metric functions for
fonts, takes a LyXFont as parameter. Better separation of concepts.
* src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
changes because of this.
* src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
* src/*: compile with -Winline and move functions that don't
inline out of line.
* src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
instead of strspn.
2000-04-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/paragraph.C (GetLabelstring): renamed from GetLabestring.
(various files changed because of this)
* src/Painter.C (text): fixed the drawing of smallcaps.
* src/lyxfont.[Ch] (drawText): removed unused member func.
(drawString): ditto
* src/*.C: added needed "using" statements and "std::" qualifiers.
2000-03-31 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/*.h: removed all use of "using" from header files use
qualifier std:: instead.
2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text.C (Backspace): some additional cleanups (we already
know whether cursor.pos is 0 or not).
* lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
automake does not provide one).
* src/bmtable.h: replace C++ comments with C comments.
2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
* src/screen.C (ShowCursor): Change the shape of the cursor if
the current language is not equal to the language of the document.
(If the cursor change its shape unexpectedly, then you've found a bug)
* src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
bugs [I hope...]
* src/insets/insetnumber.[Ch]: New files.
* src/LyXAction.C (init)
* src/lyxfunc.C (dispatch): Add command number-inset-insert
* lyxrc.example
* src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
* src/lyxparagraph.h
* src/paragraph.C: Changed insetlist to Vector<InsetTable>.
(the vector is kept sorted).
* src/text.C (GetVisibleRow): Draw selection correctly when there
is both LTR and RTL text.
* src/paragraph.C (Clone): Use the assignment operator for cloning,
which is much faster.
* src/text.C (GetVisibleRow and other): Do not draw the last space
in a row if the direction of the last letter is not equal to the
direction of the paragraph.
* src/lyxfont.C (latexWriteStartChanges):
Check that font language is not equal to basefont language.
(latexWriteEndChanges): ditto
* src/lyx_cb.C (StyleReset): Don't change the language while using
the font-default command.
* src/paragraph.C (GetFirstFontSettings): Handle correctly an
empty paragraph before a footnote.
* src/insets/insetcommand.C (draw): Increase x correctly.
* src/screen.C (ShowCursor): Change cursor shape if
current language != document language.
* src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
2000-03-31 Juergen Vigna <jug@sad.it>
* src/paragraph.C (GetInset): commented out text[pos] = ' '
(Clone): changed mode how the paragraph-data is copied to the
new clone-paragraph.
* src/lyxfunc.C (Dispatch): fixed small problem when calling
GetInset(pos) with no inset anymore there (in inset UNDO)
* src/insets/insetcommand.C (draw): small fix as here x is
incremented not as much as width() returns (2 before, 2 behind = 4)
2000-03-30 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (InsetText): small fix in initialize
widthOffset (should not be done in the init() function)
2000-03-29 Amir Karger <karger@lyx.org>
* lib/examples/it_ItemizeBullets.lyx: translation by
Stefano Mastella
* Implemented \textasciitilde and fixed a tiny bug in reLyX
2000-03-29 Juergen Vigna <jug@sad.it>
* src/insets/insetcollapsable.C (Clone): same as in InsetFoot
* src/insets/insetfoot.C (Clone): small change as for the below
new init function in the text-inset
* src/insets/insettext.C (init): new function as I've seen that
clone did not copy the Paragraph-Data!
(LocalDispatch): Added code so that now we have some sort of Undo
functionality (well actually we HAVE Undo ;)
* src/text.C (Backspace): Small fix for the a | a Backspace problem
2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
* src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
were erased)
2000-03-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/main.C: added a runtime check that verifies that the xforms
header used when building LyX and the library used when running
LyX match. Exit with a message if they don't match. This is a
version number check only.
* src/buffer.C (save): Don't allocate memory on the heap for
struct utimbuf times.
* *: some using changes, use iosfwd instead of the real headers.
* src/lyxfont.C use char const * instead of string for the static
strings. Rewrite some functions to use sstream.
2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text.C (Backspace): hopefully fix the dreaded backaspace
bug.
2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
of Geodesy (from Martin Vermeer)
* lib/layouts/svjour.inc: include file for the Springer svjour
class. It can be used to support journals other than JoG.
* lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
Miskiewicz <misiek@pld.org.pl>)
* lib/reLyX/Makefile.am: ditto.
2000-03-27 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C: added Cut/Copy/Paste inside insets,
also some modifications with operations on selected text.
* src/BufferView.C (checkInsetHit): Now hopefully fixed all the
problems with clicking on insets (last famous words ;)
* src/insets/insetcommand.C (draw):
(width): Changed to have a bit of space before and after the inset so
that the blinking cursor can be seen (otherwise it was hidden)
2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
would not be added to the link list when an installed gettext (not
part of libc) is found.
2000-03-24 Juergen Vigna <jug@sad.it>
* src/insets/insetcollapsable.C (Edit):
* src/mathed/formula.C (InsetButtonRelease):
(InsetButtonPress): fixed for new handling of ButtonPress/Release
handling.
* src/BufferView.C (workAreaButtonPress):
(workAreaButtonRelease):
(checkInsetHit): Finally fixed the clicking on insets be handled
correctly!
* src/insets/insetert.C (Edit): inserted this call so that ERT
insets work always with LaTeX-font
2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
* src/lyx_main.C (easyParse): Removed misplaced gui=false which
caused lyx to startup with no GUI in place, causing in a crash
upon startup when called with arguments.
2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/FontLoader.C: better initialization of dummyXFontStruct.
2000-03-20 Jos<6F> Ab<41>lio Matos <jamatos@lyx.org>
* src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
for linuxdoc and docbook import and export format options.
* lib/lyxrc.example Example of default values for the previous flags.
* src/lyx_cb.C Use those flags instead of the hardwired values for
linuxdoc and docbook export.
* src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
linuxdoc import.
* src/menus.C Added menus entries for the new import/exports formats.
2000-03-09 Andr<64> P<>nitz <poenitz@mathematik.tu-chemnitz.de>
* src/lyxrc.*: Added support for running without Gui
(\use_gui false)
* src/FontLoader.C: sensible defaults if no fonts are needed
* src/lyx_cb.C: New function ShowMessage (writes either to the
minibuffer or cout in case of no gui
New function AskOverwrite for common stuff
Consequently various changes to call these functions
* src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
wild guess at sensible screen resolution when having no gui
* src/lyxfont.C: no gui, no fonts... set some defaults
2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/LColor.C: made the command inset background a bit lighter.
2000-03-20 Hartmut Goebel <goebel@noris.net>
* lib/layouts/stdstruct.inc: split into stdtitle.inc and
stdstruct.inc. Koma-Script added some title elements which
otherwise have been listed below "bibliography". This split allows
adding title elements to where they belong.
* lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
define the additional title elements and then include
stdstruct.inc.
* many other layout files: changed to include stdtitle.inc just
before stdstruct.inc.
2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
* src/buffer.C: (save) Added the option to store all backup files
in a single directory
* src/lyxrc.[Ch]: Added variable \backupdir_path
* lib/lyxrc.example: Added descriptions of recently added variables
* src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
bibtex inset, not closing the bibtex popup when deleting the inset)
2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_cb.C: add a couple using directives.
2000-03-17 Jos<6F> Ab<41>lio Matos <jamatos@lyx.org>
* src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
import based on the filename.
* src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
file would be imported at start, if the filename where of a sgml file.
* src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
* src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyxfont.h Replaced the member variable bits.direction by the
member variable lang. Made many changes in other files.
This allows having a multi-lingual document
* src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
that change the current language to <l>.
Removed the command "font-rtl"
* src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
format for Hebrew documents)
* src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
When auto_mathmode is "true", pressing a digit key in normal mode
will cause entering into mathmode.
If auto_mathmode is "rtl" then this behavior will be active only
when writing right-to-left text.
* src/text2.C (InsertStringA) The string is inserted using the
current font.
* src/paragraph.C (GetEndLabel) Gives a correct result for
footnote paragraphs.
* src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
2000-03-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text.C (Backspace): move RemoveParagraph and RemoveRow in
front of PasteParagraph. Never insert a ' '. This should at least
fix some cause for the segfaults that we have been experiencing,
it also fixes backspace behaviour slightly. (Phu!)
* src/support/lstrings.C (compare_no_case): some change to make it
compile with gcc 2.95.2 and stdlibc++-v3
* src/text2.C (MeltFootnoteEnvironment): change type o
first_footnote_par_is_not_empty to bool.
* src/lyxparagraph.h: make text private. Changes in other files
because of this.
(fitToSize): new function
(setContentsFromPar): new function
(clearContents): new function
(SetChar): new function
* src/paragraph.C (readSimpleWholeFile): deleted.
* src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
the file, just use a simple string instead. Also read the file in
a more maintainable manner.
* src/text2.C (InsertStringA): deleted.
(InsertStringB): deleted.
2000-03-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (DeleteEmptyParagraphMechanism): don't run,
RedoParagraphs from the doublespace handling part, just set status
to NEED_MORE_REFRESH. Also don't update cursor position (should be
done, but perhaps not like this.)
2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text2.C (InsertStringA): don't forget to insert a META_INSET
character when inserting an inset.
2000-03-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/bufferparams.C (readLanguage): now takes "default" into
consideration.
* src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
also initialize the toplevel_keymap with the default bindings from
lyxrc.
* src/buffer.C (Buffer): remove lyxrc from the parameters.
* all files using lyxrc: have lyxrc as a real variable and not a
pointer. remove all extern LyXRC * lyxrc. The equiv to this is
done in lyxrc.h.
* src/lyxrc.C: remove double call to defaultKeyBindings
* src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
toolbar defauls using lyxlex. Remove enums, structs, functions
related to this.
* src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
toolbar defaults. Also store default keybindings in a map.
* src/ToolbarDefaults.[Ch]: New file. This class is used for
storing the toolbar defaults without any xforms dependencies.
* src/insets/figinset.C: patch posted to list by Andre Poenitz
applied. Changed to use iterators.
2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
* development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
systems that don't have LINGUAS set to begin with.
2000-03-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
the list by Dekel Tsur.
2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
* src/insets/form_graphics.C: ditto.
* src/insets/inseturl.C (Latex): the free_spc argument is not used.
2000-03-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/bufferparams.C (readLanguage): use the new language map
* src/intl.C (InitKeyMapper): use the new language map
* src/lyx_gui.C (create_forms): use the new language map
* src/language.[Ch]: New files. Used for holding the information
about each language. Now! Use this new language map enhance it and
make it really usable for our needs.
2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
* screen.C (ShowCursor): Removed duplicate code.
(ShowManualCursor): Support for 3 cursor shapes: Bar (default),
L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
* src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
* src/lyxtext.h
* src/text.C Added TransformChar method. Used for rendering Arabic
text correctly (change the glyphs of the letter according to the
position in the word)
* src/buffer.C
* src/paragraph.C
* src/lyxrc.h
* src/lyxrc.C Added lyxrc command {language_command_begin,
language_command_end,language_command_ltr,language_command_rtl,
language_package} which allows the use of either arabtex or Omega
for Arabic
* src/lyx_gui.C (init)
* src/lyxrc.h
* src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
to use encoding for menu fonts which is different than the encoding
for screen fonts
* src/buffer.C (makeLaTeXFile): If params.language = "default",
do not load the babel package.
To write an English document with Hebrew/Arabic, change the document
language to "english".
* src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
(alphaCounter): changed to return char
(loweralphaCounter, hebrewCounter, romanCounter): New functions
* lib/lyxrc.example Added examples for Hebrew/Arabic
* src/layout.h
* src/layout.C Added layout command endlabeltype
* src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
* src/text.C (GetVisibleRow): Draw a box at the end of proof layout
2000-03-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/math_delim.C (search_deco): return a
math_deco_struct* instead of index.
2000-03-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* All files with a USE_OSTREAM_ONLY within: removed all code that
was unused when USE_OSTREAM_ONLY is defined.
* src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
of any less. Removed header and using.
* src/text.C (GetVisibleRow): draw the string "Page Break
(top/bottom)" on screen when drawing a pagebreak line.
2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
* src/mathed/math_macro.C (draw): do some cast magic.
(Metrics): ditto.
* src/mathed/math_defs.h: change byte* argument to byte const*.
* src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
* src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
know it is right to return InsetFoot* too, but cxx does not like
it...).
* src/insets/insetcollapsable.[Ch] (Clone): make const.
* development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
* src/mathed/math_delim.C: change == to proper assignment.
2000-03-09 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (setPos): fixed various cursor positioning
problems (via mouse and cursor-keys)
(LocalDispatch): added posibility to add a Ctrl-Enter inside a text
inset (still a small display problem but it works ;)
* src/insets/insetcollapsable.C (draw): added button_top_y and
button_bottom_y to have correct values for clicking on the inset.
* src/support/lyxalgo.h: commented out 'using std::less'
2000-03-08 Juergen Vigna <jug@sad.it>
* src/insets/insetcollapsable.C (InsetButtonRelease): Now a
Button-Release event closes as it is alos the Release-Event
which opens it.
* src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
* lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
can add multiple spaces in Scrap (literate programming) styles...
which, by the way, is how I got hooked on LyX to begin with.
* src/mathed/formula.C (Write): Added dummy variable to an
inset::Latex() call.
(Latex): Add free_spacing boolean to inset::Latex()
* src/mathed/formula.h (Latex): Added free_spacing boolean arg.
* src/insets/lyxinset.h: Changed definition of the inset::Latex()
virtual function to include the free_spacing boolean from
the containing paragraph's style.
* src/insets/inseturl.C, src/insets/inseturl.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insettext.C, src/insets/insettext.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
Added free_spacing boolean and made sure that if in a free_spacing
paragraph, that we output normal space if there is a protected space.
* src/insets/insetref.C, src/insets/insetref.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetparent.C, src/insets/insetparent.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
free_spacing boolean arg to match inset.h
* src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/inseterror.C, src/insets/inseterror.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
free_spacing boolean arg to match inset.h
* src/insets/figinset.C, src/insets/figinset.h (Latex): Added
free_spacing boolean arg to match inset.h
* src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
ignore free_spacing paragraphs. The user's spaces are left
alone.
* src/text.C (InsertChar): Fixed the free_spacing layout
attribute behavior. Now, if free_spacing is set, you can
add multiple spaces in a paragraph with impunity (and they
get output verbatim).
(SelectSelectedWord): Added dummy argument to inset::Latex()
call.
* src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
calls.
* src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
paragraph layouts now only input a simple space instead.
Special character insets don't make any sense in free-spacing
paragraphs.
* src/buffer.C (parseSingleLyXformat2Token): Code to convert
hard-spaces in the *input* file to simple spaces if the layout
is free-spacing. This converts old files which had to have
hard-spaces in free-spacing layouts where a simple space was
preferrable.
(writeFileAscii): Added free_spacing check to pass to the newly
reworked inset::Latex(...) methods. The inset::Latex() code
ensures that hard-spaces in free-spacing paragraphs get output
as spaces (rather than "~").
2000-03-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/math_delim.C (draw): draw the empty placeholder
delims with a onoffdash line.
(struct math_deco_compare): struct that holds the "functors" used
for the sort and the binary search in math_deco_table.
(class init_deco_table): class used for initial sort of the
math_deco_table.
(search_deco): use lower_bound to do a binary search in the
math_deco_table.
2000-03-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxrc.C: a small secret thingie...
* src/lyxlex.C (printTable): changed to take a ostream as paramter
and to not flush the stream as often as it used to.
* src/support/lyxalgo.h: new file
(sorted): template function used for checking if a sequence is
sorted or not. Two versions with and without user supplied
compare. Uses same compare as std::sort.
* src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
it and give warning on lyxerr.
(pushTable): ditto
(struct compare_tags): struct with function operators used for
checking if sorted, sorting and lower_bound.
(search_kw): use lower_bound instead of manually implemented
binary search.
2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insetcollapsable.h: fix Clone() declaration.
* src/insets/insetfoot.h: ditto.
* src/insets/lyxinset.h: remove an extra comma at the end of enum.
2000-03-08 Juergen Vigna <jug@sad.it>
* src/insets/lyxinset.h: added owner call which tells us if
this inset is inside another inset. Changed also the return-type
of Editable to an enum so it tells clearer what the return-value is.
* src/insets/insettext.C (computeTextRows): fixed computing of
textinsets which split automatically on more rows.
* src/insets/insetert.[Ch]: changed this to be of BaseType
InsetCollapsable.
* src/insets/insetfoot.[Ch]: added footnote inset
* src/insets/insetcollapsable.[Ch]: added this BaseClass for
collapsable insets (like footnote, ert, ...)
2000-03-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxdraw.h: remvoe file
* src/lyxdraw.C: remove file
* src/insets/insettext.C: added <algorithm>.
2000-03-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
(matrix_cb): case MM_OK use string stream
* src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
stream.
* src/mathed/math_macro.C (draw): use string stream
(Metrics): use string stream
* src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
directly to the ostream.
* src/vspace.C (asString): use string stream.
(asString): use string stream
(asLatexString): use string stream
* src/lyx_cb.C (UpdateLayoutDocument): use string stream for
setting Spacing::Other.
* src/LaTeXFeatures.C (getPackages): use string stream instead of
sprintf when creating the stretch vale.
* src/text2.C (alphaCounter): changed to return a string and to
not use a static variable internally. Also fixed a one-off bug.
(SetCounter): changed the drawing of the labels to use string
streams instead of sprintf.
* src/support/lyxmanip.h: rewrite the newlineanDepth ostream
manipulator to use a scheme that does not require library support.
This is also the way it is done in the new GNU libstdc++. Should
work with DEC cxx now.
2000-03-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/math_inset.h (Write(ostream & os): add a space at the
end. This fixes a bug.
* src/mathed (all files concerned with file writing): apply the
USE_OSTREAM_ONLY changes to mathed too.
* src/support/DebugStream.h: make the constructor explicit.
* src/lyxfont.C (latexWriteStartChanges): small bug related to
count and ostream squashed.
2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
* src/buffer.C (makeLaTeXFile): add a .c_str(), since
ostringstream uses STL strings, and we might not.
* src/insets/insetspecialchar.C: add using directive.
* src/insets/insettext.C: ditto.
2000-03-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lib/layouts/seminar.layout: feeble attempt at a layout for
seminar.cls, far from completet and could really use some looking
at from people used to write layout files.
* src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
a lot nicer and works nicely with ostreams.
* src/mathed/formula.C (draw): a slightly different solution that
the one posted to the list, but I think this one works too. (font
size wrong in headers.)
* src/insets/insettext.C (computeTextRows): some fiddling on
J<>rgens turf, added some comments that he should read.
* src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
used and it gave compiler warnings.
RC_SHOW_BANNER + "\\show_banner" added, also to reading and
writing of lyxrc.
* src/lyx_gui.C (create_forms): do the right thing when
show_banner is true/false.
* src/lyx_cb.C (TimerCB): no need to close or do anything if
show_banner is false.
* most file writing files: Now use iostreams to do almost all of
the writing. Also instead of passing string &, we now use
stringstreams. mathed output is still not adapted to iostreams.
This change can be turned off by commenting out all the occurences
of the "#define USE_OSTREAM_ONLY 1" lines.
* src/WorkArea.C (createPixmap): don't output debug messages.
(WorkArea): don't output debug messages.
* lib/lyxrc.example: added a comment about the new variable
\show_banner
* development/Code_rules/Rules: Added some more commente about how
to build class interfaces and on how better encapsulation can be
achieved.
2000-03-03 Juergen Vigna <jug@sad.it>
* src/insets/insetert.C (InsetERT): Now ERT-insets break row
automatically with the width of the LyX-Window
* src/insets/insettext.C (computeTextRows): fixed update bug in
displaying text-insets (scrollvalues where not initialized!)
2000-03-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
id in the check of the result from lower_bound is not enough since
lower_bound can return last too, and then res->id will not be a
valid construct.
* all insets and some code that use them: I have conditionalized
removed the Latex(string & out, ...) this means that only the
Latex(ostream &, ...) will be used. This is a work in progress to
move towards using streams for all output of files.
* src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
c to 0.
2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_utils.C (MathedLookupBOP): fix the search
routine (this fixes bug where greek letters were surrounded by too
much white space).
* src/support/filetools.C (findtexfile): change a bit the search
algorithm, to fix bug introduced in 1.1.4. Note that --format is
no longer passed to kpsewhich, we may have to change that later.
* config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
warning options to avoid problems with X header files (from Angus
Leeming).
* acinclude.m4: regenerated.
2000-03-02 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (WriteParagraphData): Using the
par->writeFile() function for writing paragraph-data.
(Read): Using buffer->parseSingleLyXformat2Token()-function
for parsing paragraph data!
* src/buffer.C (readLyXformat2): removed all parse data and using
the new parseSingleLyXformat2Token()-function.
(parseSingleLyXformat2Token): added this function to parse (read)
lyx-file-format (this is called also from text-insets now!)
2000-03-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/paragraph.C (BeginningOfMainBody): initialize previous_char
and temp.
* src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
directly instead of going through a func. One very bad thing: a
static LyXFindReplace, but I don't know where to place it.
* src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
string instead of char[]. Also changed to static.
(GetSelectionOrWordAtCursor): changed to static inline
(SetSelectionOverLenChars): ditto.
* src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
current_view and global variables. both classes has changed names
and LyXFindReplace is not inherited from SearchForm.
* src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
fl_form_search form.
* src/lyx_gui.C (create_forms): removed the fl_form_search form.
2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/bind/*.bind: make sure 'buffer-previous' function is not
bound (from Kayvan).
* src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
* lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
2000-03-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* some things that I should comment but the local pub says head to
swirly...
* comment out all code that belongs to the Roff code for Ascii
export of tables. (this is unused)
* src/LyXView.C: use correct type for global variable
current_layout. (LyXTextClass::size_type)
* some code to get the new insetgraphics closer to working I'd be
grateful for any help.
* src/BufferView2.C (insertInset): use the return type of
NumberOfLayout properly. (also changes in other files)
* src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
this as a test. I want to know what breaks because of this.
* src/BufferView.[Ch] (tripleClick): name change from trippleClick.
2000-02-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lib/layouts/stdlists.inc: changed the lyxlist latex definition
to use a \makebox in the label, this allows proper justification
with out using protected spaces or multiple hfills. Now it is
"label" for left justified, "\hfill label\hfill" for center, and
"\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
should be changed accordingly.
2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxtext.h: change SetLayout() to take a
LyXTextClass::size_type instead of a char (when there is more than
127 layouts in a class); also change type of copylayouttype.
* src/text2.C (SetLayout): ditto.
* src/LyXView.C (updateLayoutChoice): ditto.
* src/LaTeX.C (scanLogFile): errors where the line number was not
given just after the '!'-line were ignored (from Dekel Tsur).
* lib/lyxrc.example: fix description of \date_insert_format
* lib/layouts/llncs.layout: new layout, contributed by Martin
Vermeer.
2000-02-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
paragraph.C, text.C, text2.C)
2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insettext.C (LocalDispatch): remove extra break
statement.
* src/insets/insetert.[Ch] (Clone): change return value to Inset*
* src/insets/insettext.[Ch] (Clone): change return value to Inset*
* src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
* src/insets/insettext.[Ch] (GetCursorPos): ditto
* src/insets/insetbib.h: move InsetBibkey::Holder and
InsetCitation::Holder in public space.
2000-02-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insettext.h: small change to get the new files from
Juergen to compile (use "string", not "class string").
* src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
const & as parameter to LocalDispatch, use LyXFont const & as
paramter to some other func. This also had impacto on lyxinsets.h
and the two mathed insets.
2000-02-24 Juergen Vigna <jug@sad.it>
* src/buffer.C:
* src/commandtags.h:
* src/LyXAction.C:
* src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
* src/BufferView.h
* src/BufferView.C
* src/BufferView2.C: added/updated code for various inset-functions
* src/insets/insetert.[Ch]: added implementation of InsetERT
* src/insets/insettext.[Ch]: added implementation of InsetText
* src/insets/inset.C (Edit): added "unsigned int button" parameter
(draw): added preliminary code for inset scrolling not finshed yet
* src/insets/inset.C (LocalDispatch): changed arg parameter to string
as it is in lyxfunc.C now
* src/insets/lyxinset.h: Added functions for text-insets
2000-02-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
BufferView and reimplement the list as a queue put inside its own
class.
* src/bufferlist.[Ch] (updateInset): remove func, not needed.
* several files: use the new interface to the "updateinsetlist"
* src/WorkArea.C (work_area_handler): call BufferView::doubleClick
on doubleclick.
(work_area_handler): call BufferView::trippleClick on trippleclick.
* src/BufferView.C (doubleClick): new function, selects word on
doubleclick.
(trippleClick): new function, selects line on trippleclick.
2000-02-22 Allan Rae <rae@lyx.org>
* lib/bind/xemacs.bind: buffer-previous not supported
2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
as const.
2000-02-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/bufferlist.C: get rid of current_view from this file
* src/spellchecker.C: get rid of current_view from this file
* src/vspace.C: get rid of current_view from this file
(inPixels): added BufferView parameter for this func
(asLatexCommand): added a BufferParams for this func
* src/text.C src/text2.C: get rid of current_view from these
files.
* src/lyxfont.C (getFontDirection): move this function here from
text.C
* src/bufferparams.C (getDocumentDirection): move this function
here from text.C
* src/paragraph.C (getParDirection): move this function here from
text.C
(getLetterDirection): ditto
2000-02-18 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* WorkArea, Painter, LyXScreen: Fixed the crash that occured on
resize due to wrong pixmap beeing used. Also took the opurtunity
to make the LyXScreen stateless on regard to WorkArea and some
general cleanup in the same files.
2000-02-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/Makefile.am: add missing direction.h
* src/PainterBase.h: made the width functions const.
* lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
missing ones.
* src/insets/insetcommand.C (draw): draw Editable as buttons.
* src/insets/insetlatexaccent.C (draw): make the accents draw
better, at present this will only work well with iso8859-1.
* several files: remove the old drawing code, now we use the new
painter only.
* several files: remove support for mono_video, reverse_video and
fast selection.
2000-02-17 Juergen Vigna <jug@sad.it>
* src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
int ** as we have to return the pointer, otherwise we have only
NULL pointers in the returning function.
2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/LaTeX.C (operator()): quote file name when running latex.
2000-02-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/toolbar.C (set): use fl_set_object_helper for the tooltop
(bubble tip), this removes our special handling of this.
* Remove all code that is unused now that we have the new
workarea. (Code that are not active when NEW_WA is defined.)
* Make the uses of XSync not conditionalized on define USE_XSYNC.
2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
nonexisting layout; correctly redirect obsoleted layouts.
* lib/lyxrc.example: document \view_dvi_paper_option
* src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
variable.
* src/lyx_cb.C (RunScript): handle $$FName for command names.
(PreviewDVI): handle the view_dvi_paper_option variable.
[Both from Roland Krause]
2000-02-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
char const *, int, LyXFont)
(text(int, int, string, LyXFont)): ditto
* src/text.C (InsertCharInTable): attempt to fix the double-space
feature in tables too.
(BackspaceInTable): ditto.
(GetVisibleRow): make bottom pagebreak line be a onoff line.
2000-02-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (owner): only complain if owner_ is set and bv != 0
* src/BufferView.C (resizeCurrentBuffer): set the owner of the
newly found text in textcache to this.
(buffer): set the owner of the text put into the textcache to 0
* src/insets/figinset.C (draw): fixed the drawing of figures with
the new Painter.
* src/text.C src/mathed/math_cursor.C: nailed and fixed the
drawing of mathframe, hfills, protected space, table lines. I have
now no outstanding drawing problems with the new Painter code.
2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/PainterBase.C (ellipse, circle): do not specify the default
arguments.
* src/LColor.h: add using directive.
* src/Painter.[Ch]: change return type of methods from Painter& to
PainterBase&. Add a using directive.
* src/WorkArea.C: wrap xforms callbacks in C functions
C_WorkArea_xxx.
* lib/layouts/foils.layout: font fix and simplifications from Carl
Ollivier-Gooch.
2000-02-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* a lot of files: The Painter, LColor and WorkArea from the old
devel branch has been ported to lyx-devel. Some new files and a
lot of #ifdeffed code. The new workarea is enabled by default, but
if you want to test the new Painter and LColor you have to compile
with USE_PAINTER defined (do this in config.h f.ex.) There are
still some rought edges, and I'd like some help to clear those
out. It looks stable (loads and displays the Userguide very well).
2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (pop_tag): revert to the previous implementation
(use a global variable for both loops).
* lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
* src/lyxrc.C (LyXRC): change slightly default date format.
* src/paragraph.C (TeXOnePar): Generate a correct latex file when
there is an English text with a footnote that starts with a Hebrew
paragraph, or vice versa.
(TeXFootnote): ditto.
* src/text.C (LeftMargin): allow for negative values for
parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
this out.
* src/lyx_gui.C (create_forms): add iso88595 as a possible choice
for input encoding (cyrillic)
2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_gui.C (create_forms): make combo box taller (from Dekel
Tsur).
* src/toolbar.C (set): ditto
* src/insets/insetbib.C (create_form_citation_form): ditto
* lib/CREDITS: added Dekel Tsur.
* lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
hebrew supports files from Dekel Tsur.
* lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
<tzafrir@technion.ac.il>
* src/lyxrc.C: put \date_insert_format at the right place.
* src/buffer.C (makeLaTeXFile): fix the handling of
BufferParams::sides when writing out latex files.
* src/BufferView2.C: add a "using" directive.
* src/support/lyxsum.C (sum): when we use lyxstring,
ostringstream::str needs an additional .c_str().
2000-02-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/filetools.C (ChangeExtension): patch from Etienne
applied.
* src/TextCache.C (show): remove const_cast and make second
parameter non-const LyXText *.
* src/TextCache.h: use non const LyXText in show.
* src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
with hebrew.
2000-02-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxsum.C: rework to be more flexible.
* several places: don't check if a pointer is 0 if you are going
to delete it.
* src/text.C: remove some dead code.
* src/insets/figinset.C: remove some dead code
* src/buffer.C: move the BufferView funcs to BufferView2.C
remove all support for insetlatexdel
remove support for oldpapersize stuff
made some member funcs const
* src/kbmap.C: use a std::list to store the bindings in.
* src/BufferView2.C: new file
* src/kbsequence.[Ch]: new files
* src/LyXAction.C + others: remove all trace of buffer-previous
* src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
only have one copy in the binary of this table.
* hebrew patch: moved some functions from LyXText to more
appropriate places. (LyXParagraph, BufferParams, LyXFont)
* several files: remove support for XForms older than 0.88
whitespace changes.
remove some #if 0 #endif code
* src/TextCache.[Ch]: new file. Holds the textcache.
* src/BufferView.C: changes to use the new TextCache interface.
(waitForX): remove the now unused code.
* src/BackStack.h: remove some commented code
* lib/bind/emacs.bind: remove binding for buffer-previous
2000-02-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* applied the hebrew patch.
* src/lyxrow.h: make sure that all Row variables are initialized.
* src/text2.C (TextHandleUndo): comment out a delete, this might
introduce a memory leak, but should also help us to not try to
read freed memory. We need to look at this one.
* src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
(LyXParagraph): initalize footnotekind.
* src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
forgot this when applying the patch. Please heed the warnings.
* src/BufferView.C (buffer): a fix for the buffer-reload problem
(aka. reformat problem)
* src/bufferlist.C (exists): made const, and use const_iterator
(isLoaded): new func.
(release): use std::find to find the correct buffer.
* src/bufferlist.h: made getState a const func.
made empty a const func.
made exists a const func.
new func: isLoaded
2000-02-01 Juergen Vigna <jug@sad.it>
* src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
* po/it.po: updated a bit the italian po file and also changed the
'file nuovo' for newfile to 'filenuovo' without a space, this did
annoy me a lot :)
* src/lyxrc.C (LyXRC): added support for a default insert_date_format
for the new insert_date command.
* src/lyxfunc.C (Dispatch): added support for a insert_date function
from jdblair, to insert a date into the current text conforming to
a strftime format (for now only considering the locale-set and not
the document-language).
2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfont.C (textWidth): hopefully better fix for the Array
Bounds Read error seen by purify. The problem was that islower is
a macros which takes an unsigned char and uses it as an index for
in array of characters properties (and is thus subject to the
above error).
(drawText): ditto.
* src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
correctly the paper sides radio buttons.
(UpdateDocumentButtons): ditto.
2000-01-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/kbmap.C (getsym + others): change to return unsigned int,
returning a long can give problems on 64 bit systems. (I assume
that int is 32bit on 64bit systems)
2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
LyXLookupString to be zero-terminated. Really fixes problems seen
by purify, I think.
2000-01-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
write a (char*)0 to the lyxerr stream.
* src/lastfiles.C: move algorithm before the using statemets.
2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lastfiles.C: move using directives in global scope (egcs 1.x
complains otherwise).
* src/table.C: ditto
* lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
directory.
* lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
that I removed earlier... It is really needed.
* lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* INSTALL: update xforms home page URL.
* lib/configure.m4: fix a bug with unreadable layout files.
* src/table.C (calculate_width_of_column): add "using std::max"
directive.
2000-01-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* several files: marked several lines with "DEL LINE", this is
lines that can be deleted without changing anything.
if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
checks this anyway */
delete <ptr>
* src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
* src/DepTable.C (update): add a "+" at the end when the checksum
is different. (debugging string only)
* src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
the next inset to not be displayed. This should also fix the list
of labels in the "Insert Crossreference" dialog.
2000-01-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/LSubstring.C (LSubstring): set pos to string::npos
when regex was not found.
* src/support/lstrings.C (lowercase): use handcoded transform always.
(uppercase): ditto
* src/text.C (Delete): fixed the crash. cursor.par->prev and
old_cursor.par->prev could be 0.
* several files: changed post inc/dec to pre inc/dec
* src/lastfiles.C (writeFile): use ostream_iterator and copy to
write the lastfiles to file.
* src/BufferView.C (buffer): only show TextCache info when debugging
(buffer): ditto
(resizeCurrentBuffer): ditto
(workAreaExpose): ditto
* lib/kbd/iso8859-7.cdef: changed to new quoting scheme
* lib/kbd/iso8859-2.cdef: changed to new quoting scheme
* src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
a bit better by removing the special case for \i and \j.
2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_main.C (easyParse): remove test for bad comand line
options, since this broke all xforms-related parsing.
* src/kbmap.C (getsym): set return type to unsigned long, as
declared in header. On an alpha, long is _not_ the same as int.
* src/support/LOstream.h: add a "using std::flush;"
* src/insets/figinset.C: ditto.
2000-01-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/bufferlist.C (write): use blinding fast file copy instead of
"a char at a time", now we are doing it the C++ way.
* src/insets/figinset.C: get rid of struct pidwaitpit, use a
std::list<int> instead.
(addpidwait): reflect move to std::list<int>
(sigchldchecker): ditto
* src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
version also.
* src/paragraph.C (FirstPhysicalPar): remove assert and comment
that obviously was wrong...
* src/lyxfont.C (textWidth): have c as char c[2] instead of char
c, this avoids warnings with purify and islower.
* src/insets/figinset.C: rename struct queue to struct
queue_element and rewrite to use a std::queue. gsqueue is now a
std::queue<queue_element>
(runqueue): reflect move to std::queue
(addwait): ditto
* src/support/lstrings.h (tostr): specialize for bool, otherwise
we would get "1" "0" instead of "true" "false. Also make the tostr
functions inline.
2000-01-21 Juergen Vigna <jug@sad.it>
* src/buffer.C (writeFileAscii): Disabled code for special groff
handling of tabulars till I fix this in table.C
2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/mkdir.C (mkdir): change second argument of mkdir to
unsigned long int.
* src/support/lyxlib.h: ditto.
2000-01-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
and 'j' look better. This might fix the "macron" bug that has been
observed.
* src/support/lstrings.[Ch] (tostr): reimplement all the tostr
functions as one template function. Delete the old versions.
* src/support/lyxsum.C: move using std::ifstream inside
MODERN_STL_STREAMS
* src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
and putenv.C
* src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
* src/mathed/formula.C: delete #include "bufferlist.h" never used
* src/insets/figinset.C (InitFigures): use new instead of malloc
to allocate memory for figures and bitmaps.
(DoneFigures): use delete[] instead of free to deallocate memory
for figures and bitmaps.
(runqueue): use new to allocate
(getfigdata): use new/delete[] instead of malloc/free
(RegisterFigure): ditto
* some files: moved some declarations closer to first use, small
whitespace changes use preincrement instead of postincrement where
it does not make a difference.
* src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
step on the way to use stl::containers for key maps.
* src/bufferlist.h: add a typedef for const_iterator and const
versions of begin and end.
* src/bufferlist.[Ch]: change name of member variable _state to
state_. (avoid reserved names)
(makePup): removed
(getFileNames): returns the filenames of the buffers in a vector.
* configure.in (ALL_LINGUAS): added ro
* src/support/putenv.C: new file
* src/support/mkdir.C: new file
2000-01-20 Allan Rae <rae@lyx.org>
* lib/layouts/IEEEtran.layout: Added several theorem environments
* lib/templates/IEEEtran.lyx: Example theorem environments and a
couple of minor additions.
* lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
(except for those in footnotes of course)
2000-01-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
* src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
std::sort and std::lower_bound instead of qsort and handwritten
binarysearch.
(struct compara): struct that holds the functors used by std::sort
and std::lower_bound in MathedLookupBOP.
2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/LAssert.h: do not do partial specialization. We do
not really need it.
* src/support/lyxlib.h: note that lyx::getUserName() and
lyx::date() are not in use right now. Should these be suppressed?
* src/buffer.C (makeLaTeXFile): we do not need the user name here.
(makeLinuxDocFile): do not put date and user name in linuxdoc
headers.
* src/support/lyxlib.h (kill): change first argument to long int,
since that's what solaris uses.
* src/support/kill.C (kill): fix declaration to match prototype.
* config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
actually check whether namespaces are supported. This is not what
it used to do.
* src/support/lyxsum.C: add a using directive.
2000-01-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/kill.C: if we have namespace support we don't have
to include lyxlib.h.
* src/support/lyxlib.h: use namespace lyx if supported.
2000-01-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/date.C: new file
* src/support/chdir.C: new file
* src/support/getUserName.C: new file
* src/support/getcwd.C: new file
* src/support/abort.C: new file
* src/support/kill.C: new file
* src/support/lyxlib.h: moved all the functions in this file
insede struct lyx. Added also kill and abort to this struct. This
is a way to avoid the "kill is not defined in <csignal>", we make
C++ wrappers for functions that are not ANSI C or ANSI C++.
* src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
lyx it has been renamed to sum.
2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text.C: add using directives for std::min and std::max.
2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/texrow.C (getIdFromRow): actually return something useful in
id and pos. Hopefully fixes the bug with positionning of errorbox
insets.
* src/lyx_main.C (easyParse): output an error and exit if an
incorrect command line option has been given.
* src/spellchecker.C (ispell_check_word): document a memory leak.
* src/bufferlist.C (write): fix mismatched allocation/deletion,
where a "struct utimbuf" is allocated with "new" and deleted with
"delete[]".
2000-01-13 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (CutSelection): don't delete double spaces.
(PasteSelection): ditto
(CopySelection): ditto
* src/text.C (Backspace): don't delete double spaces.
* src/lyxlex.C (next): fix a bug that were only present with
conformant std::istream::get to read comment lines, use
std::istream::getline instead. This seems to fix the problem.
2000-01-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
allowed to insert space before space" editing problem. Please read
commends at the beginning of the function. Comments about usage
are very welcome.
* src/text.C (InsertChar): fix for the "not allowed to insert
space before space" editing problem.
* src/text2.C (DeleteEmptyParagraphMechanism): when
IsEmptyTableRow can only return false this last "else if" will
always be a no-op. Commented out.
* src/text.C (RedoParagraph): As far as I can understand tmp
cursor is not really needed.
* src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
present it could only return false anyway.
(several functions): Did something not so smart...added a const
specifier on a lot of methods.
* src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
and add a tmp->text.resize. The LyXParagraph constructor does the
resize for us.
(BreakParagraphConservative): ditto
* src/support/path.h (Path): add a define so that the wrong usage
"Path("/tmp") will be flagged as a compilation error:
"`unnamed_Path' undeclared (first use this function)"
2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
which was bogus for several reasons.
* src/LaTeX.C (scanAux): fix the regular expression used to scan
.aux files.
(runBibTeX): ditto.
* autogen.sh: do not use "type -path" (what's that anyway?).
* src/support/filetools.C (findtexfile): remove extraneous space
which caused a kpsewhich warning (at least with kpathsea version
3.0).
2000-01-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
* src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
* src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/paragraph.C (BreakParagraph): do not reserve space on text
if we don't need to (otherwise, if pos_end < pos, we end up
reserving huge amounts of memory due to bad unsigned karma).
(BreakParagraphConservative): ditto, although I have not seen
evidence the bug can happen here.
* src/lyxparagraph.h: add a using std::list.
2000-01-11 Juergen Vigna <jug@sad.it>
* src/menus.C (MenuDocu): output an Alert if the documentation-file
could not be found.
2000-01-11 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/vc-backend.C (doVCCommand): change to be static and take one
more parameter: the path to chdir too be fore executing the command.
(retrive): new function equiv to "co -r"
* src/bufferlist.C (loadLyXFile): implement the missing parts if
file_not_found_hook is true.
* src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
* src/support/filetools.C (IsFileWriteable): use FileInfo to check
if a file is readwrite,readonly...anything else.
2000-01-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
(CreatePostscript): name change from MenuRunDVIPS (or something)
(PreviewPostscript): name change from MenuPreviewPS
(PreviewDVI): name change from MenuPreviewDVI
* lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
\view_pdf_command., \pdf_to_ps_command
* lib/configure.m4: added search for PDF viewer, and search for
PDF to PS converter.
(lyxrc.defaults output): add \pdflatex_command,
\view_pdf_command and \pdf_to_ps_command.
* src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
* src/bufferlist.C (write): we don't use blocksize for anything so
I removed it.
2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/block.h: disable operator T* (), since it causes
problems with both compilers I tried. See comments in the file.
* lib/reLyX/configure.in: do not define LYX_DIR. support flag
--with-lyxname.
* lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
variable LYX_DIR_10x to LYX_DIR_11x.
* src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
* INSTALL: document --with-lyxname.
* NEWS: ditto.
* configure.in: new configure flag --with-lyxname which allows to
choose the name under which lyx is installed. Default is "lyx", of
course. It used to be possible to do this with --program-suffix,
but the later has in fact a different meaning for autoconf.
* src/support/lstrings.h (lstrchr): reformat a bit.
* src/lyxlex.h: include LIstream.h, for Sun CC this time.
* src/mathed/math_defs.h: ditto.
2000-01-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
true, decides if we create a backup file or not when saving. New
tag and variable \pdf_mode, defaults to false. New tag and
variable \pdflatex_command, defaults to pdflatex. New tag and
variable \view_pdf_command, defaults to xpdf. New tag and variable
\pdf_to_ps_command, defaults to pdf2ps.
2000-01-08 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/bufferlist.C (close): don't call insetUnlock if the buffer
does not have a BufferView.
(unlockInset): ditto + don't access the_locking_inset if the
buffer does not have a BufferView.
* src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
certain circumstances so that we don't continue a keyboard
operation long after the key was released. Try f.ex. to load a
large document, press PageDown for some seconds and then release
it. Before this change the document would contine to scroll for
some time, with this change it stops imidiatly.
* src/support/block.h: don't allocate more space than needed. As
long as we don't try to write to the arr[x] in a array_type arr[x]
it is perfectly ok. (if you write to it you might segfault).
added operator value_type*() so that is possible to pass the array
to functions expecting a C-pointer.
* lib/Makefile.am (dist-hook): don't fail completely if unable to
cvs.
* intl/*: updated to gettext 0.10.35, tried to add our own
required modifications. Please verify.
* po/*: updated to gettext 0.10.35, tried to add our own required
modifications. Please verify.
* src/support/lstrings.C (tostr): go at fixing the problem with
cxx and stringstream. When stringstream is used return
oss.str().c_str() so that problems with lyxstring and basic_string
are avoided. Note that the best solution would be for cxx to use
basic_string all the way, but it is not conformant yet. (it seems)
* src/lyx_cb.C + other files: moved several global functions to
class BufferView, some have been moved to BufferView.[Ch] others
are still located in lyx_cb.C. Code changes because of this. (part
of "get rid of current_view project".)
* src/buffer.C + other files: moved several Buffer functions to
class BufferView, the functions are still present in buffer.C.
Code changes because of this.
* config/lcmessage.m4: updated to most recent. used when creating
acinclude.m4.
* config/progtest.m4: updated to most recent. used when creating
acinclude.m4.
* config/gettext.m4: updated to most recent. applied patch for
tmplinguas.
* config/gettext.m4.patch: new file that shows what changes we
have done to the local copy of gettext.m4.
* config/libtool.m4: new file, used in creation of acinclude.m4
* config/lyxinclude.m4: new file, this is the lyx created m4
macros, used in making acinclude.m4.
* autogen.sh: GNU m4 discovered as a separate task not as part of
the lib/configure creation.
Generate acinlucde from files in config. Actually cat
lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
easier to upgrade .m4 files that really are external.
* src/Spacing.h: moved using std::istringstream to right after
<sstream>. This should fix the problem seen with some compilers.
2000-01-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_cb.C: began some work to remove the dependency a lot of
functions have on BufferView::text, even if not really needed.
(GetCurrentTextClass): removed this func, it only hid the
current_view.
* src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
forgot this in last commit.
* src/Bullet.C (bulletEntry): use static char const *[] for the
tables, becuase of this the return arg had to change to string.
(bulletSize): ditto
(~Bullet): removed unneeded destructor
* src/BufferView.C (beforeChange): moved from lyx_cb.C
(insetSleep): moved from Buffer
(insetWakeup): moved from Buffer
(insetUnlock): moved from Buffer
* buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
from Buffer to BufferView.
* acinclude.m4: include libtool.m4 from libtool 1.3.4.
* config/ltmain.sh: updated to version 1.3.4 of libtool
* config/ltconfig: updated to version 1.3.4 of libtool
2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (pop_tag): fix a dubious for() loop initialization.
Did I get that right?
* src/lyxlex.h: add a "using" directive or two.
* src/Spacing.h: ditto.
* src/insets/figinset.C: ditto.
* src/support/filetools.C: ditto.
* src/support/lstrings.C: ditto.
* src/BufferView.C: ditto.
* src/bufferlist.C: ditto.
* src/lyx_cb.C: ditto.
* src/lyxlex.C: ditto.
* NEWS: add some changes for 1.1.4.
2000-01-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/BufferView.C: first go at a TextCache to speed up switching
between documents.
2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
* lib/examples/nl_voorbeeld_ruw.lyx: ditto.
* lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
* lib/examples/nl_opsommingstekens.lyx: new translation from Tino
Meinen.
* src/mathed/math_defs.h (MathedRowSt): make sure that all
members of the struct are correctly initialized to 0 (detected by
purify)
* src/lyxrc.C (LyXRC): ditto for print_adapt_output.
* src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
* src/insets/figinset.C (sigchldchecker): use "delete" to free a
pidwait, since it was allocated with "new". This was potentially
very bad. Thanks to Michael Schmitt for running purify for us.
2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
* src/lyx_gui_misc.h: add a 'using std::pair;' statement.
1999-12-30 Allan Rae <rae@lyx.org>
* lib/templates/IEEEtran.lyx: minor change
* src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
src/mathed/formula.C (LocalDispatch): askForText changes
* src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
know when a user has cancelled input. Fixes annoying problems with
inserting labels and version control.
1999-12-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lstrings.C (tostr): rewritten to use strstream and
stringstream
1999-12-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/filetools.C (IsFileWriteable): use fstream to check
(IsDirWriteable): use fileinfo to check
* src/support/filetools.h (FilePtr): whole class deleted
* src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
* src/lyxparagraph.h (readSimpleWholeFile): make arg istream
* src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
* src/bufferlist.C (write): use ifstream and ofstream instead of
FILE*
* src/Spacing.h: use istrstream instead of sscanf
* src/mathed/math_defs.h: change first arg to istream from FILE*
* src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
* src/mathed/math_parser.C: have yyis to be an istream
(LexGetArg): use istream (yyis)
(yylex): ditto
(mathed_parse): ditto
(mathed_parser_file): first arg istream instead of FILE*, set yyis
* src/mathed/formula.C (Read): rewritten to use istream
* src/mathed/formulamacro.C (Read): rewritten to use istream
* src/lyxlex.h (~LyXLex): deleted desturctor
(getStream): new function, returns an istream
(getFile): deleted funtion
(IsOK): return is.good();
* src/lyxlex.C (LyXLex): delete file and owns_file
(setFile): open an filebuf and assign that to a istream instead of
using FILE*
(setStream): new function, takes an istream as arg.
(setFile): deleted function
(EatLine): rewritten us use istream instead of FILE*
(next): ditto
(nextToken): ditto
* src/table.C (LyXTable): use istream instead of FILE*
(Read): rewritten to take an istream instead of FILE*
1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (Dispatch): remove an extraneous break statement.
* src/support/filetools.C (QuoteName): change to do simple
'quoting'. More work is necessary. Also changed to do nothing
under emx (needs fix too).
(Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
* acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
config.h.in to the AC_DEFINE_UNQUOTED() call.
(LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
needs char * as argument (because Solaris 7 declares it like
that).
* acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
remove definition of BZERO.
1999-12-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
defined, "lyxregex.h" if not.
* src/support/Makefile.am (noinst_LTLIBRARIES): changed from
pkglib_ to noinst_
(REGEX): new variable that is set to regex.c lyxregex.h when
AM_CONDITIONAL USE_REGEX is set.
(libsupport_la_SOURCES): add $(REGEX)
* src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
pkglib_ to noinst_
* src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
pkglib_ to noinst_
* configure.in: add call to LYX_REGEX
* acinclude.m4 (LYX_REGEX): checks if we need to use the included
regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/bind/fi_menus.bind: new file, from
pauli.virtanen@saunalahti.fi.
* src/buffer.C (getBibkeyList): pass the parameter delim to
InsetInclude::getKeys and InsetBibtex::getKeys.
* src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
is passed to Buffer::getBibkeyList
* src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
instead of the hardcoded comma.
* src/insets/insetbib.C (getKeys): make sure that there are not
leading blanks in bibtex keys. Normal latex does not care, but
harvard.sty seems to dislike blanks at the beginning of citation
keys. In particular, the retturn value of the function is
* INSTALL: make it clear that libstdc++ is needed and that gcc
2.7.x probably does not work.
* src/support/filetools.C (findtexfile): make debug message go to
the LATEX channel
* src/insets/insetbib.C (getKeys): ditto
* src/debug.C (showTags): make sure that the output is correctly
aligned.
* configure.in: add a comment for TWO_COLOR_ICON define.
* acconfig.h: remove all the entries that already defined in
configure.in or acinclude.m4.
* src/buffer.C (makeLaTeXFile): headers of latex file also changed
to avoid user name, date and copyright.
1999-12-21 Juergen Vigna <jug@sad.it>
* src/table.C (Read): Now read bogus row format informations
if the format is < 5 so that afterwards the table can
be read by lyx but without any format-info. Fixed the
crash we experienced when not doing this.
1999-12-21 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
(RedoDrawingOfParagraph): ditto
(RedoParagraphs): ditto
(RemoveTableRow): ditto
* src/text.C (Fill): rename arg paperwidth -> paper_width
* src/buffer.C (insertLyXFile): rename var filename -> fname
(writeFile): rename arg filename -> fname
(writeFileAscii): ditto
(makeLaTeXFile): ditto
(makeLinuxDocFile): ditto
(makeDocBookFile): ditto
* src/LaTeX.C (runMakeIndex): change arg name from file -> f
(runBibTeX): ditto
* src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
* src/bmtable.h: add extern "C" on this file when __cplusplus is
defined.
* src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
compiled by a C compiler not C++.
* src/layout.h (LyXTextClass): added typedef for const_iterator
(LyXTextClassList): added typedef for const_iterator + member
functions begin and end.
* src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
iterators to fill the choice_class.
(updateLayoutChoice): rewritten to use iterators to fill the
layoutlist in the toolbar.
* src/BufferView.h (BufferView::work_area_width): removed unused
variable.
* src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
* src/buffer.C (sgmlOpenTag): drop the use of the static space array
(sgmlCloseTag): ditto
* src/support/lstrings.h: return type of countChar changed to
unsigned char.
* src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
what version of this func to use. Also made to return unsigned int.
* configure.in: call LYX_STD_COUNT
* acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
conforming std::count.
1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
and a subscript would give bad display (patch from Dekel Tsur
<dekel@math.tau.ac.il>).
* src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
* src/spellchecker.C (create_ispell_pipe): use a const_cast to
please sun CC.
* src/chset.h: add a few 'using' directives
* src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
triggered when no buffer is active
* src/layout.C: removed `break' after `return' in switch(), since
it is unreachable.
* src/lyx_main.C (init): make sure LyX can be ran in place even
when libtool has done its magic with shared libraries. Fix the
test for the case when the system directory has not been found.
* src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
name for the latex file.
(MenuMakeHTML): ditto
* src/buffer.h: add an optional boolean argument, which is passed
to ChangeExtension.
1999-12-20 Allan Rae <rae@lyx.org>
* lib/templates/IEEEtran.lyx: small correction and update.
* configure.in: Attempted to use LYX_PATH_HEADER
* src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
* acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
input from JMarc. Now use preprocessor to find the header.
Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
(LYX_PATH_HEADER): My, so far, failed attempt to generalize
LYX_STL_STRING_FWD. See comments in file.
1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
* The global MiniBuffer * minibuffer variable is dead.
* The global FD_form_main * fd_form_main variable is dead.
1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/toolbar.C (set): condition #warning on WITH_WARNINGS
* src/table.h: add the LOstream.h header
* src/debug.h: ditto
* src/LyXAction.h: change the explaination of the ReadOnly
attribute: is indicates that the function _can_ be used.
* src/LyXAction.C (init): find-replace _can_ be used in read-only
mode.
1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfont.C (ascent): Make sure that char is _always_ used as
unsigned.
(descent): ditto
(lbearing): ditto
(rbearing): ditto
* src/paragraph.C (GetWord): assert on pos>=0
(GetChar): ditto
* src/support/lyxstring.C: condition the use of an invariant on
ENABLE_ASSERTIONS
* src/support/lyxstring.h: ditto
* src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
Use LAssert.h instead of plain assert().
* src/support/lstrings.h: add LAssert.h, in case it is needed.
* src/lyxfunc.C: do not include LAssert.h, it is not used.
* src/support/filetools.C: ditto
* src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
is not defined.
* INSTALL: document the new configure flags
* configure.in: suppress --with-debug; add --enable-assertions
* acinclude.m4: various changes in alignment of help strings.
1999-12-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/kbmap.C: commented out the use of the hash map in kb_map,
beginning of movement to a stl::container.
* several files: removed code that was not in effect when
MOVE_TEXT was defined.
* lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
for escaping should not be used. We can discuss if the string
should be enclosed in f.ex. [] instead of "".
* src/trans_mgr.C (insert): use the new returned value from
encodeString to get deadkeys and keymaps done correctly.
* src/chset.C (encodeString): changed to return a pair, to tell
what to use if we know the string.
* src/lyxscreen.h (fillArc): new function.
* src/FontInfo.C (resize): rewritten to use more std::string like
structore, especially string::replace.
* src/insets/insetlatexaccent.C (Draw): use fillArc for the
approp. accents.
* configure.in (chmod +x some scripts): remove config/gcc-hack
1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (writeFile): change once again the top comment in a
.lyx file to point to www.lyx.org and to use LYX_DOCVERSION
instead of an hardcoded version number.
(makeDocBookFile): ditto
* src/version.h: add new define LYX_DOCVERSION
* po/de.po: update from Pit S<>tterlin
* lib/bind/de_menus.bind: ditto.
* src/lyxfunc.C (Dispatch): call MenuExport()
* src/buffer.C (Dispatch): ditto
* src/lyx_cb.C (MenuMakeHTML): new function, moved from
LyXFunc::Dispatch().
(MenuExport): new function, moved from
LyXFunc::Dispatch().
* src/trans_mgr.C (insert): small cleanup
* src/chset.C (loadFile): ditto
* lib/kbd/iso8859-1.cdef: add missing backslashes
1999-12-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insetlatexaccent.C (Lbearing): new function, used to
help with placing the manually drawn accents better.
(Rbearing): ditto
(Draw): x2 and hg changed to float to minimize rounding errors and
help place the accents better.
* src/lyxfont.C (ascent): fixed faulty static_cast, casting from
unsigned short to char is just wrong...cast the char to unsigned
char instead so that the two values can compare sanely. This
should also make the display of insetlatexaccents better and
perhaps also some other insets.
(descent): ditto
(lbearing): new function
(rbearing): ditto
1999-12-15 Allan Rae <rae@lyx.org>
* src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
header that provides a wrapper around the very annoying SGI STL header
of the same name.
* src/support/lyxstring.C, src/LString.h:
removed old SGI-STL-compatability attempts.
* configure.in: Use LYX_STL_STRING_FWD.
* acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
stl_string_fwd.h is around and try to determine it's location.
Major improvement over previous SGI STL 3.2 compatability.
Three small problems remain with this function due to my zero
knowledge of autoconf. JMarc and lgb see the comments in the code.
1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/broken_const.h, config/hack-gcc, config/README: removed
* configure.in: remove --with-gcc-hack option; do not call
LYX_CXX_STL_STACK
* INSTALL: remove documentation of --with-broken-const and
--with-gcc-hack
* acconfig.h: remove all trace of BROKEN_CONST define
* src/buffer.C (makeDocBookFile): update version number in output
file.
(SimpleDocBookOnePar): fix an assert when trying to a character
access beyond string length
[Patch from Jose']
1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* po/de.po: fix the Export menu
* lyx.man: update the description of -dbg
* src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
(commandLineHelp): updated
(easyParse): show list of available debug levels if -dbg is passed
without argument.
* src/Makefile.am: add debug.C
* src/debug.h: moved some code to debug.C
* src/debug.C: new file. Contains code to set and show debug
level.
* src/layout.C: remove 'break' after 'continue' in switch
statements, since these cannot be reached.
1999-12-13 Allan Rae <rae@lyx.org>
* src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
(in_word_set): hash() -> math_hash()
* src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
* acconfig.h: Added a test for whether we are using exceptions in the
current compilation run. If so USING_EXCEPTIONS is defined.
* config.in: Check for existance of stl_string_fwd.h
* src/LString.h: If compiling --with-included-string and SGI's
STL version 3.2 is present (see above test) we need to block their
forward declaration of string and supply a __get_c_string().
However, it turns out this is only necessary if compiling with
exceptions enabled so I've a bit more to add yet.
* src/insets/figinset.[Ch], src/insets/insetinclude.C,
src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
src/support/LRegex.h, src/undo.h:
Shuffle the order of the included files a little to ensure that
LString.h gets included before anything that includes stl_string_fwd.h
* src/support/lyxstring.C: We need to #include LString.h instead of
lyxstring.h to get the necessary definition of __get_c_string.
(__get_c_string): New function. This is defined static just like SGI's
although why they need to do this I'm not sure. Perhaps it should be
in lstrings.C instead.
* lib/templates/IEEEtran.lyx: New template file.
1999-12-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
* intl/Makefile.in (MKINSTALLDIRS): ditto
* src/LyXAction.C (init): changed to hold the LFUN data in a
automatic array in stead of in callso to newFunc, this speeds up
compilation a lot. Also all the memory used by the array is
returned when the init is completed.
* a lot of files: compiled with -Wold-style-cast, changed most of
the reported offenders to C++ style casts. Did not change the
offenders in C files.
* src/trans.h (Match): change argument type to unsigned int.
* src/support/DebugStream.C: fix some types on the streambufs so
that it works on a conforming implementation.
1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
* src/support/lyxstring.C: remove the inline added earlier since
they cause a bunch of unsatisfied symbols when linking with dec
cxx. Cxx likes to have the body of inlines at the place where they
are declared.
* src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
accessing negative bounds in array. This fixes the crash when
inserting accented characters.
* src/trans.h (Match): ditto
* src/buffer.C (Dispatch): since this is a void, it should not try
to return anything...
1999-12-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/buffer.h: removed the two friends from Buffer. Some changes
because of this. Buffer::getFileName and Buffer::setFileName
renamed to Buffer::fileName() and Buffer::fileName(...).
1999-12-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
and Buffer::update(short) to BufferView. This move is currently
controlled by a define MOVE_TEXT, this will be removed when all
shows to be ok. This move paves the way for better separation
between buffer contents and buffer view. One side effect is that
the BufferView needs a rebreak when swiching buffers, if we want
to avoid this we can add a cache that holds pointers to LyXText's
that is not currently in use.
* buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
Andr<64> P<>nitz.
1999-11-18 Andr<64> P<>nitz <poenitz@mathematik.tu-chemnitz.de>
* buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
* lyx_main.C: new command line option -x (or --execute) and
-e (or --export). Now direct conversion from .lyx to .tex
(.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
Unfortunately, X is still needed and the GUI pops up during the
process...
1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/Spacing.C: add a using directive to bring stream stuff into
normal namespace.
* src/paragraph.C: ditto
* src/buffer.C: ditto
* NEWS: updated a bit the new features of 1.1.3 (took a few things
from Lars' announcement).
* lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
example files from Tino Meinen.
1999-12-06 Allan Rae <rae@lyx.org>
* src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
1999-12-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxstring.C: added a lot of inline for no good
reason
* src/lyxfont.[Ch]: removed latexWriteStartChanges, and
latexWriteEndChanges, they were not used.
* src/layout.h (operator<<): output operator for PageSides
* src/mathed/math_iter.C (my_memcpy): slightly changed.
* some example files: loaded in LyX 1.0.4 and saved again to update
certain constructs (table format)
* a lot of files: did the change to use fstream/iostream for all
writing of files. Done with a close look at Andre Poenitz's patch.
* some files: whitespace changes.
1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_iter.C (my_memcpy): new function. Since the
built-in memcpy() is broken on egcs and gcc 2.95 for alpha
architecture, we provide our own. It is used unconditionnally, but
I do not think this is a performance problem. Thanks to Angus
Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
first time).
(GetInset): use my_memcpy.
(Insert): ditto
(Copy): ditto
* lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
it is easier to understand, but it uses less TeX-only constructs now.
* acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
elements contain spaces
* lib/configure: regenerated
* lib/configure.m4 (SEARCH_PROG): make it work when the PATH
elements contain spaces; display the list of programs that are
tried.
* autogen.sh: make sure lib/configure is executable
* lib/examples/*: rename the tutorial examples to begin with the
two-letters language code.
* src/lyxfunc.C (getStatus): do not query current font if no
buffer exists.
* src/lyx_cb.C (RunScript): use QuoteName
(MenuRunDvips): ditto
(PrintApplyCB): ditto
* src/support/filetools.[Ch] (QuoteName): new function. Add quotes
around argument, so that it works well with the current shell.
Does not work properly with OS/2 shells currently.
* src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
* src/LyXSendto.C (SendtoApplyCB): ditto
* src/lyxfunc.C (Dispatch): ditto
* src/buffer.C (runLaTeX): ditto
(runLiterate): ditto
(buildProgram): ditto
(runChktex): ditto
* src/lyx_cb.C (RunScript): ditto
(MenuMakeLaTeX): ditto
* src/buffer.h (getLatexName): new method
* src/support/filetools.C (MakeLatexName): renamed from SpaceLess
1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
* src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
(create_math_panel): ditto
* src/lyxfunc.C (getStatus): re-activate the code which gets
current font and cursor; add test for export to html.
* src/lyxrc.C (read): remove unreachable break statements; add a
few "using".
* src/bmtable.C (fl_set_bmtable_data): add a const_cast.
1999-12-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/mathed/formula.C (LocalDispatch): fix small whitspace bug
introduced by faulty regex.
* src/buffer.C: ditto
* src/lastfiles.C: ditto
* src/paragraph.C: ditto
* src/table.C: ditto
* src/vspace.C: ditto
* src/insets/figinset.C: ditto
Note: most of these is absolutely harmless, except the one in
src/mathed formula.C.
1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
* src/ImportNoweb.C (documentclass): fixed bounds for substr
operation, yielding correct results for the reLyX command.
1999-12-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/filetools.C (ExpandPath): removed an over eager
Assert.
(ReplaceEnvironmentPath): ditto
* src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
shows that we are doing something fishy in our code...
(BubblePost): ditto
(ToolbarCB): ditto
* src/lyxrc.C (read): use a double switch trick to get more help
from the compiler. (the same trick is used in layout.C)
(write): new function. opens a ofstream and pass that to output
(output): new function, takes a ostream and writes the lyxrc
elemts to it. uses a dummy switch to make sure no elements are
forgotten.
* src/lyxlex.h: added a struct pushpophelper for use in functions
with more than one exit point.
* src/lyxlex.[Ch] (GetInteger): made it const
(GetFloat): ditto
(GetBool): ditto
* src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
* src/layout.[hC] : LayoutTags splitted into several enums, new
methods created, better error handling cleaner use of lyxlex. Read
the diff.
* src/bmtable.[Ch]: change some member prototypes because of the
image const changes.
* commandtags.h, src/LyXAction.C (init): new function:
"preferences-save", saves the lyxrc entries into .lyx/preferences.
This file is not read automatically but you can add \input
preferences to your lyxrc if you want to. We need to discuss how
to handle this.
* src/LaTeX.C (runBibTeX): use regex to match for the needed lines
in .aux, also remove .bib and .bst files from dependencies when
running bibtex.
* src/BufferView.C, src/LyXView.C: add const_cast several places
because of changes to images.
* lib/images/*: same change as for images/*
* lib/lyxrc.example: Default for accept_compound is false not no.
* images/*: changed to be const, however I have som misgivings
about this change so it might be changed back.
1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/configure, po/POTFILES.in: regenerated
* autogen.sh: autogenerate lib/configure from lib/configure.m4
* config/lib_configure.m4: removed
* lib/configure.m4: new file (was config/lib_configure.m4)
* configure.in: do not test for rtti, since we do not use it.
1999-11-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxstring.C (lyxstring::Srep): Changed to use a
doubling of allocated space scheme. This makes it faster for large
strings end to use less memory for small strings. xtra rememoved.
* src/insets/figinset.C (waitalarm): commented out.
(GhostscriptMsg): use static_cast
(GhostscriptMsg): use new instead of malloc to allocate memory for
cmap. also delete the memory after use.
* src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
* src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
for changes in bibtex database or style.
(runBibTeX): remove all .bib and .bst files from dep before we
begin.
(run): use scanAuc in when dep file already exist.
* src/DepTable.C (remove_files_with_extension): new method
(exist): new method
* src/DepTable.[Ch]: made many of the methods const.
1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/bufferparams.C: make sure that the default textclass is
"article". It used to be the first one by description order, but
now the first one is "docbook".
* src/lyx_main.C (setDebuggingLevel): change type of argument to
string; call Debug::value.
(easyParse): pass complete argument to setDebuggingLevel().
* src/debug.h (value): fix the code that parses debug levels.
* src/debug.h: add new debug type ACTION, reserved for LyXAction
class.
* src/LyXAction.C: use Debug::ACTION as debug channel.
* src/lyxlookup.C: make the debug statements go to Debug::KEY.
* NEWS: updated for the future 1.1.3 release.
* src/mathed/symbol_def.h: swap the definitions of \varepsilon and
\epsilon. Now \epsilon shows as red text, and \varepsilon shows as
it should. This is of course a controversial change (since many
people will find that their lyx workscreen is suddenly full of
red), but done for the sake of correctness.
* src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
src/mathed/math_root.[Ch] (Clone): return a MathedInset*
* src/insets/inseterror.h, src/insets/inseturl.h,
src/insets/insetinfo.h, src/insets/figinset.h,
src/mathed/formulamacro.h, src/mathed/math_macro.h
(EditMessage): add a missing const and add _() to make sure that
translation happens
* src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
src/insets/insetbib.C, src/support/filetools.C: add `using'
directives for cxx.
* src/lyxfunc.C (Dispatch): make sure nothing bad happens when
doing 'Insert index of last word' at the beginning of a paragraph.
1999-11-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* several files: white-space changes.
* src/mathed/formula.C: removed IsAlpha and IsDigit
* src/insets/insetbib.C (getKeys): use findtexfile to look for the
.bib file. use a ifstream instead of FilePtr when parsing the .bib
file for keys.
* src/insets/figinset.C (GetPSSizes): don't break when
"EndComments" is seen. But break when a boundingbox is read.
* all classes inherited from Inset: return value of Clone
changed back to Inset *.
* all classes inherited form MathInset: return value of Clone
changed back to MathedInset *.
* src/insets/figinset.C (runqueue): use a ofstream to output the
gs/ps file. Might need some setpresicion or setw. However I can
see no problem with the current code.
(runqueue): use sleep instead of the alarm/signal code. I just
can't see the difference.
* src/paragraph.C (LyXParagraph): reserve space in the new
paragraph and resize the inserted paragraph to just fit.
* src/lyxfunc.h (operator|=): added operator for func_status.
* src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
check for readable file.
* src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
check for readable file.
(MenuMakeLinuxDoc): ditto
(MenuMakeDocBook): ditto
(MenuMakeAscii): ditto
(InsertAsciiFile): split the test for openable and readable
* src/bmtable.C (draw_bitmaptable): use
fl_state[fl_get_vclass()].depth instead of DefualtScreen.
* src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
findtexfile from LaTeX to filetools.
* src/ImportNoweb.C (documentclass): rewrote to use ifstream
instead of FilePtr. Needs to be verified by a literate user.
1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
(EditMessage): likewise.
* src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
respectively as \textasciitilde and \textasciicircum.
1999-11-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxstring.h: made the methods that take iterators
use const_iterator.
* src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
(regexMatch): made is use the real regex class.
* src/support/Makefile.am: changed to use libtool
* src/support/.cvsignore: added *.lo, .libs and libsupport.la
* src/mathed/math_defs.h: made the mathaligns be in a enum instead
of defines.
(MathIsInset ++): changed several macros to be inline functions
instead.
* src/mathed/Makefile.am: changed to use libtool
* src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
* src/insets/inset* : Clone changed to const and return type is
the true insettype not just Inset*.
* src/insets/Makefile.am: changed to use libtool
* src/insets/.cvsignore: added *.lo, .libs and libinsets.la
* src/undo.[Ch] : added empty() and changed some of the method
names.
* src/texrow.[Ch]: rewrote to store texrow's in a std::list.
* src/lyxparagraph.h: use id() and id(...) instead of getID and
setID use block<> for the bullets array, added const several places.
* src/lyxfunc.C (getStatus): new function
* src/lyxfunc.[Ch] : small changes to take advantage of the new
LyXAction, added const to several funtions.
* src/filedlg.[Ch]: rewrote to store userchache and groupchache in
a std::map, and to store the dir items in a vector.
* src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
as dependencies.
* src/LyXView.[Ch] + other files : changed currentView to view.
* src/LyXAction.[Ch] : ported from the old devel branch.
* src/.cvsignore: added .libs and a.out
* configure.in : changes to use libtool.
* acinclude.m4 : inserted libtool.m4
* .cvsignore: added libtool
1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
file name in insets and mathed directories (otherwise the
dependency is not taken in account under cygwin).
* src/text2.C (InsertString[AB]): make sure that we do not try to
read characters past the string length.
1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/doc/LaTeXConfig.lyx.in,
lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
* src/buffer.C (writeFile): Do not add a comment on top of .lyx
file saying who created them and when this heppened; this is
useless and annoys tools like cvs.
* lib/layouts/g-brief-{en,de}.layout,
lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
from Thomas Hartkens <thomas@hartkens.de>.
* src/{insets,mathed}/Makefile.am: do not declare an empty
LDFLAGS, so that it can be set at configure time (useful on Irix
for -n32 flag).
* lib/reLyX/configure.in: make sure that the prefix is set
correctly in LYX_DIR.
1999-11-18 Andr<64> P<>nitz <poenitz@mathematik.tu-chemnitz.de>
* src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
be used by 'command-sequence' this allows to bind a key to a
sequence of LyX-commands
(Example: 'command-sequence math-insert alpha; math-insert beta;")
* src/LyXAction.C: add "command-sequence"
* src/LyXFunction.C: handling of "command-sequence"
* src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
&cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
* src/lyxserver.C, src/minibuffer.C: Use this new interface
1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (writeFile): Do not output a comment giving user
and date at the beginning of a .lyx file. This is useless and
annoys cvs anyway; update version number to 1.1.
* src/Makefile.am (LYX_DIR): add this definition, so that a
default path is hardcoded in LyX.
* configure.in: Use LYX_GNU_GETTEXT.
* acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
AM_GNU_GETTEXT with a bug fixed.
* src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
* src/chset.C: add "using std::ifstream;" to please dec cxx.
* src/lyx_main.C (init), INSTALL.OS2: the environment variable
which is used to point to LyX data is now LYX_DIR_11x.
* lyx.man: convert to a unix text file; small updates.
1999-11-15 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/LSubstring.[Ch]: made the second arg of most of the
constructors be a const reference.
* src/mathed/math_parser.C (LexInitCodes): small bug introduced by
me fixed.
* src/support/lyxstring.[Ch] (swap): added missing member function
and specialization of swap(str, str);
* src/menus.C (ShowBufferMenu): to use the new BufferStorage
* src/bufferlist.[Ch]: use the new BufferStorage class and remove all
trace of the old one.
* src/undo.[Ch]: made the undostack use std::list to store undo's in
put the member definitions in undo.C.
* src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
NEW_TEXT and have now only code that was included when this was
defined.
* src/intl.C (LCombo): use static_cast
(LCombo2): ditto
(DispatchCallback): ditto
* src/definitions.h: removed whole file
* src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
* src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
parsing and stores in a std:map. a regex defines the file format.
removed unneeded members.
* src/bufferparams.h: added several enums from definitions.h here.
Removed unsused destructor. Changed some types to use proper enum
types. use block to have the temp_bullets and user_defined_bullets
and to make the whole class assignable.
* src/bufferparams.C (Copy): removed this functions, use a default
assignment instead.
* src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
isLiterate const.
* src/buffer.C (readLyXformat2): commend out all that have with
oldpapersize to do. also comment out all that hve to do with
insetlatex and insetlatexdel.
(setOldPaperStuff): commented out
* src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
* src/LyXAction.C: remove use of inset-latex-insert
* src/mathed/math_panel.C (button_cb): use static_cast
* src/insets/Makefile.am (insets_o_SOURCES): removed
insetlatex.[Ch]
* src/support/lyxstring.C (helper): use the unsigned long
specifier, UL, instead of a static_cast.
* src/support/Makefile.am (libsupport_a_SOURCES): added block.h
* src/support/block.h: new file. to be used as a c-style array in
classes, so that the class can be assignable.
1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_gui_misc.C (askForText): when fl_show_input() returns
NULL, make sure to return an empty string (it is not possible to
set a string to NULL).
1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
* src/support/lyxstring.C (helper): fix bogus cast in assertion.
* src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
link line, so that Irix users (for example) can set it explicitely to
"-n32".
* src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
it can be overidden at make time (static or dynamic link, for
example).
* src/vc-backend.C, src/LaTeXFeatures.h,
src/support/LRegex.C, src/support/LRegex.h: add a few "using"
statements to bring templates to global namespace.
1999-11-10 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxstring.C (operator[] const): make it standard
conforming.
* src/minibuffer.C (Init): changed to reflect that more
information is given from the lyxvc and need not be provided here.
* src/lyxvc.[Ch]: rewrote to use the vc-backend.
* src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
* src/LyXView.C (UpdateTimerCB): use static_cast
(KeyPressMask_raw_callback): ditto
* src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
buffer_, a lot of changes because of this. currentBuffer() ->
buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
also changes to other files because of this.
1999-11-09 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/vc-backend.[Ch]: new files. The backends for vc handling,
have no support for RCS and partial support for CVS, will be
improved later.
* src/insets/ several files: changes because of function name
changes in Bufferview and LyXView.
* src/mathed/math_symbols.C (math_insert_symbol): use static_cast
* src/support/LSubstring.[Ch]: new files. These implement a
Substring that can be very convenient to use. i.e. is this
possible:
string a = "Mary had a little sheep";
Substring(a, "sheep") = "lamb";
a is now "Mary has a little lamb".
* src/support/LRegex.[Ch]: a regex class that can be used to pick
out patterns and subpatterns of strings. It is used by LSubstring
and also by vc-backend.C
* src/support/lyxstring.C: went over all the assertions used and
tried to correct the wrong ones and flag which of them is required
by the standard. some bugs found because of this. Also removed a
couple of assertions.
* src/support/Makefile.am (libsupport_a_SOURCES): added
LSubstring.[Ch] and LRegex.[Ch]
* src/support/FileInfo.h: have struct stat buf as an object and
not a pointer to one, some changes because of this.
* src/LaTeXFeatures.C (getTClassPreamble): also use the
information in layout when adding the layouts preamble to the
textclass preamble.
* src/LaTeXFeatures.h: use a vector<bool> to store the layout
usage in.
* configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
because of bug in OS/2.
1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/layouts/lyxmacros.inc (lyxcode): set the font with
\verbatim@font instead of \ttfamily, so that it can be redefined.
* src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
src/layout.h, src/text2.C: add 'using' directive to bring the
STL templates we need from the std:: namespace to the global one.
Needed by DEC cxx in strict ansi mode.
* src/support/LIstream.h,src/support/LOstream.h,
src/support/lyxstring.h,src/table.h,
src/lyxlookup.h: do not include <config.h> in header
files. This should be done in the .C files only.
* development/lyx.spec.in: WHATSNEW has been renamed to NEWS
(from Kayvan).
1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
from Kayvan to fix the tth invokation.
* development/lyx.spec.in: updates from Kayvan to reflect the
changes of file names.
1999-11-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (InsertStringB): use std::copy
(InsertStringA): use std::copy
* src/bufferlist.C: use a vector to store the buffers in. This is
an internal change and should not affect any other thing.
* src/BufferView.C (waitForX): use XSync instead of the lengthy
stuff in waitForX.
* src/text.C (Fill): fix potential bug, one off bug.
1999-11-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/Makefile.am (lyx_main.o): add more files it depends on.
* src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
* src/support/lyxstring.C: use size_t for the reference count,
size, reserved memory and xtra.
(internal_compare): new private member function. Now the compare
functions should work for std::strings that have embedded '\0'
characters.
(compare): all compare functions rewritten to use
internal_compare.
1999-11-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxstring.C (compare): pass c_str()
(compare): pass c_str
(compare): pass c_str
1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/DebugStream.C: <config.h> was not included correctly.
* lib/configure: forgot to re-generate it :( I'll make this file
auto generated soon.
1999-11-03 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
is used.
* src/support/lyxstring.C: some changes from length() to rep->sz.
avoids a function call.
* src/support/filetools.C (SpaceLess): yet another version of the
algorithm...now per Jean-Marc's suggestions.
1999-11-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/layout.C (less_textclass_desc): functor for use in sorting
of textclasses.
(LyXTextClass::Read): sort the textclasses after reading.
* src/support/filetools.C (SpaceLess): new version of the
SpaceLess functions. What problems does this one give? Please
report.
* images/banner_bw.xbm: made the arrays unsigned char *
1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/lyxstring.C (find): remove bogus assertion in the
two versions of find where this has not been done yet.
* src/support/lyxlib.h: add missing int return type to
lyx::chdir().
* src/menus.C (ShowFileMenu): disable exporting to html if no
html export command is present.
* config/lib_configure.m4: add a test for an HTML converter. The
programs checked for are, in this order: tth, latex2html and
hevea.
* lib/configure: generated from config/lib_configure.m4.
* src/lyxfunc.C (Dispatch): update and improve the execution of an
html converter. The parameters are now passed through $$FName and
$$OutName, instead of standard input/output.
* src/lyxrc.{C,h}: rename \tth_command to \html_command.
* lib/lyxrc.example: update description of \html_command.
add "quotes" around \screen_font_xxx font setting examples to help
people who use fonts with spaces in their names.
1999-11-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* Distribution files: updates for v1.1.2
* src/support/lyxstring.C (find): remove bogus assert and return
npos for the same condition.
1999-11-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* added patch for OS/2 from SMiyata.
1999-10-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/text2.C (CutSelection): make space_wrapped a bool
(CutSelection): dont declare int i until we have to.
(alphaCounter): return a char const *.
1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/syscall.C (Systemcalls::kill):
src/support/filetools.C (PutEnv, PutEnvPath):
src/lyx_cb.C (addNewlineAndDepth):
src/FontInfo.C (FontInfo::resize): condition some #warning
directives with WITH_WARNINGS.
1999-10-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/layout.[Ch] + several files: access to class variables
limited and made accessor functions instead a lot of code changed
becuase of this. Also instead of returning pointers often a const
reference is returned instead.
* src/form1.C (create_form_Figure): added a couple fo "no-c-format"
* src/Makefile.am (dist-hook): added used to remove the CVS from
cheaders upon creating a dist
(EXTRA_DIST): added cheaders
* src/support/lstrings.C (tostr(char)): fix it to handle param as
a character not as a small integer.
* src/support/lyxstring.C (find): removed Assert and added i >=
rep->sz to the first if.
1999-10-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
src/LyXView.C src/buffer.C src/bufferparams.C
src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
src/text2.C src/insets/insetinclude.C:
lyxlayout renamed to textclasslist.
* src/layout.C: some lyxerr changes.
* src/layout.[Ch] (LyXLayout::Read): changed second paramter to
LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
(LyXLayoutList): removed all traces of this class.
(LyXTextClass::Read): rewrote LT_STYLE
(LyXTextClass::hasLayout): new function
(LyXTextClass::GetLayout): rewritten to return an iterator + has
both const and nonconst version.
(LyXTextClass::delete_layout): new function.
(LyXTextClassList::Style): bug fix. do the right thing if layout
is to big.
(LyXTextClassList::NumberOfLayout): new acces to layoutlist.
(LyXTextClassList::NameOfLayout): ditto
(LyXTextClassList::Load): ditto
* src/buffer.C (makeLaTeXFile): new access to layoutlist
* src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
* src/LyXAction.C (LookupFunc): added a workaround for sun
compiler, on the other hand...we don't know if the current code
compiles on sun at all...
* src/support/filetools.C (CleanupPath): subst fix
* src/insets/insetbib.C (delDatabase): subst fix, this looks
_really_ weird.
* src/support/filetools.C (PutEnvPath): subst fix, how come nobody
complained about this one?
* src/insets/insetinclude.C (Latex): subst fix
* src/insets/insetbib.C (getKeys): subst fix
* src/LyXSendto.C (SendtoApplyCB): subst fix
* src/lyx_main.C (init): subst fix
* src/layout.C (Read): subst fix
* src/lyx_sendfax_main.C (button_send): subst fix
* src/buffer.C (RoffAsciiTable): subst fix
* src/lyx_cb.C (MenuFax): subst fix
(PrintApplyCB): subst fix
1999-10-26 Juergen Vigna <jug@sad.it>
* src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
(Read): Cleaned up this code so now we read only format vestion >= 5
1999-10-26 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/filetools.C (PutEnvPath): subst fix for EMX, how
come nobody has complained about this one?
* src/insets/insetinclude.C (Latex): subst fix
* src/insets/insetbib.C (getKeys): subst fix
* src/lyx_main.C (init): subst fix
* src/layout.C (Read): subst fix
* src/buffer.C (RoffAsciiTable): subst fix
* src/lyx_cb.C (MenuFax): subst fix.
* src/layout.[hC] + some other files: rewrote to use
std::container to store textclasses and layouts in.
Simplified, removed a lot of code. Make all classes
assignable. Further simplifications and review of type
use still to be one.
* src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
lastfiles to create the lastfiles partr of the menu.
* src/lastfiles.[Ch]: rewritten to use deque to store the
lastfiles in. Uses fstream for reading and writing. Simplifies
code.
* src/support/syscall.C: remove explicit cast.
* src/BufferView.C (CursorToggleCB): removed code snippets that
were commented out.
use explicat C++ style casts instead of C style casts. also use
u_vdata instea of passing pointers in longs.
* src/PaperLayout.C: removed code snippets that were commented out.
* src/lyx_gui_misc.C: removed code snippets that were commented out.
* src/lyx_main.C: removed code snippets that wer commented out.
* src/paragraph.C: removed code snippets that were commented out.
* src/lyxvc.C (logClose): use static_cast
(logUpdate): ditto
(viewLog): remove explicit cast to void*
(showLog): removed old commented code
* src/menus.C: use static_cast instead of C style casts. use
u_vdata instead of u_ldata. remove explicit cast to (long) for
pointers. Removed old code that was commented out.
* src/insets/inset.C: removed old commented func
* src/insets/insetref.C (InsetRef): removed old code that had been
commented out for a long time.
(Edit): ditto
(escape): removed C style cast
* src/insets/insetlatexaccent.C (Draw): removed old commented code
* src/insets/insetlatex.C (Draw): removed old commented code
(Read): rewritten to use string
* src/insets/insetlabel.C (escape): removed C style cast
* src/insets/insetindex.h: removed vdata and ldata from FD_index_form
* src/insets/insetindex.C: use static_cast and u_vdata, removed
old commented code.
* src/insets/insetinclude.h: removed a couple of stupid bools
* src/insets/insetinclude.C (include_cb): use static_cast and u_data.
(Clone): remove C style cast
(getKeys): changed list to lst because of std::list
* src/insets/inseterror.C (Draw): removed som old commented code.
* src/insets/insetcommand.C (Draw): removed some old commented code.
* src/insets/insetbib.C (bibitem_cb): removed code that has been
commented out forever.
(bibitem_cb): use static_cast instead of C style cast
use of vdata changed to u_vdata.
* src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
parameter.
(CloseUrlCB): use static_cast instead of C style cast.
(CloseUrlCB): added a fl_free form...it seemed to be missing.
* src/insets/insetinfo.C (Edit): pass object in u_vdata instead
(C_InsetInfo_CloseInfoCB): forward the ob parameter
(CloseInfoCB): static_cast from ob->u_vdata instead.
(Edit): removed bogus arg from fl_set_object_shortcut, set to 1
instead.
* src/insets/inseterror.C (Edit): pass object in u_vdata instead
(C_InsetError_CloseErrorCB): forward the ob parameter
(CloseErrorCB): static_cast from ob->u_vdata instead.
* src/vspace.h: include LString.h since we use string in this class.
* src/vspace.C (lyx_advance): changed name from advance because of
nameclash with stl. And since we cannot use namespaces yet...I
used a lyx_ prefix instead. Expect this to change when we begin
using namespaces.
* src/BufferView.[Ch] (BufferView::~BufferView): removed
* src/BackStack.h: rewrote to use std::stack. made BackStackItem
and removed now defunct constructor and deconstructor.
* src/BufferView.h: have backstack as a object not as a pointer.
removed initialization from constructor. added include for BackStack
* development/lyx.spec.in (%build): add CFLAGS also.
* src/screen.C (drawFrame): removed another warning.
1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
README and ANNOUNCE a bit for the next release. More work is
needed, of course.
* src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
unbreakable if we are in freespacing mode (LyX-Code), but not in
latex mode.
1999-10-25 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/BackStack.h: fixed initialization order in constructor
* Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
* acinclude.m4 (VERSION): new rules for when a version is
development, added also a variable for prerelease.
(warnings): we set with_warnings=yes for prereleases
(lyx_opt): prereleases compile with same optimization as development
(CXXFLAGS): only use pedantic if we are a development version
* src/BufferView.C (restorePosition): don't do anything if the
backstack is empty.
* src/BackStack.h: added member empty, use this to test if there
is anything to pop...
1999-10-25 Juergen Vigna <jug@sad.it>
* forms/form1.fd +
* forms/layout_forms.fd +
* forms/latexoptions.fd +
* lyx.fd: changed for various form resize issues
* src/mathed/math_panel.C +
* src/insets/inseterror.C +
* src/insets/insetinfo.C +
* src/insets/inseturl.C +
* src/insets/inseturl.h +
* src/LaTeXLog.C +
* src/LyXSendto.C +
* src/PaperLayout.C +
* src/ParagraphExtra.C +
* src/TableLayout.C +
* src/form1.C +
* src/layout_forms.C +
* src/lyx.C +
* src/lyx_cb.C +
* src/lyx_gui.C +
* src/lyxfr0.C +
* src/lyxfunc.C +
* src/lyxvc.C +
* src/menus.C: fixed various resize issues. So now forms can be
resized savely or not be resized at all.
* forms/form_url.fd +
* src/insets/form_url.[Ch]: added because it's cleaner and easier
to modify IMO.
* src/insets/Makefile.am: added files form_url.[Ch]
1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* INSTALL: it is now possible to compile LyX with digital C++ 6.1
(and presumably 6.2).
* src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
remaining static member callbacks.
* src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
messages.
* src/support/lyxstring.h: declare struct Srep as friend of
lyxstring, since DEC cxx complains otherwise.
1999-10-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
1999-10-24 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/LaTeX.C (run): made run_bibtex also depend on files with
extension ".bst"
(runBibTeX): added scans for "\\bibstyle", now also ".bst" files
are put into the dependency file.
* src/spellchecker.C (create_ispell_pipe): removed old #warning,
the code has shown itself to work
(create_ispell_pipe): removed another warning, added a comment
instead.
* src/minibuffer.C (ExecutingCB): removed code that has been
commented out a long time
* src/lyxfunc.C (processKeyEvent): removed some very old commented
out code + a warning.
* src/support/lyxstring.h: comment out the three private
operators, when compiling with string ansi conforming compilers
they make problems.
* src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
unsigned char *.
(pixmapFromBitmapData): change type of bdata to be unsigned char *
(pixmapFromBitmapData): add a reinterpret_cast in the call to
XCreateImage
* src/mathed/math_panel.h: change 6th arg to AddBitmap to be
unsigned char *
* src/mathed/math_panel.C (create_math_panel): remove explicit
casts
* src/bmtable.h: change last paramter to fl_set_bmtable_data to be
unsigned char *.
* src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
(draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
to XCreatePixmapFromBitmapData
(fl_set_bmtable_data): change the last argument to be unsigned
char *
(fl_set_bmtable_file): change bdata to unsinged char *, change bw
and bh to be unsigned int, remove explicit casts in call to
XReadBitmapFileData.
* images/arrows.xbm: made the arrays unsigned char *
* images/varsz.xbm: ditto
* images/misc.xbm: ditto
* images/greek.xbm: ditto
* images/dots.xbm: ditto
* images/brel.xbm: ditto
* images/bop.xbm: ditto
* Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
* acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
(LYX_PROG_CXX): added -pedantic to g++ compile options when
with-warnings, removed the __STRING_ANSI__ hack, seems to not be
needed.
(LYX_CXX_CHEADERS): added <clocale> to the test.
1999-10-23 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
* src/support/lyxstring.C (append): fixed something that must be a
bug, rep->assign was used instead of rep->append.
* src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
and LOstream.h
* src/lyxfunc.C (processKeyEvent): removed faulty line that made
lyx insert double chars. Fix spotted by Kayvan.
1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
* Fixed the tth support. I messed up with the Emacs patch apply feature
and omitted the changes in lyxrc.C.
1999-10-22 Juergen Vigna <jug@sad.it>
* src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
* src/lyx_cb.C (MenuInsertRef) +
* src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
the form cannot be resized under it limits (fixes a segfault)
* src/lyx.C (create_form_form_ref) +
* forms/lyx.fd: Changed Gravity on name input field so that it is
resized correctly.
1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
<ostream> and <istream>.
* acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
whether <fstream> provides the latest standard features, or if we
have an oldstyle library (like in egcs).
(LYX_CXX_STL_STRING): fix the test.
* src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
code on MODERN_STL_STREAM.
* src/support/lyxstring.h: use L{I,O}stream.h.
* src/support/L{I,O}stream.h: new files, designed to setup
correctly streams for our use
- includes the right header depending on STL capabilities
- puts std::ostream and std::endl (for LOStream.h) or
std::istream (LIStream.h) in toplevel namespace.
1999-10-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/LaTeX.C (run): added a check in 0 sumchange so that if it
was a bib file that had been changed we ensure that bibtex is run.
(runBibTeX): enhanced to extract the names of the bib files and
getting their absolute path and enter them into the dep file.
(findtexfile): static func that is used to look for tex-files,
checks for absolute patchs and tries also with kpsewhich.
Alternative ways of finding the correct files are wanted. Will
probably be moved.
(do_popen): function that runs a command using popen and returns
the whole output of that command in a string. Should be moved to
somewhere else.
* src/DepTable.[Ch] (extchanged): new function that returns true if a
file with extension ext has changed.
* src/insets/figinset.C: added ifdef guards around the fl_free
code that jug commented out. Now it is commented out when
compiling with XForms == 0.89.
* src/support/lyxstring.C: moved the definition of lyxstring::Srep
to lyxstring.C, and only keep a forward declaration in
lyxstring.h. Simplifies the header file a bit and should help a
bit on compile time too. Also changes to Srep will not mandate a
recompile of code just using string.
(~lyxstring): definition moved here since it uses srep.
(size): definition moved here since it uses srep.
* src/support/lyxstring.h: removed a couple of "inline" that should
not be there.
1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
the 'ob' argument.
1999-10-21 Juergen Vigna <jug@sad.it>
* src/table.C (SetPWidth): Just a small fix so the alignment is not
set to left if I just remove the width entry (or it is empty).
* src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
paragraph when having dummy paragraphs.
1999-10-20 Juergen Vigna <jug@sad.it>
* src/insets/figinset.C: just commented some fl_free_form calls
and added warnings so that this calls should be activated later
again. This avoids for now a segfault, but we have a memory leak!
* src/lyxfunc.C (processKeyEvent) (Dispatch): changed
'const char * argument' to 'string argument', this should
fix some Asserts() in lyxstring.C.
* src/lyxfunc.h: Removed the function argAsString(const char *)
as it is not used anymore.
1999-10-20 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxstring.C (getline): reads now _all_ chars. uses
get instead of >>
* src/Literate.h: some funcs moved from public to private to make
interface clearer. Unneeded args removed.
* src/Literate.C (scanLiterateLogFile): rewritten to use iostream
instead of lyxlex.
(scanBuildLogFile): ditto
* src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
normal TeX Error. Still room for improvement.
* src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
* src/buffer.C (insertErrors): changes to make the error
desctription show properly.
* src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
could never happen
* src/support/lyxstring.C (helper): changed to use
sizeof(object->rep->ref).
(operator>>): changed to use a pointer instead.
* src/support/lyxstring.h: changed const reference & to value_type
const & lets see if that helps.
1999-10-19 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* Makefile.am (rpmdist): fixed to have non static package and
verison.
* src/support/lyxstring.C: removed the compilation guards
* src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
a bit clearer.
* src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
conditional compile of lyxstring.Ch
* acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
stupid check, but it is a lot better than the bastring hack.
(LYX_CXX_STL_STRING): bruker n<> AM_CONDITIONAL(USE_LYXSTRING
* several files: changed string::erase into string::clear. Not
really needed.
* src/chset.C (encodeString): use a char temporary instead
* src/table.C (TexEndOfCell): added tostr around
column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
(TexEndOfCell): ditto
(TexEndOfCell): ditto
(TexEndOfCell): ditto
(DocBookEndOfCell): ditto
(DocBookEndOfCell): ditto
(DocBookEndOfCell): ditto
(DocBookEndOfCell): ditto
* src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
* src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
* src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
(MenuBuildProg): added tostr around ret
(MenuRunChktex): added tostr around ret
(DocumentApplyCB): added tostr around ret
* src/chset.C (encodeString): added tostr around t->ic
* src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
(makeLaTeXFile): added tostr around tocdepth
(makeLaTeXFile): added tostr around ftcound - 1
* src/insets/insetbib.C (setCounter): added tostr around counter.
* src/support/lyxstring.h: added an operator+=(int) to catch more
mistakes.
* src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
(lyxstring): We DON'T allow NULL pointers.
1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_macro.C (MathMacroArgument::Write,
MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
when writing them out.
* src/LString.C: remove, since it is not used anymore.
* src/support/lyxstring.C: condition the content to
USE_INCLUDED_STRING macro.
* src/mathed/math_symbols.C, src/support/lstrings.C,
src/support/lyxstring.C: add `using' directive to specify what
we need in <algorithm>. I do not think that we need to
conditionalize this, but any thought is appreciated.
* many files: change all callback functions to "C" linkage
functions to please strict C++ compilers like DEC cxx 6.1 in mode
strict_ansi. Those who were static are now global.
The case of callbacks which are static class members is
trickier, since we have to make C wrappers around them (see
InsetError, InsetInfo and InsetUrl). The same holds for friends. I
did not finish this yet, since it defeats the purpose of
encapsulation, and I am not sure what the best route is.
1999-10-19 Juergen Vigna <jug@sad.it>
* src/support/lyxstring.C (lyxstring): we permit to have a null
pointer as assignment value and just don't assign it.
* src/vspace.C (nextToken): corrected this function substituting
find_first(_not)_of with find_last_of.
* src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
(TableOptCloseCB) (TableSpeCloseCB):
inserted fl_set_focus call for problem with fl_hide_form() in
xforms-0.89.
1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
string.
1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
LyXLex::next() and not eatline() to get its argument.
1999-10-17 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/DepTable.[Ch]: rewritten to store the dependencies in a map
instead, use fstreams for io of the depfile, removed unneeded
functions and variables.
* src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
vector instead, removed all functions and variables that is not in
use.
1999-10-16 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/buffer.C (insertErrors): use new interface to TeXError
* Makefile.am (rpmdist): added a rpmdist target
* lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
per Kayvan's instructions.
1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/Makefile.am: add a definition for localedir, so that locales
are found after installation (Kayvan)
1999-10-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* development/.cvsignore: new file.
1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
C++ compiler provides wrappers for C headers and use our alternate
version otherwise.
* configure.in: use LYX_CXX_CHEADERS.
* src/cheader/: new directory, populated with cname headers from
libstdc++-2.8.1. They are a bit old, but probably good enough for
what we want (support compilers who lack them).
* src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
from includes. It turns out is was stupid.
1999-10-14 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lib/Makefile.am (install-data-local): forgot a ';'
(install-data-local): forgot a '\'
(libinstalldirs): needed after all. reintroduced.
1999-10-13 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* configure.in (AC_OUTPUT): added lyx.spec
* development/lyx.spec: removed file
* development/lyx.spec.in: new file
* po/*.po: merged with lyx.pot becuase of make distcheck
* lib/Makefile.am (dist-hook): added dist-hook so that
documentation files will be included when doing a make
dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
(pkgdata_SCRIPTS): added configure.cmd for now, we can use som
conditional later.
more: tried to make install do the right thing, exclude CVS dirs
etc.
* src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
Path would fit in more nicely.
* all files that used to use pathstack: uses now Path instead.
This change was a lot easier than expected.
* src/support/path.h: new file
* src/support/Makefile.am (libsupport_a_SOURCES): added path.h
* src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
* src/support/lyxstring.C (getline): Default arg was given for
para 3. removed.
* Configure.cmd: removed file
1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/DebugStream.[Ch]: remove the explicit std:: before
streams classes and types, add the proper 'using' statements when
MODERN_STL is defined.
* src/debug.h: move the << operator definition after the inclusion
of DebugStream.h
* src/support/filetools.C: include "LAssert.h", which is needed
later.
* src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
to includes.
* src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
include "debug.h" to define a proper ostream.
1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
* src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
method to the SystemCall class which can kill a process, but it's
not fully implemented yet.
* src/*.C: Changed Systemcalls::Startscript() to startscript()
* src/support/FileInfo.h: Better documentation
* src/lyxfunc.C: Added support for buffer-export html
* src/menus.C: Added Export->As HTML...
* lib/bind/*.bind: Added short-cut for buffer-export html
* src/lyxrc.*: Added support for new \tth_command
* lib/lyxrc.example: Added stuff for new \tth_command
1999-10-12 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* lib/Makefile.am (IMAGES): removed images/README
(pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
installes in correct place. Check permisions is installed
correctly.
* src/LaTeX.C: some no-op changes moved declaration of some
variables around.
* src/LaTeX.h (LATEX_H): changed include guard name
1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/Makefile.am: install noweb2lyx.
* lib/Makefile.am: install configure.
* lib/reLyX/configure.in: declare a config aux dir; set package
name to lyx (not sure what the best solution is); generate noweb2lyx.
* lib/layouts/egs.layout: fix the bibliography layout.
1999-10-08 J<>rgen Vigna <jug@sad.it>
* src/support/filetools.C (FileOpenSearch): Fixed a bug where
when in the PATH was something like /usr/bin;;/bin (note: the ;;)
it returned without continuing to search the path.
1999-10-07 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/insets/insetquotes.C (Draw): Simplified a gread deal. This
also fixes a bug. It is not allowed to do tricks with std::strings
like: string a("hei"); &a[e]; this will not give what you
think... Any reason for the complexity in this func?
1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
* Updated README and INSTALL a bit, mostly to check that my
CVS rights are correctly set up.
1999-10-06 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/lyxstring.C (helper): removed bogus Assert. strlen
does not allow '\0' chars but lyxstring and std::string does.
1999-10-05 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* autogen.sh (AUTOCONF): let the autogen script create the
POTFILES.in file too. POTFILES.in should perhaps now not be
included in the cvs module.
* some more files changed to use C++ includes instead of C ones.
* src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
not assigned.
(Reread): added tostr to nlink. buggy output otherwise.
(Reread): added a string() around szMode when assigning to Buffer,
without this I got a log of garbled info strings.
* acconfig.h: commented out the PTR_AS_INT macros. They should not
be needed.
* I have added several ostream & operator<<(ostream &, some_type)
functions. This has been done to avoid casting and warnings when
outputting enums to lyxerr. This as thus eliminated a lot of
explicit casts and has made the code clearer. Among the enums
affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
mathed enums, some font enum the Debug::type enum.
* src/support/lyxstring.h (clear): missing method. equivalent of
erase(0, npos).
* all files that contained "stderr": rewrote constructs that used
stderr to use lyxerr instead. (except bmtable)
* src/support/DebugStream.h (level): and the passed t with
Debug::ANY to avoid spurious bits set.
* src/debug.h (Debug::type value): made it accept strings of the
type INFO,INIT,KEY.
* configure.in (Check for programs): Added a check for kpsewhich,
the latex generation will use this later to better the dicovery of
all used files.
* src/BufferView.C (create_view): we don't need to cast this to
(void*) that is done automatically.
(WorkAreaButtonPress): removed some dead code.
1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
is not overwritten when translated (David Sua'rez de Lis).
* lib/CREDITS: Added David Sua'rez de Lis
* lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
* src/bufferparams.C (BufferParams): default input encoding is now
"latin1"
* acinclude.m4 (cross_compiling): comment out macro
LYX_GXX_STRENGTH_REDUCE.
* acconfig.h: make sure that const is not defined (to empty) when
we are compiling C++. Remove commented out code using SIZEOF_xx
macros.
* configure.in : move the test for const and inline as late as
possible so that these C tests do not interefere with C++ ones.
Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
has not been proven.
1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/table.C (getDocBookAlign): remove bad default value for
isColumn parameter.
* src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
shortcut.
(ShowFileMenu2): ditto.
* lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
of files to ignore.
1999-10-04 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* Most files: finished the change from the old error code to use
DebugStream for all lyxerr debugging. Only minor changes remain
(e.g. the setting of debug levels using strings instead of number)
1999-10-02 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/layout.C (Add): Changed to use compare_no_case instead of
strcasecmp.
* src/FontInfo.C: changed loop variable type too string::size_type.
1999-10-01 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
set ETAGS_ARGS to --c++
1999-09-30 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/table.C (DocBookEndOfCell): commented out two unused variables
* src/paragraph.C: commented out four unused variables.
* src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
insed a if clause with type string::size_type.
* src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
string::size_type.
* src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
* src/lyx_cb.C (ReplaceWord): use string::size_type as loop
variable, also changed loop to go from 0 to lenght + 1, instead of
-1 to length. This should be correct.
* src/LaTeX.C (scanError): use string::size_type as loop variable
type.
* src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
(l.896) since y_tmp and row was not used anyway.
* src/insets/insetref.C (escape): use string::size_type as loop
variable type.
* src/insets/insetquotes.C (Width): use string::size_type as loop
variable type.
(Draw): use string::size_type as loop variable type.
* src/insets/insetlatexaccent.C (checkContents): use
string::size_type as loop variable type.
* src/insets/insetlabel.C (escape): use string::size_type as loop
variable type.
* src/insets/insetinfo.C: added an extern for current_view.
* src/insets/insetcommand.C (scanCommand): use string::size_type
as loop variable type.
* most files: removed the RCS tags. With them we had to recompile
a lot of files after a simple cvs commit. Also we have never used
them for anything meaningful.
* most files: tags-query-replace NULL 0. As adviced several plases
we now use "0" instead of "NULL" in our code.
* src/support/filetools.C (SpaceLess): use string::size_type as
loop variable type.
1999-09-29 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/paragraph.C: fixed up some more string stuff.
1999-09-28 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* src/support/filetools.h: make modestr a std::string.
* src/filetools.C (GetEnv): made ch really const.
* src/lyxlib.h: removed the Maximum and Minimum inline functions,
made code that used these use max/min from <algorithm> instead.
* changed several c library include files to their equivalent c++
library include files. All is not changed yet.
* created a support subdir in src, put lyxstring and lstrings
there + the extra files atexit, fileblock, strerror. Created
Makefile.am. edited configure.in and src/Makefile.am to use this
new subdir. More files moved to support.
* imported som of the functions from repository lyx, filetools
* ran tags-query-replace on LString -> string, corrected the bogus
cases. Tried to make use of lstrings.[hC], debugged a lot. There
is still some errors in there. This is errors where too much or
too litle get deleted from strings (string::erase, string::substr,
string::replace), there can also be some off by one errors, or
just plain wrong use of functions from lstrings. Viewing of quotes
is wrong.
* LyX is now running fairly well with string, but there are
certainly some bugs yet (see above) also string is quite different
from LString among others in that it does not allow null pointers
passed in and will abort if it gets any.
* Added the revtex4 files I forgot when setting up the repository.
1999-09-27 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* All over: Tried to clean everything up so that only the files
that we really need are included in the cvs repository.
* Switched to use automake.
* Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
* Install has not been checked.
1999-09-22 Lars Gullik Bj<42>nnes <larsbj@lyx.org>
* po/pt.po: Three errors:
l.533 and l.538 format specification error
l. 402 duplicate entry, I just deleted it.
Reference in New Issue View Git Blame Copy Permalink